diff --git a/.gitignore b/.gitignore index d2dad3e47..5db5db9fc 100644 --- a/.gitignore +++ b/.gitignore @@ -1,4 +1,3 @@ __pycache__/ -website/ ms.py tape* \ No newline at end of file diff --git a/confg.ini b/config.ini similarity index 100% rename from confg.ini rename to config.ini diff --git a/scripts/tdd.py b/scripts/tdd.py index e1accfcca..120ff9d3a 100644 --- a/scripts/tdd.py +++ b/scripts/tdd.py @@ -15,7 +15,7 @@ for snippet in snippets: file_to_write_to.close() test_file.write(f''' import types,functools -from tape import test +from pytape import test from {snippet} import {snippet} def {snippet}_test(t): t.true(isinstance({snippet}, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'{snippet} is a function') diff --git a/test/average/average.test.py b/test/average/average.test.py index 39c275cbd..bc715b99c 100644 --- a/test/average/average.test.py +++ b/test/average/average.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from average import average def average_test(t): t.true(isinstance(average, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'average is a function') diff --git a/test/byte_size/byte_size.test.py b/test/byte_size/byte_size.test.py index 99eb8a5d1..6cea1e5f0 100644 --- a/test/byte_size/byte_size.test.py +++ b/test/byte_size/byte_size.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from byte_size import byte_size def byte_size_test(t): t.true(isinstance(byte_size, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'byte_size is a function') diff --git a/test/capitalize/capitalize.test.py b/test/capitalize/capitalize.test.py index aa1b73422..13badb810 100644 --- a/test/capitalize/capitalize.test.py +++ b/test/capitalize/capitalize.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from capitalize import capitalize def capitalize_test(t): t.true(isinstance(capitalize, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'capitalize is a function') diff --git a/test/capitalize_every_word/capitalize_every_word.test.py b/test/capitalize_every_word/capitalize_every_word.test.py index 951367deb..36a9a381a 100644 --- a/test/capitalize_every_word/capitalize_every_word.test.py +++ b/test/capitalize_every_word/capitalize_every_word.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from capitalize_every_word import capitalize_every_word def capitalize_every_word_test(t): t.true(isinstance(capitalize_every_word, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'capitalize_every_word is a function') diff --git a/test/chunk/chunk.test.py b/test/chunk/chunk.test.py index d379a9fda..3af760779 100644 --- a/test/chunk/chunk.test.py +++ b/test/chunk/chunk.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from chunk import chunk def chunk_test(t): t.true(isinstance(chunk, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'chunk is a function') diff --git a/test/compact/compact.test.py b/test/compact/compact.test.py index 648f43cae..4ff5b875f 100644 --- a/test/compact/compact.test.py +++ b/test/compact/compact.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from compact import compact def compact_test(t): t.true(isinstance(compact, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'compact is a function') diff --git a/test/count_by/count_by.test.py b/test/count_by/count_by.test.py index 38648c04f..2edf9e070 100644 --- a/test/count_by/count_by.test.py +++ b/test/count_by/count_by.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from count_by import count_by def count_by_test(t): t.true(isinstance(count_by, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'count_by is a function') diff --git a/test/count_occurences/count_occurences.test.py b/test/count_occurences/count_occurences.test.py index b1290e7f6..73b902c2c 100644 --- a/test/count_occurences/count_occurences.test.py +++ b/test/count_occurences/count_occurences.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from count_occurences import count_occurences def count_occurences_test(t): t.true(isinstance(count_occurences, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'count_occurences is a function') diff --git a/test/count_vowels/count_vowels.test.py b/test/count_vowels/count_vowels.test.py index d83e4566f..b32d9ccd4 100644 --- a/test/count_vowels/count_vowels.test.py +++ b/test/count_vowels/count_vowels.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from count_vowels import count_vowels def count_vowels_test(t): t.true(isinstance(count_vowels, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'count_vowels is a function') diff --git a/test/decapitalize/decapitalize.test.py b/test/decapitalize/decapitalize.test.py index 6bacbffad..f6a3cbed5 100644 --- a/test/decapitalize/decapitalize.test.py +++ b/test/decapitalize/decapitalize.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from decapitalize import decapitalize def decapitalize_test(t): t.true(isinstance(decapitalize, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'decapitalize is a function') diff --git a/test/deep_flatten/deep_flatten.test.py b/test/deep_flatten/deep_flatten.test.py index 2479bc283..5ea80d419 100644 --- a/test/deep_flatten/deep_flatten.test.py +++ b/test/deep_flatten/deep_flatten.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from deep_flatten import deep_flatten def deep_flatten_test(t): t.true(isinstance(deep_flatten, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'deep_flatten is a function') diff --git a/test/difference/difference.test.py b/test/difference/difference.test.py index 424fff1b3..e82e3e54a 100644 --- a/test/difference/difference.test.py +++ b/test/difference/difference.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from difference import difference def difference_test(t): t.true(isinstance(difference, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'difference is a function') diff --git a/test/difference_by/difference_by.test.py b/test/difference_by/difference_by.test.py index 62e02d2ea..7b702ba2d 100644 --- a/test/difference_by/difference_by.test.py +++ b/test/difference_by/difference_by.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from difference_by import difference_by def difference_by_test(t): t.true(isinstance(difference_by, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'difference_by is a function') diff --git a/test/factorial/factorial.test.py b/test/factorial/factorial.test.py index 73e3fbd9f..94acd8d60 100644 --- a/test/factorial/factorial.test.py +++ b/test/factorial/factorial.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from factorial import factorial def factorial_test(t): t.true(isinstance(factorial, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'factorial is a function') diff --git a/test/gcd/gcd.test.py b/test/gcd/gcd.test.py index a89167edb..bae75801a 100644 --- a/test/gcd/gcd.test.py +++ b/test/gcd/gcd.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from gcd import gcd def gcd_test(t): t.true(isinstance(gcd, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'gcd is a function') diff --git a/test/is_lower_case/is_lower_case.test.py b/test/is_lower_case/is_lower_case.test.py index 52bb63d17..8952a9d06 100644 --- a/test/is_lower_case/is_lower_case.test.py +++ b/test/is_lower_case/is_lower_case.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from is_lower_case import is_lower_case def is_lower_case_test(t): t.true(isinstance(is_lower_case, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'is_lower_case is a function') diff --git a/test/is_upper_case/is_upper_case.test.py b/test/is_upper_case/is_upper_case.test.py index 9c834b63b..d0ddedc97 100644 --- a/test/is_upper_case/is_upper_case.test.py +++ b/test/is_upper_case/is_upper_case.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from is_upper_case import is_upper_case def is_upper_case_test(t): t.true(isinstance(is_upper_case, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'is_upper_case is a function') diff --git a/test/lcm/lcm.test.py b/test/lcm/lcm.test.py index 79e027d86..e782a3cb4 100644 --- a/test/lcm/lcm.test.py +++ b/test/lcm/lcm.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from lcm import lcm def lcm_test(t): t.true(isinstance(lcm, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'lcm is a function') diff --git a/test/max_n/max_n.test.py b/test/max_n/max_n.test.py index 6040310e7..1dd239b56 100644 --- a/test/max_n/max_n.test.py +++ b/test/max_n/max_n.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from max_n import max_n def max_n_test(t): t.true(isinstance(max_n, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'max_n is a function') diff --git a/test/min_n/min_n.test.py b/test/min_n/min_n.test.py index 5ad3eb1d0..2dccbc972 100644 --- a/test/min_n/min_n.test.py +++ b/test/min_n/min_n.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from min_n import min_n def min_n_test(t): t.true(isinstance(min_n, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'min_n is a function') diff --git a/test/palindrome/palindrome.test.py b/test/palindrome/palindrome.test.py index 863a2d3d2..3e432312f 100644 --- a/test/palindrome/palindrome.test.py +++ b/test/palindrome/palindrome.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from palindrome import palindrome def palindrome_test(t): t.true(isinstance(palindrome, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'palindrome is a function') diff --git a/test/shuffle/shuffle.test.py b/test/shuffle/shuffle.test.py index 2bb757cb1..71ca7f80f 100644 --- a/test/shuffle/shuffle.test.py +++ b/test/shuffle/shuffle.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from shuffle import shuffle def shuffle_test(t): t.true(isinstance(shuffle, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'shuffle is a function') diff --git a/test/spread/spread.test.py b/test/spread/spread.test.py index dc8e035c1..36779af5a 100644 --- a/test/spread/spread.test.py +++ b/test/spread/spread.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from spread import spread def spread_test(t): t.true(isinstance(spread, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'spread is a function') diff --git a/test/zip/zip.test.py b/test/zip/zip.test.py index c5ad71b56..4dbe4f005 100644 --- a/test/zip/zip.test.py +++ b/test/zip/zip.test.py @@ -1,5 +1,5 @@ import types,functools -from tape import test +from pytape import test from zip import zip def zip_test(t): t.true(isinstance(zip, (types.BuiltinFunctionType, types.FunctionType, functools.partial)),'zip is a function') diff --git a/website/Procfile b/website/Procfile new file mode 100644 index 000000000..80a980e84 --- /dev/null +++ b/website/Procfile @@ -0,0 +1 @@ +web: gunicorn run:app \ No newline at end of file diff --git a/website/app/__init__.py b/website/app/__init__.py new file mode 100644 index 000000000..d6e6d4a08 --- /dev/null +++ b/website/app/__init__.py @@ -0,0 +1,8 @@ +from flask import Flask + +app = Flask(__name__) + +app.config['SEND_FILE_MAX_AGE_DEFAULT'] = 0 +app.secret_key = 'thedarklordisgreat' + +from app import routes,vote \ No newline at end of file diff --git a/website/app/etc/hosts b/website/app/etc/hosts new file mode 100644 index 000000000..3abd760ec --- /dev/null +++ b/website/app/etc/hosts @@ -0,0 +1,2 @@ +127.0.0.1 localwebsite +127.0.0.1 blog.localwebsite \ No newline at end of file diff --git a/website/app/prism.css b/website/app/prism.css new file mode 100644 index 000000000..5bf332cb8 --- /dev/null +++ b/website/app/prism.css @@ -0,0 +1,124 @@ +/* PrismJS 1.10.0 +http://prismjs.com/download.html?themes=prism-okaidia&languages=python */ +/** + * okaidia theme for JavaScript, CSS and HTML + * Loosely based on Monokai textmate theme by http://www.monokai.nl/ + * @author ocodia + */ + +code[class*="language-"], +pre[class*="language-"] { + color: #f8f8f2; + background: none; + text-shadow: 0 1px rgba(0, 0, 0, 0.3); + font-family: Consolas, Monaco, 'Andale Mono', 'Ubuntu Mono', monospace; + text-align: left; + white-space: pre; + word-spacing: normal; + word-break: normal; + word-wrap: normal; + line-height: 1.5; + + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +/* Code blocks */ +pre[class*="language-"] { + padding: 1em; + margin: .5em 0; + overflow: auto; + border-radius: 0.3em; +} + +:not(pre) > code[class*="language-"], +pre[class*="language-"] { + background: #272822; +} + +/* Inline code */ +:not(pre) > code[class*="language-"] { + padding: .1em; + border-radius: .3em; + white-space: normal; +} + +.token.comment, +.token.prolog, +.token.doctype, +.token.cdata { + color: slategray; +} + +.token.punctuation { + color: #f8f8f2; +} + +.namespace { + opacity: .7; +} + +.token.property, +.token.tag, +.token.constant, +.token.symbol, +.token.deleted { + color: #f92672; +} + +.token.boolean, +.token.number { + color: #ae81ff; +} + +.token.selector, +.token.attr-name, +.token.string, +.token.char, +.token.builtin, +.token.inserted { + color: #a6e22e; +} + +.token.operator, +.token.entity, +.token.url, +.language-css .token.string, +.style .token.string, +.token.variable { + color: #f8f8f2; +} + +.token.atrule, +.token.attr-value, +.token.function { + color: #e6db74; +} + +.token.keyword { + color: #66d9ef; +} + +.token.regex, +.token.important { + color: #fd971f; +} + +.token.important, +.token.bold { + font-weight: bold; +} +.token.italic { + font-style: italic; +} + +.token.entity { + cursor: help; +} + diff --git a/website/app/prism.js b/website/app/prism.js new file mode 100644 index 000000000..b94bbedde --- /dev/null +++ b/website/app/prism.js @@ -0,0 +1,4 @@ +/* PrismJS 1.10.0 +http://prismjs.com/download.html?themes=prism-okaidia&languages=python */ +var _self="undefined"!=typeof window?window:"undefined"!=typeof WorkerGlobalScope&&self instanceof WorkerGlobalScope?self:{},Prism=function(){var e=/\blang(?:uage)?-(\w+)\b/i,t=0,n=_self.Prism={manual:_self.Prism&&_self.Prism.manual,disableWorkerMessageHandler:_self.Prism&&_self.Prism.disableWorkerMessageHandler,util:{encode:function(e){return e instanceof r?new r(e.type,n.util.encode(e.content),e.alias):"Array"===n.util.type(e)?e.map(n.util.encode):e.replace(/&/g,"&").replace(/e.length)return;if(!(w instanceof s)){h.lastIndex=0;var _=h.exec(w),P=1;if(!_&&m&&b!=t.length-1){if(h.lastIndex=k,_=h.exec(e),!_)break;for(var A=_.index+(d?_[1].length:0),j=_.index+_[0].length,x=b,O=k,N=t.length;N>x&&(j>O||!t[x].type&&!t[x-1].greedy);++x)O+=t[x].length,A>=O&&(++b,k=O);if(t[b]instanceof s||t[x-1].greedy)continue;P=x-b,w=e.slice(k,O),_.index-=k}if(_){d&&(p=_[1].length);var A=_.index+p,_=_[0].slice(p),j=A+_.length,S=w.slice(0,A),C=w.slice(j),M=[b,P];S&&(++b,k+=S.length,M.push(S));var E=new s(g,f?n.tokenize(_,f):_,y,_,m);if(M.push(E),C&&M.push(C),Array.prototype.splice.apply(t,M),1!=P&&n.matchGrammar(e,t,r,b,k,!0,g),i)break}else if(i)break}}}}},tokenize:function(e,t){var r=[e],a=t.rest;if(a){for(var l in a)t[l]=a[l];delete t.rest}return n.matchGrammar(e,r,t,0,0,!1),r},hooks:{all:{},add:function(e,t){var r=n.hooks.all;r[e]=r[e]||[],r[e].push(t)},run:function(e,t){var r=n.hooks.all[e];if(r&&r.length)for(var a,l=0;a=r[l++];)a(t)}}},r=n.Token=function(e,t,n,r,a){this.type=e,this.content=t,this.alias=n,this.length=0|(r||"").length,this.greedy=!!a};if(r.stringify=function(e,t,a){if("string"==typeof e)return e;if("Array"===n.util.type(e))return e.map(function(n){return r.stringify(n,t,e)}).join("");var l={type:e.type,content:r.stringify(e.content,t,a),tag:"span",classes:["token",e.type],attributes:{},language:t,parent:a};if(e.alias){var i="Array"===n.util.type(e.alias)?e.alias:[e.alias];Array.prototype.push.apply(l.classes,i)}n.hooks.run("wrap",l);var o=Object.keys(l.attributes).map(function(e){return e+'="'+(l.attributes[e]||"").replace(/"/g,""")+'"'}).join(" ");return"<"+l.tag+' class="'+l.classes.join(" ")+'"'+(o?" "+o:"")+">"+l.content+""},!_self.document)return _self.addEventListener?(n.disableWorkerMessageHandler||_self.addEventListener("message",function(e){var t=JSON.parse(e.data),r=t.language,a=t.code,l=t.immediateClose;_self.postMessage(n.highlight(a,n.languages[r],r)),l&&_self.close()},!1),_self.Prism):_self.Prism;var a=document.currentScript||[].slice.call(document.getElementsByTagName("script")).pop();return a&&(n.filename=a.src,n.manual||a.hasAttribute("data-manual")||("loading"!==document.readyState?window.requestAnimationFrame?window.requestAnimationFrame(n.highlightAll):window.setTimeout(n.highlightAll,16):document.addEventListener("DOMContentLoaded",n.highlightAll))),_self.Prism}();"undefined"!=typeof module&&module.exports&&(module.exports=Prism),"undefined"!=typeof global&&(global.Prism=Prism); +Prism.languages.python={comment:{pattern:/(^|[^\\])#.*/,lookbehind:!0},"triple-quoted-string":{pattern:/("""|''')[\s\S]+?\1/,greedy:!0,alias:"string"},string:{pattern:/("|')(?:\\.|(?!\1)[^\\\r\n])*\1/,greedy:!0},"function":{pattern:/((?:^|\s)def[ \t]+)[a-zA-Z_]\w*(?=\s*\()/g,lookbehind:!0},"class-name":{pattern:/(\bclass\s+)\w+/i,lookbehind:!0},keyword:/\b(?:as|assert|async|await|break|class|continue|def|del|elif|else|except|exec|finally|for|from|global|if|import|in|is|lambda|nonlocal|pass|print|raise|return|try|while|with|yield)\b/,builtin:/\b(?:__import__|abs|all|any|apply|ascii|basestring|bin|bool|buffer|bytearray|bytes|callable|chr|classmethod|cmp|coerce|compile|complex|delattr|dict|dir|divmod|enumerate|eval|execfile|file|filter|float|format|frozenset|getattr|globals|hasattr|hash|help|hex|id|input|int|intern|isinstance|issubclass|iter|len|list|locals|long|map|max|memoryview|min|next|object|oct|open|ord|pow|property|range|raw_input|reduce|reload|repr|reversed|round|set|setattr|slice|sorted|staticmethod|str|sum|super|tuple|type|unichr|unicode|vars|xrange|zip)\b/,"boolean":/\b(?:True|False|None)\b/,number:/\b-?(?:0[bo])?(?:(?:\d|0x[\da-f])[\da-f]*\.?\d*|\.\d+)(?:e[+-]?\d+)?j?\b/i,operator:/[-+%=]=?|!=|\*\*?=?|\/\/?=?|<[<=>]?|>[=>]?|[&|^~]|\b(?:or|and|not)\b/,punctuation:/[{}[\];(),.:]/}; diff --git a/website/app/routes.py b/website/app/routes.py new file mode 100644 index 000000000..91cb59e0c --- /dev/null +++ b/website/app/routes.py @@ -0,0 +1,23 @@ +from flask import render_template, redirect ,request, url_for +from app import app, vote, vote_data + +@app.route('/') +@app.route('/index') +@app.route('/index/') +def index(): + return render_template('index.html',vote={}) +''' +For future when we have logins +@app.route('/',methods=['POST']) +@app.route('/index',methods=['POST']) +@app.route('/index/',methods=['POST']) +def post(): + try: + vote.vote(request.form['submit']) + except Exception as e: + return render_template('index.html', vote=vote_data.vote_data(),err_400=True,message=e) + return redirect(f"/#{request.form['submit']}",code=302) +''' + + + diff --git a/website/app/snippets b/website/app/snippets new file mode 100644 index 000000000..28ea1fabc --- /dev/null +++ b/website/app/snippets @@ -0,0 +1,8 @@ +count_vowels +byte_size +capitalize +capitalize_every_word +decapitalize +palindrome +is_upper_case +is_lower_case \ No newline at end of file diff --git a/website/app/static/css/prism.css b/website/app/static/css/prism.css new file mode 100644 index 000000000..d56b7e094 --- /dev/null +++ b/website/app/static/css/prism.css @@ -0,0 +1,1229 @@ +:root { + --f-col:#111; + --f-col2:#444; + --b-col:#f8f8f8; + --b-col2:#f0f0f0; + --blq-col:#f57c00; + --pre-col:#1565c0; + --br-col:#aaa; + --br-col2:#ddd; + --h-ratio:1.19; + --u-m:.5rem; + --u-p:.5rem; + --u-br-r:.125rem; + --a-l-col:#0277bd; + --a-v-col:#01579b + } + html { + font-size:16px + } + a,b,del,em,i,ins,q,span,strong,u { + font-size:1em + } + html,* { + font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,Ubuntu,"Helvetica Neue",Helvetica,sans-serif; + line-height:1.5; + -webkit-text-size-adjust:100% + } + * { + font-size:1rem + } + body { + margin:0; + color:var(--f-col); + background:var(--b-col) + } + details { + display:block + } + summary { + display:list-item + } + abbr[title] { + border-bottom:none; + text-decoration:underline dotted + } + input { + overflow:visible + } + img { + max-width:100%; + height:auto + } + h1,h2,h3,h4,h5,h6 { + line-height:1.2; + margin:calc(1.5 * var(--u-m)) var(--u-m); + font-weight:500 + } + h1 small,h2 small,h3 small,h4 small,h5 small,h6 small { + color:var(--f-col2); + display:block; + margin-top:-.25rem + } + h1 { + font-size:calc(1rem * var(--h-ratio) * var(--h-ratio) * var(--h-ratio) * var(--h-ratio)) + } + h2 { + font-size:calc(1rem * var(--h-ratio) * var(--h-ratio) * var(--h-ratio)) + } + h3 { + font-size:calc(1rem * var(--h-ratio) * var(--h-ratio)) + } + h4 { + font-size:calc(1rem * var(--h-ratio)) + } + h5 { + font-size:1rem + } + h6 { + font-size:calc(1rem/ var(--h-ratio)) + } + p { + margin:var(--u-m) + } + ol,ul { + margin:var(--u-m); + padding-left:calc(2 * var(--u-m)) + } + b,strong { + font-weight:700 + } + hr { + box-sizing:content-box; + border:0; + line-height:1.25em; + margin:var(--u-m); + height:.0625rem; + background:linear-gradient(to right,transparent,var(--br-col) 20%,var(--br-col) 80%,transparent) + } + blockquote { + display:block; + position:relative; + font-style:italic; + color:var(--f-col2); + margin:var(--u-m); + padding:calc(3 * var(--u-p)); + border:.0625rem solid var(--br-col2); + border-left:.375rem solid var(--blq-col); + border-radius:0 var(--u-br-r) var(--u-br-r) 0 + } + blockquote:before { + position:absolute; + top:calc(0rem - var(--u-p)); + left:0; + font-family:sans-serif; + font-size:3rem; + font-weight:700; + content:"\201c"; + color:var(--blq-col) + } + blockquote[cite]:after { + font-style:normal; + font-size:.75em; + font-weight:700; + content:"\a— " attr(cite); + white-space:pre + } + code,kbd,pre,samp { + font-family:Menlo,Consolas,monospace; + font-size:.85em + } + code { + background:var(--b-col2); + border-radius:var(--u-br-r); + padding:calc(var(--u-p)/ 4) calc(var(--u-p)/ 2) + } + kbd { + background:var(--f-col); + color:var(--b-col); + border-radius:var(--u-br-r); + padding:calc(var(--u-p)/ 4) calc(var(--u-p)/ 2) + } + pre { + overflow:auto; + background:var(--b-col2); + padding:calc(1.5 * var(--u-p)); + margin:var(--u-m); + border:.0625rem solid var(--br-col2); + border-left:.25rem solid var(--pre-col); + border-radius:0 var(--u-br-r) var(--u-br-r) 0 + } + sup,sub,code,kbd { + line-height:0; + position:relative; + vertical-align:baseline + } + small,sup,sub,figcaption { + font-size:.75em + } + sup { + top:-.5em + } + sub { + bottom:-.25em + } + figure { + margin:var(--u-m) + } + figcaption { + color:var(--f-col2) + } + a { + text-decoration:none + } + a:link { + color:var(--a-l-col) + } + a:visited { + color:var(--a-v-col) + } + a:hover,a:focus { + text-decoration:underline + } + .container { + margin:0 auto; + padding:0 calc(1.5 * var(--u-p)) + } + .row { + box-sizing:border-box; + display:flex; + flex:0 1 auto; + flex-flow:row wrap + } + .col-sm,[class^='col-sm-'],[class^='col-sm-o-'] { + flex:0 0 auto; + padding:0 calc(var(--u-p)/ 2) + } + .col-sm { + max-width:100%; + flex-grow:1; + flex-basis:0 + } + .col-sm-1 { + max-width:8.33333%; + flex-basis:8.33333% + } + .col-sm-o-0 { + margin-left:0 + } + .col-sm-2 { + max-width:16.66667%; + flex-basis:16.66667% + } + .col-sm-o-1 { + margin-left:8.33333% + } + .col-sm-3 { + max-width:25%; + flex-basis:25% + } + .col-sm-o-2 { + margin-left:16.66667% + } + .col-sm-4 { + max-width:33.33333%; + flex-basis:33.33333% + } + .col-sm-o-3 { + margin-left:25% + } + .col-sm-5 { + max-width:41.66667%; + flex-basis:41.66667% + } + .col-sm-o-4 { + margin-left:33.33333% + } + .col-sm-6 { + max-width:50%; + flex-basis:50% + } + .col-sm-o-5 { + margin-left:41.66667% + } + .col-sm-7 { + max-width:58.33333%; + flex-basis:58.33333% + } + .col-sm-o-6 { + margin-left:50% + } + .col-sm-8 { + max-width:66.66667%; + flex-basis:66.66667% + } + .col-sm-o-7 { + margin-left:58.33333% + } + .col-sm-9 { + max-width:75%; + flex-basis:75% + } + .col-sm-o-8 { + margin-left:66.66667% + } + .col-sm-10 { + max-width:83.33333%; + flex-basis:83.33333% + } + .col-sm-o-9 { + margin-left:75% + } + .col-sm-11 { + max-width:91.66667%; + flex-basis:91.66667% + } + .col-sm-o-10 { + margin-left:83.33333% + } + .col-sm-12 { + max-width:100%; + flex-basis:100% + } + .col-sm-o-11 { + margin-left:91.66667% + } + .col-sm-n { + order:initial + } + .col-sm-f { + order:-999 + } + .col-sm-l { + order:999 + } + @media screen and (min-width: 768px) { + .col-md,[class^='col-md-'],[class^='col-md-o-'] { + flex:0 0 auto; + padding:0 calc(var(--u-p)/ 2) + } + .col-md { + max-width:100%; + flex-grow:1; + flex-basis:0 + } + .col-md-1 { + max-width:8.33333%; + flex-basis:8.33333% + } + .col-md-o-0 { + margin-left:0 + } + .col-md-2 { + max-width:16.66667%; + flex-basis:16.66667% + } + .col-md-o-1 { + margin-left:8.33333% + } + .col-md-3 { + max-width:25%; + flex-basis:25% + } + .col-md-o-2 { + margin-left:16.66667% + } + .col-md-4 { + max-width:33.33333%; + flex-basis:33.33333% + } + .col-md-o-3 { + margin-left:25% + } + .col-md-5 { + max-width:41.66667%; + flex-basis:41.66667% + } + .col-md-o-4 { + margin-left:33.33333% + } + .col-md-6 { + max-width:50%; + flex-basis:50% + } + .col-md-o-5 { + margin-left:41.66667% + } + .col-md-7 { + max-width:58.33333%; + flex-basis:58.33333% + } + .col-md-o-6 { + margin-left:50% + } + .col-md-8 { + max-width:66.66667%; + flex-basis:66.66667% + } + .col-md-o-7 { + margin-left:58.33333% + } + .col-md-9 { + max-width:75%; + flex-basis:75% + } + .col-md-o-8 { + margin-left:66.66667% + } + .col-md-10 { + max-width:83.33333%; + flex-basis:83.33333% + } + .col-md-o-9 { + margin-left:75% + } + .col-md-11 { + max-width:91.66667%; + flex-basis:91.66667% + } + .col-md-o-10 { + margin-left:83.33333% + } + .col-md-12 { + max-width:100%; + flex-basis:100% + } + .col-md-o-11 { + margin-left:91.66667% + } + .col-md-n { + order:initial + } + .col-md-f { + order:-999 + } + .col-md-l { + order:999 + } + } + @media screen and (min-width: 1280px) { + .col-lg,[class^='col-lg-'],[class^='col-lg-o-'] { + flex:0 0 auto; + padding:0 calc(var(--u-p)/ 2) + } + .col-lg { + max-width:100%; + flex-grow:1; + flex-basis:0 + } + .col-lg-1 { + max-width:8.33333%; + flex-basis:8.33333% + } + .col-lg-o-0 { + margin-left:0 + } + .col-lg-2 { + max-width:16.66667%; + flex-basis:16.66667% + } + .col-lg-o-1 { + margin-left:8.33333% + } + .col-lg-3 { + max-width:25%; + flex-basis:25% + } + .col-lg-o-2 { + margin-left:16.66667% + } + .col-lg-4 { + max-width:33.33333%; + flex-basis:33.33333% + } + .col-lg-o-3 { + margin-left:25% + } + .col-lg-5 { + max-width:41.66667%; + flex-basis:41.66667% + } + .col-lg-o-4 { + margin-left:33.33333% + } + .col-lg-6 { + max-width:50%; + flex-basis:50% + } + .col-lg-o-5 { + margin-left:41.66667% + } + .col-lg-7 { + max-width:58.33333%; + flex-basis:58.33333% + } + .col-lg-o-6 { + margin-left:50% + } + .col-lg-8 { + max-width:66.66667%; + flex-basis:66.66667% + } + .col-lg-o-7 { + margin-left:58.33333% + } + .col-lg-9 { + max-width:75%; + flex-basis:75% + } + .col-lg-o-8 { + margin-left:66.66667% + } + .col-lg-10 { + max-width:83.33333%; + flex-basis:83.33333% + } + .col-lg-o-9 { + margin-left:75% + } + .col-lg-11 { + max-width:91.66667%; + flex-basis:91.66667% + } + .col-lg-o-10 { + margin-left:83.33333% + } + .col-lg-12 { + max-width:100%; + flex-basis:100% + } + .col-lg-o-11 { + margin-left:91.66667% + } + .col-lg-n { + order:initial + } + .col-lg-f { + order:-999 + } + .col-lg-l { + order:999 + } + } + :root { + --cd-b-col:#f8f8f8; + --cd-f-col:#111; + --cd-br-col:#ddd + } + .card { + display:flex; + flex-direction:column; + justify-content:space-between; + align-self:center; + position:relative; + width:100%; + background:var(--cd-b-col); + color:var(--cd-f-col); + border:.0625rem solid var(--cd-br-col); + border-radius:var(--u-br-r); + margin:var(--u-m); + overflow:hidden + } + @media screen and (min-width: 320px) { + .card { + max-width:320px + } + } + .card>.section { + background:var(--cd-b-col); + color:var(--cd-f-col); + box-sizing:border-box; + margin:0; + border:0; + border-radius:0; + border-bottom:.0625rem solid var(--cd-br-col); + padding:var(--u-p); + width:100% + } + .card>.section.media { + height:200px; + padding:0; + -o-object-fit:cover; + object-fit:cover + } + .card>.section:last-child { + border-bottom:0 + } + .card.fluid { + max-width:100%; + width:auto + } + .card>.section.double-padded { + padding:calc(1.5 * var(--u-p)) + } + .card { + box-shadow:0 1.25rem 2.5rem -0.625rem rgba(0,32,64,0.1) + } + .card>h3.section.double-padded { + padding:calc(3 * var(--u-p)) + } + .card>.section.double-padded>p { + margin:var(--u-m) calc(var(--u-m)/ 2) + } + .card+.card { + margin-top:calc(5 * var(--u-m)) + } + :root { + --frm-b-col:#f0f0f0; + --frm-f-col:#111; + --frm-br-col:#ddd; + --in-b-col:#f8f8f8; + --in-f-col:#111; + --in-br-col:#ddd; + --in-fc-col:#0288d1; + --in-inv-col:#d32f2f; + --btn-b-col:#e2e2e2; + --btn-h-b-col:#dcdcdc; + --btn-f-col:#212121; + --btn-br-col:transparent; + --btn-h-br-col:transparent; + --btn-grp-br-col:rgba(124,124,124,0.54) + } + form { + background:var(--frm-b-col); + color:var(--frm-f-col); + border:.0625rem solid var(--frm-br-col); + border-radius:var(--u-br-r); + margin:var(--u-m); + padding:calc(2 * var(--u-p)) var(--u-p) + } + fieldset { + border:.0625rem solid var(--frm-br-col); + border-radius:var(--u-br-r); + margin:calc(var(--u-m)/ 4); + padding:var(--u-p) + } + legend { + box-sizing:border-box; + display:table; + max-width:100%; + white-space:normal; + font-weight:700; + padding:calc(var(--u-p)/ 2) + } + label { + padding:calc(var(--u-p)/ 2) var(--u-p) + } + .input-group { + display:inline-block + } + [type="number"]::-webkit-inner-spin-button,[type="number"]::-webkit-outer-spin-button { + height:auto + } + [type="search"] { + -webkit-appearance:textfield; + outline-offset:-2px + } + [type="search"]::-webkit-search-cancel-button,[type="search"]::-webkit-search-decoration { + -webkit-appearance:none + } + input:not([type]),[type="text"],[type="email"],[type="number"],[type="search"],[type="password"],[type="url"],[type="tel"],[type="checkbox"],[type="radio"],textarea,select { + box-sizing:border-box; + background:var(--in-b-col); + color:var(--in-f-col); + border:.0625rem solid var(--in-br-col); + border-radius:var(--u-br-r); + margin:calc(var(--u-m)/ 2); + padding:var(--u-p) calc(1.5 * var(--u-p)) + } + input:not([type="button"]):not([type="submit"]):not([type="reset"]):hover,input:not([type="button"]):not([type="submit"]):not([type="reset"]):focus,textarea:hover,textarea:focus,select:hover,select:focus { + border-color:var(--in-fc-col); + box-shadow:none + } + input:not([type="button"]):not([type="submit"]):not([type="reset"]):invalid,input:not([type="button"]):not([type="submit"]):not([type="reset"]):focus:invalid,textarea:invalid,textarea:focus:invalid,select:invalid,select:focus:invalid { + border-color:var(--in-inv-col); + box-shadow:none + } + input:not([type="button"]):not([type="submit"]):not([type="reset"])[readonly],textarea[readonly],select[readonly] { + background:var(--b-col2) + } + select { + max-width:100% + } + option { + overflow:hidden; + text-overflow:ellipsis + } + [type="checkbox"],[type="radio"] { + -webkit-appearance:none; + -moz-appearance:none; + appearance:none; + position:relative; + height:calc(1rem + var(--u-p) / 2); + width:calc(1rem + var(--u-p) / 2); + vertical-align:text-bottom; + padding:0; + flex-basis:calc(1rem + var(--u-p) / 2)!important; + flex-grow:0!important + } + [type="checkbox"]:checked:before,[type="radio"]:checked:before { + position:absolute + } + [type="checkbox"]:checked:before { + content:'\2713'; + font-family:sans-serif; + font-size:calc(1rem + var(--u-p) / 2); + top:calc(0rem - var(--u-p)); + left:calc(var(--u-p)/ 4) + } + [type="radio"] { + border-radius:100% + } + [type="radio"]:checked:before { + border-radius:100%; + content:''; + top:calc(.0625rem + var(--u-p) / 2); + left:calc(.0625rem + var(--u-p) / 2); + background:var(--in-f-col); + width:0.5rem; + height:0.5rem + } + :placeholder-shown { + color:var(--in-f-col) + } + ::-ms-placeholder { + color:var(--in-f-col); + opacity:0.54 + } + button::-moz-focus-inner,[type="button"]::-moz-focus-inner,[type="reset"]::-moz-focus-inner,[type="submit"]::-moz-focus-inner { + border-style:none; + padding:0 + } + button,html [type="button"],[type="reset"],[type="submit"] { + -webkit-appearance:button + } + button { + overflow:visible; + text-transform:none + } + button,[type="button"],[type="submit"],[type="reset"],a.button,label.button,.button,a[role="button"],label[role="button"],[role="button"] { + display:inline-block; + background:var(--btn-b-col); + color:var(--btn-f-col); + border:.0625rem solid var(--btn-br-col); + border-radius:var(--u-br-r); + padding:var(--u-p) calc(1.5 * var(--u-p)); + margin:var(--u-m); + text-decoration:none; + cursor:pointer; + transition:background 0.3s + } + button:hover,button:focus,[type="button"]:hover,[type="button"]:focus,[type="submit"]:hover,[type="submit"]:focus,[type="reset"]:hover,[type="reset"]:focus,a.button:hover,a.button:focus,label.button:hover,label.button:focus,.button:hover,.button:focus,a[role="button"]:hover,a[role="button"]:focus,label[role="button"]:hover,label[role="button"]:focus,[role="button"]:hover,[role="button"]:focus { + background:var(--btn-h-b-col); + border-color:var(--btn-h-br-col) + } + input:disabled,input[disabled],textarea:disabled,textarea[disabled],select:disabled,select[disabled],button:disabled,button[disabled],.button:disabled,.button[disabled],[role="button"]:disabled,[role="button"][disabled] { + cursor:not-allowed; + opacity:.75 + } + .button-group { + display:flex; + border:.0625rem solid var(--btn-grp-br-col); + border-radius:var(--u-br-r); + margin:var(--u-m) + } + .button-group>button,.button-group [type="button"],.button-group>[type="submit"],.button-group>[type="reset"],.button-group>.button,.button-group>[role="button"] { + margin:0; + max-width:100%; + flex:1 1 auto; + text-align:center; + border:0; + border-radius:0; + box-shadow:none + } + .button-group>:not(:first-child) { + border-left:.0625rem solid var(--btn-grp-br-col) + } + @media screen and (max-width: 767px) { + .button-group { + flex-direction:column + } + .button-group>:not(:first-child) { + border:0; + border-top:.0625rem solid var(--btn-grp-br-col) + } + } + button.primary,[type="button"].primary,[type="submit"].primary,[type="reset"].primary,.button.primary,[role="button"].primary { + --btn-b-col:#1976d2; + --btn-f-col:#f8f8f8 + } + button.primary:hover,button.primary:focus,[type="button"].primary:hover,[type="button"].primary:focus,[type="submit"].primary:hover,[type="submit"].primary:focus,[type="reset"].primary:hover,[type="reset"].primary:focus,.button.primary:hover,.button.primary:focus,[role="button"].primary:hover,[role="button"].primary:focus { + --btn-h-b-col:#1565c0 + } + :root { + --hd-b-col:#f8f8f8; + --hd-hv-b-col:#f0f0f0; + --hd-f-col:#444; + --hd-br-col:#ddd; + --nv-b-col:#f8f8f8; + --nv-hv-b-col:#f0f0f0; + --nv-f-col:#444; + --nv-br-col:#ddd; + --nv-ln-col:#0277bd; + --ft-f-col:#444; + --ft-b-col:#f8f8f8; + --ft-br-col:#ddd; + --ft-ln-col:#0277bd; + --dr-b-col:#f8f8f8; + --dr-hv-b-col:#f0f0f0; + --dr-br-col:#ddd; + --dr-cl-col:#444 + } + header { + height:3.1875rem; + background:var(--hd-b-col); + color:var(--hd-f-col); + border-bottom:.0625rem solid var(--hd-br-col); + padding:calc(var(--u-p)/ 4) 0; + white-space:nowrap; + overflow-x:auto; + overflow-y:hidden + } + header.row { + box-sizing:content-box + } + header .logo { + color:var(--hd-f-col); + font-size:1.75rem; + padding:var(--u-p) calc(2 * var(--u-p)); + text-decoration:none + } + header button,header [type="button"],header .button,header [role="button"] { + box-sizing:border-box; + position:relative; + top:calc(0rem - var(--u-p) / 4); + height:calc(3.1875rem + var(--u-p) / 2); + background:var(--hd-b-col); + line-height:calc(3.1875rem - var(--u-p) * 1.5); + text-align:center; + color:var(--hd-f-col); + border:0; + border-radius:0; + margin:0; + text-transform:uppercase + } + header button:hover,header button:focus,header [type="button"]:hover,header [type="button"]:focus,header .button:hover,header .button:focus,header [role="button"]:hover,header [role="button"]:focus { + background:var(--hd-hv-b-col) + } + nav { + background:var(--nv-b-col); + color:var(--nv-f-col); + border:.0625rem solid var(--nv-br-col); + border-radius:var(--u-br-r); + margin:var(--u-m) + } + nav * { + padding:var(--u-p) calc(1.5 * var(--u-p)) + } + nav a,nav a:visited { + display:block; + color:var(--nv-ln-col); + border-radius:var(--u-br-r); + transition:background 0.3s + } + nav a:hover,nav a:focus,nav a:visited:hover,nav a:visited:focus { + text-decoration:none; + background:var(--nv-hv-b-col) + } + nav .sublink-1 { + position:relative; + margin-left:calc(2 * var(--u-p)) + } + nav .sublink-1:before { + position:absolute; + left:calc(var(--u-p) - 1 * var(--u-p)); + top:-.0625rem; + content:''; + height:100%; + border:.0625rem solid var(--nv-br-col); + border-left:0 + } + footer { + background:var(--ft-b-col); + color:var(--ft-f-col); + border-top:.0625rem solid var(--ft-br-col); + padding:calc(2 * var(--u-p)) var(--u-p); + font-size:.875rem + } + footer a,footer a:visited { + color:var(--ft-ln-col) + } + header.sticky { + position:-webkit-sticky; + position:sticky; + z-index:1101; + top:0 + } + footer.sticky { + position:-webkit-sticky; + position:sticky; + z-index:1101; + bottom:0 + } + .drawer-toggle:before { + display:inline-block; + position:relative; + vertical-align:bottom; + content:'\00a0\2261\00a0'; + font-family:sans-serif; + font-size:1.5em + } + @media screen and (min-width: 768px) { + .drawer-toggle:not(.persistent) { + display:none + } + } + [type="checkbox"].drawer { + height:1px; + width:1px; + margin:-1px; + overflow:hidden; + position:absolute; + clip:rect(0 0 0 0); + -webkit-clip-path:inset(100%); + clip-path:inset(100%) + } + [type="checkbox"].drawer+* { + display:block; + box-sizing:border-box; + position:fixed; + top:0; + width:320px; + height:100vh; + overflow-y:auto; + background:var(--dr-b-col); + border:.0625rem solid var(--dr-br-col); + border-radius:0; + margin:0; + z-index:1110; + left:-320px; + transition:left 0.3s + } + [type="checkbox"].drawer+* .drawer-close { + position:absolute; + top:var(--u-m); + right:var(--u-m); + z-index:1111; + width:2rem; + height:2rem; + border-radius:var(--u-br-r); + padding:var(--u-p); + margin:0; + cursor:pointer; + transition:background 0.3s + } + [type="checkbox"].drawer+* .drawer-close:before { + display:block; + content:'\00D7'; + color:var(--dr-cl-col); + position:relative; + font-family:sans-serif; + font-size:2rem; + line-height:1; + text-align:center + } + [type="checkbox"].drawer+* .drawer-close:hover,[type="checkbox"].drawer+* .drawer-close:focus { + background:var(--dr-hv-b-col) + } + @media screen and (max-width: 320px) { + [type="checkbox"].drawer+* { + width:100% + } + } + [type="checkbox"].drawer:checked+* { + left:0 + } + @media screen and (min-width: 768px) { + [type="checkbox"].drawer:not(.persistent)+* { + position:static; + height:100%; + z-index:1100 + } + [type="checkbox"].drawer:not(.persistent)+* .drawer-close { + display:none + } + } + :root { + --mrk-b-col:#424242; + --mrk-f-col:#fafafa + } + mark { + background:var(--mrk-b-col); + color:var(--mrk-f-col); + font-size:.5em; + line-height:1em; + border-radius:var(--u-br-r); + padding:calc(var(--u-p)/ 4) calc(var(--u-p)/ 2) + } + mark.inline-block { + display:inline-block; + font-size:1em; + line-height:1.5; + padding:calc(var(--u-p)/ 2) var(--u-p) + } + :root { + --tst-b-col:#212121; + --tst-f-col:#fafafa + } + .toast { + position:fixed; + bottom:calc(var(--u-m) * 3); + left:50%; + transform:translate(-50%,-50%); + z-index:1111; + color:var(--tst-f-col); + background:var(--tst-b-col); + border-radius:calc(var(--u-br-r) * 16); + padding:var(--u-p) calc(var(--u-p) * 3) + } + .toast { + bottom:calc(var(--u-m)/ 2); + opacity:1; + transition:opacity 0.3s ease-in-out + } + mark { + position:relative; + top:-0.25rem; + left:0.25rem + } + mark.secondary { + --mrk-b-col:#d32f2f + } + mark.tertiary { + --mrk-b-col:#308732 + } + mark.tag { + padding:calc(var(--u-p)/2) var(--u-p); + border-radius:1em + } + code,pre,kbd,code *,pre *,kbd *,code[class*="language-"],pre[class*="language-"] { + font-family:Menlo,Consolas,monospace!important + } + pre { + border:0.0625rem solid var(--br-col2); + border-radius:var(--u-br-r) + } + .group { + position:relative; + margin-top:2em; + margin-bottom:1em + } + .search { + font-size:0.875rem; + margin-top:-0.1em; + display:block; + width:100%; + border:none; + border-bottom:.0625rem solid var(--nv-ln-col) + } + .search:focus { + outline:none + } + label#search-label { + color:var(--nv-ln-col); + font-size:1.125rem; + font-weight:400; + position:absolute; + left:0.3125rem; + top:0.625rem + } + .search:focus~label#search-label,.search:valid~label#search-label { + top:-1.25rem; + font-size:0.875rem; + color:var(--nv-ln-col) + } + label#menu-toggle { + width:3.4375rem + } + header h1.logo { + margin-top:-0.8rem; + text-align:center + } + header h1.logo a { + text-decoration:none; + color:#111 + } + header #title { + position:relative; + top:-1rem + } + @media screen and (max-width: 500px) { + header #title { + font-size:1rem; + display:block + } + } + header h1 small { + display:block; + font-size:0.875rem; + color:#888; + margin-top:-0.8rem + } + @media screen and (max-width: 768px) { + header h1 small { + font-size:0.75rem + } + } + @media screen and (max-width: 600px) { + header h1 small { + font-size:0.625rem + } + } + @media screen and (max-width: 500px) { + header h1 small { + font-size:0.5rem; + margin-top:-1.2rem + } + } + label#menu-toggle { + position:absolute; + left:0.5rem; + top:0.5rem; + width:3.4375rem + } + main { + padding:0 + } + :root { + --clps-lbl-b-col:#e8e8e8; + --clps-lbl-f-col:#212121; + --clps-lbl-h-b-col:#f0f0f0; + --clps-sel-lbl-b-col:#ececec; + --clps-br-col:#ddd; + --clps-cnt-b-col:#fafafa; + --clps-sel-lbl-br-col:#0277bd + } + label.collapse { + width:100%; + display:inline-block; + cursor:pointer; + box-sizing:border-box; + transition:background 0.3s; + color:var(--clps-lbl-f-col); + background:var(--clps-lbl-b-col); + border:.0625rem solid var(--clps-br-col); + padding:calc(1.5 * var(--u-p)); + border-radius:var(--u-br-r) + } + label.collapse:hover,label.collapse:focus { + background:var(--clps-lbl-h-b-col) + } + label.collapse+pre { + box-sizing:border-box; + height:0; + max-height:1px; + overflow:auto; + margin:0; + border:0; + padding:0; + transition:max-height 0.3s + } + label.collapse.toggled { + background:var(--clps-sel-lbl-b-col); + border-bottom-color:var(--clps-sel-lbl-br-col); + border-bottom-left-radius:0; + border-bottom-right-radius:0 + } + label.collapse.toggled+pre { + border-top-left-radius:0; + border-top-right-radius:0; + position:relative; + width:100%; + height:auto; + border:.0625rem solid var(--clps-br-col); + border-top:0; + padding:calc(2 * var(--u-p)); + max-height:400px + } + button.primary.clipboard-copy { + width:100%; + margin-left:0 + } + button.primary.clipboard-copy>img { + vertical-align:bottom + } + code[class*="language-"],pre[class*="language-"] { + color:#222; + text-align:left; + white-space:pre; + word-spacing:normal; + word-break:normal; + word-wrap:normal; + line-height:1.8; + -moz-tab-size:2; + -o-tab-size:2; + tab-size:2; + -webkit-hypens:none; + -moz-hyphens:none; + -ms-hyphens:none; + hyphens:none + } + pre[class*="language-"] { + padding:calc(2 * var(--u-p)); + overflow:auto; + margin:var(--u-m) 0 + } + pre[class*="language-"]::-moz-selection,pre[class*="language-"] ::-moz-selection,code[class*="language-"]::-moz-selection,code[class*="language-"] ::-moz-selection { + background:#b3d4fc + } + pre[class*="language-"]::selection,pre[class*="language-"] ::selection,code[class*="language-"]::selection,code[class*="language-"] ::selection { + background:#b3d4fc + } + :not(pre)>code[class*="language-"] { + padding:.1em; + border-radius:.3em; + white-space:normal + } + .token.comment,.token.prolog,.token.doctype,.token.cdata { + color:#7a8490 + } + .token.punctuation { + color:#666 + } + .namespace { + opacity:.7 + } + .token.property,.token.tag,.token.boolean,.token.constant,.token.symbol,.token.deleted,.token.function { + color:#005cc5 + } + .token.number,.token.class-name { + color:#832ed2 + } + .token.selector,.token.attr-name,.token.string,.token.char,.token.builtin,.token.inserted { + color:#067e36 + } + .token.operator,.token.entity,.token.url,.language-css .token.string,.style .token.string,.token.atrule,.token.attr-value,.token.keyword { + color:#d73a49 + } + .token.regex { + color:#097cab + } + .token.important,.token.variable { + color:#e90 + } + .token.important,.token.bold { + font-weight:bold + } + .token.italic { + font-style:italic + } + .token.entity { + cursor:help + } + button.scroll-to-top { + border-radius:100%; + font-size:1.5rem; + line-height:1; + box-sizing:border-box; + width:2.75rem; + height:2.75rem; + position:fixed; + bottom:1rem; + right:2rem; + background:var(--b-col); + box-shadow:0 0.25rem 0.25rem 0 rgba(0,0,0,0.125),0 0.125rem 0.125rem -0.125rem rgba(0,0,0,0.25) + } + button.scroll-to-top:hover,button.scroll-to-top:focus { + background:var(--b-col2) + } + \ No newline at end of file diff --git a/website/app/static/favicon.1png b/website/app/static/favicon.1png new file mode 100644 index 000000000..b84672d14 Binary files /dev/null and b/website/app/static/favicon.1png differ diff --git a/website/app/static/favicon.ico b/website/app/static/favicon.ico new file mode 100644 index 000000000..30fcc5df0 Binary files /dev/null and b/website/app/static/favicon.ico differ diff --git a/website/app/static/favicon.png b/website/app/static/favicon.png new file mode 100644 index 000000000..f98e25b17 Binary files /dev/null and b/website/app/static/favicon.png differ diff --git a/website/app/static/js/prism.js b/website/app/static/js/prism.js new file mode 100644 index 000000000..6ee9187a2 --- /dev/null +++ b/website/app/static/js/prism.js @@ -0,0 +1,4 @@ +/* PrismJS 1.10.0 +http://prismjs.com/download.html?themes=prism-okaidia&languages=python */ +var _self="undefined"!=typeof window?window:"undefined"!=typeof WorkerGlobalScope&&self instanceof WorkerGlobalScope?self:{},Prism=function(){var e=/\blang(?:uage)?-(\w+)\b/i,t=0,n=_self.Prism={manual:_self.Prism&&_self.Prism.manual,disableWorkerMessageHandler:_self.Prism&&_self.Prism.disableWorkerMessageHandler,util:{encode:function(e){return e instanceof r?new r(e.type,n.util.encode(e.content),e.alias):"Array"===n.util.type(e)?e.map(n.util.encode):e.replace(/&/g,"&").replace(/e.length)return;if(!(w instanceof s)){h.lastIndex=0;var _=h.exec(w),P=1;if(!_&&m&&b!=t.length-1){if(h.lastIndex=k,_=h.exec(e),!_)break;for(var A=_.index+(d?_[1].length:0),j=_.index+_[0].length,x=b,O=k,N=t.length;N>x&&(j>O||!t[x].type&&!t[x-1].greedy);++x)O+=t[x].length,A>=O&&(++b,k=O);if(t[b]instanceof s||t[x-1].greedy)continue;P=x-b,w=e.slice(k,O),_.index-=k}if(_){d&&(p=_[1].length);var A=_.index+p,_=_[0].slice(p),j=A+_.length,S=w.slice(0,A),C=w.slice(j),M=[b,P];S&&(++b,k+=S.length,M.push(S));var E=new s(g,f?n.tokenize(_,f):_,y,_,m);if(M.push(E),C&&M.push(C),Array.prototype.splice.apply(t,M),1!=P&&n.matchGrammar(e,t,r,b,k,!0,g),i)break}else if(i)break}}}}},tokenize:function(e,t){var r=[e],a=t.rest;if(a){for(var l in a)t[l]=a[l];delete t.rest}return n.matchGrammar(e,r,t,0,0,!1),r},hooks:{all:{},add:function(e,t){var r=n.hooks.all;r[e]=r[e]||[],r[e].push(t)},run:function(e,t){var r=n.hooks.all[e];if(r&&r.length)for(var a,l=0;a=r[l++];)a(t)}}},r=n.Token=function(e,t,n,r,a){this.type=e,this.content=t,this.alias=n,this.length=0|(r||"").length,this.greedy=!!a};if(r.stringify=function(e,t,a){if("string"==typeof e)return e;if("Array"===n.util.type(e))return e.map(function(n){return r.stringify(n,t,e)}).join("");var l={type:e.type,content:r.stringify(e.content,t,a),tag:"span",classes:["token",e.type],attributes:{},language:t,parent:a};if(e.alias){var i="Array"===n.util.type(e.alias)?e.alias:[e.alias];Array.prototype.push.apply(l.classes,i)}n.hooks.run("wrap",l);var o=Object.keys(l.attributes).map(function(e){return e+'="'+(l.attributes[e]||"").replace(/"/g,""")+'"'}).join(" ");return"<"+l.tag+' class="'+l.classes.join(" ")+'"'+(o?" "+o:"")+">"+l.content+""},!_self.document)return _self.addEventListener?(n.disableWorkerMessageHandler||_self.addEventListener("message",function(e){var t=JSON.parse(e.data),r=t.language,a=t.code,l=t.immediateClose;_self.postMessage(n.highlight(a,n.languages[r],r)),l&&_self.close()},!1),_self.Prism):_self.Prism;var a=document.currentScript||[].slice.call(document.getElementsByTagName("script")).pop();return a&&(n.filename=a.src,n.manual||a.hasAttribute("data-manual")||("loading"!==document.readyState?window.requestAnimationFrame?window.requestAnimationFrame(n.highlightAll):window.setTimeout(n.highlightAll,16):document.addEventListener("DOMContentLoaded",n.highlightAll))),_self.Prism}();"undefined"!=typeof module&&module.exports&&(module.exports=Prism),"undefined"!=typeof global&&(global.Prism=Prism); +Prism.languages.python={comment:{pattern:/(^|[^\\])#.*/,lookbehind:!0},"triple-quoted-string":{pattern:/("""|''')[\s\S]+?\1/,greedy:!0,alias:"string"},string:{pattern:/("|')(?:\\.|(?!\1)[^\\\r\n])*\1/,greedy:!0},"malfunction":{pattern:/[a-z0-9_]+(?=\()/i,number:/\b-?(?:0x[\da-f]+|\d*\.?\d+(?:e[+-]?\d+)?)\b/i,alias:"function"},"function":{pattern:/((?:^|\s)def[ \t]+)[a-zA-Z_]\w*(?=\s*\()/g,lookbehind:!0},"class-name":{pattern:/(\bclass\s+)\w+/i,lookbehind:!0},keyword:/\b(?:as|assert|async|await|break|class|continue|def|del|elif|else|except|exec|finally|for|from|global|if|import|in|is|lambda|nonlocal|pass|print|raise|return|try|while|with|yield)\b/,builtin:/\b(?:__import__|abs|all|any|apply|ascii|basestring|bin|bool|buffer|bytearray|bytes|callable|chr|classmethod|cmp|coerce|compile|complex|delattr|dict|dir|divmod|enumerate|eval|execfile|file|filter|float|format|frozenset|getattr|globals|hasattr|hash|help|hex|id|input|int|intern|isinstance|issubclass|iter|len|list|locals|long|map|max|memoryview|min|next|object|oct|open|ord|pow|property|range|raw_input|reduce|reload|repr|reversed|round|set|setattr|slice|sorted|staticmethod|str|sum|super|tuple|type|unichr|unicode|vars|xrange|zip)\b/,"boolean":/\b(?:True|False|None)\b/,number:/\b-?(?:0[bo])?(?:(?:\d|0x[\da-f])[\da-f]*\.?\d*|\.\d+)(?:e[+-]?\d+)?j?\b/i,operator:/[-+%=]=?|!=|\*\*?=?|\/\/?=?|<[<=>]?|>[=>]?|[&|^~]|\b(?:or|and|not)\b/,punctuation:/[{}[\];(),.:]/}; diff --git a/website/app/templates/base.html b/website/app/templates/base.html new file mode 100644 index 000000000..335d59039 --- /dev/null +++ b/website/app/templates/base.html @@ -0,0 +1,73 @@ + + + + + + + + + {% if err_400 %} +
{{ message }}
+ {% endif %} +

logo 30 seconds of python code Python Implementation of 30 seconds of code

+ {% block content %}{% endblock %} + + + + diff --git a/website/app/templates/index.html b/website/app/templates/index.html new file mode 100644 index 000000000..d2460b84c --- /dev/null +++ b/website/app/templates/index.html @@ -0,0 +1,379 @@ +{% extends "base.html" %} + +{% block content %}

Math

average

+

Already implemented via statistics.mean. statistics.mean takes an array as an argument whereas this function takes variadic arguments.

+

Returns the average of two or more numbers.

+

Takes the sum of all the args and divides it by len(args). The secind argument 0.0 in sum is to handle floating point division in python2.

+ +
def average(*args):
+    return sum(args, 0.0) / len(args)
+ +
average(*[1, 2, 3]) # 2.0
+average(1, 2, 3) # 2.0
+
+ +

factorial

+

Calculates the factorial of a number.

+

Use recursion. If num is less than or equal to 1, return 1. Otherwise, return the product of num and the factorial of num - 1. Throws an exception if num is a negative or a floating point number.

+ +
def factorial(num):
+    if not ((num >= 0) & (num % 1 == 0)):
+        raise Exception(
+            f"Number( {num} ) can't be floating point or negative ")
+    return 1 if num == 0 else num * factorial(num - 1)
+ +
factorial(6) # 720
+
+ +

gcd

+

math.gcd works with only two numbers

+

Calculates the greatest common divisor between two or more numbers/lists.

+

The helperGcdfunction uses recursion. Base case is when y equals 0. In this case, return x. Otherwise, return the GCD of y and the remainder of the division x/y.

+

Uses the reduce function from the inbuilt module functools. Also defines a method spread for javascript like spreading of lists.

+ +
from functools import reduce
+
+
+def spread(arg):
+    ret = []
+    for i in arg:
+        if isinstance(i, list):
+            ret.extend(i)
+        else:
+            ret.append(i)
+    return ret
+
+
+def gcd(*args):
+    numbers = []
+    numbers.extend(spread(list(args)))
+
+    def _gcd(x, y):
+        return x if not y else gcd(y, x % y)
+
+    return reduce((lambda x, y: _gcd(x, y)), numbers)
+ +
gcd(8,36) # 4
+
+ +

lcm

+

Returns the least common multiple of two or more numbers.

+

Use the greatest common divisor (GCD) formula and the fact that lcm(x,y) = x * y / gcd(x,y) to determine the least common multiple. The GCD formula uses recursion.

+

Uses reduce function from the inbuilt module functools. Also defines a method spread for javascript like spreading of lists.

+ +
from functools import reduce
+
+
+def spread(arg):
+    ret = []
+    for i in arg:
+        if isinstance(i, list):
+            ret.extend(i)
+        else:
+            ret.append(i)
+    return ret
+
+
+def lcm(*args):
+    numbers = []
+    numbers.extend(spread(list(args)))
+
+    def _gcd(x, y):
+        return x if not y else gcd(y, x % y)
+
+    def _lcm(x, y):
+        return x * y / _gcd(x, y)
+
+    return reduce((lambda x, y: _lcm(x, y)), numbers)
+ +
lcm(12, 7) # 84
+lcm([1, 3, 4], 5) # 60
+
+ +

max_n

+

Returns the n maximum elements from the provided list. If n is greater than or equal to the provided list's length, then return the original list(sorted in descending order).

+

Use list.sort() combined with the deepcopy function from the inbuilt copy module to create a shallow clone of the list and sort it in ascending order and then use list.reverse() reverse it to make it descending order. Use [:n] to get the specified number of elements. Omit the second argument, n, to get a one-element array

+ +
from copy import deepcopy
+
+
+def max_n(arr, n=1):
+    numbers = deepcopy(arr)
+    numbers.sort()
+    numbers.reverse()
+    return numbers[:n]
+ +
max_n([1, 2, 3]) # [3]
+max_n([1, 2, 3], 2) # [3,2]
+
+ +

min_n

+

Returns the n minimum elements from the provided list. If n is greater than or equal to the provided list's length, then return the original list(sorted in ascending order).

+

Use list.sort() combined with the deepcopy function from the inbuilt copy module to create a shallow clone of the list and sort it in ascending order. Use [:n] to get the specified number of elements. Omit the second argument, n, to get a one-element array

+ +
from copy import deepcopy
+
+
+def min_n(arr, n=1):
+    numbers = deepcopy(arr)
+    numbers.sort()
+    return numbers[:n]
+ +
min_n([1, 2, 3]) # [1]
+min_n([1, 2, 3], 2) # [1,2]
+
+ +

List

chunk

+

Chunks an array into smaller lists of a specified size.

+

Uses range to create a list of desired size. Then use map on this list and fill it with splices of arr.

+ +
from math import ceil
+
+
+def chunk(arr, size):
+    return list(
+        map(lambda x: arr[x * size:x * size + size],
+            list(range(0, ceil(len(arr) / size)))))
+ +
chunk([1,2,3,4,5],2) # [[1,2],[3,4],5]
+
+ +

compact

+

Removes falsey values from a list.

+

Use filter() to filter out falsey values (False, None, 0, and "").

+ +
def compact(arr):
+    return list(filter(lambda x: bool(x), arr))
+ +
compact([0, 1, False, 2, '', 3, 'a', 's', 34]) # [ 1, 2, 3, 'a', 's', 34 ]
+
+ +

count_occurences

+

Already implemented via list.count().

+

Counts the occurrences of a value in an list.

+

Uses the reduce functin from built-in module functools to increment a counter each time you encounter the specific value inside the list.

+ +
def count_occurences(arr, val):
+    return reduce(
+        (lambda x, y: x + 1 if y == val and type(y) == type(val) else x + 0),
+        arr)
+ +
count_occurrences([1, 1, 2, 1, 2, 3], 1) # 3
+
+ +

deep_flatten

+

Deep flattens a list.

+

Use recursion. Use list.extend() with an empty array (result) and the spread function to flatten a list. Recursively flatten each element that is a list.

+ +
def spread(arg):
+    ret = []
+    for i in arg:
+        if isinstance(i, list):
+            ret.extend(i)
+        else:
+            ret.append(i)
+    return ret
+
+
+def deep_flatten(arr):
+    result = []
+    result.extend(
+        spread(list(map(lambda x: deep(x) if type(x) == list else x, arr))))
+    return result
+ +
deep_flatten([1, [2], [[3], 4], 5]) # [1,2,3,4,5]
+
+ +

difference

+

Returns the difference between two arrays.

+

Create a set from b, then use list comprehension to only keep values not contained in b

+ +
def difference(a, b):
+    b = set(b)
+    return [item for item in a if item not in b]
+ +
difference([1, 2, 3], [1, 2, 4]) # [3]
+
+ +

shuffle

+

The same algorithm is already implemented via random.shuffle.

+

Randomizes the order of the values of an list, returning a new list.

+

Uses the Fisher-Yates algorithm to reorder the elements of the list.

+ +
from copy import deepcopy
+from random import randint
+
+
+def shuffle(arr):
+    temp_arr = deepcopy(arr)
+    m = len(temp_arr)
+    while (m):
+        m -= 1
+        i = randint(0, m)
+        temp_arr[m], temp_arr[i] = temp_arr[i], temp_arr[m]
+    return temp_arr
+ +
foo = [1,2,3]
+shuffle(foo) # [2,3,1] , foo = [1,2,3]
+
+ +

spread

+

Implements javascript's [].concat(...arr). Flattens the list(non-deep) and returns an list.

+ +
def spread(arg):
+    ret = []
+    for i in arg:
+        if isinstance(i, list):
+            ret.extend(i)
+        else:
+            ret.append(i)
+    return ret
+ +
spread([1,2,3,[4,5,6],[7],8,9]) # [1,2,3,4,5,6,7,8,9]
+
+ +

zip

+

Already implemented via itertools.zip_longest()

+

Creates a list of elements, grouped based on the position in the original lists.

+

Use max combined with list comprehension to get the length of the longest list in the arguments. Loops for max_length times grouping elements. If lengths of lists vary fill_value is used. By default fill_value is None.

+ +
def zip(*args, fillvalue=None):
+    max_length = max([len(arr) for arr in args])
+    result = []
+    for i in range(max_length):
+        result.append([
+            args[k][i] if i < len(args[k]) else None for k in range(len(args))
+        ])
+    return result
+ +
zip(['a', 'b'], [1, 2], [True, False]) # [['a', 1, True], ['b', 2, False]]
+zip(['a'], [1, 2], [True, False]) # [['a', 1, True], [None, 2, False]]
+zip(['a'], [1, 2], [True, False], fill_value = '_') # [['a', 1, True], ['_', 2, False]]
+
+ +

count_by

+

Already implemented via collections.Counter

+

Groups the elements of a list based on the given function and returns the count of elements in each group.

+

Use map() to map the values of the list using the given function. Iterate over the map and increase the the elements count each time it occurs.

+ +
def count_by(arr, fn=lambda x: x):
+    key = {}
+    for el in map(fn, arr):
+        key[el] = 0 if not el in key else key[el]
+        key[el] += 1
+    return key
+ +
from math import floor
+count_by([6.1, 4.2, 6.3], floor) # {4: 1, 6: 2}
+count_by(['one', 'two', 'three'], len) # {3: 2, 5: 1}
+
+ +

difference_by

+

Returns the difference between two list, after applying the provided function to each list element of both.

+

Create a set by applying fn to each element in b, then use list comprehension in combination with fn on a to only keep values not contained in the previously created set.

+ +
def difference_by(a, b, fn):
+    b = set(map(fn, b))
+    return [item for item in a if fn(item) not in b]
+ +
from math import floor
+difference_by([2.1, 1.2], [2.3, 3.4],floor) # [1.2]
+difference_by([{ 'x': 2 }, { 'x': 1 }], [{ 'x': 1 }], lambda v : v['x']) # [ { x: 2 } ]
+
+ +

String

count_vowels

+

Retuns number of vowels in provided string.

+

Use a regular expression to count the number of vowels (A, E, I, O, U) in a string.

+ +
import re
+
+
+def count_vowels(str):
+    return len(len(re.findall(r'[aeiou]', str, re.IGNORECASE)))
+ +
count_vowels('foobar') # 3
+count_vowels('gym') # 0
+
+ +

byte_size

+

Returns the length of a string in bytes.

+

utf-8 encodes a given string and find its length.

+ +
def byte_size(string):
+    return(len(string.encode('utf-8')))
+ +
byte_size('😀') # 4
+byte_size('Hello World') # 11
+
+ +

capitalize

+

Capitalizes the first letter of a string.

+

Capitalizes the fist letter of the sring and then adds it with rest of the string. Omit the lower_rest parameter to keep the rest of the string intact, or set it to true to convert to lowercase.

+ +
def capitalize(string, lower_rest=False):
+    return string[:1].upper() + (string[1:].lower() if lower_rest else string[1:])
+ +
capitalize('fooBar') # 'FooBar'
+capitalize('fooBar', True) # 'Foobar'
+
+ +

capitalize_every_word

+

Capitalizes the first letter of every word in a string.

+

Uses str.title to capitalize first letter of evry word in the string.

+ +
def capitalize_every_word(string):
+    return string.title()
+ +
capitalize_every_word('hello world!') # 'Hello World!'
+
+ +

decapitalize

+

Decapitalizes the first letter of a string.

+

Decapitalizes the fist letter of the sring and then adds it with rest of the string. Omit the upper_rest parameter to keep the rest of the string intact, or set it to true to convert to uppercase.

+ +
def decapitalize(string, upper_rest=False):
+    return str[:1].lower() + (str[1:].upper() if upper_rest else str[1:])
+ +
decapitalize('FooBar') # 'fooBar'
+decapitalize('FooBar', True) # 'fOOBAR'
+
+ +

palindrome

+

Returns True if the given string is a palindrome, False otherwise.

+

Convert string str.lower() and use re.sub to remove non-alphanumeric characters from it. Then compare the new string to the reversed.

+ +
def palindrome(string):
+    from re import sub
+    s = sub('[\W_]', '', string.lower())
+    return s == s[::-1]
+ +
palindrome('taco cat') # True
+
+ +

is_upper_case

+

Checks if a string is upper case.

+

Convert the given string to upper case, using str.upper() method and compare it to the original.

+ +
def is_upper_case(str):
+    return str == str.upper()
+ +
is_upper_case('ABC') # True
+is_upper_case('a3@$') # True
+is_upper_case('aB4') # False
+
+ +

is_lower_case

+

Checks if a string is lower case.

+

Convert the given string to lower case, using str.lower() method and compare it to the original.

+ +
def is_lower_case(str):
+    return str == str.lower()
+ +
is_lower_case('abc') # True
+is_lower_case('a3@$') # True
+is_lower_case('Ab4') # False
+
+ +
+ +
{% endblock %} \ No newline at end of file diff --git a/website/app/templates/prism.css b/website/app/templates/prism.css new file mode 100644 index 000000000..5bf332cb8 --- /dev/null +++ b/website/app/templates/prism.css @@ -0,0 +1,124 @@ +/* PrismJS 1.10.0 +http://prismjs.com/download.html?themes=prism-okaidia&languages=python */ +/** + * okaidia theme for JavaScript, CSS and HTML + * Loosely based on Monokai textmate theme by http://www.monokai.nl/ + * @author ocodia + */ + +code[class*="language-"], +pre[class*="language-"] { + color: #f8f8f2; + background: none; + text-shadow: 0 1px rgba(0, 0, 0, 0.3); + font-family: Consolas, Monaco, 'Andale Mono', 'Ubuntu Mono', monospace; + text-align: left; + white-space: pre; + word-spacing: normal; + word-break: normal; + word-wrap: normal; + line-height: 1.5; + + -moz-tab-size: 4; + -o-tab-size: 4; + tab-size: 4; + + -webkit-hyphens: none; + -moz-hyphens: none; + -ms-hyphens: none; + hyphens: none; +} + +/* Code blocks */ +pre[class*="language-"] { + padding: 1em; + margin: .5em 0; + overflow: auto; + border-radius: 0.3em; +} + +:not(pre) > code[class*="language-"], +pre[class*="language-"] { + background: #272822; +} + +/* Inline code */ +:not(pre) > code[class*="language-"] { + padding: .1em; + border-radius: .3em; + white-space: normal; +} + +.token.comment, +.token.prolog, +.token.doctype, +.token.cdata { + color: slategray; +} + +.token.punctuation { + color: #f8f8f2; +} + +.namespace { + opacity: .7; +} + +.token.property, +.token.tag, +.token.constant, +.token.symbol, +.token.deleted { + color: #f92672; +} + +.token.boolean, +.token.number { + color: #ae81ff; +} + +.token.selector, +.token.attr-name, +.token.string, +.token.char, +.token.builtin, +.token.inserted { + color: #a6e22e; +} + +.token.operator, +.token.entity, +.token.url, +.language-css .token.string, +.style .token.string, +.token.variable { + color: #f8f8f2; +} + +.token.atrule, +.token.attr-value, +.token.function { + color: #e6db74; +} + +.token.keyword { + color: #66d9ef; +} + +.token.regex, +.token.important { + color: #fd971f; +} + +.token.important, +.token.bold { + font-weight: bold; +} +.token.italic { + font-style: italic; +} + +.token.entity { + cursor: help; +} + diff --git a/website/app/templates/prism.js b/website/app/templates/prism.js new file mode 100644 index 000000000..982420588 --- /dev/null +++ b/website/app/templates/prism.js @@ -0,0 +1,2 @@ +var _self="undefined"!=typeof window?window:"undefined"!=typeof WorkerGlobalScope&&self instanceof WorkerGlobalScope?self:{},Prism=function(){var e=/\blang(?:uage)?-(\w+)\b/i,t=0,n=_self.Prism={manual:_self.Prism&&_self.Prism.manual,disableWorkerMessageHandler:_self.Prism&&_self.Prism.disableWorkerMessageHandler,util:{encode:function(e){return e instanceof r?new r(e.type,n.util.encode(e.content),e.alias):"Array"===n.util.type(e)?e.map(n.util.encode):e.replace(/&/g,"&").replace(/e.length)return;if(!(w instanceof s)){h.lastIndex=0;var _=h.exec(w),P=1;if(!_&&m&&b!=t.length-1){if(h.lastIndex=k,_=h.exec(e),!_)break;for(var A=_.index+(d?_[1].length:0),j=_.index+_[0].length,x=b,O=k,N=t.length;N>x&&(j>O||!t[x].type&&!t[x-1].greedy);++x)O+=t[x].length,A>=O&&(++b,k=O);if(t[b]instanceof s||t[x-1].greedy)continue;P=x-b,w=e.slice(k,O),_.index-=k}if(_){d&&(p=_[1].length);var A=_.index+p,_=_[0].slice(p),j=A+_.length,S=w.slice(0,A),C=w.slice(j),M=[b,P];S&&(++b,k+=S.length,M.push(S));var E=new s(g,f?n.tokenize(_,f):_,y,_,m);if(M.push(E),C&&M.push(C),Array.prototype.splice.apply(t,M),1!=P&&n.matchGrammar(e,t,r,b,k,!0,g),i)break}else if(i)break}}}}},tokenize:function(e,t){var r=[e],a=t.rest;if(a){for(var l in a)t[l]=a[l];delete t.rest}return n.matchGrammar(e,r,t,0,0,!1),r},hooks:{all:{},add:function(e,t){var r=n.hooks.all;r[e]=r[e]||[],r[e].push(t)},run:function(e,t){var r=n.hooks.all[e];if(r&&r.length)for(var a,l=0;a=r[l++];)a(t)}}},r=n.Token=function(e,t,n,r,a){this.type=e,this.content=t,this.alias=n,this.length=0|(r||"").length,this.greedy=!!a};if(r.stringify=function(e,t,a){if("string"==typeof e)return e;if("Array"===n.util.type(e))return e.map(function(n){return r.stringify(n,t,e)}).join("");var l={type:e.type,content:r.stringify(e.content,t,a),tag:"span",classes:["token",e.type],attributes:{},language:t,parent:a};if(e.alias){var i="Array"===n.util.type(e.alias)?e.alias:[e.alias];Array.prototype.push.apply(l.classes,i)}n.hooks.run("wrap",l);var o=Object.keys(l.attributes).map(function(e){return e+'="'+(l.attributes[e]||"").replace(/"/g,""")+'"'}).join(" ");return"<"+l.tag+' class="'+l.classes.join(" ")+'"'+(o?" "+o:"")+">"+l.content+""},!_self.document)return _self.addEventListener?(n.disableWorkerMessageHandler||_self.addEventListener("message",function(e){var t=JSON.parse(e.data),r=t.language,a=t.code,l=t.immediateClose;_self.postMessage(n.highlight(a,n.languages[r],r)),l&&_self.close()},!1),_self.Prism):_self.Prism;var a=document.currentScript||[].slice.call(document.getElementsByTagName("script")).pop();return a&&(n.filename=a.src,n.manual||a.hasAttribute("data-manual")||("loading"!==document.readyState?window.requestAnimationFrame?window.requestAnimationFrame(n.highlightAll):window.setTimeout(n.highlightAll,16):document.addEventListener("DOMContentLoaded",n.highlightAll))),_self.Prism}();"undefined"!=typeof module&&module.exports&&(module.exports=Prism),"undefined"!=typeof global&&(global.Prism=Prism); +Prism.languages.python={comment:{pattern:/(^|[^\\])#.*/,lookbehind:!0},"triple-quoted-string":{pattern:/("""|''')[\s\S]+?\1/,greedy:!0,alias:"string"},string:{pattern:/("|')(?:\\.|(?!\1)[^\\\r\n])*\1/,greedy:!0},"callable":{pattern:/\S+\([\s\S]*\)/g},"function":{pattern:/((?:^|\s)def[ \t]+)[a-zA-Z_]\w*(?=\s*\()/g,lookbehind:!0},"class-name":{pattern:/(\bclass\s+)\w+/i,lookbehind:!0},keyword:/\b(?:as|assert|async|await|break|class|continue|def|del|elif|else|except|exec|finally|for|from|global|if|import|in|is|lambda|nonlocal|pass|print|raise|return|try|while|with|yield)\b/,builtin:/\b(?:__import__|abs|all|any|apply|ascii|basestring|bin|bool|buffer|bytearray|bytes|callable|chr|classmethod|cmp|coerce|compile|complex|delattr|dict|dir|divmod|enumerate|eval|execfile|file|filter|float|format|frozenset|getattr|globals|hasattr|hash|help|hex|id|input|int|intern|isinstance|issubclass|iter|len|list|locals|long|map|max|memoryview|min|next|object|oct|open|ord|pow|property|range|raw_input|reduce|reload|repr|reversed|round|set|setattr|slice|sorted|staticmethod|str|sum|super|tuple|type|unichr|unicode|vars|xrange|zip)\b/,"boolean":/\b(?:True|False|None)\b/,number:/\b-?(?:0[bo])?(?:(?:\d|0x[\da-f])[\da-f]*\.?\d*|\.\d+)(?:e[+-]?\d+)?j?\b/i,operator:/[-+%=]=?|!=|\*\*?=?|\/\/?=?|<[<=>]?|>[=>]?|[&|^~]|\b(?:or|and|not)\b/,punctuation:/[{}[\];(),.:]/}; diff --git a/website/app/vote.py b/website/app/vote.py new file mode 100644 index 000000000..631017dbd --- /dev/null +++ b/website/app/vote.py @@ -0,0 +1,16 @@ +import json + + +def vote(snippet): + snippets = open('website/app/snippets').read().split('\n') + with open('website/app/votes.json', 'r') as f: + if snippet in snippets: + data = json.load(f) + try: + data[snippet] + except KeyError: + data[snippet] = 0 + data[snippet] += 1 + open('website/app/votes.json','w').write(str(data).replace("'",'"')) + else: + raise Exception(f'{snippet} does not exists ') diff --git a/website/app/vote_data.py b/website/app/vote_data.py new file mode 100644 index 000000000..e36806df4 --- /dev/null +++ b/website/app/vote_data.py @@ -0,0 +1,16 @@ +import json + +def vote_data(): + f = open('website/app/snippets') + snippets = f.read().split('\n') + f.close() + + f = open('website/app/votes.json') + votes_data = json.load(f) + votes = {} + for snippet in snippets: + try: + votes[snippet] = votes_data[snippet] + except KeyError: + votes[snippet] = 0 + return votes diff --git a/website/app/votes.json b/website/app/votes.json new file mode 100644 index 000000000..9e26dfeeb --- /dev/null +++ b/website/app/votes.json @@ -0,0 +1 @@ +{} \ No newline at end of file diff --git a/website/etc/hosts b/website/etc/hosts new file mode 100644 index 000000000..3abd760ec --- /dev/null +++ b/website/etc/hosts @@ -0,0 +1,2 @@ +127.0.0.1 localwebsite +127.0.0.1 blog.localwebsite \ No newline at end of file diff --git a/website/index.html b/website/index.html new file mode 100644 index 000000000..b580d1bf5 --- /dev/null +++ b/website/index.html @@ -0,0 +1,10 @@ + + + + + +
def Hello_World(val):
+    print(f'Hello {val}')
+    wow!
+
+ diff --git a/website/main.py b/website/main.py new file mode 100644 index 000000000..49e18b76e --- /dev/null +++ b/website/main.py @@ -0,0 +1,69 @@ +import os +import re + +import emoji +import mistune + +codeRe = "```\s*python([\s\S]*?)```" +def tagger(): + tag_data = open('tag_database').read() + tag_dict = {} + tag_list = tag_data.split('\n') + for tag in tag_list: + category = tag.split(':')[1] + snippet = tag.split(':')[0] + if category in tag_dict: + tag_dict[category].append(snippet) + else: + tag_dict[category] = [snippet] + return tag_dict + +class MyRenderer(mistune.Renderer): + def block_code(self, code, lang): + if not lang: + return f'\n
{mistune.escape(code.strip())}
\n' + else: + return f'\n
{mistune.escape(code.strip())}
\n' + + +renderer = MyRenderer() +md = mistune.Markdown(renderer=renderer,escape=True) +def title_case(str): + return str[:1].upper() + str[1:].lower() + +rendered = '' + +tag_dict = tagger() + +for category in tag_dict: + rendered += f'

{title_case(category)}

' + snippets = tag_dict[category] + for file in snippets: + content = open('snippets/'+file+'.md').read() + content = re.sub(':(\S+):',r':\1:',content) + codeParts = re.split(codeRe,content) + codeParts[3] = f'\n\n\n\n```python\n{codeParts[3].strip()}\n```\n' + content = codeParts[0] + '``` python' + codeParts[1] + '```' + codeParts[2] + codeParts[3] + content = f'
{emoji.emojize(md.render(content),use_aliases=True)}
'+'\n\n' + rendered += re.sub('

(\S+)

',r'

\1

',content) + '
' + rendered = re.sub('

(\S+)

',r'

\1

',rendered) +nav_string = '' +start = '''{% extends "base.html" %} + +{% block content %}''' + +end = '{% endblock %}' + +footer = ''' + + ''' +rendered = f'
{nav_string}
' + rendered + f'{footer}
' +rendered = re.sub('','',rendered) +open('website/app/templates/index.html','w',encoding='utf-8').write(start + rendered + end) +snippets = [snippet.replace('.md','') for snippet in snippets] +open('website/app/snippets','w').write('\n'.join(snippets)) diff --git a/website/requirements.txt b/website/requirements.txt new file mode 100644 index 000000000..d1632f66b --- /dev/null +++ b/website/requirements.txt @@ -0,0 +1,11 @@ +cffi==1.11.4 +click==6.7 +emoji==0.4.5 +Flask==0.12.2 +gunicorn==19.7.1 +itsdangerous==0.24 +Jinja2==2.10 +MarkupSafe==1.0 +misaka==2.1.0 +pycparser==2.18 +Werkzeug==0.14.1 diff --git a/website/run.py b/website/run.py new file mode 100644 index 000000000..714d5bd3f --- /dev/null +++ b/website/run.py @@ -0,0 +1,6 @@ +from app import app + +if __name__ == '__main__': + app.jinja_env.auto_reload = True + app.config['TEMPLATES_AUTO_RELOAD'] = True + app.run(debug=True, host='0.0.0.0',port=80) \ No newline at end of file diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/DESCRIPTION.rst b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/DESCRIPTION.rst new file mode 100644 index 000000000..239dbda32 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/DESCRIPTION.rst @@ -0,0 +1,46 @@ +Flask +----- + +Flask is a microframework for Python based on Werkzeug, Jinja 2 and good +intentions. And before you ask: It's BSD licensed! + +Flask is Fun +```````````` + +Save in a hello.py: + +.. code:: python + + from flask import Flask + app = Flask(__name__) + + @app.route("/") + def hello(): + return "Hello World!" + + if __name__ == "__main__": + app.run() + +And Easy to Setup +````````````````` + +And run it: + +.. code:: bash + + $ pip install Flask + $ python hello.py + * Running on http://localhost:5000/ + + Ready for production? `Read this first `. + +Links +````` + +* `website `_ +* `documentation `_ +* `development version + `_ + + + diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/INSTALLER b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/INSTALLER new file mode 100644 index 000000000..a1b589e38 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/LICENSE.txt b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/LICENSE.txt new file mode 100644 index 000000000..a7da10e17 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/LICENSE.txt @@ -0,0 +1,33 @@ +Copyright (c) 2015 by Armin Ronacher and contributors. See AUTHORS +for more details. + +Some rights reserved. + +Redistribution and use in source and binary forms of the software as well +as documentation, with or without modification, are permitted provided +that the following conditions are met: + +* Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above + copyright notice, this list of conditions and the following + disclaimer in the documentation and/or other materials provided + with the distribution. + +* The names of the contributors may not be used to endorse or + promote products derived from this software without specific + prior written permission. + +THIS SOFTWARE AND DOCUMENTATION IS PROVIDED BY THE COPYRIGHT HOLDERS AND +CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT +NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER +OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, +EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, +PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR +PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF +LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING +NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS +SOFTWARE AND DOCUMENTATION, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH +DAMAGE. diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/METADATA b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/METADATA new file mode 100644 index 000000000..8c43205bb --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/METADATA @@ -0,0 +1,75 @@ +Metadata-Version: 2.0 +Name: Flask +Version: 0.12.2 +Summary: A microframework based on Werkzeug, Jinja2 and good intentions +Home-page: http://github.com/pallets/flask/ +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: BSD +Platform: any +Classifier: Development Status :: 4 - Beta +Classifier: Environment :: Web Environment +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Software Development :: Libraries :: Python Modules +Requires-Dist: Jinja2 (>=2.4) +Requires-Dist: Werkzeug (>=0.7) +Requires-Dist: click (>=2.0) +Requires-Dist: itsdangerous (>=0.21) + +Flask +----- + +Flask is a microframework for Python based on Werkzeug, Jinja 2 and good +intentions. And before you ask: It's BSD licensed! + +Flask is Fun +```````````` + +Save in a hello.py: + +.. code:: python + + from flask import Flask + app = Flask(__name__) + + @app.route("/") + def hello(): + return "Hello World!" + + if __name__ == "__main__": + app.run() + +And Easy to Setup +````````````````` + +And run it: + +.. code:: bash + + $ pip install Flask + $ python hello.py + * Running on http://localhost:5000/ + + Ready for production? `Read this first `. + +Links +````` + +* `website `_ +* `documentation `_ +* `development version + `_ + + + diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/RECORD b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/RECORD new file mode 100644 index 000000000..750e2fad0 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/RECORD @@ -0,0 +1,52 @@ +Flask-0.12.2.dist-info/DESCRIPTION.rst,sha256=DmJm8IBlBjl3wkm0Ly23jYvWbvK_mCuE5oUseYCijbI,810 +Flask-0.12.2.dist-info/LICENSE.txt,sha256=hLgKluMRHSnxG-L0EmrqjmKgG5cHlff6pIh3rCNINeI,1582 +Flask-0.12.2.dist-info/METADATA,sha256=OgSkJQ_kmrz4qEkS-OzYtL75uZmXAThymkOcGR4kXRQ,1948 +Flask-0.12.2.dist-info/RECORD,, +Flask-0.12.2.dist-info/WHEEL,sha256=o2k-Qa-RMNIJmUdIc7KU6VWR_ErNRbWNlxDIpl7lm34,110 +Flask-0.12.2.dist-info/entry_points.txt,sha256=jzk2Wy2h30uEcqqzd4CVnlzsMXB-vaD5GXjuPMXmTmI,60 +Flask-0.12.2.dist-info/metadata.json,sha256=By8kZ1vY9lLEAGnRiWNBhudqKvLPo0HkZVXTYECyPKk,1389 +Flask-0.12.2.dist-info/top_level.txt,sha256=dvi65F6AeGWVU0TBpYiC04yM60-FX1gJFkK31IKQr5c,6 +flask/__init__.py,sha256=sHdK1v6WRbVmCN0fEv990EE7rOT2UlamQkSof2d0Dt0,1673 +flask/__main__.py,sha256=cldbNi5zpjE68XzIWI8uYHNWwBHHVJmwtlXWk6P4CO4,291 +flask/_compat.py,sha256=VlfjUuLjufsTHJIjr_ZsnnOesSbAXIslBBgRe5tfOok,2802 +flask/app.py,sha256=6DPjtb5jUJWgL5fXksG5boA49EB3l-k9pWyftitbNNk,83169 +flask/blueprints.py,sha256=6HVasMcPcaq7tk36kCrgX4bnhTkky4G5WIWCyyJL8HY,16872 +flask/cli.py,sha256=2NXEdCOu5-4ymklxX4Lf6bjb-89I4VHYeP6xScR3i8E,18328 +flask/config.py,sha256=Ym5Jenyu6zAZ1fdVLeKekY9-EsKmq8183qnRgauwCMY,9905 +flask/ctx.py,sha256=UPA0YwoIlHP0txOGanC9lQLSGv6eCqV5Fmw2cVJRmgQ,14739 +flask/debughelpers.py,sha256=z-uQavKIymOZl0WQDLXsnacA00ERIlCx3S3Tnb_OYsE,6024 +flask/exthook.py,sha256=SvXs5jwpcOjogwJ7SNquiWTxowoN1-MHFoqAejWnk2o,5762 +flask/globals.py,sha256=I3m_4RssLhWW1R11zuEI8oFryHUHX3NQwjMkGXOZzg8,1645 +flask/helpers.py,sha256=KrsQ2Yo3lOVHvBTgQCLvpubgmTOpQdTTyiCOOYlwDuQ,38452 +flask/json.py,sha256=1zPM-NPLiWoOfGd0P14FxnEkeKtjtUZxMC9pyYyDBYI,9183 +flask/logging.py,sha256=UG-77jPkRClk9w1B-_ArjjXPuj9AmZz9mG0IRGvptW0,2751 +flask/sessions.py,sha256=QBKXVYKJ-HKbx9m6Yb5yan_EPq84a5yevVLgAzNKFQY,14394 +flask/signals.py,sha256=MfZk5qTRj_R_O3aGYlTEnx2g3SvlZncz8Ii73eKK59g,2209 +flask/templating.py,sha256=u7FbN6j56H_q6CrdJJyJ6gZtqaMa0vh1_GP12gEHRQQ,4912 +flask/testing.py,sha256=II8EO_NjOT1LvL8Hh_SdIFL_BdlwVPcB9yot5pbltxE,5630 +flask/views.py,sha256=6OPv7gwu3h14JhqpeeMRWwrxoGHsUr4_nOGSyTRAxAI,5630 +flask/wrappers.py,sha256=1S_5mmuA1Tlx7D9lXV6xMblrg-PdAauNWahe-henMEE,7612 +flask/ext/__init__.py,sha256=UEezCApsG4ZJWqwUnX9YmWcNN4OVENgph_9L05n0eOM,842 +../../Scripts/flask.exe,sha256=WiosIiBPkig5ooCR_yaHUrP5WMPviLDqJxogDFixmOY,98150 +Flask-0.12.2.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 +flask/ext/__pycache__/__init__.cpython-36.pyc,, +flask/__pycache__/app.cpython-36.pyc,, +flask/__pycache__/blueprints.cpython-36.pyc,, +flask/__pycache__/cli.cpython-36.pyc,, +flask/__pycache__/config.cpython-36.pyc,, +flask/__pycache__/ctx.cpython-36.pyc,, +flask/__pycache__/debughelpers.cpython-36.pyc,, +flask/__pycache__/exthook.cpython-36.pyc,, +flask/__pycache__/globals.cpython-36.pyc,, +flask/__pycache__/helpers.cpython-36.pyc,, +flask/__pycache__/json.cpython-36.pyc,, +flask/__pycache__/logging.cpython-36.pyc,, +flask/__pycache__/sessions.cpython-36.pyc,, +flask/__pycache__/signals.cpython-36.pyc,, +flask/__pycache__/templating.cpython-36.pyc,, +flask/__pycache__/testing.cpython-36.pyc,, +flask/__pycache__/views.cpython-36.pyc,, +flask/__pycache__/wrappers.cpython-36.pyc,, +flask/__pycache__/_compat.cpython-36.pyc,, +flask/__pycache__/__init__.cpython-36.pyc,, +flask/__pycache__/__main__.cpython-36.pyc,, diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/WHEEL b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/WHEEL new file mode 100644 index 000000000..8b6dd1b5a --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.29.0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/entry_points.txt b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/entry_points.txt new file mode 100644 index 000000000..14adf18ab --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/entry_points.txt @@ -0,0 +1,4 @@ + + [console_scripts] + flask=flask.cli:main + \ No newline at end of file diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/metadata.json b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/metadata.json new file mode 100644 index 000000000..4d814b8b3 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/metadata.json @@ -0,0 +1 @@ +{"classifiers": ["Development Status :: 4 - Beta", "Environment :: Web Environment", "Intended Audience :: Developers", "License :: OSI Approved :: BSD License", "Operating System :: OS Independent", "Programming Language :: Python", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5", "Topic :: Internet :: WWW/HTTP :: Dynamic Content", "Topic :: Software Development :: Libraries :: Python Modules"], "extensions": {"python.commands": {"wrap_console": {"flask": "flask.cli:main"}}, "python.details": {"contacts": [{"email": "armin.ronacher@active-4.com", "name": "Armin Ronacher", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst", "license": "LICENSE.txt"}, "project_urls": {"Home": "http://github.com/pallets/flask/"}}, "python.exports": {"console_scripts": {"flask": "flask.cli:main"}}}, "extras": [], "generator": "bdist_wheel (0.29.0)", "license": "BSD", "metadata_version": "2.0", "name": "Flask", "platform": "any", "run_requires": [{"requires": ["Jinja2 (>=2.4)", "Werkzeug (>=0.7)", "click (>=2.0)", "itsdangerous (>=0.21)"]}], "summary": "A microframework based on Werkzeug, Jinja2 and good intentions", "version": "0.12.2"} \ No newline at end of file diff --git a/website/web/Lib/site-packages/Flask-0.12.2.dist-info/top_level.txt b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/top_level.txt new file mode 100644 index 000000000..7e1060246 --- /dev/null +++ b/website/web/Lib/site-packages/Flask-0.12.2.dist-info/top_level.txt @@ -0,0 +1 @@ +flask diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/PKG-INFO b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/PKG-INFO new file mode 100644 index 000000000..c7e3f5907 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/PKG-INFO @@ -0,0 +1,30 @@ +Metadata-Version: 1.1 +Name: Flask-OAuth +Version: 0.12 +Summary: Adds OAuth support to Flask +Home-page: http://github.com/mitsuhiko/flask-oauth +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: BSD +Description: + Flask-OAuth + ----------- + + Adds OAuth support to Flask. + + Links + ````` + + * `documentation `_ + * `development version + `_ + +Platform: any +Classifier: Development Status :: 4 - Beta +Classifier: Environment :: Web Environment +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Software Development :: Libraries :: Python Modules diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/SOURCES.txt b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/SOURCES.txt new file mode 100644 index 000000000..f12db5add --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/SOURCES.txt @@ -0,0 +1,10 @@ +README +flask_oauth.py +setup.cfg +setup.py +Flask_OAuth.egg-info/PKG-INFO +Flask_OAuth.egg-info/SOURCES.txt +Flask_OAuth.egg-info/dependency_links.txt +Flask_OAuth.egg-info/not-zip-safe +Flask_OAuth.egg-info/requires.txt +Flask_OAuth.egg-info/top_level.txt \ No newline at end of file diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/dependency_links.txt b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/dependency_links.txt new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/dependency_links.txt @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/installed-files.txt b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/installed-files.txt new file mode 100644 index 000000000..a20164513 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/installed-files.txt @@ -0,0 +1,8 @@ +..\flask_oauth.py +..\__pycache__\flask_oauth.cpython-36.pyc +dependency_links.txt +not-zip-safe +PKG-INFO +requires.txt +SOURCES.txt +top_level.txt diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/not-zip-safe b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/not-zip-safe new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/not-zip-safe @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/requires.txt b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/requires.txt new file mode 100644 index 000000000..b17522e93 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/requires.txt @@ -0,0 +1,2 @@ +Flask +oauth2 diff --git a/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/top_level.txt b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/top_level.txt new file mode 100644 index 000000000..b53f96d53 --- /dev/null +++ b/website/web/Lib/site-packages/Flask_OAuth-0.12-py3.6.egg-info/top_level.txt @@ -0,0 +1 @@ +flask_oauth diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/DESCRIPTION.rst b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/DESCRIPTION.rst new file mode 100644 index 000000000..1594da5ce --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/DESCRIPTION.rst @@ -0,0 +1,37 @@ + +Jinja2 +~~~~~~ + +Jinja2 is a template engine written in pure Python. It provides a +`Django`_ inspired non-XML syntax but supports inline expressions and +an optional `sandboxed`_ environment. + +Nutshell +-------- + +Here a small example of a Jinja template:: + + {% extends 'base.html' %} + {% block title %}Memberlist{% endblock %} + {% block content %} + + {% endblock %} + +Philosophy +---------- + +Application logic is for the controller but don't try to make the life +for the template designer too hard by giving him too few functionality. + +For more informations visit the new `Jinja2 webpage`_ and `documentation`_. + +.. _sandboxed: https://en.wikipedia.org/wiki/Sandbox_(computer_security) +.. _Django: https://www.djangoproject.com/ +.. _Jinja2 webpage: http://jinja.pocoo.org/ +.. _documentation: http://jinja.pocoo.org/2/documentation/ + + diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/INSTALLER b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/INSTALLER new file mode 100644 index 000000000..a1b589e38 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/LICENSE.txt b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/LICENSE.txt new file mode 100644 index 000000000..31bf900e5 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/LICENSE.txt @@ -0,0 +1,31 @@ +Copyright (c) 2009 by the Jinja Team, see AUTHORS for more details. + +Some rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + + * Redistributions of source code must retain the above copyright + notice, this list of conditions and the following disclaimer. + + * Redistributions in binary form must reproduce the above + copyright notice, this list of conditions and the following + disclaimer in the documentation and/or other materials provided + with the distribution. + + * The names of the contributors may not be used to endorse or + promote products derived from this software without specific + prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS +"AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT +LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR +A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT +OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, +SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT +LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, +DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY +THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/METADATA b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/METADATA new file mode 100644 index 000000000..40f2b46b4 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/METADATA @@ -0,0 +1,68 @@ +Metadata-Version: 2.0 +Name: Jinja2 +Version: 2.10 +Summary: A small but fast and easy to use stand-alone template engine written in pure python. +Home-page: http://jinja.pocoo.org/ +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: BSD +Description-Content-Type: UNKNOWN +Platform: UNKNOWN +Classifier: Development Status :: 5 - Production/Stable +Classifier: Environment :: Web Environment +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Software Development :: Libraries :: Python Modules +Classifier: Topic :: Text Processing :: Markup :: HTML +Requires-Dist: MarkupSafe (>=0.23) +Provides-Extra: i18n +Requires-Dist: Babel (>=0.8); extra == 'i18n' + + +Jinja2 +~~~~~~ + +Jinja2 is a template engine written in pure Python. It provides a +`Django`_ inspired non-XML syntax but supports inline expressions and +an optional `sandboxed`_ environment. + +Nutshell +-------- + +Here a small example of a Jinja template:: + + {% extends 'base.html' %} + {% block title %}Memberlist{% endblock %} + {% block content %} + + {% endblock %} + +Philosophy +---------- + +Application logic is for the controller but don't try to make the life +for the template designer too hard by giving him too few functionality. + +For more informations visit the new `Jinja2 webpage`_ and `documentation`_. + +.. _sandboxed: https://en.wikipedia.org/wiki/Sandbox_(computer_security) +.. _Django: https://www.djangoproject.com/ +.. _Jinja2 webpage: http://jinja.pocoo.org/ +.. _documentation: http://jinja.pocoo.org/2/documentation/ + + diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/RECORD b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/RECORD new file mode 100644 index 000000000..4bef2c1d5 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/RECORD @@ -0,0 +1,63 @@ +Jinja2-2.10.dist-info/DESCRIPTION.rst,sha256=b5ckFDoM7vVtz_mAsJD4OPteFKCqE7beu353g4COoYI,978 +Jinja2-2.10.dist-info/LICENSE.txt,sha256=JvzUNv3Io51EiWrAPm8d_SXjhJnEjyDYvB3Tvwqqils,1554 +Jinja2-2.10.dist-info/METADATA,sha256=18EgU8zR6-av-0-5y_gXebzK4GnBB_76lALUsl-6QHM,2258 +Jinja2-2.10.dist-info/RECORD,, +Jinja2-2.10.dist-info/WHEEL,sha256=kdsN-5OJAZIiHN-iO4Rhl82KyS0bDWf4uBwMbkNafr8,110 +Jinja2-2.10.dist-info/entry_points.txt,sha256=NdzVcOrqyNyKDxD09aERj__3bFx2paZhizFDsKmVhiA,72 +Jinja2-2.10.dist-info/metadata.json,sha256=NPUJ9TMBxVQAv_kTJzvU8HwmP-4XZvbK9mz6_4YUVl4,1473 +Jinja2-2.10.dist-info/top_level.txt,sha256=PkeVWtLb3-CqjWi1fO29OCbj55EhX_chhKrCdrVe_zs,7 +jinja2/__init__.py,sha256=xJHjaMoy51_KXn1wf0cysH6tUUifUxZCwSOfcJGEYZw,2614 +jinja2/_compat.py,sha256=xP60CE5Qr8FTYcDE1f54tbZLKGvMwYml4-8T7Q4KG9k,2596 +jinja2/_identifier.py,sha256=W1QBSY-iJsyt6oR_nKSuNNCzV95vLIOYgUNPUI1d5gU,1726 +jinja2/asyncfilters.py,sha256=cTDPvrS8Hp_IkwsZ1m9af_lr5nHysw7uTa5gV0NmZVE,4144 +jinja2/asyncsupport.py,sha256=UErQ3YlTLaSjFb94P4MVn08-aVD9jJxty2JVfMRb-1M,7878 +jinja2/bccache.py,sha256=nQldx0ZRYANMyfvOihRoYFKSlUdd5vJkS7BjxNwlOZM,12794 +jinja2/compiler.py,sha256=BqC5U6JxObSRhblyT_a6Tp5GtEU5z3US1a4jLQaxxgo,65386 +jinja2/constants.py,sha256=uwwV8ZUhHhacAuz5PTwckfsbqBaqM7aKfyJL7kGX5YQ,1626 +jinja2/debug.py,sha256=WTVeUFGUa4v6ReCsYv-iVPa3pkNB75OinJt3PfxNdXs,12045 +jinja2/defaults.py,sha256=Em-95hmsJxIenDCZFB1YSvf9CNhe9rBmytN3yUrBcWA,1400 +jinja2/environment.py,sha256=VnkAkqw8JbjZct4tAyHlpBrka2vqB-Z58RAP-32P1ZY,50849 +jinja2/exceptions.py,sha256=_Rj-NVi98Q6AiEjYQOsP8dEIdu5AlmRHzcSNOPdWix4,4428 +jinja2/ext.py,sha256=atMQydEC86tN1zUsdQiHw5L5cF62nDbqGue25Yiu3N4,24500 +jinja2/filters.py,sha256=yOAJk0MsH-_gEC0i0U6NweVQhbtYaC-uE8xswHFLF4w,36528 +jinja2/idtracking.py,sha256=2GbDSzIvGArEBGLkovLkqEfmYxmWsEf8c3QZwM4uNsw,9197 +jinja2/lexer.py,sha256=ySEPoXd1g7wRjsuw23uimS6nkGN5aqrYwcOKxCaVMBQ,28559 +jinja2/loaders.py,sha256=xiTuURKAEObyym0nU8PCIXu_Qp8fn0AJ5oIADUUm-5Q,17382 +jinja2/meta.py,sha256=fmKHxkmZYAOm9QyWWy8EMd6eefAIh234rkBMW2X4ZR8,4340 +jinja2/nativetypes.py,sha256=_sJhS8f-8Q0QMIC0dm1YEdLyxEyoO-kch8qOL5xUDfE,7308 +jinja2/nodes.py,sha256=L10L_nQDfubLhO3XjpF9qz46FSh2clL-3e49ogVlMmA,30853 +jinja2/optimizer.py,sha256=MsdlFACJ0FRdPtjmCAdt7JQ9SGrXFaDNUaslsWQaG3M,1722 +jinja2/parser.py,sha256=lPzTEbcpTRBLw8ii6OYyExHeAhaZLMA05Hpv4ll3ULk,35875 +jinja2/runtime.py,sha256=DHdD38Pq8gj7uWQC5usJyWFoNWL317A9AvXOW_CLB34,27755 +jinja2/sandbox.py,sha256=TVyZHlNqqTzsv9fv2NvJNmSdWRHTguhyMHdxjWms32U,16708 +jinja2/tests.py,sha256=iJQLwbapZr-EKquTG_fVOVdwHUUKf3SX9eNkjQDF8oU,4237 +jinja2/utils.py,sha256=q24VupGZotQ-uOyrJxCaXtDWhZC1RgsQG7kcdmjck2Q,20629 +jinja2/visitor.py,sha256=JD1H1cANA29JcntFfN5fPyqQxB4bI4wC00BzZa-XHks,3316 +Jinja2-2.10.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 +jinja2/__pycache__/asyncfilters.cpython-36.pyc,, +jinja2/__pycache__/asyncsupport.cpython-36.pyc,, +jinja2/__pycache__/bccache.cpython-36.pyc,, +jinja2/__pycache__/compiler.cpython-36.pyc,, +jinja2/__pycache__/constants.cpython-36.pyc,, +jinja2/__pycache__/debug.cpython-36.pyc,, +jinja2/__pycache__/defaults.cpython-36.pyc,, +jinja2/__pycache__/environment.cpython-36.pyc,, +jinja2/__pycache__/exceptions.cpython-36.pyc,, +jinja2/__pycache__/ext.cpython-36.pyc,, +jinja2/__pycache__/filters.cpython-36.pyc,, +jinja2/__pycache__/idtracking.cpython-36.pyc,, +jinja2/__pycache__/lexer.cpython-36.pyc,, +jinja2/__pycache__/loaders.cpython-36.pyc,, +jinja2/__pycache__/meta.cpython-36.pyc,, +jinja2/__pycache__/nativetypes.cpython-36.pyc,, +jinja2/__pycache__/nodes.cpython-36.pyc,, +jinja2/__pycache__/optimizer.cpython-36.pyc,, +jinja2/__pycache__/parser.cpython-36.pyc,, +jinja2/__pycache__/runtime.cpython-36.pyc,, +jinja2/__pycache__/sandbox.cpython-36.pyc,, +jinja2/__pycache__/tests.cpython-36.pyc,, +jinja2/__pycache__/utils.cpython-36.pyc,, +jinja2/__pycache__/visitor.cpython-36.pyc,, +jinja2/__pycache__/_compat.cpython-36.pyc,, +jinja2/__pycache__/_identifier.cpython-36.pyc,, +jinja2/__pycache__/__init__.cpython-36.pyc,, diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/WHEEL b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/WHEEL new file mode 100644 index 000000000..7332a419c --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.30.0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/entry_points.txt b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/entry_points.txt new file mode 100644 index 000000000..32e6b7530 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/entry_points.txt @@ -0,0 +1,4 @@ + + [babel.extractors] + jinja2 = jinja2.ext:babel_extract[i18n] + \ No newline at end of file diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/metadata.json b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/metadata.json new file mode 100644 index 000000000..7f5dc3879 --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/metadata.json @@ -0,0 +1 @@ +{"classifiers": ["Development Status :: 5 - Production/Stable", "Environment :: Web Environment", "Intended Audience :: Developers", "License :: OSI Approved :: BSD License", "Operating System :: OS Independent", "Programming Language :: Python", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5", "Programming Language :: Python :: 3.6", "Topic :: Internet :: WWW/HTTP :: Dynamic Content", "Topic :: Software Development :: Libraries :: Python Modules", "Topic :: Text Processing :: Markup :: HTML"], "description_content_type": "UNKNOWN", "extensions": {"python.details": {"contacts": [{"email": "armin.ronacher@active-4.com", "name": "Armin Ronacher", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst", "license": "LICENSE.txt"}, "project_urls": {"Home": "http://jinja.pocoo.org/"}}, "python.exports": {"babel.extractors": {"jinja2": "jinja2.ext:babel_extract [i18n]"}}}, "extras": ["i18n"], "generator": "bdist_wheel (0.30.0)", "license": "BSD", "metadata_version": "2.0", "name": "Jinja2", "run_requires": [{"extra": "i18n", "requires": ["Babel (>=0.8)"]}, {"requires": ["MarkupSafe (>=0.23)"]}], "summary": "A small but fast and easy to use stand-alone template engine written in pure python.", "version": "2.10"} \ No newline at end of file diff --git a/website/web/Lib/site-packages/Jinja2-2.10.dist-info/top_level.txt b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/top_level.txt new file mode 100644 index 000000000..7f7afbf3b --- /dev/null +++ b/website/web/Lib/site-packages/Jinja2-2.10.dist-info/top_level.txt @@ -0,0 +1 @@ +jinja2 diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/PKG-INFO b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/PKG-INFO new file mode 100644 index 000000000..6f2568f66 --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/PKG-INFO @@ -0,0 +1,133 @@ +Metadata-Version: 1.1 +Name: MarkupSafe +Version: 1.0 +Summary: Implements a XML/HTML/XHTML Markup safe string for Python +Home-page: http://github.com/pallets/markupsafe +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: BSD +Description: MarkupSafe + ========== + + Implements a unicode subclass that supports HTML strings: + + .. code-block:: python + + >>> from markupsafe import Markup, escape + >>> escape("") + Markup(u'<script>alert(document.cookie);</script>') + >>> tmpl = Markup("%s") + >>> tmpl % "Peter > Lustig" + Markup(u'Peter > Lustig') + + If you want to make an object unicode that is not yet unicode + but don't want to lose the taint information, you can use the + ``soft_unicode`` function. (On Python 3 you can also use ``soft_str`` which + is a different name for the same function). + + .. code-block:: python + + >>> from markupsafe import soft_unicode + >>> soft_unicode(42) + u'42' + >>> soft_unicode(Markup('foo')) + Markup(u'foo') + + HTML Representations + -------------------- + + Objects can customize their HTML markup equivalent by overriding + the ``__html__`` function: + + .. code-block:: python + + >>> class Foo(object): + ... def __html__(self): + ... return 'Nice' + ... + >>> escape(Foo()) + Markup(u'Nice') + >>> Markup(Foo()) + Markup(u'Nice') + + Silent Escapes + -------------- + + Since MarkupSafe 0.10 there is now also a separate escape function + called ``escape_silent`` that returns an empty string for ``None`` for + consistency with other systems that return empty strings for ``None`` + when escaping (for instance Pylons' webhelpers). + + If you also want to use this for the escape method of the Markup + object, you can create your own subclass that does that: + + .. code-block:: python + + from markupsafe import Markup, escape_silent as escape + + class SilentMarkup(Markup): + __slots__ = () + + @classmethod + def escape(cls, s): + return cls(escape(s)) + + New-Style String Formatting + --------------------------- + + Starting with MarkupSafe 0.21 new style string formats from Python 2.6 and + 3.x are now fully supported. Previously the escape behavior of those + functions was spotty at best. The new implementations operates under the + following algorithm: + + 1. if an object has an ``__html_format__`` method it is called as + replacement for ``__format__`` with the format specifier. It either + has to return a string or markup object. + 2. if an object has an ``__html__`` method it is called. + 3. otherwise the default format system of Python kicks in and the result + is HTML escaped. + + Here is how you can implement your own formatting: + + .. code-block:: python + + class User(object): + + def __init__(self, id, username): + self.id = id + self.username = username + + def __html_format__(self, format_spec): + if format_spec == 'link': + return Markup('{1}').format( + self.id, + self.__html__(), + ) + elif format_spec: + raise ValueError('Invalid format spec') + return self.__html__() + + def __html__(self): + return Markup('{0}').format(self.username) + + And to format that user: + + .. code-block:: python + + >>> user = User(1, 'foo') + >>> Markup('

User: {0:link}').format(user) + Markup(u'

User: foo') + + Markupsafe supports Python 2.6, 2.7 and Python 3.3 and higher. + +Platform: UNKNOWN +Classifier: Development Status :: 5 - Production/Stable +Classifier: Environment :: Web Environment +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 3 +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Software Development :: Libraries :: Python Modules +Classifier: Topic :: Text Processing :: Markup :: HTML diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/SOURCES.txt b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/SOURCES.txt new file mode 100644 index 000000000..210b339ce --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/SOURCES.txt @@ -0,0 +1,18 @@ +AUTHORS +CHANGES +LICENSE +MANIFEST.in +README.rst +setup.cfg +setup.py +tests.py +MarkupSafe.egg-info/PKG-INFO +MarkupSafe.egg-info/SOURCES.txt +MarkupSafe.egg-info/dependency_links.txt +MarkupSafe.egg-info/not-zip-safe +MarkupSafe.egg-info/top_level.txt +markupsafe/__init__.py +markupsafe/_compat.py +markupsafe/_constants.py +markupsafe/_native.py +markupsafe/_speedups.c \ No newline at end of file diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/dependency_links.txt b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/dependency_links.txt new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/dependency_links.txt @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/installed-files.txt b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/installed-files.txt new file mode 100644 index 000000000..6cdf040ee --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/installed-files.txt @@ -0,0 +1,15 @@ +..\markupsafe\_compat.py +..\markupsafe\_constants.py +..\markupsafe\_native.py +..\markupsafe\__init__.py +..\markupsafe\_speedups.c +..\markupsafe\__pycache__\_compat.cpython-36.pyc +..\markupsafe\__pycache__\_constants.cpython-36.pyc +..\markupsafe\__pycache__\_native.cpython-36.pyc +..\markupsafe\__pycache__\__init__.cpython-36.pyc +..\markupsafe\_speedups.cp36-win_amd64.pyd +dependency_links.txt +not-zip-safe +PKG-INFO +SOURCES.txt +top_level.txt diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/not-zip-safe b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/not-zip-safe new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/not-zip-safe @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/top_level.txt b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/top_level.txt new file mode 100644 index 000000000..75bf72925 --- /dev/null +++ b/website/web/Lib/site-packages/MarkupSafe-1.0-py3.6.egg-info/top_level.txt @@ -0,0 +1 @@ +markupsafe diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/DESCRIPTION.rst b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/DESCRIPTION.rst new file mode 100644 index 000000000..675f08d10 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/DESCRIPTION.rst @@ -0,0 +1,80 @@ +Werkzeug +======== + +Werkzeug is a comprehensive `WSGI`_ web application library. It began as +a simple collection of various utilities for WSGI applications and has +become one of the most advanced WSGI utility libraries. + +It includes: + +* An interactive debugger that allows inspecting stack traces and source + code in the browser with an interactive interpreter for any frame in + the stack. +* A full-featured request object with objects to interact with headers, + query args, form data, files, and cookies. +* A response object that can wrap other WSGI applications and handle + streaming data. +* A routing system for matching URLs to endpoints and generating URLs + for endpoints, with an extensible system for capturing variables from + URLs. +* HTTP utilities to handle entity tags, cache control, dates, user + agents, cookies, files, and more. +* A threaded WSGI server for use while developing applications locally. +* A test client for simulating HTTP requests during testing without + requiring running a server. + +Werkzeug is Unicode aware and doesn't enforce any dependencies. It is up +to the developer to choose a template engine, database adapter, and even +how to handle requests. It can be used to build all sorts of end user +applications such as blogs, wikis, or bulletin boards. + +`Flask`_ wraps Werkzeug, using it to handle the details of WSGI while +providing more structure and patterns for defining powerful +applications. + + +Installing +---------- + +Install and update using `pip`_: + +.. code-block:: text + + pip install -U Werkzeug + + +A Simple Example +---------------- + +.. code-block:: python + + from werkzeug.wrappers import Request, Response + + @Request.application + def application(request): + return Response('Hello, World!') + + if __name__ == '__main__': + from werkzeug.serving import run_simple + run_simple('localhost', 4000, application) + + +Links +----- + +* Website: https://www.palletsprojects.com/p/werkzeug/ +* Releases: https://pypi.org/project/Werkzeug/ +* Code: https://github.com/pallets/werkzeug +* Issue tracker: https://github.com/pallets/werkzeug/issues +* Test status: + + * Linux, Mac: https://travis-ci.org/pallets/werkzeug + * Windows: https://ci.appveyor.com/project/davidism/werkzeug + +* Test coverage: https://codecov.io/gh/pallets/werkzeug + +.. _WSGI: https://wsgi.readthedocs.io/en/latest/ +.. _Flask: https://www.palletsprojects.com/p/flask/ +.. _pip: https://pip.pypa.io/en/stable/quickstart/ + + diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/INSTALLER b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/INSTALLER new file mode 100644 index 000000000..a1b589e38 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/LICENSE.txt b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/LICENSE.txt new file mode 100644 index 000000000..1cc75bb0e --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/LICENSE.txt @@ -0,0 +1,31 @@ +Copyright © 2007 by the Pallets team. + +Some rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are +met: + +* Redistributions of source code must retain the above copyright notice, + this list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright + notice, this list of conditions and the following disclaimer in the + documentation and/or other materials provided with the distribution. + +* Neither the name of the copyright holder nor the names of its + contributors may be used to endorse or promote products derived from + this software without specific prior written permission. + +THIS SOFTWARE AND DOCUMENTATION IS PROVIDED BY THE COPYRIGHT HOLDERS AND +CONTRIBUTORS "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, +BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND +FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE +COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, +INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT +NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF +USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON +ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT +(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF +THIS SOFTWARE AND DOCUMENTATION, EVEN IF ADVISED OF THE POSSIBILITY OF +SUCH DAMAGE. diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/METADATA b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/METADATA new file mode 100644 index 000000000..bfc3c4e89 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/METADATA @@ -0,0 +1,116 @@ +Metadata-Version: 2.0 +Name: Werkzeug +Version: 0.14.1 +Summary: The comprehensive WSGI web application library. +Home-page: https://www.palletsprojects.org/p/werkzeug/ +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: BSD +Description-Content-Type: UNKNOWN +Platform: any +Classifier: Development Status :: 5 - Production/Stable +Classifier: Environment :: Web Environment +Classifier: Intended Audience :: Developers +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Software Development :: Libraries :: Python Modules +Provides-Extra: dev +Requires-Dist: coverage; extra == 'dev' +Requires-Dist: pytest; extra == 'dev' +Requires-Dist: sphinx; extra == 'dev' +Requires-Dist: tox; extra == 'dev' +Provides-Extra: termcolor +Requires-Dist: termcolor; extra == 'termcolor' +Provides-Extra: watchdog +Requires-Dist: watchdog; extra == 'watchdog' + +Werkzeug +======== + +Werkzeug is a comprehensive `WSGI`_ web application library. It began as +a simple collection of various utilities for WSGI applications and has +become one of the most advanced WSGI utility libraries. + +It includes: + +* An interactive debugger that allows inspecting stack traces and source + code in the browser with an interactive interpreter for any frame in + the stack. +* A full-featured request object with objects to interact with headers, + query args, form data, files, and cookies. +* A response object that can wrap other WSGI applications and handle + streaming data. +* A routing system for matching URLs to endpoints and generating URLs + for endpoints, with an extensible system for capturing variables from + URLs. +* HTTP utilities to handle entity tags, cache control, dates, user + agents, cookies, files, and more. +* A threaded WSGI server for use while developing applications locally. +* A test client for simulating HTTP requests during testing without + requiring running a server. + +Werkzeug is Unicode aware and doesn't enforce any dependencies. It is up +to the developer to choose a template engine, database adapter, and even +how to handle requests. It can be used to build all sorts of end user +applications such as blogs, wikis, or bulletin boards. + +`Flask`_ wraps Werkzeug, using it to handle the details of WSGI while +providing more structure and patterns for defining powerful +applications. + + +Installing +---------- + +Install and update using `pip`_: + +.. code-block:: text + + pip install -U Werkzeug + + +A Simple Example +---------------- + +.. code-block:: python + + from werkzeug.wrappers import Request, Response + + @Request.application + def application(request): + return Response('Hello, World!') + + if __name__ == '__main__': + from werkzeug.serving import run_simple + run_simple('localhost', 4000, application) + + +Links +----- + +* Website: https://www.palletsprojects.com/p/werkzeug/ +* Releases: https://pypi.org/project/Werkzeug/ +* Code: https://github.com/pallets/werkzeug +* Issue tracker: https://github.com/pallets/werkzeug/issues +* Test status: + + * Linux, Mac: https://travis-ci.org/pallets/werkzeug + * Windows: https://ci.appveyor.com/project/davidism/werkzeug + +* Test coverage: https://codecov.io/gh/pallets/werkzeug + +.. _WSGI: https://wsgi.readthedocs.io/en/latest/ +.. _Flask: https://www.palletsprojects.com/p/flask/ +.. _pip: https://pip.pypa.io/en/stable/quickstart/ + + diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/RECORD b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/RECORD new file mode 100644 index 000000000..357d9b772 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/RECORD @@ -0,0 +1,97 @@ +Werkzeug-0.14.1.dist-info/DESCRIPTION.rst,sha256=rOCN36jwsWtWsTpqPG96z7FMilB5qI1CIARSKRuUmz8,2452 +Werkzeug-0.14.1.dist-info/LICENSE.txt,sha256=xndz_dD4m269AF9l_Xbl5V3tM1N3C1LoZC2PEPxWO-8,1534 +Werkzeug-0.14.1.dist-info/METADATA,sha256=FbfadrPdJNUWAxMOKxGUtHe5R3IDSBKYYmAz3FvI3uY,3872 +Werkzeug-0.14.1.dist-info/RECORD,, +Werkzeug-0.14.1.dist-info/WHEEL,sha256=GrqQvamwgBV4nLoJe0vhYRSWzWsx7xjlt74FT0SWYfE,110 +Werkzeug-0.14.1.dist-info/metadata.json,sha256=4489UTt6HBp2NQil95-pBkjU4Je93SMHvMxZ_rjOpqA,1452 +Werkzeug-0.14.1.dist-info/top_level.txt,sha256=QRyj2VjwJoQkrwjwFIOlB8Xg3r9un0NtqVHQF-15xaw,9 +werkzeug/__init__.py,sha256=NR0d4n_-U9BLVKlOISean3zUt2vBwhvK-AZE6M0sC0k,6842 +werkzeug/_compat.py,sha256=8c4U9o6A_TR9nKCcTbpZNxpqCXcXDVIbFawwKM2s92c,6311 +werkzeug/_internal.py,sha256=GhEyGMlsSz_tYjsDWO9TG35VN7304MM8gjKDrXLEdVc,13873 +werkzeug/_reloader.py,sha256=AyPphcOHPbu6qzW0UbrVvTDJdre5WgpxbhIJN_TqzUc,9264 +werkzeug/datastructures.py,sha256=3IgNKNqrz-ZjmAG7y3YgEYK-enDiMT_b652PsypWcYg,90080 +werkzeug/exceptions.py,sha256=3wp95Hqj9FqV8MdikV99JRcHse_fSMn27V8tgP5Hw2c,20505 +werkzeug/filesystem.py,sha256=hHWeWo_gqLMzTRfYt8-7n2wWcWUNTnDyudQDLOBEICE,2175 +werkzeug/formparser.py,sha256=mUuCwjzjb8_E4RzrAT2AioLuZSYpqR1KXTK6LScRYzA,21722 +werkzeug/http.py,sha256=RQg4MJuhRv2isNRiEh__Phh09ebpfT3Kuu_GfrZ54_c,40079 +werkzeug/local.py,sha256=QdQhWV5L8p1Y1CJ1CDStwxaUs24SuN5aebHwjVD08C8,14553 +werkzeug/posixemulation.py,sha256=xEF2Bxc-vUCPkiu4IbfWVd3LW7DROYAT-ExW6THqyzw,3519 +werkzeug/routing.py,sha256=2JVtdSgxKGeANy4Z_FP-dKESvKtkYGCZ1J2fARCLGCY,67214 +werkzeug/script.py,sha256=DwaVDcXdaOTffdNvlBdLitxWXjKaRVT32VbhDtljFPY,11365 +werkzeug/security.py,sha256=0m107exslz4QJLWQCpfQJ04z3re4eGHVggRvrQVAdWc,9193 +werkzeug/serving.py,sha256=A0flnIJHufdn2QJ9oeuHfrXwP3LzP8fn3rNW6hbxKUg,31926 +werkzeug/test.py,sha256=XmECSmnpASiYQTct4oMiWr0LT5jHWCtKqnpYKZd2ui8,36100 +werkzeug/testapp.py,sha256=3HQRW1sHZKXuAjCvFMet4KXtQG3loYTFnvn6LWt-4zI,9396 +werkzeug/urls.py,sha256=dUeLg2IeTm0WLmSvFeD4hBZWGdOs-uHudR5-t8n9zPo,36771 +werkzeug/useragents.py,sha256=BhYMf4cBTHyN4U0WsQedePIocmNlH_34C-UwqSThGCc,5865 +werkzeug/utils.py,sha256=BrY1j0DHQ8RTb0K1StIobKuMJhN9SQQkWEARbrh2qpk,22972 +werkzeug/websocket.py,sha256=PpSeDxXD_0UsPAa5hQhQNM6mxibeUgn8lA8eRqiS0vM,11344 +werkzeug/wrappers.py,sha256=kbyL_aFjxELwPgMwfNCYjKu-CR6kNkh-oO8wv3GXbk8,84511 +werkzeug/wsgi.py,sha256=1Nob-aeChWQf7MsiicO8RZt6J90iRzEcik44ev9Qu8s,49347 +werkzeug/contrib/__init__.py,sha256=f7PfttZhbrImqpr5Ezre8CXgwvcGUJK7zWNpO34WWrw,623 +werkzeug/contrib/atom.py,sha256=qqfJcfIn2RYY-3hO3Oz0aLq9YuNubcPQ_KZcNsDwVJo,15575 +werkzeug/contrib/cache.py,sha256=xBImHNj09BmX_7kC5NUCx8f_l4L8_O7zi0jCL21UZKE,32163 +werkzeug/contrib/fixers.py,sha256=gR06T-w71ur-tHQ_31kP_4jpOncPJ4Wc1dOqTvYusr8,10179 +werkzeug/contrib/iterio.py,sha256=RlqDvGhz0RneTpzE8dVc-yWCUv4nkPl1jEc_EDp2fH0,10814 +werkzeug/contrib/jsrouting.py,sha256=QTmgeDoKXvNK02KzXgx9lr3cAH6fAzpwF5bBdPNvJPs,8564 +werkzeug/contrib/limiter.py,sha256=iS8-ahPZ-JLRnmfIBzxpm7O_s3lPsiDMVWv7llAIDCI,1334 +werkzeug/contrib/lint.py,sha256=Mj9NeUN7s4zIUWeQOAVjrmtZIcl3Mm2yDe9BSIr9YGE,12558 +werkzeug/contrib/profiler.py,sha256=ISwCWvwVyGpDLRBRpLjo_qUWma6GXYBrTAco4PEQSHY,5151 +werkzeug/contrib/securecookie.py,sha256=uWMyHDHY3lkeBRiCSayGqWkAIy4a7xAbSE_Hln9ecqc,12196 +werkzeug/contrib/sessions.py,sha256=39LVNvLbm5JWpbxM79WC2l87MJFbqeISARjwYbkJatw,12577 +werkzeug/contrib/testtools.py,sha256=G9xN-qeihJlhExrIZMCahvQOIDxdL9NiX874jiiHFMs,2453 +werkzeug/contrib/wrappers.py,sha256=v7OYlz7wQtDlS9fey75UiRZ1IkUWqCpzbhsLy4k14Hw,10398 +werkzeug/debug/__init__.py,sha256=uSn9BqCZ5E3ySgpoZtundpROGsn-uYvZtSFiTfAX24M,17452 +werkzeug/debug/console.py,sha256=n3-dsKk1TsjnN-u4ZgmuWCU_HO0qw5IA7ttjhyyMM6I,5607 +werkzeug/debug/repr.py,sha256=bKqstDYGfECpeLerd48s_hxuqK4b6UWnjMu3d_DHO8I,9340 +werkzeug/debug/tbtools.py,sha256=rBudXCmkVdAKIcdhxANxgf09g6kQjJWW9_5bjSpr4OY,18451 +werkzeug/debug/shared/FONT_LICENSE,sha256=LwAVEI1oYnvXiNMT9SnCH_TaLCxCpeHziDrMg0gPkAI,4673 +werkzeug/debug/shared/console.png,sha256=bxax6RXXlvOij_KeqvSNX0ojJf83YbnZ7my-3Gx9w2A,507 +werkzeug/debug/shared/debugger.js,sha256=PKPVYuyO4SX1hkqLOwCLvmIEO5154WatFYaXE-zIfKI,6264 +werkzeug/debug/shared/jquery.js,sha256=7LkWEzqTdpEfELxcZZlS6wAx5Ff13zZ83lYO2_ujj7g,95957 +werkzeug/debug/shared/less.png,sha256=-4-kNRaXJSONVLahrQKUxMwXGm9R4OnZ9SxDGpHlIR4,191 +werkzeug/debug/shared/more.png,sha256=GngN7CioHQoV58rH6ojnkYi8c_qED2Aka5FO5UXrReY,200 +werkzeug/debug/shared/source.png,sha256=RoGcBTE4CyCB85GBuDGTFlAnUqxwTBiIfDqW15EpnUQ,818 +werkzeug/debug/shared/style.css,sha256=IEO0PC2pWmh2aEyGCaN--txuWsRCliuhlbEhPDFwh0A,6270 +werkzeug/debug/shared/ubuntu.ttf,sha256=1eaHFyepmy4FyDvjLVzpITrGEBu_CZYY94jE0nED1c0,70220 +Werkzeug-0.14.1.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 +werkzeug/contrib/__pycache__/atom.cpython-36.pyc,, +werkzeug/contrib/__pycache__/cache.cpython-36.pyc,, +werkzeug/contrib/__pycache__/fixers.cpython-36.pyc,, +werkzeug/contrib/__pycache__/iterio.cpython-36.pyc,, +werkzeug/contrib/__pycache__/jsrouting.cpython-36.pyc,, +werkzeug/contrib/__pycache__/limiter.cpython-36.pyc,, +werkzeug/contrib/__pycache__/lint.cpython-36.pyc,, +werkzeug/contrib/__pycache__/profiler.cpython-36.pyc,, +werkzeug/contrib/__pycache__/securecookie.cpython-36.pyc,, +werkzeug/contrib/__pycache__/sessions.cpython-36.pyc,, +werkzeug/contrib/__pycache__/testtools.cpython-36.pyc,, +werkzeug/contrib/__pycache__/wrappers.cpython-36.pyc,, +werkzeug/contrib/__pycache__/__init__.cpython-36.pyc,, +werkzeug/debug/__pycache__/console.cpython-36.pyc,, +werkzeug/debug/__pycache__/repr.cpython-36.pyc,, +werkzeug/debug/__pycache__/tbtools.cpython-36.pyc,, +werkzeug/debug/__pycache__/__init__.cpython-36.pyc,, +werkzeug/__pycache__/datastructures.cpython-36.pyc,, +werkzeug/__pycache__/exceptions.cpython-36.pyc,, +werkzeug/__pycache__/filesystem.cpython-36.pyc,, +werkzeug/__pycache__/formparser.cpython-36.pyc,, +werkzeug/__pycache__/http.cpython-36.pyc,, +werkzeug/__pycache__/local.cpython-36.pyc,, +werkzeug/__pycache__/posixemulation.cpython-36.pyc,, +werkzeug/__pycache__/routing.cpython-36.pyc,, +werkzeug/__pycache__/script.cpython-36.pyc,, +werkzeug/__pycache__/security.cpython-36.pyc,, +werkzeug/__pycache__/serving.cpython-36.pyc,, +werkzeug/__pycache__/test.cpython-36.pyc,, +werkzeug/__pycache__/testapp.cpython-36.pyc,, +werkzeug/__pycache__/urls.cpython-36.pyc,, +werkzeug/__pycache__/useragents.cpython-36.pyc,, +werkzeug/__pycache__/utils.cpython-36.pyc,, +werkzeug/__pycache__/websocket.cpython-36.pyc,, +werkzeug/__pycache__/wrappers.cpython-36.pyc,, +werkzeug/__pycache__/wsgi.cpython-36.pyc,, +werkzeug/__pycache__/_compat.cpython-36.pyc,, +werkzeug/__pycache__/_internal.cpython-36.pyc,, +werkzeug/__pycache__/_reloader.cpython-36.pyc,, +werkzeug/__pycache__/__init__.cpython-36.pyc,, diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/WHEEL b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/WHEEL new file mode 100644 index 000000000..0de529b1e --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.26.0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/metadata.json b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/metadata.json new file mode 100644 index 000000000..bca8d1262 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/metadata.json @@ -0,0 +1 @@ +{"generator": "bdist_wheel (0.26.0)", "summary": "The comprehensive WSGI web application library.", "classifiers": ["Development Status :: 5 - Production/Stable", "Environment :: Web Environment", "Intended Audience :: Developers", "License :: OSI Approved :: BSD License", "Operating System :: OS Independent", "Programming Language :: Python", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5", "Programming Language :: Python :: 3.6", "Topic :: Internet :: WWW/HTTP :: Dynamic Content", "Topic :: Software Development :: Libraries :: Python Modules"], "description_content_type": "UNKNOWN", "extensions": {"python.details": {"project_urls": {"Home": "https://www.palletsprojects.org/p/werkzeug/"}, "contacts": [{"email": "armin.ronacher@active-4.com", "name": "Armin Ronacher", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst", "license": "LICENSE.txt"}}}, "license": "BSD", "metadata_version": "2.0", "name": "Werkzeug", "platform": "any", "extras": ["dev", "termcolor", "watchdog"], "run_requires": [{"requires": ["coverage", "pytest", "sphinx", "tox"], "extra": "dev"}, {"requires": ["termcolor"], "extra": "termcolor"}, {"requires": ["watchdog"], "extra": "watchdog"}], "version": "0.14.1"} \ No newline at end of file diff --git a/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/top_level.txt b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/top_level.txt new file mode 100644 index 000000000..6fe8da849 --- /dev/null +++ b/website/web/Lib/site-packages/Werkzeug-0.14.1.dist-info/top_level.txt @@ -0,0 +1 @@ +werkzeug diff --git a/website/web/Lib/site-packages/_cffi_backend.cp36-win_amd64.pyd b/website/web/Lib/site-packages/_cffi_backend.cp36-win_amd64.pyd new file mode 100644 index 000000000..f87d64670 Binary files /dev/null and b/website/web/Lib/site-packages/_cffi_backend.cp36-win_amd64.pyd differ diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/DESCRIPTION.rst b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/DESCRIPTION.rst new file mode 100644 index 000000000..ef4aa7bb3 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/DESCRIPTION.rst @@ -0,0 +1,13 @@ + +CFFI +==== + +Foreign Function Interface for Python calling C code. +Please see the `Documentation `_. + +Contact +------- + +`Mailing list `_ + + diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/INSTALLER b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/INSTALLER new file mode 100644 index 000000000..a1b589e38 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/METADATA b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/METADATA new file mode 100644 index 000000000..549dfe5e4 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/METADATA @@ -0,0 +1,37 @@ +Metadata-Version: 2.0 +Name: cffi +Version: 1.11.4 +Summary: Foreign Function Interface for Python calling C code. +Home-page: http://cffi.readthedocs.org +Author: Armin Rigo, Maciej Fijalkowski +Author-email: python-cffi@googlegroups.com +License: MIT +Description-Content-Type: UNKNOWN +Platform: UNKNOWN +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.2 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Programming Language :: Python :: Implementation :: CPython +Classifier: Programming Language :: Python :: Implementation :: PyPy +Requires-Dist: pycparser + + +CFFI +==== + +Foreign Function Interface for Python calling C code. +Please see the `Documentation `_. + +Contact +------- + +`Mailing list `_ + + diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/RECORD b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/RECORD new file mode 100644 index 000000000..54d4939de --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/RECORD @@ -0,0 +1,43 @@ +_cffi_backend.cp36-win_amd64.pyd,sha256=likuFoX9C7Qi1bfHpJJHzKgOXmWFdXIN1IbPCbmO7bc,170496 +cffi/__init__.py,sha256=mewOsqyqnxYpvL3XfQFIRYyxcoW2ic60hMResP7gdJM,479 +cffi/_cffi_errors.h,sha256=NLNuKgpRUJ4x0ku4pi-Pe1vT1mzovxBTeHjPZTxCB7U,3804 +cffi/_cffi_include.h,sha256=JuFfmwpRE65vym3Nxr9vDMOIEuv21tXdarkL1l2WNms,12149 +cffi/_embedding.h,sha256=iSs9APxG4SDy_ahlyV1s46_lvWdVBxnuOwaEBN5jOUg,17643 +cffi/api.py,sha256=eUXlc8fTxiS3PjpfBU3sMi8gVgeG4yIsPA6teyNWehI,40221 +cffi/backend_ctypes.py,sha256=XxMfz3Kn_QZhvLLqNXmIL_Z9M8CGlGAa1YWtH6k8wYQ,42086 +cffi/cffi_opcode.py,sha256=v9RdD_ovA8rCtqsC95Ivki5V667rAOhGgs3fb2q9xpM,5724 +cffi/commontypes.py,sha256=QS4uxCDI7JhtTyjh1hlnCA-gynmaszWxJaRRLGkJa1A,2689 +cffi/cparser.py,sha256=R0_gdB8vL1YNf-W5G_5KvV1pOTnZwvuLeioaDvODI6c,39250 +cffi/error.py,sha256=L_J76qbh6LSxH4A64muOUwJKL6zVHC32E3gG1ntUM-A,666 +cffi/ffiplatform.py,sha256=HMXqR8ks2wtdsNxGaWpQ_PyqIvtiuos_vf1qKCy-cwg,4046 +cffi/lock.py,sha256=l9TTdwMIMpi6jDkJGnQgE9cvTIR7CAntIJr8EGHt3pY,747 +cffi/model.py,sha256=-ZXCFO_EPbX3zN3ecx4H2rR0MZZA16ZwldDuv3CzJXU,21495 +cffi/parse_c_type.h,sha256=OdwQfwM9ktq6vlCB43exFQmxDBtj2MBNdK8LYl15tjw,5976 +cffi/recompiler.py,sha256=4qpl0bOTaegsWJbaCvjtRh4q6KH5hWZurnKK1YGEeRk,63092 +cffi/setuptools_ext.py,sha256=6K2HJn-qNTQL-FvILZCH0T90MR6FVelFClL4f8ZCWaQ,7682 +cffi/vengine_cpy.py,sha256=hdyjjZNijLrg_uGMnnFyC-7GG_LxWtwB8BlS2vvVDQ0,41470 +cffi/vengine_gen.py,sha256=Zkq0-EdeZwn6qUvf_CI8iUEs2UxVIvDmKCH1j0-y0GI,26676 +cffi/verifier.py,sha256=J9Enz2rbJb9CHPqWlWQ5uQESoyr0uc7MNWugchjXBv4,11207 +cffi-1.11.4.dist-info/DESCRIPTION.rst,sha256=9ijQLbcqTWNF-iV0RznFiBeBCNrjArA0P-eutKUPw98,220 +cffi-1.11.4.dist-info/METADATA,sha256=uiGWsWy8zEb_-R4-vMutpELIrBKsvCV-_soHfZNjUaw,1174 +cffi-1.11.4.dist-info/RECORD,, +cffi-1.11.4.dist-info/WHEEL,sha256=3o6dJ54ci-MtRFdJCPkLCK5G-vO7QSv3lIQ-NrhglGk,106 +cffi-1.11.4.dist-info/entry_points.txt,sha256=Q9f5C9IpjYxo0d2PK9eUcnkgxHc9pHWwjEMaANPKNCI,76 +cffi-1.11.4.dist-info/metadata.json,sha256=8S4WNSCRPXo6P__ARsF2aUGV0Drrh82dQQxr9Xsj9vw,1192 +cffi-1.11.4.dist-info/top_level.txt,sha256=rE7WR3rZfNKxWI9-jn6hsHCAl7MDkB-FmuQbxWjFehQ,19 +cffi-1.11.4.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 +cffi/__pycache__/api.cpython-36.pyc,, +cffi/__pycache__/backend_ctypes.cpython-36.pyc,, +cffi/__pycache__/cffi_opcode.cpython-36.pyc,, +cffi/__pycache__/commontypes.cpython-36.pyc,, +cffi/__pycache__/cparser.cpython-36.pyc,, +cffi/__pycache__/error.cpython-36.pyc,, +cffi/__pycache__/ffiplatform.cpython-36.pyc,, +cffi/__pycache__/lock.cpython-36.pyc,, +cffi/__pycache__/model.cpython-36.pyc,, +cffi/__pycache__/recompiler.cpython-36.pyc,, +cffi/__pycache__/setuptools_ext.cpython-36.pyc,, +cffi/__pycache__/vengine_cpy.cpython-36.pyc,, +cffi/__pycache__/vengine_gen.cpython-36.pyc,, +cffi/__pycache__/verifier.cpython-36.pyc,, +cffi/__pycache__/__init__.cpython-36.pyc,, diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/WHEEL b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/WHEEL new file mode 100644 index 000000000..2be04293c --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/WHEEL @@ -0,0 +1,5 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.30.0) +Root-Is-Purelib: false +Tag: cp36-cp36m-win_amd64 + diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/entry_points.txt b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/entry_points.txt new file mode 100644 index 000000000..eee7e0fb1 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/entry_points.txt @@ -0,0 +1,3 @@ +[distutils.setup_keywords] +cffi_modules = cffi.setuptools_ext:cffi_modules + diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/metadata.json b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/metadata.json new file mode 100644 index 000000000..76e93d287 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/metadata.json @@ -0,0 +1 @@ +{"classifiers": ["Programming Language :: Python", "Programming Language :: Python :: 2", "Programming Language :: Python :: 2.6", "Programming Language :: Python :: 2.7", "Programming Language :: Python :: 3", "Programming Language :: Python :: 3.2", "Programming Language :: Python :: 3.3", "Programming Language :: Python :: 3.4", "Programming Language :: Python :: 3.5", "Programming Language :: Python :: 3.6", "Programming Language :: Python :: Implementation :: CPython", "Programming Language :: Python :: Implementation :: PyPy"], "description_content_type": "UNKNOWN", "extensions": {"python.details": {"contacts": [{"email": "python-cffi@googlegroups.com", "name": "Armin Rigo, Maciej Fijalkowski", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst"}, "project_urls": {"Home": "http://cffi.readthedocs.org"}}, "python.exports": {"distutils.setup_keywords": {"cffi_modules": "cffi.setuptools_ext:cffi_modules"}}}, "extras": [], "generator": "bdist_wheel (0.30.0)", "license": "MIT", "metadata_version": "2.0", "name": "cffi", "run_requires": [{"requires": ["pycparser"]}], "summary": "Foreign Function Interface for Python calling C code.", "version": "1.11.4"} \ No newline at end of file diff --git a/website/web/Lib/site-packages/cffi-1.11.4.dist-info/top_level.txt b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/top_level.txt new file mode 100644 index 000000000..f64577957 --- /dev/null +++ b/website/web/Lib/site-packages/cffi-1.11.4.dist-info/top_level.txt @@ -0,0 +1,2 @@ +_cffi_backend +cffi diff --git a/website/web/Lib/site-packages/cffi/__init__.py b/website/web/Lib/site-packages/cffi/__init__.py new file mode 100644 index 000000000..519a6fa42 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/__init__.py @@ -0,0 +1,13 @@ +__all__ = ['FFI', 'VerificationError', 'VerificationMissing', 'CDefError', + 'FFIError'] + +from .api import FFI +from .error import CDefError, FFIError, VerificationError, VerificationMissing + +__version__ = "1.11.4" +__version_info__ = (1, 11, 4) + +# The verifier module file names are based on the CRC32 of a string that +# contains the following version number. It may be older than __version__ +# if nothing is clearly incompatible. +__version_verifier_modules__ = "0.8.6" diff --git a/website/web/Lib/site-packages/cffi/_cffi_errors.h b/website/web/Lib/site-packages/cffi/_cffi_errors.h new file mode 100644 index 000000000..60dcc3b86 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/_cffi_errors.h @@ -0,0 +1,145 @@ +#ifndef CFFI_MESSAGEBOX +# ifdef _MSC_VER +# define CFFI_MESSAGEBOX 1 +# else +# define CFFI_MESSAGEBOX 0 +# endif +#endif + + +#if CFFI_MESSAGEBOX +/* Windows only: logic to take the Python-CFFI embedding logic + initialization errors and display them in a background thread + with MessageBox. The idea is that if the whole program closes + as a result of this problem, then likely it is already a console + program and you can read the stderr output in the console too. + If it is not a console program, then it will likely show its own + dialog to complain, or generally not abruptly close, and for this + case the background thread should stay alive. +*/ +static void *volatile _cffi_bootstrap_text; + +static PyObject *_cffi_start_error_capture(void) +{ + PyObject *result = NULL; + PyObject *x, *m, *bi; + + if (InterlockedCompareExchangePointer(&_cffi_bootstrap_text, + (void *)1, NULL) != NULL) + return (PyObject *)1; + + m = PyImport_AddModule("_cffi_error_capture"); + if (m == NULL) + goto error; + + result = PyModule_GetDict(m); + if (result == NULL) + goto error; + +#if PY_MAJOR_VERSION >= 3 + bi = PyImport_ImportModule("builtins"); +#else + bi = PyImport_ImportModule("__builtin__"); +#endif + if (bi == NULL) + goto error; + PyDict_SetItemString(result, "__builtins__", bi); + Py_DECREF(bi); + + x = PyRun_String( + "import sys\n" + "class FileLike:\n" + " def write(self, x):\n" + " of.write(x)\n" + " self.buf += x\n" + "fl = FileLike()\n" + "fl.buf = ''\n" + "of = sys.stderr\n" + "sys.stderr = fl\n" + "def done():\n" + " sys.stderr = of\n" + " return fl.buf\n", /* make sure the returned value stays alive */ + Py_file_input, + result, result); + Py_XDECREF(x); + + error: + if (PyErr_Occurred()) + { + PyErr_WriteUnraisable(Py_None); + PyErr_Clear(); + } + return result; +} + +#pragma comment(lib, "user32.lib") + +static DWORD WINAPI _cffi_bootstrap_dialog(LPVOID ignored) +{ + Sleep(666); /* may be interrupted if the whole process is closing */ +#if PY_MAJOR_VERSION >= 3 + MessageBoxW(NULL, (wchar_t *)_cffi_bootstrap_text, + L"Python-CFFI error", + MB_OK | MB_ICONERROR); +#else + MessageBoxA(NULL, (char *)_cffi_bootstrap_text, + "Python-CFFI error", + MB_OK | MB_ICONERROR); +#endif + _cffi_bootstrap_text = NULL; + return 0; +} + +static void _cffi_stop_error_capture(PyObject *ecap) +{ + PyObject *s; + void *text; + + if (ecap == (PyObject *)1) + return; + + if (ecap == NULL) + goto error; + + s = PyRun_String("done()", Py_eval_input, ecap, ecap); + if (s == NULL) + goto error; + + /* Show a dialog box, but in a background thread, and + never show multiple dialog boxes at once. */ +#if PY_MAJOR_VERSION >= 3 + text = PyUnicode_AsWideCharString(s, NULL); +#else + text = PyString_AsString(s); +#endif + + _cffi_bootstrap_text = text; + + if (text != NULL) + { + HANDLE h; + h = CreateThread(NULL, 0, _cffi_bootstrap_dialog, + NULL, 0, NULL); + if (h != NULL) + CloseHandle(h); + } + /* decref the string, but it should stay alive as 'fl.buf' + in the small module above. It will really be freed only if + we later get another similar error. So it's a leak of at + most one copy of the small module. That's fine for this + situation which is usually a "fatal error" anyway. */ + Py_DECREF(s); + PyErr_Clear(); + return; + + error: + _cffi_bootstrap_text = NULL; + PyErr_Clear(); +} + +#else + +static PyObject *_cffi_start_error_capture(void) { return NULL; } +static void _cffi_stop_error_capture(PyObject *ecap) { } + +#endif diff --git a/website/web/Lib/site-packages/cffi/_cffi_include.h b/website/web/Lib/site-packages/cffi/_cffi_include.h new file mode 100644 index 000000000..37ea74feb --- /dev/null +++ b/website/web/Lib/site-packages/cffi/_cffi_include.h @@ -0,0 +1,308 @@ +#define _CFFI_ + +/* We try to define Py_LIMITED_API before including Python.h. + + Mess: we can only define it if Py_DEBUG, Py_TRACE_REFS and + Py_REF_DEBUG are not defined. This is a best-effort approximation: + we can learn about Py_DEBUG from pyconfig.h, but it is unclear if + the same works for the other two macros. Py_DEBUG implies them, + but not the other way around. + + Issue #350 is still open: on Windows, the code here causes it to link + with PYTHON36.DLL (for example) instead of PYTHON3.DLL. A fix was + attempted in 164e526a5515 and 14ce6985e1c3, but reverted: virtualenv + does not make PYTHON3.DLL available, and so the "correctly" compiled + version would not run inside a virtualenv. We will re-apply the fix + after virtualenv has been fixed for some time. For explanation, see + issue #355. For a workaround if you want PYTHON3.DLL and don't worry + about virtualenv, see issue #350. See also 'py_limited_api' in + setuptools_ext.py. +*/ +#if !defined(_CFFI_USE_EMBEDDING) && !defined(Py_LIMITED_API) +# include +# if !defined(Py_DEBUG) && !defined(Py_TRACE_REFS) && !defined(Py_REF_DEBUG) +# define Py_LIMITED_API +# endif +#endif + +#include +#ifdef __cplusplus +extern "C" { +#endif +#include +#include "parse_c_type.h" + +/* this block of #ifs should be kept exactly identical between + c/_cffi_backend.c, cffi/vengine_cpy.py, cffi/vengine_gen.py + and cffi/_cffi_include.h */ +#if defined(_MSC_VER) +# include /* for alloca() */ +# if _MSC_VER < 1600 /* MSVC < 2010 */ + typedef __int8 int8_t; + typedef __int16 int16_t; + typedef __int32 int32_t; + typedef __int64 int64_t; + typedef unsigned __int8 uint8_t; + typedef unsigned __int16 uint16_t; + typedef unsigned __int32 uint32_t; + typedef unsigned __int64 uint64_t; + typedef __int8 int_least8_t; + typedef __int16 int_least16_t; + typedef __int32 int_least32_t; + typedef __int64 int_least64_t; + typedef unsigned __int8 uint_least8_t; + typedef unsigned __int16 uint_least16_t; + typedef unsigned __int32 uint_least32_t; + typedef unsigned __int64 uint_least64_t; + typedef __int8 int_fast8_t; + typedef __int16 int_fast16_t; + typedef __int32 int_fast32_t; + typedef __int64 int_fast64_t; + typedef unsigned __int8 uint_fast8_t; + typedef unsigned __int16 uint_fast16_t; + typedef unsigned __int32 uint_fast32_t; + typedef unsigned __int64 uint_fast64_t; + typedef __int64 intmax_t; + typedef unsigned __int64 uintmax_t; +# else +# include +# endif +# if _MSC_VER < 1800 /* MSVC < 2013 */ +# ifndef __cplusplus + typedef unsigned char _Bool; +# endif +# endif +#else +# include +# if (defined (__SVR4) && defined (__sun)) || defined(_AIX) || defined(__hpux) +# include +# endif +#endif + +#ifdef __GNUC__ +# define _CFFI_UNUSED_FN __attribute__((unused)) +#else +# define _CFFI_UNUSED_FN /* nothing */ +#endif + +#ifdef __cplusplus +# ifndef _Bool + typedef bool _Bool; /* semi-hackish: C++ has no _Bool; bool is builtin */ +# endif +#endif + +/********** CPython-specific section **********/ +#ifndef PYPY_VERSION + + +#if PY_MAJOR_VERSION >= 3 +# define PyInt_FromLong PyLong_FromLong +#endif + +#define _cffi_from_c_double PyFloat_FromDouble +#define _cffi_from_c_float PyFloat_FromDouble +#define _cffi_from_c_long PyInt_FromLong +#define _cffi_from_c_ulong PyLong_FromUnsignedLong +#define _cffi_from_c_longlong PyLong_FromLongLong +#define _cffi_from_c_ulonglong PyLong_FromUnsignedLongLong +#define _cffi_from_c__Bool PyBool_FromLong + +#define _cffi_to_c_double PyFloat_AsDouble +#define _cffi_to_c_float PyFloat_AsDouble + +#define _cffi_from_c_int(x, type) \ + (((type)-1) > 0 ? /* unsigned */ \ + (sizeof(type) < sizeof(long) ? \ + PyInt_FromLong((long)x) : \ + sizeof(type) == sizeof(long) ? \ + PyLong_FromUnsignedLong((unsigned long)x) : \ + PyLong_FromUnsignedLongLong((unsigned long long)x)) : \ + (sizeof(type) <= sizeof(long) ? \ + PyInt_FromLong((long)x) : \ + PyLong_FromLongLong((long long)x))) + +#define _cffi_to_c_int(o, type) \ + ((type)( \ + sizeof(type) == 1 ? (((type)-1) > 0 ? (type)_cffi_to_c_u8(o) \ + : (type)_cffi_to_c_i8(o)) : \ + sizeof(type) == 2 ? (((type)-1) > 0 ? (type)_cffi_to_c_u16(o) \ + : (type)_cffi_to_c_i16(o)) : \ + sizeof(type) == 4 ? (((type)-1) > 0 ? (type)_cffi_to_c_u32(o) \ + : (type)_cffi_to_c_i32(o)) : \ + sizeof(type) == 8 ? (((type)-1) > 0 ? (type)_cffi_to_c_u64(o) \ + : (type)_cffi_to_c_i64(o)) : \ + (Py_FatalError("unsupported size for type " #type), (type)0))) + +#define _cffi_to_c_i8 \ + ((int(*)(PyObject *))_cffi_exports[1]) +#define _cffi_to_c_u8 \ + ((int(*)(PyObject *))_cffi_exports[2]) +#define _cffi_to_c_i16 \ + ((int(*)(PyObject *))_cffi_exports[3]) +#define _cffi_to_c_u16 \ + ((int(*)(PyObject *))_cffi_exports[4]) +#define _cffi_to_c_i32 \ + ((int(*)(PyObject *))_cffi_exports[5]) +#define _cffi_to_c_u32 \ + ((unsigned int(*)(PyObject *))_cffi_exports[6]) +#define _cffi_to_c_i64 \ + ((long long(*)(PyObject *))_cffi_exports[7]) +#define _cffi_to_c_u64 \ + ((unsigned long long(*)(PyObject *))_cffi_exports[8]) +#define _cffi_to_c_char \ + ((int(*)(PyObject *))_cffi_exports[9]) +#define _cffi_from_c_pointer \ + ((PyObject *(*)(char *, struct _cffi_ctypedescr *))_cffi_exports[10]) +#define _cffi_to_c_pointer \ + ((char *(*)(PyObject *, struct _cffi_ctypedescr *))_cffi_exports[11]) +#define _cffi_get_struct_layout \ + not used any more +#define _cffi_restore_errno \ + ((void(*)(void))_cffi_exports[13]) +#define _cffi_save_errno \ + ((void(*)(void))_cffi_exports[14]) +#define _cffi_from_c_char \ + ((PyObject *(*)(char))_cffi_exports[15]) +#define _cffi_from_c_deref \ + ((PyObject *(*)(char *, struct _cffi_ctypedescr *))_cffi_exports[16]) +#define _cffi_to_c \ + ((int(*)(char *, struct _cffi_ctypedescr *, PyObject *))_cffi_exports[17]) +#define _cffi_from_c_struct \ + ((PyObject *(*)(char *, struct _cffi_ctypedescr *))_cffi_exports[18]) +#define _cffi_to_c_wchar_t \ + ((_cffi_wchar_t(*)(PyObject *))_cffi_exports[19]) +#define _cffi_from_c_wchar_t \ + ((PyObject *(*)(_cffi_wchar_t))_cffi_exports[20]) +#define _cffi_to_c_long_double \ + ((long double(*)(PyObject *))_cffi_exports[21]) +#define _cffi_to_c__Bool \ + ((_Bool(*)(PyObject *))_cffi_exports[22]) +#define _cffi_prepare_pointer_call_argument \ + ((Py_ssize_t(*)(struct _cffi_ctypedescr *, \ + PyObject *, char **))_cffi_exports[23]) +#define _cffi_convert_array_from_object \ + ((int(*)(char *, struct _cffi_ctypedescr *, PyObject *))_cffi_exports[24]) +#define _CFFI_CPIDX 25 +#define _cffi_call_python \ + ((void(*)(struct _cffi_externpy_s *, char *))_cffi_exports[_CFFI_CPIDX]) +#define _cffi_to_c_wchar3216_t \ + ((int(*)(PyObject *))_cffi_exports[26]) +#define _cffi_from_c_wchar3216_t \ + ((PyObject *(*)(int))_cffi_exports[27]) +#define _CFFI_NUM_EXPORTS 28 + +struct _cffi_ctypedescr; + +static void *_cffi_exports[_CFFI_NUM_EXPORTS]; + +#define _cffi_type(index) ( \ + assert((((uintptr_t)_cffi_types[index]) & 1) == 0), \ + (struct _cffi_ctypedescr *)_cffi_types[index]) + +static PyObject *_cffi_init(const char *module_name, Py_ssize_t version, + const struct _cffi_type_context_s *ctx) +{ + PyObject *module, *o_arg, *new_module; + void *raw[] = { + (void *)module_name, + (void *)version, + (void *)_cffi_exports, + (void *)ctx, + }; + + module = PyImport_ImportModule("_cffi_backend"); + if (module == NULL) + goto failure; + + o_arg = PyLong_FromVoidPtr((void *)raw); + if (o_arg == NULL) + goto failure; + + new_module = PyObject_CallMethod( + module, (char *)"_init_cffi_1_0_external_module", (char *)"O", o_arg); + + Py_DECREF(o_arg); + Py_DECREF(module); + return new_module; + + failure: + Py_XDECREF(module); + return NULL; +} + + +#ifdef HAVE_WCHAR_H +typedef wchar_t _cffi_wchar_t; +#else +typedef uint16_t _cffi_wchar_t; /* same random pick as _cffi_backend.c */ +#endif + +_CFFI_UNUSED_FN static uint16_t _cffi_to_c_char16_t(PyObject *o) +{ + if (sizeof(_cffi_wchar_t) == 2) + return (uint16_t)_cffi_to_c_wchar_t(o); + else + return (uint16_t)_cffi_to_c_wchar3216_t(o); +} + +_CFFI_UNUSED_FN static PyObject *_cffi_from_c_char16_t(uint16_t x) +{ + if (sizeof(_cffi_wchar_t) == 2) + return _cffi_from_c_wchar_t((_cffi_wchar_t)x); + else + return _cffi_from_c_wchar3216_t((int)x); +} + +_CFFI_UNUSED_FN static int _cffi_to_c_char32_t(PyObject *o) +{ + if (sizeof(_cffi_wchar_t) == 4) + return (int)_cffi_to_c_wchar_t(o); + else + return (int)_cffi_to_c_wchar3216_t(o); +} + +_CFFI_UNUSED_FN static PyObject *_cffi_from_c_char32_t(int x) +{ + if (sizeof(_cffi_wchar_t) == 4) + return _cffi_from_c_wchar_t((_cffi_wchar_t)x); + else + return _cffi_from_c_wchar3216_t(x); +} + + +/********** end CPython-specific section **********/ +#else +_CFFI_UNUSED_FN +static void (*_cffi_call_python_org)(struct _cffi_externpy_s *, char *); +# define _cffi_call_python _cffi_call_python_org +#endif + + +#define _cffi_array_len(array) (sizeof(array) / sizeof((array)[0])) + +#define _cffi_prim_int(size, sign) \ + ((size) == 1 ? ((sign) ? _CFFI_PRIM_INT8 : _CFFI_PRIM_UINT8) : \ + (size) == 2 ? ((sign) ? _CFFI_PRIM_INT16 : _CFFI_PRIM_UINT16) : \ + (size) == 4 ? ((sign) ? _CFFI_PRIM_INT32 : _CFFI_PRIM_UINT32) : \ + (size) == 8 ? ((sign) ? _CFFI_PRIM_INT64 : _CFFI_PRIM_UINT64) : \ + _CFFI__UNKNOWN_PRIM) + +#define _cffi_prim_float(size) \ + ((size) == sizeof(float) ? _CFFI_PRIM_FLOAT : \ + (size) == sizeof(double) ? _CFFI_PRIM_DOUBLE : \ + (size) == sizeof(long double) ? _CFFI__UNKNOWN_LONG_DOUBLE : \ + _CFFI__UNKNOWN_FLOAT_PRIM) + +#define _cffi_check_int(got, got_nonpos, expected) \ + ((got_nonpos) == (expected <= 0) && \ + (got) == (unsigned long long)expected) + +#ifdef MS_WIN32 +# define _cffi_stdcall __stdcall +#else +# define _cffi_stdcall /* nothing */ +#endif + +#ifdef __cplusplus +} +#endif diff --git a/website/web/Lib/site-packages/cffi/_embedding.h b/website/web/Lib/site-packages/cffi/_embedding.h new file mode 100644 index 000000000..2b744dfa5 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/_embedding.h @@ -0,0 +1,536 @@ + +/***** Support code for embedding *****/ + +#ifdef __cplusplus +extern "C" { +#endif + + +#if defined(_WIN32) +# define CFFI_DLLEXPORT __declspec(dllexport) +#elif defined(__GNUC__) +# define CFFI_DLLEXPORT __attribute__((visibility("default"))) +#else +# define CFFI_DLLEXPORT /* nothing */ +#endif + + +/* There are two global variables of type _cffi_call_python_fnptr: + + * _cffi_call_python, which we declare just below, is the one called + by ``extern "Python"`` implementations. + + * _cffi_call_python_org, which on CPython is actually part of the + _cffi_exports[] array, is the function pointer copied from + _cffi_backend. + + After initialization is complete, both are equal. However, the + first one remains equal to &_cffi_start_and_call_python until the + very end of initialization, when we are (or should be) sure that + concurrent threads also see a completely initialized world, and + only then is it changed. +*/ +#undef _cffi_call_python +typedef void (*_cffi_call_python_fnptr)(struct _cffi_externpy_s *, char *); +static void _cffi_start_and_call_python(struct _cffi_externpy_s *, char *); +static _cffi_call_python_fnptr _cffi_call_python = &_cffi_start_and_call_python; + + +#ifndef _MSC_VER + /* --- Assuming a GCC not infinitely old --- */ +# define cffi_compare_and_swap(l,o,n) __sync_bool_compare_and_swap(l,o,n) +# define cffi_write_barrier() __sync_synchronize() +# if !defined(__amd64__) && !defined(__x86_64__) && \ + !defined(__i386__) && !defined(__i386) +# define cffi_read_barrier() __sync_synchronize() +# else +# define cffi_read_barrier() (void)0 +# endif +#else + /* --- Windows threads version --- */ +# include +# define cffi_compare_and_swap(l,o,n) \ + (InterlockedCompareExchangePointer(l,n,o) == (o)) +# define cffi_write_barrier() InterlockedCompareExchange(&_cffi_dummy,0,0) +# define cffi_read_barrier() (void)0 +static volatile LONG _cffi_dummy; +#endif + +#ifdef WITH_THREAD +# ifndef _MSC_VER +# include + static pthread_mutex_t _cffi_embed_startup_lock; +# else + static CRITICAL_SECTION _cffi_embed_startup_lock; +# endif + static char _cffi_embed_startup_lock_ready = 0; +#endif + +static void _cffi_acquire_reentrant_mutex(void) +{ + static void *volatile lock = NULL; + + while (!cffi_compare_and_swap(&lock, NULL, (void *)1)) { + /* should ideally do a spin loop instruction here, but + hard to do it portably and doesn't really matter I + think: pthread_mutex_init() should be very fast, and + this is only run at start-up anyway. */ + } + +#ifdef WITH_THREAD + if (!_cffi_embed_startup_lock_ready) { +# ifndef _MSC_VER + pthread_mutexattr_t attr; + pthread_mutexattr_init(&attr); + pthread_mutexattr_settype(&attr, PTHREAD_MUTEX_RECURSIVE); + pthread_mutex_init(&_cffi_embed_startup_lock, &attr); +# else + InitializeCriticalSection(&_cffi_embed_startup_lock); +# endif + _cffi_embed_startup_lock_ready = 1; + } +#endif + + while (!cffi_compare_and_swap(&lock, (void *)1, NULL)) + ; + +#ifndef _MSC_VER + pthread_mutex_lock(&_cffi_embed_startup_lock); +#else + EnterCriticalSection(&_cffi_embed_startup_lock); +#endif +} + +static void _cffi_release_reentrant_mutex(void) +{ +#ifndef _MSC_VER + pthread_mutex_unlock(&_cffi_embed_startup_lock); +#else + LeaveCriticalSection(&_cffi_embed_startup_lock); +#endif +} + + +/********** CPython-specific section **********/ +#ifndef PYPY_VERSION + +#include "_cffi_errors.h" + + +#define _cffi_call_python_org _cffi_exports[_CFFI_CPIDX] + +PyMODINIT_FUNC _CFFI_PYTHON_STARTUP_FUNC(void); /* forward */ + +static void _cffi_py_initialize(void) +{ + /* XXX use initsigs=0, which "skips initialization registration of + signal handlers, which might be useful when Python is + embedded" according to the Python docs. But review and think + if it should be a user-controllable setting. + + XXX we should also give a way to write errors to a buffer + instead of to stderr. + + XXX if importing 'site' fails, CPython (any version) calls + exit(). Should we try to work around this behavior here? + */ + Py_InitializeEx(0); +} + +static int _cffi_initialize_python(void) +{ + /* This initializes Python, imports _cffi_backend, and then the + present .dll/.so is set up as a CPython C extension module. + */ + int result; + PyGILState_STATE state; + PyObject *pycode=NULL, *global_dict=NULL, *x; + +#if PY_MAJOR_VERSION >= 3 + /* see comments in _cffi_carefully_make_gil() about the + Python2/Python3 difference + */ +#else + /* Acquire the GIL. We have no threadstate here. If Python is + already initialized, it is possible that there is already one + existing for this thread, but it is not made current now. + */ + PyEval_AcquireLock(); + + _cffi_py_initialize(); + + /* The Py_InitializeEx() sometimes made a threadstate for us, but + not always. Indeed Py_InitializeEx() could be called and do + nothing. So do we have a threadstate, or not? We don't know, + but we can replace it with NULL in all cases. + */ + (void)PyThreadState_Swap(NULL); + + /* Now we can release the GIL and re-acquire immediately using the + logic of PyGILState(), which handles making or installing the + correct threadstate. + */ + PyEval_ReleaseLock(); +#endif + state = PyGILState_Ensure(); + + /* Call the initxxx() function from the present module. It will + create and initialize us as a CPython extension module, instead + of letting the startup Python code do it---it might reimport + the same .dll/.so and get maybe confused on some platforms. + It might also have troubles locating the .dll/.so again for all + I know. + */ + (void)_CFFI_PYTHON_STARTUP_FUNC(); + if (PyErr_Occurred()) + goto error; + + /* Now run the Python code provided to ffi.embedding_init_code(). + */ + pycode = Py_CompileString(_CFFI_PYTHON_STARTUP_CODE, + "", + Py_file_input); + if (pycode == NULL) + goto error; + global_dict = PyDict_New(); + if (global_dict == NULL) + goto error; + if (PyDict_SetItemString(global_dict, "__builtins__", + PyThreadState_GET()->interp->builtins) < 0) + goto error; + x = PyEval_EvalCode( +#if PY_MAJOR_VERSION < 3 + (PyCodeObject *) +#endif + pycode, global_dict, global_dict); + if (x == NULL) + goto error; + Py_DECREF(x); + + /* Done! Now if we've been called from + _cffi_start_and_call_python() in an ``extern "Python"``, we can + only hope that the Python code did correctly set up the + corresponding @ffi.def_extern() function. Otherwise, the + general logic of ``extern "Python"`` functions (inside the + _cffi_backend module) will find that the reference is still + missing and print an error. + */ + result = 0; + done: + Py_XDECREF(pycode); + Py_XDECREF(global_dict); + PyGILState_Release(state); + return result; + + error:; + { + /* Print as much information as potentially useful. + Debugging load-time failures with embedding is not fun + */ + PyObject *ecap; + PyObject *exception, *v, *tb, *f, *modules, *mod; + PyErr_Fetch(&exception, &v, &tb); + ecap = _cffi_start_error_capture(); + f = PySys_GetObject((char *)"stderr"); + if (f != NULL && f != Py_None) { + PyFile_WriteString( + "Failed to initialize the Python-CFFI embedding logic:\n\n", f); + } + + if (exception != NULL) { + PyErr_NormalizeException(&exception, &v, &tb); + PyErr_Display(exception, v, tb); + } + Py_XDECREF(exception); + Py_XDECREF(v); + Py_XDECREF(tb); + + if (f != NULL && f != Py_None) { + PyFile_WriteString("\nFrom: " _CFFI_MODULE_NAME + "\ncompiled with cffi version: 1.11.4" + "\n_cffi_backend module: ", f); + modules = PyImport_GetModuleDict(); + mod = PyDict_GetItemString(modules, "_cffi_backend"); + if (mod == NULL) { + PyFile_WriteString("not loaded", f); + } + else { + v = PyObject_GetAttrString(mod, "__file__"); + PyFile_WriteObject(v, f, 0); + Py_XDECREF(v); + } + PyFile_WriteString("\nsys.path: ", f); + PyFile_WriteObject(PySys_GetObject((char *)"path"), f, 0); + PyFile_WriteString("\n\n", f); + } + _cffi_stop_error_capture(ecap); + } + result = -1; + goto done; +} + +PyAPI_DATA(char *) _PyParser_TokenNames[]; /* from CPython */ + +static int _cffi_carefully_make_gil(void) +{ + /* This does the basic initialization of Python. It can be called + completely concurrently from unrelated threads. It assumes + that we don't hold the GIL before (if it exists), and we don't + hold it afterwards. + + What it really does is completely different in Python 2 and + Python 3. + + Python 2 + ======== + + Initialize the GIL, without initializing the rest of Python, + by calling PyEval_InitThreads(). + + PyEval_InitThreads() must not be called concurrently at all. + So we use a global variable as a simple spin lock. This global + variable must be from 'libpythonX.Y.so', not from this + cffi-based extension module, because it must be shared from + different cffi-based extension modules. We choose + _PyParser_TokenNames[0] as a completely arbitrary pointer value + that is never written to. The default is to point to the + string "ENDMARKER". We change it temporarily to point to the + next character in that string. (Yes, I know it's REALLY + obscure.) + + Python 3 + ======== + + In Python 3, PyEval_InitThreads() cannot be called before + Py_InitializeEx() any more. So this function calls + Py_InitializeEx() first. It uses the same obscure logic to + make sure we never call it concurrently. + + Arguably, this is less good on the spinlock, because + Py_InitializeEx() takes much longer to run than + PyEval_InitThreads(). But I didn't find a way around it. + */ + +#ifdef WITH_THREAD + char *volatile *lock = (char *volatile *)_PyParser_TokenNames; + char *old_value; + + while (1) { /* spin loop */ + old_value = *lock; + if (old_value[0] == 'E') { + assert(old_value[1] == 'N'); + if (cffi_compare_and_swap(lock, old_value, old_value + 1)) + break; + } + else { + assert(old_value[0] == 'N'); + /* should ideally do a spin loop instruction here, but + hard to do it portably and doesn't really matter I + think: PyEval_InitThreads() should be very fast, and + this is only run at start-up anyway. */ + } + } +#endif + +#if PY_MAJOR_VERSION >= 3 + /* Python 3: call Py_InitializeEx() */ + { + PyGILState_STATE state = PyGILState_UNLOCKED; + if (!Py_IsInitialized()) + _cffi_py_initialize(); + else + state = PyGILState_Ensure(); + + PyEval_InitThreads(); + PyGILState_Release(state); + } +#else + /* Python 2: call PyEval_InitThreads() */ +# ifdef WITH_THREAD + if (!PyEval_ThreadsInitialized()) { + PyEval_InitThreads(); /* makes the GIL */ + PyEval_ReleaseLock(); /* then release it */ + } + /* else: there is already a GIL, but we still needed to do the + spinlock dance to make sure that we see it as fully ready */ +# endif +#endif + +#ifdef WITH_THREAD + /* release the lock */ + while (!cffi_compare_and_swap(lock, old_value + 1, old_value)) + ; +#endif + + return 0; +} + +/********** end CPython-specific section **********/ + + +#else + + +/********** PyPy-specific section **********/ + +PyMODINIT_FUNC _CFFI_PYTHON_STARTUP_FUNC(const void *[]); /* forward */ + +static struct _cffi_pypy_init_s { + const char *name; + void (*func)(const void *[]); + const char *code; +} _cffi_pypy_init = { + _CFFI_MODULE_NAME, + (void(*)(const void *[]))_CFFI_PYTHON_STARTUP_FUNC, + _CFFI_PYTHON_STARTUP_CODE, +}; + +extern int pypy_carefully_make_gil(const char *); +extern int pypy_init_embedded_cffi_module(int, struct _cffi_pypy_init_s *); + +static int _cffi_carefully_make_gil(void) +{ + return pypy_carefully_make_gil(_CFFI_MODULE_NAME); +} + +static int _cffi_initialize_python(void) +{ + return pypy_init_embedded_cffi_module(0xB011, &_cffi_pypy_init); +} + +/********** end PyPy-specific section **********/ + + +#endif + + +#ifdef __GNUC__ +__attribute__((noinline)) +#endif +static _cffi_call_python_fnptr _cffi_start_python(void) +{ + /* Delicate logic to initialize Python. This function can be + called multiple times concurrently, e.g. when the process calls + its first ``extern "Python"`` functions in multiple threads at + once. It can also be called recursively, in which case we must + ignore it. We also have to consider what occurs if several + different cffi-based extensions reach this code in parallel + threads---it is a different copy of the code, then, and we + can't have any shared global variable unless it comes from + 'libpythonX.Y.so'. + + Idea: + + * _cffi_carefully_make_gil(): "carefully" call + PyEval_InitThreads() (possibly with Py_InitializeEx() first). + + * then we use a (local) custom lock to make sure that a call to this + cffi-based extension will wait if another call to the *same* + extension is running the initialization in another thread. + It is reentrant, so that a recursive call will not block, but + only one from a different thread. + + * then we grab the GIL and (Python 2) we call Py_InitializeEx(). + At this point, concurrent calls to Py_InitializeEx() are not + possible: we have the GIL. + + * do the rest of the specific initialization, which may + temporarily release the GIL but not the custom lock. + Only release the custom lock when we are done. + */ + static char called = 0; + + if (_cffi_carefully_make_gil() != 0) + return NULL; + + _cffi_acquire_reentrant_mutex(); + + /* Here the GIL exists, but we don't have it. We're only protected + from concurrency by the reentrant mutex. */ + + /* This file only initializes the embedded module once, the first + time this is called, even if there are subinterpreters. */ + if (!called) { + called = 1; /* invoke _cffi_initialize_python() only once, + but don't set '_cffi_call_python' right now, + otherwise concurrent threads won't call + this function at all (we need them to wait) */ + if (_cffi_initialize_python() == 0) { + /* now initialization is finished. Switch to the fast-path. */ + + /* We would like nobody to see the new value of + '_cffi_call_python' without also seeing the rest of the + data initialized. However, this is not possible. But + the new value of '_cffi_call_python' is the function + 'cffi_call_python()' from _cffi_backend. So: */ + cffi_write_barrier(); + /* ^^^ we put a write barrier here, and a corresponding + read barrier at the start of cffi_call_python(). This + ensures that after that read barrier, we see everything + done here before the write barrier. + */ + + assert(_cffi_call_python_org != NULL); + _cffi_call_python = (_cffi_call_python_fnptr)_cffi_call_python_org; + } + else { + /* initialization failed. Reset this to NULL, even if it was + already set to some other value. Future calls to + _cffi_start_python() are still forced to occur, and will + always return NULL from now on. */ + _cffi_call_python_org = NULL; + } + } + + _cffi_release_reentrant_mutex(); + + return (_cffi_call_python_fnptr)_cffi_call_python_org; +} + +static +void _cffi_start_and_call_python(struct _cffi_externpy_s *externpy, char *args) +{ + _cffi_call_python_fnptr fnptr; + int current_err = errno; +#ifdef _MSC_VER + int current_lasterr = GetLastError(); +#endif + fnptr = _cffi_start_python(); + if (fnptr == NULL) { + fprintf(stderr, "function %s() called, but initialization code " + "failed. Returning 0.\n", externpy->name); + memset(args, 0, externpy->size_of_result); + } +#ifdef _MSC_VER + SetLastError(current_lasterr); +#endif + errno = current_err; + + if (fnptr != NULL) + fnptr(externpy, args); +} + + +/* The cffi_start_python() function makes sure Python is initialized + and our cffi module is set up. It can be called manually from the + user C code. The same effect is obtained automatically from any + dll-exported ``extern "Python"`` function. This function returns + -1 if initialization failed, 0 if all is OK. */ +_CFFI_UNUSED_FN +static int cffi_start_python(void) +{ + if (_cffi_call_python == &_cffi_start_and_call_python) { + if (_cffi_start_python() == NULL) + return -1; + } + cffi_read_barrier(); + return 0; +} + +#undef cffi_compare_and_swap +#undef cffi_write_barrier +#undef cffi_read_barrier + +#ifdef __cplusplus +} +#endif diff --git a/website/web/Lib/site-packages/cffi/api.py b/website/web/Lib/site-packages/cffi/api.py new file mode 100644 index 000000000..446e55481 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/api.py @@ -0,0 +1,925 @@ +import sys, types +from .lock import allocate_lock +from .error import CDefError +from . import model + +try: + callable +except NameError: + # Python 3.1 + from collections import Callable + callable = lambda x: isinstance(x, Callable) + +try: + basestring +except NameError: + # Python 3.x + basestring = str + + + +class FFI(object): + r''' + The main top-level class that you instantiate once, or once per module. + + Example usage: + + ffi = FFI() + ffi.cdef(""" + int printf(const char *, ...); + """) + + C = ffi.dlopen(None) # standard library + -or- + C = ffi.verify() # use a C compiler: verify the decl above is right + + C.printf("hello, %s!\n", ffi.new("char[]", "world")) + ''' + + def __init__(self, backend=None): + """Create an FFI instance. The 'backend' argument is used to + select a non-default backend, mostly for tests. + """ + if backend is None: + # You need PyPy (>= 2.0 beta), or a CPython (>= 2.6) with + # _cffi_backend.so compiled. + import _cffi_backend as backend + from . import __version__ + if backend.__version__ != __version__: + # bad version! Try to be as explicit as possible. + if hasattr(backend, '__file__'): + # CPython + raise Exception("Version mismatch: this is the 'cffi' package version %s, located in %r. When we import the top-level '_cffi_backend' extension module, we get version %s, located in %r. The two versions should be equal; check your installation." % ( + __version__, __file__, + backend.__version__, backend.__file__)) + else: + # PyPy + raise Exception("Version mismatch: this is the 'cffi' package version %s, located in %r. This interpreter comes with a built-in '_cffi_backend' module, which is version %s. The two versions should be equal; check your installation." % ( + __version__, __file__, backend.__version__)) + # (If you insist you can also try to pass the option + # 'backend=backend_ctypes.CTypesBackend()', but don't + # rely on it! It's probably not going to work well.) + + from . import cparser + self._backend = backend + self._lock = allocate_lock() + self._parser = cparser.Parser() + self._cached_btypes = {} + self._parsed_types = types.ModuleType('parsed_types').__dict__ + self._new_types = types.ModuleType('new_types').__dict__ + self._function_caches = [] + self._libraries = [] + self._cdefsources = [] + self._included_ffis = [] + self._windows_unicode = None + self._init_once_cache = {} + self._cdef_version = None + self._embedding = None + self._typecache = model.get_typecache(backend) + if hasattr(backend, 'set_ffi'): + backend.set_ffi(self) + for name in list(backend.__dict__): + if name.startswith('RTLD_'): + setattr(self, name, getattr(backend, name)) + # + with self._lock: + self.BVoidP = self._get_cached_btype(model.voidp_type) + self.BCharA = self._get_cached_btype(model.char_array_type) + if isinstance(backend, types.ModuleType): + # _cffi_backend: attach these constants to the class + if not hasattr(FFI, 'NULL'): + FFI.NULL = self.cast(self.BVoidP, 0) + FFI.CData, FFI.CType = backend._get_types() + else: + # ctypes backend: attach these constants to the instance + self.NULL = self.cast(self.BVoidP, 0) + self.CData, self.CType = backend._get_types() + self.buffer = backend.buffer + + def cdef(self, csource, override=False, packed=False): + """Parse the given C source. This registers all declared functions, + types, and global variables. The functions and global variables can + then be accessed via either 'ffi.dlopen()' or 'ffi.verify()'. + The types can be used in 'ffi.new()' and other functions. + If 'packed' is specified as True, all structs declared inside this + cdef are packed, i.e. laid out without any field alignment at all. + """ + self._cdef(csource, override=override, packed=packed) + + def embedding_api(self, csource, packed=False): + self._cdef(csource, packed=packed, dllexport=True) + if self._embedding is None: + self._embedding = '' + + def _cdef(self, csource, override=False, **options): + if not isinstance(csource, str): # unicode, on Python 2 + if not isinstance(csource, basestring): + raise TypeError("cdef() argument must be a string") + csource = csource.encode('ascii') + with self._lock: + self._cdef_version = object() + self._parser.parse(csource, override=override, **options) + self._cdefsources.append(csource) + if override: + for cache in self._function_caches: + cache.clear() + finishlist = self._parser._recomplete + if finishlist: + self._parser._recomplete = [] + for tp in finishlist: + tp.finish_backend_type(self, finishlist) + + def dlopen(self, name, flags=0): + """Load and return a dynamic library identified by 'name'. + The standard C library can be loaded by passing None. + Note that functions and types declared by 'ffi.cdef()' are not + linked to a particular library, just like C headers; in the + library we only look for the actual (untyped) symbols. + """ + assert isinstance(name, basestring) or name is None + with self._lock: + lib, function_cache = _make_ffi_library(self, name, flags) + self._function_caches.append(function_cache) + self._libraries.append(lib) + return lib + + def _typeof_locked(self, cdecl): + # call me with the lock! + key = cdecl + if key in self._parsed_types: + return self._parsed_types[key] + # + if not isinstance(cdecl, str): # unicode, on Python 2 + cdecl = cdecl.encode('ascii') + # + type = self._parser.parse_type(cdecl) + really_a_function_type = type.is_raw_function + if really_a_function_type: + type = type.as_function_pointer() + btype = self._get_cached_btype(type) + result = btype, really_a_function_type + self._parsed_types[key] = result + return result + + def _typeof(self, cdecl, consider_function_as_funcptr=False): + # string -> ctype object + try: + result = self._parsed_types[cdecl] + except KeyError: + with self._lock: + result = self._typeof_locked(cdecl) + # + btype, really_a_function_type = result + if really_a_function_type and not consider_function_as_funcptr: + raise CDefError("the type %r is a function type, not a " + "pointer-to-function type" % (cdecl,)) + return btype + + def typeof(self, cdecl): + """Parse the C type given as a string and return the + corresponding object. + It can also be used on 'cdata' instance to get its C type. + """ + if isinstance(cdecl, basestring): + return self._typeof(cdecl) + if isinstance(cdecl, self.CData): + return self._backend.typeof(cdecl) + if isinstance(cdecl, types.BuiltinFunctionType): + res = _builtin_function_type(cdecl) + if res is not None: + return res + if (isinstance(cdecl, types.FunctionType) + and hasattr(cdecl, '_cffi_base_type')): + with self._lock: + return self._get_cached_btype(cdecl._cffi_base_type) + raise TypeError(type(cdecl)) + + def sizeof(self, cdecl): + """Return the size in bytes of the argument. It can be a + string naming a C type, or a 'cdata' instance. + """ + if isinstance(cdecl, basestring): + BType = self._typeof(cdecl) + return self._backend.sizeof(BType) + else: + return self._backend.sizeof(cdecl) + + def alignof(self, cdecl): + """Return the natural alignment size in bytes of the C type + given as a string. + """ + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + return self._backend.alignof(cdecl) + + def offsetof(self, cdecl, *fields_or_indexes): + """Return the offset of the named field inside the given + structure or array, which must be given as a C type name. + You can give several field names in case of nested structures. + You can also give numeric values which correspond to array + items, in case of an array type. + """ + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + return self._typeoffsetof(cdecl, *fields_or_indexes)[1] + + def new(self, cdecl, init=None): + """Allocate an instance according to the specified C type and + return a pointer to it. The specified C type must be either a + pointer or an array: ``new('X *')`` allocates an X and returns + a pointer to it, whereas ``new('X[n]')`` allocates an array of + n X'es and returns an array referencing it (which works + mostly like a pointer, like in C). You can also use + ``new('X[]', n)`` to allocate an array of a non-constant + length n. + + The memory is initialized following the rules of declaring a + global variable in C: by default it is zero-initialized, but + an explicit initializer can be given which can be used to + fill all or part of the memory. + + When the returned object goes out of scope, the memory + is freed. In other words the returned object has + ownership of the value of type 'cdecl' that it points to. This + means that the raw data can be used as long as this object is + kept alive, but must not be used for a longer time. Be careful + about that when copying the pointer to the memory somewhere + else, e.g. into another structure. + """ + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + return self._backend.newp(cdecl, init) + + def new_allocator(self, alloc=None, free=None, + should_clear_after_alloc=True): + """Return a new allocator, i.e. a function that behaves like ffi.new() + but uses the provided low-level 'alloc' and 'free' functions. + + 'alloc' is called with the size as argument. If it returns NULL, a + MemoryError is raised. 'free' is called with the result of 'alloc' + as argument. Both can be either Python function or directly C + functions. If 'free' is None, then no free function is called. + If both 'alloc' and 'free' are None, the default is used. + + If 'should_clear_after_alloc' is set to False, then the memory + returned by 'alloc' is assumed to be already cleared (or you are + fine with garbage); otherwise CFFI will clear it. + """ + compiled_ffi = self._backend.FFI() + allocator = compiled_ffi.new_allocator(alloc, free, + should_clear_after_alloc) + def allocate(cdecl, init=None): + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + return allocator(cdecl, init) + return allocate + + def cast(self, cdecl, source): + """Similar to a C cast: returns an instance of the named C + type initialized with the given 'source'. The source is + casted between integers or pointers of any type. + """ + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + return self._backend.cast(cdecl, source) + + def string(self, cdata, maxlen=-1): + """Return a Python string (or unicode string) from the 'cdata'. + If 'cdata' is a pointer or array of characters or bytes, returns + the null-terminated string. The returned string extends until + the first null character, or at most 'maxlen' characters. If + 'cdata' is an array then 'maxlen' defaults to its length. + + If 'cdata' is a pointer or array of wchar_t, returns a unicode + string following the same rules. + + If 'cdata' is a single character or byte or a wchar_t, returns + it as a string or unicode string. + + If 'cdata' is an enum, returns the value of the enumerator as a + string, or 'NUMBER' if the value is out of range. + """ + return self._backend.string(cdata, maxlen) + + def unpack(self, cdata, length): + """Unpack an array of C data of the given length, + returning a Python string/unicode/list. + + If 'cdata' is a pointer to 'char', returns a byte string. + It does not stop at the first null. This is equivalent to: + ffi.buffer(cdata, length)[:] + + If 'cdata' is a pointer to 'wchar_t', returns a unicode string. + 'length' is measured in wchar_t's; it is not the size in bytes. + + If 'cdata' is a pointer to anything else, returns a list of + 'length' items. This is a faster equivalent to: + [cdata[i] for i in range(length)] + """ + return self._backend.unpack(cdata, length) + + #def buffer(self, cdata, size=-1): + # """Return a read-write buffer object that references the raw C data + # pointed to by the given 'cdata'. The 'cdata' must be a pointer or + # an array. Can be passed to functions expecting a buffer, or directly + # manipulated with: + # + # buf[:] get a copy of it in a regular string, or + # buf[idx] as a single character + # buf[:] = ... + # buf[idx] = ... change the content + # """ + # note that 'buffer' is a type, set on this instance by __init__ + + def from_buffer(self, python_buffer): + """Return a that points to the data of the + given Python object, which must support the buffer interface. + Note that this is not meant to be used on the built-in types + str or unicode (you can build 'char[]' arrays explicitly) + but only on objects containing large quantities of raw data + in some other format, like 'array.array' or numpy arrays. + """ + return self._backend.from_buffer(self.BCharA, python_buffer) + + def memmove(self, dest, src, n): + """ffi.memmove(dest, src, n) copies n bytes of memory from src to dest. + + Like the C function memmove(), the memory areas may overlap; + apart from that it behaves like the C function memcpy(). + + 'src' can be any cdata ptr or array, or any Python buffer object. + 'dest' can be any cdata ptr or array, or a writable Python buffer + object. The size to copy, 'n', is always measured in bytes. + + Unlike other methods, this one supports all Python buffer including + byte strings and bytearrays---but it still does not support + non-contiguous buffers. + """ + return self._backend.memmove(dest, src, n) + + def callback(self, cdecl, python_callable=None, error=None, onerror=None): + """Return a callback object or a decorator making such a + callback object. 'cdecl' must name a C function pointer type. + The callback invokes the specified 'python_callable' (which may + be provided either directly or via a decorator). Important: the + callback object must be manually kept alive for as long as the + callback may be invoked from the C level. + """ + def callback_decorator_wrap(python_callable): + if not callable(python_callable): + raise TypeError("the 'python_callable' argument " + "is not callable") + return self._backend.callback(cdecl, python_callable, + error, onerror) + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl, consider_function_as_funcptr=True) + if python_callable is None: + return callback_decorator_wrap # decorator mode + else: + return callback_decorator_wrap(python_callable) # direct mode + + def getctype(self, cdecl, replace_with=''): + """Return a string giving the C type 'cdecl', which may be itself + a string or a object. If 'replace_with' is given, it gives + extra text to append (or insert for more complicated C types), like + a variable name, or '*' to get actually the C type 'pointer-to-cdecl'. + """ + if isinstance(cdecl, basestring): + cdecl = self._typeof(cdecl) + replace_with = replace_with.strip() + if (replace_with.startswith('*') + and '&[' in self._backend.getcname(cdecl, '&')): + replace_with = '(%s)' % replace_with + elif replace_with and not replace_with[0] in '[(': + replace_with = ' ' + replace_with + return self._backend.getcname(cdecl, replace_with) + + def gc(self, cdata, destructor, size=0): + """Return a new cdata object that points to the same + data. Later, when this new cdata object is garbage-collected, + 'destructor(old_cdata_object)' will be called. + + The optional 'size' gives an estimate of the size, used to + trigger the garbage collection more eagerly. So far only used + on PyPy. It tells the GC that the returned object keeps alive + roughly 'size' bytes of external memory. + """ + return self._backend.gcp(cdata, destructor, size) + + def _get_cached_btype(self, type): + assert self._lock.acquire(False) is False + # call me with the lock! + try: + BType = self._cached_btypes[type] + except KeyError: + finishlist = [] + BType = type.get_cached_btype(self, finishlist) + for type in finishlist: + type.finish_backend_type(self, finishlist) + return BType + + def verify(self, source='', tmpdir=None, **kwargs): + """Verify that the current ffi signatures compile on this + machine, and return a dynamic library object. The dynamic + library can be used to call functions and access global + variables declared in this 'ffi'. The library is compiled + by the C compiler: it gives you C-level API compatibility + (including calling macros). This is unlike 'ffi.dlopen()', + which requires binary compatibility in the signatures. + """ + from .verifier import Verifier, _caller_dir_pycache + # + # If set_unicode(True) was called, insert the UNICODE and + # _UNICODE macro declarations + if self._windows_unicode: + self._apply_windows_unicode(kwargs) + # + # Set the tmpdir here, and not in Verifier.__init__: it picks + # up the caller's directory, which we want to be the caller of + # ffi.verify(), as opposed to the caller of Veritier(). + tmpdir = tmpdir or _caller_dir_pycache() + # + # Make a Verifier() and use it to load the library. + self.verifier = Verifier(self, source, tmpdir, **kwargs) + lib = self.verifier.load_library() + # + # Save the loaded library for keep-alive purposes, even + # if the caller doesn't keep it alive itself (it should). + self._libraries.append(lib) + return lib + + def _get_errno(self): + return self._backend.get_errno() + def _set_errno(self, errno): + self._backend.set_errno(errno) + errno = property(_get_errno, _set_errno, None, + "the value of 'errno' from/to the C calls") + + def getwinerror(self, code=-1): + return self._backend.getwinerror(code) + + def _pointer_to(self, ctype): + with self._lock: + return model.pointer_cache(self, ctype) + + def addressof(self, cdata, *fields_or_indexes): + """Return the address of a . + If 'fields_or_indexes' are given, returns the address of that + field or array item in the structure or array, recursively in + case of nested structures. + """ + try: + ctype = self._backend.typeof(cdata) + except TypeError: + if '__addressof__' in type(cdata).__dict__: + return type(cdata).__addressof__(cdata, *fields_or_indexes) + raise + if fields_or_indexes: + ctype, offset = self._typeoffsetof(ctype, *fields_or_indexes) + else: + if ctype.kind == "pointer": + raise TypeError("addressof(pointer)") + offset = 0 + ctypeptr = self._pointer_to(ctype) + return self._backend.rawaddressof(ctypeptr, cdata, offset) + + def _typeoffsetof(self, ctype, field_or_index, *fields_or_indexes): + ctype, offset = self._backend.typeoffsetof(ctype, field_or_index) + for field1 in fields_or_indexes: + ctype, offset1 = self._backend.typeoffsetof(ctype, field1, 1) + offset += offset1 + return ctype, offset + + def include(self, ffi_to_include): + """Includes the typedefs, structs, unions and enums defined + in another FFI instance. Usage is similar to a #include in C, + where a part of the program might include types defined in + another part for its own usage. Note that the include() + method has no effect on functions, constants and global + variables, which must anyway be accessed directly from the + lib object returned by the original FFI instance. + """ + if not isinstance(ffi_to_include, FFI): + raise TypeError("ffi.include() expects an argument that is also of" + " type cffi.FFI, not %r" % ( + type(ffi_to_include).__name__,)) + if ffi_to_include is self: + raise ValueError("self.include(self)") + with ffi_to_include._lock: + with self._lock: + self._parser.include(ffi_to_include._parser) + self._cdefsources.append('[') + self._cdefsources.extend(ffi_to_include._cdefsources) + self._cdefsources.append(']') + self._included_ffis.append(ffi_to_include) + + def new_handle(self, x): + return self._backend.newp_handle(self.BVoidP, x) + + def from_handle(self, x): + return self._backend.from_handle(x) + + def set_unicode(self, enabled_flag): + """Windows: if 'enabled_flag' is True, enable the UNICODE and + _UNICODE defines in C, and declare the types like TCHAR and LPTCSTR + to be (pointers to) wchar_t. If 'enabled_flag' is False, + declare these types to be (pointers to) plain 8-bit characters. + This is mostly for backward compatibility; you usually want True. + """ + if self._windows_unicode is not None: + raise ValueError("set_unicode() can only be called once") + enabled_flag = bool(enabled_flag) + if enabled_flag: + self.cdef("typedef wchar_t TBYTE;" + "typedef wchar_t TCHAR;" + "typedef const wchar_t *LPCTSTR;" + "typedef const wchar_t *PCTSTR;" + "typedef wchar_t *LPTSTR;" + "typedef wchar_t *PTSTR;" + "typedef TBYTE *PTBYTE;" + "typedef TCHAR *PTCHAR;") + else: + self.cdef("typedef char TBYTE;" + "typedef char TCHAR;" + "typedef const char *LPCTSTR;" + "typedef const char *PCTSTR;" + "typedef char *LPTSTR;" + "typedef char *PTSTR;" + "typedef TBYTE *PTBYTE;" + "typedef TCHAR *PTCHAR;") + self._windows_unicode = enabled_flag + + def _apply_windows_unicode(self, kwds): + defmacros = kwds.get('define_macros', ()) + if not isinstance(defmacros, (list, tuple)): + raise TypeError("'define_macros' must be a list or tuple") + defmacros = list(defmacros) + [('UNICODE', '1'), + ('_UNICODE', '1')] + kwds['define_macros'] = defmacros + + def _apply_embedding_fix(self, kwds): + # must include an argument like "-lpython2.7" for the compiler + def ensure(key, value): + lst = kwds.setdefault(key, []) + if value not in lst: + lst.append(value) + # + if '__pypy__' in sys.builtin_module_names: + import os + if sys.platform == "win32": + # we need 'libpypy-c.lib'. Current distributions of + # pypy (>= 4.1) contain it as 'libs/python27.lib'. + pythonlib = "python27" + if hasattr(sys, 'prefix'): + ensure('library_dirs', os.path.join(sys.prefix, 'libs')) + else: + # we need 'libpypy-c.{so,dylib}', which should be by + # default located in 'sys.prefix/bin' for installed + # systems. + if sys.version_info < (3,): + pythonlib = "pypy-c" + else: + pythonlib = "pypy3-c" + if hasattr(sys, 'prefix'): + ensure('library_dirs', os.path.join(sys.prefix, 'bin')) + # On uninstalled pypy's, the libpypy-c is typically found in + # .../pypy/goal/. + if hasattr(sys, 'prefix'): + ensure('library_dirs', os.path.join(sys.prefix, 'pypy', 'goal')) + else: + if sys.platform == "win32": + template = "python%d%d" + if hasattr(sys, 'gettotalrefcount'): + template += '_d' + else: + try: + import sysconfig + except ImportError: # 2.6 + from distutils import sysconfig + template = "python%d.%d" + if sysconfig.get_config_var('DEBUG_EXT'): + template += sysconfig.get_config_var('DEBUG_EXT') + pythonlib = (template % + (sys.hexversion >> 24, (sys.hexversion >> 16) & 0xff)) + if hasattr(sys, 'abiflags'): + pythonlib += sys.abiflags + ensure('libraries', pythonlib) + if sys.platform == "win32": + ensure('extra_link_args', '/MANIFEST') + + def set_source(self, module_name, source, source_extension='.c', **kwds): + import os + if hasattr(self, '_assigned_source'): + raise ValueError("set_source() cannot be called several times " + "per ffi object") + if not isinstance(module_name, basestring): + raise TypeError("'module_name' must be a string") + if os.sep in module_name or (os.altsep and os.altsep in module_name): + raise ValueError("'module_name' must not contain '/': use a dotted " + "name to make a 'package.module' location") + self._assigned_source = (str(module_name), source, + source_extension, kwds) + + def distutils_extension(self, tmpdir='build', verbose=True): + from distutils.dir_util import mkpath + from .recompiler import recompile + # + if not hasattr(self, '_assigned_source'): + if hasattr(self, 'verifier'): # fallback, 'tmpdir' ignored + return self.verifier.get_extension() + raise ValueError("set_source() must be called before" + " distutils_extension()") + module_name, source, source_extension, kwds = self._assigned_source + if source is None: + raise TypeError("distutils_extension() is only for C extension " + "modules, not for dlopen()-style pure Python " + "modules") + mkpath(tmpdir) + ext, updated = recompile(self, module_name, + source, tmpdir=tmpdir, extradir=tmpdir, + source_extension=source_extension, + call_c_compiler=False, **kwds) + if verbose: + if updated: + sys.stderr.write("regenerated: %r\n" % (ext.sources[0],)) + else: + sys.stderr.write("not modified: %r\n" % (ext.sources[0],)) + return ext + + def emit_c_code(self, filename): + from .recompiler import recompile + # + if not hasattr(self, '_assigned_source'): + raise ValueError("set_source() must be called before emit_c_code()") + module_name, source, source_extension, kwds = self._assigned_source + if source is None: + raise TypeError("emit_c_code() is only for C extension modules, " + "not for dlopen()-style pure Python modules") + recompile(self, module_name, source, + c_file=filename, call_c_compiler=False, **kwds) + + def emit_python_code(self, filename): + from .recompiler import recompile + # + if not hasattr(self, '_assigned_source'): + raise ValueError("set_source() must be called before emit_c_code()") + module_name, source, source_extension, kwds = self._assigned_source + if source is not None: + raise TypeError("emit_python_code() is only for dlopen()-style " + "pure Python modules, not for C extension modules") + recompile(self, module_name, source, + c_file=filename, call_c_compiler=False, **kwds) + + def compile(self, tmpdir='.', verbose=0, target=None, debug=None): + """The 'target' argument gives the final file name of the + compiled DLL. Use '*' to force distutils' choice, suitable for + regular CPython C API modules. Use a file name ending in '.*' + to ask for the system's default extension for dynamic libraries + (.so/.dll/.dylib). + + The default is '*' when building a non-embedded C API extension, + and (module_name + '.*') when building an embedded library. + """ + from .recompiler import recompile + # + if not hasattr(self, '_assigned_source'): + raise ValueError("set_source() must be called before compile()") + module_name, source, source_extension, kwds = self._assigned_source + return recompile(self, module_name, source, tmpdir=tmpdir, + target=target, source_extension=source_extension, + compiler_verbose=verbose, debug=debug, **kwds) + + def init_once(self, func, tag): + # Read _init_once_cache[tag], which is either (False, lock) if + # we're calling the function now in some thread, or (True, result). + # Don't call setdefault() in most cases, to avoid allocating and + # immediately freeing a lock; but still use setdefaut() to avoid + # races. + try: + x = self._init_once_cache[tag] + except KeyError: + x = self._init_once_cache.setdefault(tag, (False, allocate_lock())) + # Common case: we got (True, result), so we return the result. + if x[0]: + return x[1] + # Else, it's a lock. Acquire it to serialize the following tests. + with x[1]: + # Read again from _init_once_cache the current status. + x = self._init_once_cache[tag] + if x[0]: + return x[1] + # Call the function and store the result back. + result = func() + self._init_once_cache[tag] = (True, result) + return result + + def embedding_init_code(self, pysource): + if self._embedding: + raise ValueError("embedding_init_code() can only be called once") + # fix 'pysource' before it gets dumped into the C file: + # - remove empty lines at the beginning, so it starts at "line 1" + # - dedent, if all non-empty lines are indented + # - check for SyntaxErrors + import re + match = re.match(r'\s*\n', pysource) + if match: + pysource = pysource[match.end():] + lines = pysource.splitlines() or [''] + prefix = re.match(r'\s*', lines[0]).group() + for i in range(1, len(lines)): + line = lines[i] + if line.rstrip(): + while not line.startswith(prefix): + prefix = prefix[:-1] + i = len(prefix) + lines = [line[i:]+'\n' for line in lines] + pysource = ''.join(lines) + # + compile(pysource, "cffi_init", "exec") + # + self._embedding = pysource + + def def_extern(self, *args, **kwds): + raise ValueError("ffi.def_extern() is only available on API-mode FFI " + "objects") + + def list_types(self): + """Returns the user type names known to this FFI instance. + This returns a tuple containing three lists of names: + (typedef_names, names_of_structs, names_of_unions) + """ + typedefs = [] + structs = [] + unions = [] + for key in self._parser._declarations: + if key.startswith('typedef '): + typedefs.append(key[8:]) + elif key.startswith('struct '): + structs.append(key[7:]) + elif key.startswith('union '): + unions.append(key[6:]) + typedefs.sort() + structs.sort() + unions.sort() + return (typedefs, structs, unions) + + +def _load_backend_lib(backend, name, flags): + import os + if name is None: + if sys.platform != "win32": + return backend.load_library(None, flags) + name = "c" # Windows: load_library(None) fails, but this works + # on Python 2 (backward compatibility hack only) + first_error = None + if '.' in name or '/' in name or os.sep in name: + try: + return backend.load_library(name, flags) + except OSError as e: + first_error = e + import ctypes.util + path = ctypes.util.find_library(name) + if path is None: + if name == "c" and sys.platform == "win32" and sys.version_info >= (3,): + raise OSError("dlopen(None) cannot work on Windows for Python 3 " + "(see http://bugs.python.org/issue23606)") + msg = ("ctypes.util.find_library() did not manage " + "to locate a library called %r" % (name,)) + if first_error is not None: + msg = "%s. Additionally, %s" % (first_error, msg) + raise OSError(msg) + return backend.load_library(path, flags) + +def _make_ffi_library(ffi, libname, flags): + backend = ffi._backend + backendlib = _load_backend_lib(backend, libname, flags) + # + def accessor_function(name): + key = 'function ' + name + tp, _ = ffi._parser._declarations[key] + BType = ffi._get_cached_btype(tp) + value = backendlib.load_function(BType, name) + library.__dict__[name] = value + # + def accessor_variable(name): + key = 'variable ' + name + tp, _ = ffi._parser._declarations[key] + BType = ffi._get_cached_btype(tp) + read_variable = backendlib.read_variable + write_variable = backendlib.write_variable + setattr(FFILibrary, name, property( + lambda self: read_variable(BType, name), + lambda self, value: write_variable(BType, name, value))) + # + def addressof_var(name): + try: + return addr_variables[name] + except KeyError: + with ffi._lock: + if name not in addr_variables: + key = 'variable ' + name + tp, _ = ffi._parser._declarations[key] + BType = ffi._get_cached_btype(tp) + if BType.kind != 'array': + BType = model.pointer_cache(ffi, BType) + p = backendlib.load_function(BType, name) + addr_variables[name] = p + return addr_variables[name] + # + def accessor_constant(name): + raise NotImplementedError("non-integer constant '%s' cannot be " + "accessed from a dlopen() library" % (name,)) + # + def accessor_int_constant(name): + library.__dict__[name] = ffi._parser._int_constants[name] + # + accessors = {} + accessors_version = [False] + addr_variables = {} + # + def update_accessors(): + if accessors_version[0] is ffi._cdef_version: + return + # + for key, (tp, _) in ffi._parser._declarations.items(): + if not isinstance(tp, model.EnumType): + tag, name = key.split(' ', 1) + if tag == 'function': + accessors[name] = accessor_function + elif tag == 'variable': + accessors[name] = accessor_variable + elif tag == 'constant': + accessors[name] = accessor_constant + else: + for i, enumname in enumerate(tp.enumerators): + def accessor_enum(name, tp=tp, i=i): + tp.check_not_partial() + library.__dict__[name] = tp.enumvalues[i] + accessors[enumname] = accessor_enum + for name in ffi._parser._int_constants: + accessors.setdefault(name, accessor_int_constant) + accessors_version[0] = ffi._cdef_version + # + def make_accessor(name): + with ffi._lock: + if name in library.__dict__ or name in FFILibrary.__dict__: + return # added by another thread while waiting for the lock + if name not in accessors: + update_accessors() + if name not in accessors: + raise AttributeError(name) + accessors[name](name) + # + class FFILibrary(object): + def __getattr__(self, name): + make_accessor(name) + return getattr(self, name) + def __setattr__(self, name, value): + try: + property = getattr(self.__class__, name) + except AttributeError: + make_accessor(name) + setattr(self, name, value) + else: + property.__set__(self, value) + def __dir__(self): + with ffi._lock: + update_accessors() + return accessors.keys() + def __addressof__(self, name): + if name in library.__dict__: + return library.__dict__[name] + if name in FFILibrary.__dict__: + return addressof_var(name) + make_accessor(name) + if name in library.__dict__: + return library.__dict__[name] + if name in FFILibrary.__dict__: + return addressof_var(name) + raise AttributeError("cffi library has no function or " + "global variable named '%s'" % (name,)) + # + if libname is not None: + try: + if not isinstance(libname, str): # unicode, on Python 2 + libname = libname.encode('utf-8') + FFILibrary.__name__ = 'FFILibrary_%s' % libname + except UnicodeError: + pass + library = FFILibrary() + return library, library.__dict__ + +def _builtin_function_type(func): + # a hack to make at least ffi.typeof(builtin_function) work, + # if the builtin function was obtained by 'vengine_cpy'. + import sys + try: + module = sys.modules[func.__module__] + ffi = module._cffi_original_ffi + types_of_builtin_funcs = module._cffi_types_of_builtin_funcs + tp = types_of_builtin_funcs[func] + except (KeyError, AttributeError, TypeError): + return None + else: + with ffi._lock: + return ffi._get_cached_btype(tp) diff --git a/website/web/Lib/site-packages/cffi/backend_ctypes.py b/website/web/Lib/site-packages/cffi/backend_ctypes.py new file mode 100644 index 000000000..5ef3c135e --- /dev/null +++ b/website/web/Lib/site-packages/cffi/backend_ctypes.py @@ -0,0 +1,1114 @@ +import ctypes, ctypes.util, operator, sys +from . import model + +if sys.version_info < (3,): + bytechr = chr +else: + unicode = str + long = int + xrange = range + bytechr = lambda num: bytes([num]) + +class CTypesType(type): + pass + +class CTypesData(object): + __metaclass__ = CTypesType + __slots__ = ['__weakref__'] + __name__ = '' + + def __init__(self, *args): + raise TypeError("cannot instantiate %r" % (self.__class__,)) + + @classmethod + def _newp(cls, init): + raise TypeError("expected a pointer or array ctype, got '%s'" + % (cls._get_c_name(),)) + + @staticmethod + def _to_ctypes(value): + raise TypeError + + @classmethod + def _arg_to_ctypes(cls, *value): + try: + ctype = cls._ctype + except AttributeError: + raise TypeError("cannot create an instance of %r" % (cls,)) + if value: + res = cls._to_ctypes(*value) + if not isinstance(res, ctype): + res = cls._ctype(res) + else: + res = cls._ctype() + return res + + @classmethod + def _create_ctype_obj(cls, init): + if init is None: + return cls._arg_to_ctypes() + else: + return cls._arg_to_ctypes(init) + + @staticmethod + def _from_ctypes(ctypes_value): + raise TypeError + + @classmethod + def _get_c_name(cls, replace_with=''): + return cls._reftypename.replace(' &', replace_with) + + @classmethod + def _fix_class(cls): + cls.__name__ = 'CData<%s>' % (cls._get_c_name(),) + cls.__qualname__ = 'CData<%s>' % (cls._get_c_name(),) + cls.__module__ = 'ffi' + + def _get_own_repr(self): + raise NotImplementedError + + def _addr_repr(self, address): + if address == 0: + return 'NULL' + else: + if address < 0: + address += 1 << (8*ctypes.sizeof(ctypes.c_void_p)) + return '0x%x' % address + + def __repr__(self, c_name=None): + own = self._get_own_repr() + return '' % (c_name or self._get_c_name(), own) + + def _convert_to_address(self, BClass): + if BClass is None: + raise TypeError("cannot convert %r to an address" % ( + self._get_c_name(),)) + else: + raise TypeError("cannot convert %r to %r" % ( + self._get_c_name(), BClass._get_c_name())) + + @classmethod + def _get_size(cls): + return ctypes.sizeof(cls._ctype) + + def _get_size_of_instance(self): + return ctypes.sizeof(self._ctype) + + @classmethod + def _cast_from(cls, source): + raise TypeError("cannot cast to %r" % (cls._get_c_name(),)) + + def _cast_to_integer(self): + return self._convert_to_address(None) + + @classmethod + def _alignment(cls): + return ctypes.alignment(cls._ctype) + + def __iter__(self): + raise TypeError("cdata %r does not support iteration" % ( + self._get_c_name()),) + + def _make_cmp(name): + cmpfunc = getattr(operator, name) + def cmp(self, other): + v_is_ptr = not isinstance(self, CTypesGenericPrimitive) + w_is_ptr = (isinstance(other, CTypesData) and + not isinstance(other, CTypesGenericPrimitive)) + if v_is_ptr and w_is_ptr: + return cmpfunc(self._convert_to_address(None), + other._convert_to_address(None)) + elif v_is_ptr or w_is_ptr: + return NotImplemented + else: + if isinstance(self, CTypesGenericPrimitive): + self = self._value + if isinstance(other, CTypesGenericPrimitive): + other = other._value + return cmpfunc(self, other) + cmp.func_name = name + return cmp + + __eq__ = _make_cmp('__eq__') + __ne__ = _make_cmp('__ne__') + __lt__ = _make_cmp('__lt__') + __le__ = _make_cmp('__le__') + __gt__ = _make_cmp('__gt__') + __ge__ = _make_cmp('__ge__') + + def __hash__(self): + return hash(self._convert_to_address(None)) + + def _to_string(self, maxlen): + raise TypeError("string(): %r" % (self,)) + + +class CTypesGenericPrimitive(CTypesData): + __slots__ = [] + + def __hash__(self): + return hash(self._value) + + def _get_own_repr(self): + return repr(self._from_ctypes(self._value)) + + +class CTypesGenericArray(CTypesData): + __slots__ = [] + + @classmethod + def _newp(cls, init): + return cls(init) + + def __iter__(self): + for i in xrange(len(self)): + yield self[i] + + def _get_own_repr(self): + return self._addr_repr(ctypes.addressof(self._blob)) + + +class CTypesGenericPtr(CTypesData): + __slots__ = ['_address', '_as_ctype_ptr'] + _automatic_casts = False + kind = "pointer" + + @classmethod + def _newp(cls, init): + return cls(init) + + @classmethod + def _cast_from(cls, source): + if source is None: + address = 0 + elif isinstance(source, CTypesData): + address = source._cast_to_integer() + elif isinstance(source, (int, long)): + address = source + else: + raise TypeError("bad type for cast to %r: %r" % + (cls, type(source).__name__)) + return cls._new_pointer_at(address) + + @classmethod + def _new_pointer_at(cls, address): + self = cls.__new__(cls) + self._address = address + self._as_ctype_ptr = ctypes.cast(address, cls._ctype) + return self + + def _get_own_repr(self): + try: + return self._addr_repr(self._address) + except AttributeError: + return '???' + + def _cast_to_integer(self): + return self._address + + def __nonzero__(self): + return bool(self._address) + __bool__ = __nonzero__ + + @classmethod + def _to_ctypes(cls, value): + if not isinstance(value, CTypesData): + raise TypeError("unexpected %s object" % type(value).__name__) + address = value._convert_to_address(cls) + return ctypes.cast(address, cls._ctype) + + @classmethod + def _from_ctypes(cls, ctypes_ptr): + address = ctypes.cast(ctypes_ptr, ctypes.c_void_p).value or 0 + return cls._new_pointer_at(address) + + @classmethod + def _initialize(cls, ctypes_ptr, value): + if value: + ctypes_ptr.contents = cls._to_ctypes(value).contents + + def _convert_to_address(self, BClass): + if (BClass in (self.__class__, None) or BClass._automatic_casts + or self._automatic_casts): + return self._address + else: + return CTypesData._convert_to_address(self, BClass) + + +class CTypesBaseStructOrUnion(CTypesData): + __slots__ = ['_blob'] + + @classmethod + def _create_ctype_obj(cls, init): + # may be overridden + raise TypeError("cannot instantiate opaque type %s" % (cls,)) + + def _get_own_repr(self): + return self._addr_repr(ctypes.addressof(self._blob)) + + @classmethod + def _offsetof(cls, fieldname): + return getattr(cls._ctype, fieldname).offset + + def _convert_to_address(self, BClass): + if getattr(BClass, '_BItem', None) is self.__class__: + return ctypes.addressof(self._blob) + else: + return CTypesData._convert_to_address(self, BClass) + + @classmethod + def _from_ctypes(cls, ctypes_struct_or_union): + self = cls.__new__(cls) + self._blob = ctypes_struct_or_union + return self + + @classmethod + def _to_ctypes(cls, value): + return value._blob + + def __repr__(self, c_name=None): + return CTypesData.__repr__(self, c_name or self._get_c_name(' &')) + + +class CTypesBackend(object): + + PRIMITIVE_TYPES = { + 'char': ctypes.c_char, + 'short': ctypes.c_short, + 'int': ctypes.c_int, + 'long': ctypes.c_long, + 'long long': ctypes.c_longlong, + 'signed char': ctypes.c_byte, + 'unsigned char': ctypes.c_ubyte, + 'unsigned short': ctypes.c_ushort, + 'unsigned int': ctypes.c_uint, + 'unsigned long': ctypes.c_ulong, + 'unsigned long long': ctypes.c_ulonglong, + 'float': ctypes.c_float, + 'double': ctypes.c_double, + '_Bool': ctypes.c_bool, + } + + for _name in ['unsigned long long', 'unsigned long', + 'unsigned int', 'unsigned short', 'unsigned char']: + _size = ctypes.sizeof(PRIMITIVE_TYPES[_name]) + PRIMITIVE_TYPES['uint%d_t' % (8*_size)] = PRIMITIVE_TYPES[_name] + if _size == ctypes.sizeof(ctypes.c_void_p): + PRIMITIVE_TYPES['uintptr_t'] = PRIMITIVE_TYPES[_name] + if _size == ctypes.sizeof(ctypes.c_size_t): + PRIMITIVE_TYPES['size_t'] = PRIMITIVE_TYPES[_name] + + for _name in ['long long', 'long', 'int', 'short', 'signed char']: + _size = ctypes.sizeof(PRIMITIVE_TYPES[_name]) + PRIMITIVE_TYPES['int%d_t' % (8*_size)] = PRIMITIVE_TYPES[_name] + if _size == ctypes.sizeof(ctypes.c_void_p): + PRIMITIVE_TYPES['intptr_t'] = PRIMITIVE_TYPES[_name] + PRIMITIVE_TYPES['ptrdiff_t'] = PRIMITIVE_TYPES[_name] + if _size == ctypes.sizeof(ctypes.c_size_t): + PRIMITIVE_TYPES['ssize_t'] = PRIMITIVE_TYPES[_name] + + + def __init__(self): + self.RTLD_LAZY = 0 # not supported anyway by ctypes + self.RTLD_NOW = 0 + self.RTLD_GLOBAL = ctypes.RTLD_GLOBAL + self.RTLD_LOCAL = ctypes.RTLD_LOCAL + + def set_ffi(self, ffi): + self.ffi = ffi + + def _get_types(self): + return CTypesData, CTypesType + + def load_library(self, path, flags=0): + cdll = ctypes.CDLL(path, flags) + return CTypesLibrary(self, cdll) + + def new_void_type(self): + class CTypesVoid(CTypesData): + __slots__ = [] + _reftypename = 'void &' + @staticmethod + def _from_ctypes(novalue): + return None + @staticmethod + def _to_ctypes(novalue): + if novalue is not None: + raise TypeError("None expected, got %s object" % + (type(novalue).__name__,)) + return None + CTypesVoid._fix_class() + return CTypesVoid + + def new_primitive_type(self, name): + if name == 'wchar_t': + raise NotImplementedError(name) + ctype = self.PRIMITIVE_TYPES[name] + if name == 'char': + kind = 'char' + elif name in ('float', 'double'): + kind = 'float' + else: + if name in ('signed char', 'unsigned char'): + kind = 'byte' + elif name == '_Bool': + kind = 'bool' + else: + kind = 'int' + is_signed = (ctype(-1).value == -1) + # + def _cast_source_to_int(source): + if isinstance(source, (int, long, float)): + source = int(source) + elif isinstance(source, CTypesData): + source = source._cast_to_integer() + elif isinstance(source, bytes): + source = ord(source) + elif source is None: + source = 0 + else: + raise TypeError("bad type for cast to %r: %r" % + (CTypesPrimitive, type(source).__name__)) + return source + # + kind1 = kind + class CTypesPrimitive(CTypesGenericPrimitive): + __slots__ = ['_value'] + _ctype = ctype + _reftypename = '%s &' % name + kind = kind1 + + def __init__(self, value): + self._value = value + + @staticmethod + def _create_ctype_obj(init): + if init is None: + return ctype() + return ctype(CTypesPrimitive._to_ctypes(init)) + + if kind == 'int' or kind == 'byte': + @classmethod + def _cast_from(cls, source): + source = _cast_source_to_int(source) + source = ctype(source).value # cast within range + return cls(source) + def __int__(self): + return self._value + + if kind == 'bool': + @classmethod + def _cast_from(cls, source): + if not isinstance(source, (int, long, float)): + source = _cast_source_to_int(source) + return cls(bool(source)) + def __int__(self): + return self._value + + if kind == 'char': + @classmethod + def _cast_from(cls, source): + source = _cast_source_to_int(source) + source = bytechr(source & 0xFF) + return cls(source) + def __int__(self): + return ord(self._value) + + if kind == 'float': + @classmethod + def _cast_from(cls, source): + if isinstance(source, float): + pass + elif isinstance(source, CTypesGenericPrimitive): + if hasattr(source, '__float__'): + source = float(source) + else: + source = int(source) + else: + source = _cast_source_to_int(source) + source = ctype(source).value # fix precision + return cls(source) + def __int__(self): + return int(self._value) + def __float__(self): + return self._value + + _cast_to_integer = __int__ + + if kind == 'int' or kind == 'byte' or kind == 'bool': + @staticmethod + def _to_ctypes(x): + if not isinstance(x, (int, long)): + if isinstance(x, CTypesData): + x = int(x) + else: + raise TypeError("integer expected, got %s" % + type(x).__name__) + if ctype(x).value != x: + if not is_signed and x < 0: + raise OverflowError("%s: negative integer" % name) + else: + raise OverflowError("%s: integer out of bounds" + % name) + return x + + if kind == 'char': + @staticmethod + def _to_ctypes(x): + if isinstance(x, bytes) and len(x) == 1: + return x + if isinstance(x, CTypesPrimitive): # > + return x._value + raise TypeError("character expected, got %s" % + type(x).__name__) + def __nonzero__(self): + return ord(self._value) != 0 + else: + def __nonzero__(self): + return self._value != 0 + __bool__ = __nonzero__ + + if kind == 'float': + @staticmethod + def _to_ctypes(x): + if not isinstance(x, (int, long, float, CTypesData)): + raise TypeError("float expected, got %s" % + type(x).__name__) + return ctype(x).value + + @staticmethod + def _from_ctypes(value): + return getattr(value, 'value', value) + + @staticmethod + def _initialize(blob, init): + blob.value = CTypesPrimitive._to_ctypes(init) + + if kind == 'char': + def _to_string(self, maxlen): + return self._value + if kind == 'byte': + def _to_string(self, maxlen): + return chr(self._value & 0xff) + # + CTypesPrimitive._fix_class() + return CTypesPrimitive + + def new_pointer_type(self, BItem): + getbtype = self.ffi._get_cached_btype + if BItem is getbtype(model.PrimitiveType('char')): + kind = 'charp' + elif BItem in (getbtype(model.PrimitiveType('signed char')), + getbtype(model.PrimitiveType('unsigned char'))): + kind = 'bytep' + elif BItem is getbtype(model.void_type): + kind = 'voidp' + else: + kind = 'generic' + # + class CTypesPtr(CTypesGenericPtr): + __slots__ = ['_own'] + if kind == 'charp': + __slots__ += ['__as_strbuf'] + _BItem = BItem + if hasattr(BItem, '_ctype'): + _ctype = ctypes.POINTER(BItem._ctype) + _bitem_size = ctypes.sizeof(BItem._ctype) + else: + _ctype = ctypes.c_void_p + if issubclass(BItem, CTypesGenericArray): + _reftypename = BItem._get_c_name('(* &)') + else: + _reftypename = BItem._get_c_name(' * &') + + def __init__(self, init): + ctypeobj = BItem._create_ctype_obj(init) + if kind == 'charp': + self.__as_strbuf = ctypes.create_string_buffer( + ctypeobj.value + b'\x00') + self._as_ctype_ptr = ctypes.cast( + self.__as_strbuf, self._ctype) + else: + self._as_ctype_ptr = ctypes.pointer(ctypeobj) + self._address = ctypes.cast(self._as_ctype_ptr, + ctypes.c_void_p).value + self._own = True + + def __add__(self, other): + if isinstance(other, (int, long)): + return self._new_pointer_at(self._address + + other * self._bitem_size) + else: + return NotImplemented + + def __sub__(self, other): + if isinstance(other, (int, long)): + return self._new_pointer_at(self._address - + other * self._bitem_size) + elif type(self) is type(other): + return (self._address - other._address) // self._bitem_size + else: + return NotImplemented + + def __getitem__(self, index): + if getattr(self, '_own', False) and index != 0: + raise IndexError + return BItem._from_ctypes(self._as_ctype_ptr[index]) + + def __setitem__(self, index, value): + self._as_ctype_ptr[index] = BItem._to_ctypes(value) + + if kind == 'charp' or kind == 'voidp': + @classmethod + def _arg_to_ctypes(cls, *value): + if value and isinstance(value[0], bytes): + return ctypes.c_char_p(value[0]) + else: + return super(CTypesPtr, cls)._arg_to_ctypes(*value) + + if kind == 'charp' or kind == 'bytep': + def _to_string(self, maxlen): + if maxlen < 0: + maxlen = sys.maxsize + p = ctypes.cast(self._as_ctype_ptr, + ctypes.POINTER(ctypes.c_char)) + n = 0 + while n < maxlen and p[n] != b'\x00': + n += 1 + return b''.join([p[i] for i in range(n)]) + + def _get_own_repr(self): + if getattr(self, '_own', False): + return 'owning %d bytes' % ( + ctypes.sizeof(self._as_ctype_ptr.contents),) + return super(CTypesPtr, self)._get_own_repr() + # + if (BItem is self.ffi._get_cached_btype(model.void_type) or + BItem is self.ffi._get_cached_btype(model.PrimitiveType('char'))): + CTypesPtr._automatic_casts = True + # + CTypesPtr._fix_class() + return CTypesPtr + + def new_array_type(self, CTypesPtr, length): + if length is None: + brackets = ' &[]' + else: + brackets = ' &[%d]' % length + BItem = CTypesPtr._BItem + getbtype = self.ffi._get_cached_btype + if BItem is getbtype(model.PrimitiveType('char')): + kind = 'char' + elif BItem in (getbtype(model.PrimitiveType('signed char')), + getbtype(model.PrimitiveType('unsigned char'))): + kind = 'byte' + else: + kind = 'generic' + # + class CTypesArray(CTypesGenericArray): + __slots__ = ['_blob', '_own'] + if length is not None: + _ctype = BItem._ctype * length + else: + __slots__.append('_ctype') + _reftypename = BItem._get_c_name(brackets) + _declared_length = length + _CTPtr = CTypesPtr + + def __init__(self, init): + if length is None: + if isinstance(init, (int, long)): + len1 = init + init = None + elif kind == 'char' and isinstance(init, bytes): + len1 = len(init) + 1 # extra null + else: + init = tuple(init) + len1 = len(init) + self._ctype = BItem._ctype * len1 + self._blob = self._ctype() + self._own = True + if init is not None: + self._initialize(self._blob, init) + + @staticmethod + def _initialize(blob, init): + if isinstance(init, bytes): + init = [init[i:i+1] for i in range(len(init))] + else: + init = tuple(init) + if len(init) > len(blob): + raise IndexError("too many initializers") + addr = ctypes.cast(blob, ctypes.c_void_p).value + PTR = ctypes.POINTER(BItem._ctype) + itemsize = ctypes.sizeof(BItem._ctype) + for i, value in enumerate(init): + p = ctypes.cast(addr + i * itemsize, PTR) + BItem._initialize(p.contents, value) + + def __len__(self): + return len(self._blob) + + def __getitem__(self, index): + if not (0 <= index < len(self._blob)): + raise IndexError + return BItem._from_ctypes(self._blob[index]) + + def __setitem__(self, index, value): + if not (0 <= index < len(self._blob)): + raise IndexError + self._blob[index] = BItem._to_ctypes(value) + + if kind == 'char' or kind == 'byte': + def _to_string(self, maxlen): + if maxlen < 0: + maxlen = len(self._blob) + p = ctypes.cast(self._blob, + ctypes.POINTER(ctypes.c_char)) + n = 0 + while n < maxlen and p[n] != b'\x00': + n += 1 + return b''.join([p[i] for i in range(n)]) + + def _get_own_repr(self): + if getattr(self, '_own', False): + return 'owning %d bytes' % (ctypes.sizeof(self._blob),) + return super(CTypesArray, self)._get_own_repr() + + def _convert_to_address(self, BClass): + if BClass in (CTypesPtr, None) or BClass._automatic_casts: + return ctypes.addressof(self._blob) + else: + return CTypesData._convert_to_address(self, BClass) + + @staticmethod + def _from_ctypes(ctypes_array): + self = CTypesArray.__new__(CTypesArray) + self._blob = ctypes_array + return self + + @staticmethod + def _arg_to_ctypes(value): + return CTypesPtr._arg_to_ctypes(value) + + def __add__(self, other): + if isinstance(other, (int, long)): + return CTypesPtr._new_pointer_at( + ctypes.addressof(self._blob) + + other * ctypes.sizeof(BItem._ctype)) + else: + return NotImplemented + + @classmethod + def _cast_from(cls, source): + raise NotImplementedError("casting to %r" % ( + cls._get_c_name(),)) + # + CTypesArray._fix_class() + return CTypesArray + + def _new_struct_or_union(self, kind, name, base_ctypes_class): + # + class struct_or_union(base_ctypes_class): + pass + struct_or_union.__name__ = '%s_%s' % (kind, name) + kind1 = kind + # + class CTypesStructOrUnion(CTypesBaseStructOrUnion): + __slots__ = ['_blob'] + _ctype = struct_or_union + _reftypename = '%s &' % (name,) + _kind = kind = kind1 + # + CTypesStructOrUnion._fix_class() + return CTypesStructOrUnion + + def new_struct_type(self, name): + return self._new_struct_or_union('struct', name, ctypes.Structure) + + def new_union_type(self, name): + return self._new_struct_or_union('union', name, ctypes.Union) + + def complete_struct_or_union(self, CTypesStructOrUnion, fields, tp, + totalsize=-1, totalalignment=-1, sflags=0): + if totalsize >= 0 or totalalignment >= 0: + raise NotImplementedError("the ctypes backend of CFFI does not support " + "structures completed by verify(); please " + "compile and install the _cffi_backend module.") + struct_or_union = CTypesStructOrUnion._ctype + fnames = [fname for (fname, BField, bitsize) in fields] + btypes = [BField for (fname, BField, bitsize) in fields] + bitfields = [bitsize for (fname, BField, bitsize) in fields] + # + bfield_types = {} + cfields = [] + for (fname, BField, bitsize) in fields: + if bitsize < 0: + cfields.append((fname, BField._ctype)) + bfield_types[fname] = BField + else: + cfields.append((fname, BField._ctype, bitsize)) + bfield_types[fname] = Ellipsis + if sflags & 8: + struct_or_union._pack_ = 1 + struct_or_union._fields_ = cfields + CTypesStructOrUnion._bfield_types = bfield_types + # + @staticmethod + def _create_ctype_obj(init): + result = struct_or_union() + if init is not None: + initialize(result, init) + return result + CTypesStructOrUnion._create_ctype_obj = _create_ctype_obj + # + def initialize(blob, init): + if is_union: + if len(init) > 1: + raise ValueError("union initializer: %d items given, but " + "only one supported (use a dict if needed)" + % (len(init),)) + if not isinstance(init, dict): + if isinstance(init, (bytes, unicode)): + raise TypeError("union initializer: got a str") + init = tuple(init) + if len(init) > len(fnames): + raise ValueError("too many values for %s initializer" % + CTypesStructOrUnion._get_c_name()) + init = dict(zip(fnames, init)) + addr = ctypes.addressof(blob) + for fname, value in init.items(): + BField, bitsize = name2fieldtype[fname] + assert bitsize < 0, \ + "not implemented: initializer with bit fields" + offset = CTypesStructOrUnion._offsetof(fname) + PTR = ctypes.POINTER(BField._ctype) + p = ctypes.cast(addr + offset, PTR) + BField._initialize(p.contents, value) + is_union = CTypesStructOrUnion._kind == 'union' + name2fieldtype = dict(zip(fnames, zip(btypes, bitfields))) + # + for fname, BField, bitsize in fields: + if fname == '': + raise NotImplementedError("nested anonymous structs/unions") + if hasattr(CTypesStructOrUnion, fname): + raise ValueError("the field name %r conflicts in " + "the ctypes backend" % fname) + if bitsize < 0: + def getter(self, fname=fname, BField=BField, + offset=CTypesStructOrUnion._offsetof(fname), + PTR=ctypes.POINTER(BField._ctype)): + addr = ctypes.addressof(self._blob) + p = ctypes.cast(addr + offset, PTR) + return BField._from_ctypes(p.contents) + def setter(self, value, fname=fname, BField=BField): + setattr(self._blob, fname, BField._to_ctypes(value)) + # + if issubclass(BField, CTypesGenericArray): + setter = None + if BField._declared_length == 0: + def getter(self, fname=fname, BFieldPtr=BField._CTPtr, + offset=CTypesStructOrUnion._offsetof(fname), + PTR=ctypes.POINTER(BField._ctype)): + addr = ctypes.addressof(self._blob) + p = ctypes.cast(addr + offset, PTR) + return BFieldPtr._from_ctypes(p) + # + else: + def getter(self, fname=fname, BField=BField): + return BField._from_ctypes(getattr(self._blob, fname)) + def setter(self, value, fname=fname, BField=BField): + # xxx obscure workaround + value = BField._to_ctypes(value) + oldvalue = getattr(self._blob, fname) + setattr(self._blob, fname, value) + if value != getattr(self._blob, fname): + setattr(self._blob, fname, oldvalue) + raise OverflowError("value too large for bitfield") + setattr(CTypesStructOrUnion, fname, property(getter, setter)) + # + CTypesPtr = self.ffi._get_cached_btype(model.PointerType(tp)) + for fname in fnames: + if hasattr(CTypesPtr, fname): + raise ValueError("the field name %r conflicts in " + "the ctypes backend" % fname) + def getter(self, fname=fname): + return getattr(self[0], fname) + def setter(self, value, fname=fname): + setattr(self[0], fname, value) + setattr(CTypesPtr, fname, property(getter, setter)) + + def new_function_type(self, BArgs, BResult, has_varargs): + nameargs = [BArg._get_c_name() for BArg in BArgs] + if has_varargs: + nameargs.append('...') + nameargs = ', '.join(nameargs) + # + class CTypesFunctionPtr(CTypesGenericPtr): + __slots__ = ['_own_callback', '_name'] + _ctype = ctypes.CFUNCTYPE(getattr(BResult, '_ctype', None), + *[BArg._ctype for BArg in BArgs], + use_errno=True) + _reftypename = BResult._get_c_name('(* &)(%s)' % (nameargs,)) + + def __init__(self, init, error=None): + # create a callback to the Python callable init() + import traceback + assert not has_varargs, "varargs not supported for callbacks" + if getattr(BResult, '_ctype', None) is not None: + error = BResult._from_ctypes( + BResult._create_ctype_obj(error)) + else: + error = None + def callback(*args): + args2 = [] + for arg, BArg in zip(args, BArgs): + args2.append(BArg._from_ctypes(arg)) + try: + res2 = init(*args2) + res2 = BResult._to_ctypes(res2) + except: + traceback.print_exc() + res2 = error + if issubclass(BResult, CTypesGenericPtr): + if res2: + res2 = ctypes.cast(res2, ctypes.c_void_p).value + # .value: http://bugs.python.org/issue1574593 + else: + res2 = None + #print repr(res2) + return res2 + if issubclass(BResult, CTypesGenericPtr): + # The only pointers callbacks can return are void*s: + # http://bugs.python.org/issue5710 + callback_ctype = ctypes.CFUNCTYPE( + ctypes.c_void_p, + *[BArg._ctype for BArg in BArgs], + use_errno=True) + else: + callback_ctype = CTypesFunctionPtr._ctype + self._as_ctype_ptr = callback_ctype(callback) + self._address = ctypes.cast(self._as_ctype_ptr, + ctypes.c_void_p).value + self._own_callback = init + + @staticmethod + def _initialize(ctypes_ptr, value): + if value: + raise NotImplementedError("ctypes backend: not supported: " + "initializers for function pointers") + + def __repr__(self): + c_name = getattr(self, '_name', None) + if c_name: + i = self._reftypename.index('(* &)') + if self._reftypename[i-1] not in ' )*': + c_name = ' ' + c_name + c_name = self._reftypename.replace('(* &)', c_name) + return CTypesData.__repr__(self, c_name) + + def _get_own_repr(self): + if getattr(self, '_own_callback', None) is not None: + return 'calling %r' % (self._own_callback,) + return super(CTypesFunctionPtr, self)._get_own_repr() + + def __call__(self, *args): + if has_varargs: + assert len(args) >= len(BArgs) + extraargs = args[len(BArgs):] + args = args[:len(BArgs)] + else: + assert len(args) == len(BArgs) + ctypes_args = [] + for arg, BArg in zip(args, BArgs): + ctypes_args.append(BArg._arg_to_ctypes(arg)) + if has_varargs: + for i, arg in enumerate(extraargs): + if arg is None: + ctypes_args.append(ctypes.c_void_p(0)) # NULL + continue + if not isinstance(arg, CTypesData): + raise TypeError( + "argument %d passed in the variadic part " + "needs to be a cdata object (got %s)" % + (1 + len(BArgs) + i, type(arg).__name__)) + ctypes_args.append(arg._arg_to_ctypes(arg)) + result = self._as_ctype_ptr(*ctypes_args) + return BResult._from_ctypes(result) + # + CTypesFunctionPtr._fix_class() + return CTypesFunctionPtr + + def new_enum_type(self, name, enumerators, enumvalues, CTypesInt): + assert isinstance(name, str) + reverse_mapping = dict(zip(reversed(enumvalues), + reversed(enumerators))) + # + class CTypesEnum(CTypesInt): + __slots__ = [] + _reftypename = '%s &' % name + + def _get_own_repr(self): + value = self._value + try: + return '%d: %s' % (value, reverse_mapping[value]) + except KeyError: + return str(value) + + def _to_string(self, maxlen): + value = self._value + try: + return reverse_mapping[value] + except KeyError: + return str(value) + # + CTypesEnum._fix_class() + return CTypesEnum + + def get_errno(self): + return ctypes.get_errno() + + def set_errno(self, value): + ctypes.set_errno(value) + + def string(self, b, maxlen=-1): + return b._to_string(maxlen) + + def buffer(self, bptr, size=-1): + raise NotImplementedError("buffer() with ctypes backend") + + def sizeof(self, cdata_or_BType): + if isinstance(cdata_or_BType, CTypesData): + return cdata_or_BType._get_size_of_instance() + else: + assert issubclass(cdata_or_BType, CTypesData) + return cdata_or_BType._get_size() + + def alignof(self, BType): + assert issubclass(BType, CTypesData) + return BType._alignment() + + def newp(self, BType, source): + if not issubclass(BType, CTypesData): + raise TypeError + return BType._newp(source) + + def cast(self, BType, source): + return BType._cast_from(source) + + def callback(self, BType, source, error, onerror): + assert onerror is None # XXX not implemented + return BType(source, error) + + _weakref_cache_ref = None + + def gcp(self, cdata, destructor, size=0): + if self._weakref_cache_ref is None: + import weakref + class MyRef(weakref.ref): + def __eq__(self, other): + myref = self() + return self is other or ( + myref is not None and myref is other()) + def __ne__(self, other): + return not (self == other) + def __hash__(self): + try: + return self._hash + except AttributeError: + self._hash = hash(self()) + return self._hash + self._weakref_cache_ref = {}, MyRef + weak_cache, MyRef = self._weakref_cache_ref + + if destructor is None: + try: + del weak_cache[MyRef(cdata)] + except KeyError: + raise TypeError("Can remove destructor only on a object " + "previously returned by ffi.gc()") + return None + + def remove(k): + cdata, destructor = weak_cache.pop(k, (None, None)) + if destructor is not None: + destructor(cdata) + + new_cdata = self.cast(self.typeof(cdata), cdata) + assert new_cdata is not cdata + weak_cache[MyRef(new_cdata, remove)] = (cdata, destructor) + return new_cdata + + typeof = type + + def getcname(self, BType, replace_with): + return BType._get_c_name(replace_with) + + def typeoffsetof(self, BType, fieldname, num=0): + if isinstance(fieldname, str): + if num == 0 and issubclass(BType, CTypesGenericPtr): + BType = BType._BItem + if not issubclass(BType, CTypesBaseStructOrUnion): + raise TypeError("expected a struct or union ctype") + BField = BType._bfield_types[fieldname] + if BField is Ellipsis: + raise TypeError("not supported for bitfields") + return (BField, BType._offsetof(fieldname)) + elif isinstance(fieldname, (int, long)): + if issubclass(BType, CTypesGenericArray): + BType = BType._CTPtr + if not issubclass(BType, CTypesGenericPtr): + raise TypeError("expected an array or ptr ctype") + BItem = BType._BItem + offset = BItem._get_size() * fieldname + if offset > sys.maxsize: + raise OverflowError + return (BItem, offset) + else: + raise TypeError(type(fieldname)) + + def rawaddressof(self, BTypePtr, cdata, offset=None): + if isinstance(cdata, CTypesBaseStructOrUnion): + ptr = ctypes.pointer(type(cdata)._to_ctypes(cdata)) + elif isinstance(cdata, CTypesGenericPtr): + if offset is None or not issubclass(type(cdata)._BItem, + CTypesBaseStructOrUnion): + raise TypeError("unexpected cdata type") + ptr = type(cdata)._to_ctypes(cdata) + elif isinstance(cdata, CTypesGenericArray): + ptr = type(cdata)._to_ctypes(cdata) + else: + raise TypeError("expected a ") + if offset: + ptr = ctypes.cast( + ctypes.c_void_p( + ctypes.cast(ptr, ctypes.c_void_p).value + offset), + type(ptr)) + return BTypePtr._from_ctypes(ptr) + + +class CTypesLibrary(object): + + def __init__(self, backend, cdll): + self.backend = backend + self.cdll = cdll + + def load_function(self, BType, name): + c_func = getattr(self.cdll, name) + funcobj = BType._from_ctypes(c_func) + funcobj._name = name + return funcobj + + def read_variable(self, BType, name): + try: + ctypes_obj = BType._ctype.in_dll(self.cdll, name) + except AttributeError as e: + raise NotImplementedError(e) + return BType._from_ctypes(ctypes_obj) + + def write_variable(self, BType, name, value): + new_ctypes_obj = BType._to_ctypes(value) + ctypes_obj = BType._ctype.in_dll(self.cdll, name) + ctypes.memmove(ctypes.addressof(ctypes_obj), + ctypes.addressof(new_ctypes_obj), + ctypes.sizeof(BType._ctype)) diff --git a/website/web/Lib/site-packages/cffi/cffi_opcode.py b/website/web/Lib/site-packages/cffi/cffi_opcode.py new file mode 100644 index 000000000..a0df98d1c --- /dev/null +++ b/website/web/Lib/site-packages/cffi/cffi_opcode.py @@ -0,0 +1,187 @@ +from .error import VerificationError + +class CffiOp(object): + def __init__(self, op, arg): + self.op = op + self.arg = arg + + def as_c_expr(self): + if self.op is None: + assert isinstance(self.arg, str) + return '(_cffi_opcode_t)(%s)' % (self.arg,) + classname = CLASS_NAME[self.op] + return '_CFFI_OP(_CFFI_OP_%s, %s)' % (classname, self.arg) + + def as_python_bytes(self): + if self.op is None and self.arg.isdigit(): + value = int(self.arg) # non-negative: '-' not in self.arg + if value >= 2**31: + raise OverflowError("cannot emit %r: limited to 2**31-1" + % (self.arg,)) + return format_four_bytes(value) + if isinstance(self.arg, str): + raise VerificationError("cannot emit to Python: %r" % (self.arg,)) + return format_four_bytes((self.arg << 8) | self.op) + + def __str__(self): + classname = CLASS_NAME.get(self.op, self.op) + return '(%s %s)' % (classname, self.arg) + +def format_four_bytes(num): + return '\\x%02X\\x%02X\\x%02X\\x%02X' % ( + (num >> 24) & 0xFF, + (num >> 16) & 0xFF, + (num >> 8) & 0xFF, + (num ) & 0xFF) + +OP_PRIMITIVE = 1 +OP_POINTER = 3 +OP_ARRAY = 5 +OP_OPEN_ARRAY = 7 +OP_STRUCT_UNION = 9 +OP_ENUM = 11 +OP_FUNCTION = 13 +OP_FUNCTION_END = 15 +OP_NOOP = 17 +OP_BITFIELD = 19 +OP_TYPENAME = 21 +OP_CPYTHON_BLTN_V = 23 # varargs +OP_CPYTHON_BLTN_N = 25 # noargs +OP_CPYTHON_BLTN_O = 27 # O (i.e. a single arg) +OP_CONSTANT = 29 +OP_CONSTANT_INT = 31 +OP_GLOBAL_VAR = 33 +OP_DLOPEN_FUNC = 35 +OP_DLOPEN_CONST = 37 +OP_GLOBAL_VAR_F = 39 +OP_EXTERN_PYTHON = 41 + +PRIM_VOID = 0 +PRIM_BOOL = 1 +PRIM_CHAR = 2 +PRIM_SCHAR = 3 +PRIM_UCHAR = 4 +PRIM_SHORT = 5 +PRIM_USHORT = 6 +PRIM_INT = 7 +PRIM_UINT = 8 +PRIM_LONG = 9 +PRIM_ULONG = 10 +PRIM_LONGLONG = 11 +PRIM_ULONGLONG = 12 +PRIM_FLOAT = 13 +PRIM_DOUBLE = 14 +PRIM_LONGDOUBLE = 15 + +PRIM_WCHAR = 16 +PRIM_INT8 = 17 +PRIM_UINT8 = 18 +PRIM_INT16 = 19 +PRIM_UINT16 = 20 +PRIM_INT32 = 21 +PRIM_UINT32 = 22 +PRIM_INT64 = 23 +PRIM_UINT64 = 24 +PRIM_INTPTR = 25 +PRIM_UINTPTR = 26 +PRIM_PTRDIFF = 27 +PRIM_SIZE = 28 +PRIM_SSIZE = 29 +PRIM_INT_LEAST8 = 30 +PRIM_UINT_LEAST8 = 31 +PRIM_INT_LEAST16 = 32 +PRIM_UINT_LEAST16 = 33 +PRIM_INT_LEAST32 = 34 +PRIM_UINT_LEAST32 = 35 +PRIM_INT_LEAST64 = 36 +PRIM_UINT_LEAST64 = 37 +PRIM_INT_FAST8 = 38 +PRIM_UINT_FAST8 = 39 +PRIM_INT_FAST16 = 40 +PRIM_UINT_FAST16 = 41 +PRIM_INT_FAST32 = 42 +PRIM_UINT_FAST32 = 43 +PRIM_INT_FAST64 = 44 +PRIM_UINT_FAST64 = 45 +PRIM_INTMAX = 46 +PRIM_UINTMAX = 47 +PRIM_FLOATCOMPLEX = 48 +PRIM_DOUBLECOMPLEX = 49 +PRIM_CHAR16 = 50 +PRIM_CHAR32 = 51 + +_NUM_PRIM = 52 +_UNKNOWN_PRIM = -1 +_UNKNOWN_FLOAT_PRIM = -2 +_UNKNOWN_LONG_DOUBLE = -3 + +_IO_FILE_STRUCT = -1 + +PRIMITIVE_TO_INDEX = { + 'char': PRIM_CHAR, + 'short': PRIM_SHORT, + 'int': PRIM_INT, + 'long': PRIM_LONG, + 'long long': PRIM_LONGLONG, + 'signed char': PRIM_SCHAR, + 'unsigned char': PRIM_UCHAR, + 'unsigned short': PRIM_USHORT, + 'unsigned int': PRIM_UINT, + 'unsigned long': PRIM_ULONG, + 'unsigned long long': PRIM_ULONGLONG, + 'float': PRIM_FLOAT, + 'double': PRIM_DOUBLE, + 'long double': PRIM_LONGDOUBLE, + 'float _Complex': PRIM_FLOATCOMPLEX, + 'double _Complex': PRIM_DOUBLECOMPLEX, + '_Bool': PRIM_BOOL, + 'wchar_t': PRIM_WCHAR, + 'char16_t': PRIM_CHAR16, + 'char32_t': PRIM_CHAR32, + 'int8_t': PRIM_INT8, + 'uint8_t': PRIM_UINT8, + 'int16_t': PRIM_INT16, + 'uint16_t': PRIM_UINT16, + 'int32_t': PRIM_INT32, + 'uint32_t': PRIM_UINT32, + 'int64_t': PRIM_INT64, + 'uint64_t': PRIM_UINT64, + 'intptr_t': PRIM_INTPTR, + 'uintptr_t': PRIM_UINTPTR, + 'ptrdiff_t': PRIM_PTRDIFF, + 'size_t': PRIM_SIZE, + 'ssize_t': PRIM_SSIZE, + 'int_least8_t': PRIM_INT_LEAST8, + 'uint_least8_t': PRIM_UINT_LEAST8, + 'int_least16_t': PRIM_INT_LEAST16, + 'uint_least16_t': PRIM_UINT_LEAST16, + 'int_least32_t': PRIM_INT_LEAST32, + 'uint_least32_t': PRIM_UINT_LEAST32, + 'int_least64_t': PRIM_INT_LEAST64, + 'uint_least64_t': PRIM_UINT_LEAST64, + 'int_fast8_t': PRIM_INT_FAST8, + 'uint_fast8_t': PRIM_UINT_FAST8, + 'int_fast16_t': PRIM_INT_FAST16, + 'uint_fast16_t': PRIM_UINT_FAST16, + 'int_fast32_t': PRIM_INT_FAST32, + 'uint_fast32_t': PRIM_UINT_FAST32, + 'int_fast64_t': PRIM_INT_FAST64, + 'uint_fast64_t': PRIM_UINT_FAST64, + 'intmax_t': PRIM_INTMAX, + 'uintmax_t': PRIM_UINTMAX, + } + +F_UNION = 0x01 +F_CHECK_FIELDS = 0x02 +F_PACKED = 0x04 +F_EXTERNAL = 0x08 +F_OPAQUE = 0x10 + +G_FLAGS = dict([('_CFFI_' + _key, globals()[_key]) + for _key in ['F_UNION', 'F_CHECK_FIELDS', 'F_PACKED', + 'F_EXTERNAL', 'F_OPAQUE']]) + +CLASS_NAME = {} +for _name, _value in list(globals().items()): + if _name.startswith('OP_') and isinstance(_value, int): + CLASS_NAME[_value] = _name[3:] diff --git a/website/web/Lib/site-packages/cffi/commontypes.py b/website/web/Lib/site-packages/cffi/commontypes.py new file mode 100644 index 000000000..8ec97c756 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/commontypes.py @@ -0,0 +1,80 @@ +import sys +from . import model +from .error import FFIError + + +COMMON_TYPES = {} + +try: + # fetch "bool" and all simple Windows types + from _cffi_backend import _get_common_types + _get_common_types(COMMON_TYPES) +except ImportError: + pass + +COMMON_TYPES['FILE'] = model.unknown_type('FILE', '_IO_FILE') +COMMON_TYPES['bool'] = '_Bool' # in case we got ImportError above + +for _type in model.PrimitiveType.ALL_PRIMITIVE_TYPES: + if _type.endswith('_t'): + COMMON_TYPES[_type] = _type +del _type + +_CACHE = {} + +def resolve_common_type(parser, commontype): + try: + return _CACHE[commontype] + except KeyError: + cdecl = COMMON_TYPES.get(commontype, commontype) + if not isinstance(cdecl, str): + result, quals = cdecl, 0 # cdecl is already a BaseType + elif cdecl in model.PrimitiveType.ALL_PRIMITIVE_TYPES: + result, quals = model.PrimitiveType(cdecl), 0 + elif cdecl == 'set-unicode-needed': + raise FFIError("The Windows type %r is only available after " + "you call ffi.set_unicode()" % (commontype,)) + else: + if commontype == cdecl: + raise FFIError( + "Unsupported type: %r. Please look at " + "http://cffi.readthedocs.io/en/latest/cdef.html#ffi-cdef-limitations " + "and file an issue if you think this type should really " + "be supported." % (commontype,)) + result, quals = parser.parse_type_and_quals(cdecl) # recursive + + assert isinstance(result, model.BaseTypeByIdentity) + _CACHE[commontype] = result, quals + return result, quals + + +# ____________________________________________________________ +# extra types for Windows (most of them are in commontypes.c) + + +def win_common_types(): + return { + "UNICODE_STRING": model.StructType( + "_UNICODE_STRING", + ["Length", + "MaximumLength", + "Buffer"], + [model.PrimitiveType("unsigned short"), + model.PrimitiveType("unsigned short"), + model.PointerType(model.PrimitiveType("wchar_t"))], + [-1, -1, -1]), + "PUNICODE_STRING": "UNICODE_STRING *", + "PCUNICODE_STRING": "const UNICODE_STRING *", + + "TBYTE": "set-unicode-needed", + "TCHAR": "set-unicode-needed", + "LPCTSTR": "set-unicode-needed", + "PCTSTR": "set-unicode-needed", + "LPTSTR": "set-unicode-needed", + "PTSTR": "set-unicode-needed", + "PTBYTE": "set-unicode-needed", + "PTCHAR": "set-unicode-needed", + } + +if sys.platform == 'win32': + COMMON_TYPES.update(win_common_types()) diff --git a/website/web/Lib/site-packages/cffi/cparser.py b/website/web/Lib/site-packages/cffi/cparser.py new file mode 100644 index 000000000..f7e2e3563 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/cparser.py @@ -0,0 +1,891 @@ +from . import model +from .commontypes import COMMON_TYPES, resolve_common_type +from .error import FFIError, CDefError +try: + from . import _pycparser as pycparser +except ImportError: + import pycparser +import weakref, re, sys + +try: + if sys.version_info < (3,): + import thread as _thread + else: + import _thread + lock = _thread.allocate_lock() +except ImportError: + lock = None + +CDEF_SOURCE_STRING = "" +_r_comment = re.compile(r"/\*.*?\*/|//([^\n\\]|\\.)*?$", + re.DOTALL | re.MULTILINE) +_r_define = re.compile(r"^\s*#\s*define\s+([A-Za-z_][A-Za-z_0-9]*)" + r"\b((?:[^\n\\]|\\.)*?)$", + re.DOTALL | re.MULTILINE) +_r_partial_enum = re.compile(r"=\s*\.\.\.\s*[,}]|\.\.\.\s*\}") +_r_enum_dotdotdot = re.compile(r"__dotdotdot\d+__$") +_r_partial_array = re.compile(r"\[\s*\.\.\.\s*\]") +_r_words = re.compile(r"\w+|\S") +_parser_cache = None +_r_int_literal = re.compile(r"-?0?x?[0-9a-f]+[lu]*$", re.IGNORECASE) +_r_stdcall1 = re.compile(r"\b(__stdcall|WINAPI)\b") +_r_stdcall2 = re.compile(r"[(]\s*(__stdcall|WINAPI)\b") +_r_cdecl = re.compile(r"\b__cdecl\b") +_r_extern_python = re.compile(r'\bextern\s*"' + r'(Python|Python\s*\+\s*C|C\s*\+\s*Python)"\s*.') +_r_star_const_space = re.compile( # matches "* const " + r"[*]\s*((const|volatile|restrict)\b\s*)+") +_r_int_dotdotdot = re.compile(r"(\b(int|long|short|signed|unsigned|char)\s*)+" + r"\.\.\.") +_r_float_dotdotdot = re.compile(r"\b(double|float)\s*\.\.\.") + +def _get_parser(): + global _parser_cache + if _parser_cache is None: + _parser_cache = pycparser.CParser() + return _parser_cache + +def _workaround_for_old_pycparser(csource): + # Workaround for a pycparser issue (fixed between pycparser 2.10 and + # 2.14): "char*const***" gives us a wrong syntax tree, the same as + # for "char***(*const)". This means we can't tell the difference + # afterwards. But "char(*const(***))" gives us the right syntax + # tree. The issue only occurs if there are several stars in + # sequence with no parenthesis inbetween, just possibly qualifiers. + # Attempt to fix it by adding some parentheses in the source: each + # time we see "* const" or "* const *", we add an opening + # parenthesis before each star---the hard part is figuring out where + # to close them. + parts = [] + while True: + match = _r_star_const_space.search(csource) + if not match: + break + #print repr(''.join(parts)+csource), '=>', + parts.append(csource[:match.start()]) + parts.append('('); closing = ')' + parts.append(match.group()) # e.g. "* const " + endpos = match.end() + if csource.startswith('*', endpos): + parts.append('('); closing += ')' + level = 0 + i = endpos + while i < len(csource): + c = csource[i] + if c == '(': + level += 1 + elif c == ')': + if level == 0: + break + level -= 1 + elif c in ',;=': + if level == 0: + break + i += 1 + csource = csource[endpos:i] + closing + csource[i:] + #print repr(''.join(parts)+csource) + parts.append(csource) + return ''.join(parts) + +def _preprocess_extern_python(csource): + # input: `extern "Python" int foo(int);` or + # `extern "Python" { int foo(int); }` + # output: + # void __cffi_extern_python_start; + # int foo(int); + # void __cffi_extern_python_stop; + # + # input: `extern "Python+C" int foo(int);` + # output: + # void __cffi_extern_python_plus_c_start; + # int foo(int); + # void __cffi_extern_python_stop; + parts = [] + while True: + match = _r_extern_python.search(csource) + if not match: + break + endpos = match.end() - 1 + #print + #print ''.join(parts)+csource + #print '=>' + parts.append(csource[:match.start()]) + if 'C' in match.group(1): + parts.append('void __cffi_extern_python_plus_c_start; ') + else: + parts.append('void __cffi_extern_python_start; ') + if csource[endpos] == '{': + # grouping variant + closing = csource.find('}', endpos) + if closing < 0: + raise CDefError("'extern \"Python\" {': no '}' found") + if csource.find('{', endpos + 1, closing) >= 0: + raise NotImplementedError("cannot use { } inside a block " + "'extern \"Python\" { ... }'") + parts.append(csource[endpos+1:closing]) + csource = csource[closing+1:] + else: + # non-grouping variant + semicolon = csource.find(';', endpos) + if semicolon < 0: + raise CDefError("'extern \"Python\": no ';' found") + parts.append(csource[endpos:semicolon+1]) + csource = csource[semicolon+1:] + parts.append(' void __cffi_extern_python_stop;') + #print ''.join(parts)+csource + #print + parts.append(csource) + return ''.join(parts) + +def _preprocess(csource): + # Remove comments. NOTE: this only work because the cdef() section + # should not contain any string literal! + csource = _r_comment.sub(' ', csource) + # Remove the "#define FOO x" lines + macros = {} + for match in _r_define.finditer(csource): + macroname, macrovalue = match.groups() + macrovalue = macrovalue.replace('\\\n', '').strip() + macros[macroname] = macrovalue + csource = _r_define.sub('', csource) + # + if pycparser.__version__ < '2.14': + csource = _workaround_for_old_pycparser(csource) + # + # BIG HACK: replace WINAPI or __stdcall with "volatile const". + # It doesn't make sense for the return type of a function to be + # "volatile volatile const", so we abuse it to detect __stdcall... + # Hack number 2 is that "int(volatile *fptr)();" is not valid C + # syntax, so we place the "volatile" before the opening parenthesis. + csource = _r_stdcall2.sub(' volatile volatile const(', csource) + csource = _r_stdcall1.sub(' volatile volatile const ', csource) + csource = _r_cdecl.sub(' ', csource) + # + # Replace `extern "Python"` with start/end markers + csource = _preprocess_extern_python(csource) + # + # Replace "[...]" with "[__dotdotdotarray__]" + csource = _r_partial_array.sub('[__dotdotdotarray__]', csource) + # + # Replace "...}" with "__dotdotdotNUM__}". This construction should + # occur only at the end of enums; at the end of structs we have "...;}" + # and at the end of vararg functions "...);". Also replace "=...[,}]" + # with ",__dotdotdotNUM__[,}]": this occurs in the enums too, when + # giving an unknown value. + matches = list(_r_partial_enum.finditer(csource)) + for number, match in enumerate(reversed(matches)): + p = match.start() + if csource[p] == '=': + p2 = csource.find('...', p, match.end()) + assert p2 > p + csource = '%s,__dotdotdot%d__ %s' % (csource[:p], number, + csource[p2+3:]) + else: + assert csource[p:p+3] == '...' + csource = '%s __dotdotdot%d__ %s' % (csource[:p], number, + csource[p+3:]) + # Replace "int ..." or "unsigned long int..." with "__dotdotdotint__" + csource = _r_int_dotdotdot.sub(' __dotdotdotint__ ', csource) + # Replace "float ..." or "double..." with "__dotdotdotfloat__" + csource = _r_float_dotdotdot.sub(' __dotdotdotfloat__ ', csource) + # Replace all remaining "..." with the same name, "__dotdotdot__", + # which is declared with a typedef for the purpose of C parsing. + return csource.replace('...', ' __dotdotdot__ '), macros + +def _common_type_names(csource): + # Look in the source for what looks like usages of types from the + # list of common types. A "usage" is approximated here as the + # appearance of the word, minus a "definition" of the type, which + # is the last word in a "typedef" statement. Approximative only + # but should be fine for all the common types. + look_for_words = set(COMMON_TYPES) + look_for_words.add(';') + look_for_words.add(',') + look_for_words.add('(') + look_for_words.add(')') + look_for_words.add('typedef') + words_used = set() + is_typedef = False + paren = 0 + previous_word = '' + for word in _r_words.findall(csource): + if word in look_for_words: + if word == ';': + if is_typedef: + words_used.discard(previous_word) + look_for_words.discard(previous_word) + is_typedef = False + elif word == 'typedef': + is_typedef = True + paren = 0 + elif word == '(': + paren += 1 + elif word == ')': + paren -= 1 + elif word == ',': + if is_typedef and paren == 0: + words_used.discard(previous_word) + look_for_words.discard(previous_word) + else: # word in COMMON_TYPES + words_used.add(word) + previous_word = word + return words_used + + +class Parser(object): + + def __init__(self): + self._declarations = {} + self._included_declarations = set() + self._anonymous_counter = 0 + self._structnode2type = weakref.WeakKeyDictionary() + self._options = {} + self._int_constants = {} + self._recomplete = [] + self._uses_new_feature = None + + def _parse(self, csource): + csource, macros = _preprocess(csource) + # XXX: for more efficiency we would need to poke into the + # internals of CParser... the following registers the + # typedefs, because their presence or absence influences the + # parsing itself (but what they are typedef'ed to plays no role) + ctn = _common_type_names(csource) + typenames = [] + for name in sorted(self._declarations): + if name.startswith('typedef '): + name = name[8:] + typenames.append(name) + ctn.discard(name) + typenames += sorted(ctn) + # + csourcelines = [] + csourcelines.append('# 1 ""') + for typename in typenames: + csourcelines.append('typedef int %s;' % typename) + csourcelines.append('typedef int __dotdotdotint__, __dotdotdotfloat__,' + ' __dotdotdot__;') + # this forces pycparser to consider the following in the file + # called from line 1 + csourcelines.append('# 1 "%s"' % (CDEF_SOURCE_STRING,)) + csourcelines.append(csource) + fullcsource = '\n'.join(csourcelines) + if lock is not None: + lock.acquire() # pycparser is not thread-safe... + try: + ast = _get_parser().parse(fullcsource) + except pycparser.c_parser.ParseError as e: + self.convert_pycparser_error(e, csource) + finally: + if lock is not None: + lock.release() + # csource will be used to find buggy source text + return ast, macros, csource + + def _convert_pycparser_error(self, e, csource): + # xxx look for ":NUM:" at the start of str(e) + # and interpret that as a line number. This will not work if + # the user gives explicit ``# NUM "FILE"`` directives. + line = None + msg = str(e) + match = re.match(r"%s:(\d+):" % (CDEF_SOURCE_STRING,), msg) + if match: + linenum = int(match.group(1), 10) + csourcelines = csource.splitlines() + if 1 <= linenum <= len(csourcelines): + line = csourcelines[linenum-1] + return line + + def convert_pycparser_error(self, e, csource): + line = self._convert_pycparser_error(e, csource) + + msg = str(e) + if line: + msg = 'cannot parse "%s"\n%s' % (line.strip(), msg) + else: + msg = 'parse error\n%s' % (msg,) + raise CDefError(msg) + + def parse(self, csource, override=False, packed=False, dllexport=False): + prev_options = self._options + try: + self._options = {'override': override, + 'packed': packed, + 'dllexport': dllexport} + self._internal_parse(csource) + finally: + self._options = prev_options + + def _internal_parse(self, csource): + ast, macros, csource = self._parse(csource) + # add the macros + self._process_macros(macros) + # find the first "__dotdotdot__" and use that as a separator + # between the repeated typedefs and the real csource + iterator = iter(ast.ext) + for decl in iterator: + if decl.name == '__dotdotdot__': + break + else: + assert 0 + current_decl = None + # + try: + self._inside_extern_python = '__cffi_extern_python_stop' + for decl in iterator: + current_decl = decl + if isinstance(decl, pycparser.c_ast.Decl): + self._parse_decl(decl) + elif isinstance(decl, pycparser.c_ast.Typedef): + if not decl.name: + raise CDefError("typedef does not declare any name", + decl) + quals = 0 + if (isinstance(decl.type.type, pycparser.c_ast.IdentifierType) and + decl.type.type.names[-1].startswith('__dotdotdot')): + realtype = self._get_unknown_type(decl) + elif (isinstance(decl.type, pycparser.c_ast.PtrDecl) and + isinstance(decl.type.type, pycparser.c_ast.TypeDecl) and + isinstance(decl.type.type.type, + pycparser.c_ast.IdentifierType) and + decl.type.type.type.names[-1].startswith('__dotdotdot')): + realtype = self._get_unknown_ptr_type(decl) + else: + realtype, quals = self._get_type_and_quals( + decl.type, name=decl.name, partial_length_ok=True) + self._declare('typedef ' + decl.name, realtype, quals=quals) + elif decl.__class__.__name__ == 'Pragma': + pass # skip pragma, only in pycparser 2.15 + else: + raise CDefError("unexpected <%s>: this construct is valid " + "C but not valid in cdef()" % + decl.__class__.__name__, decl) + except CDefError as e: + if len(e.args) == 1: + e.args = e.args + (current_decl,) + raise + except FFIError as e: + msg = self._convert_pycparser_error(e, csource) + if msg: + e.args = (e.args[0] + "\n *** Err: %s" % msg,) + raise + + def _add_constants(self, key, val): + if key in self._int_constants: + if self._int_constants[key] == val: + return # ignore identical double declarations + raise FFIError( + "multiple declarations of constant: %s" % (key,)) + self._int_constants[key] = val + + def _add_integer_constant(self, name, int_str): + int_str = int_str.lower().rstrip("ul") + neg = int_str.startswith('-') + if neg: + int_str = int_str[1:] + # "010" is not valid oct in py3 + if (int_str.startswith("0") and int_str != '0' + and not int_str.startswith("0x")): + int_str = "0o" + int_str[1:] + pyvalue = int(int_str, 0) + if neg: + pyvalue = -pyvalue + self._add_constants(name, pyvalue) + self._declare('macro ' + name, pyvalue) + + def _process_macros(self, macros): + for key, value in macros.items(): + value = value.strip() + if _r_int_literal.match(value): + self._add_integer_constant(key, value) + elif value == '...': + self._declare('macro ' + key, value) + else: + raise CDefError( + 'only supports one of the following syntax:\n' + ' #define %s ... (literally dot-dot-dot)\n' + ' #define %s NUMBER (with NUMBER an integer' + ' constant, decimal/hex/octal)\n' + 'got:\n' + ' #define %s %s' + % (key, key, key, value)) + + def _declare_function(self, tp, quals, decl): + tp = self._get_type_pointer(tp, quals) + if self._options.get('dllexport'): + tag = 'dllexport_python ' + elif self._inside_extern_python == '__cffi_extern_python_start': + tag = 'extern_python ' + elif self._inside_extern_python == '__cffi_extern_python_plus_c_start': + tag = 'extern_python_plus_c ' + else: + tag = 'function ' + self._declare(tag + decl.name, tp) + + def _parse_decl(self, decl): + node = decl.type + if isinstance(node, pycparser.c_ast.FuncDecl): + tp, quals = self._get_type_and_quals(node, name=decl.name) + assert isinstance(tp, model.RawFunctionType) + self._declare_function(tp, quals, decl) + else: + if isinstance(node, pycparser.c_ast.Struct): + self._get_struct_union_enum_type('struct', node) + elif isinstance(node, pycparser.c_ast.Union): + self._get_struct_union_enum_type('union', node) + elif isinstance(node, pycparser.c_ast.Enum): + self._get_struct_union_enum_type('enum', node) + elif not decl.name: + raise CDefError("construct does not declare any variable", + decl) + # + if decl.name: + tp, quals = self._get_type_and_quals(node, + partial_length_ok=True) + if tp.is_raw_function: + self._declare_function(tp, quals, decl) + elif (tp.is_integer_type() and + hasattr(decl, 'init') and + hasattr(decl.init, 'value') and + _r_int_literal.match(decl.init.value)): + self._add_integer_constant(decl.name, decl.init.value) + elif (tp.is_integer_type() and + isinstance(decl.init, pycparser.c_ast.UnaryOp) and + decl.init.op == '-' and + hasattr(decl.init.expr, 'value') and + _r_int_literal.match(decl.init.expr.value)): + self._add_integer_constant(decl.name, + '-' + decl.init.expr.value) + elif (tp is model.void_type and + decl.name.startswith('__cffi_extern_python_')): + # hack: `extern "Python"` in the C source is replaced + # with "void __cffi_extern_python_start;" and + # "void __cffi_extern_python_stop;" + self._inside_extern_python = decl.name + else: + if self._inside_extern_python !='__cffi_extern_python_stop': + raise CDefError( + "cannot declare constants or " + "variables with 'extern \"Python\"'") + if (quals & model.Q_CONST) and not tp.is_array_type: + self._declare('constant ' + decl.name, tp, quals=quals) + else: + self._declare('variable ' + decl.name, tp, quals=quals) + + def parse_type(self, cdecl): + return self.parse_type_and_quals(cdecl)[0] + + def parse_type_and_quals(self, cdecl): + ast, macros = self._parse('void __dummy(\n%s\n);' % cdecl)[:2] + assert not macros + exprnode = ast.ext[-1].type.args.params[0] + if isinstance(exprnode, pycparser.c_ast.ID): + raise CDefError("unknown identifier '%s'" % (exprnode.name,)) + return self._get_type_and_quals(exprnode.type) + + def _declare(self, name, obj, included=False, quals=0): + if name in self._declarations: + prevobj, prevquals = self._declarations[name] + if prevobj is obj and prevquals == quals: + return + if not self._options.get('override'): + raise FFIError( + "multiple declarations of %s (for interactive usage, " + "try cdef(xx, override=True))" % (name,)) + assert '__dotdotdot__' not in name.split() + self._declarations[name] = (obj, quals) + if included: + self._included_declarations.add(obj) + + def _extract_quals(self, type): + quals = 0 + if isinstance(type, (pycparser.c_ast.TypeDecl, + pycparser.c_ast.PtrDecl)): + if 'const' in type.quals: + quals |= model.Q_CONST + if 'volatile' in type.quals: + quals |= model.Q_VOLATILE + if 'restrict' in type.quals: + quals |= model.Q_RESTRICT + return quals + + def _get_type_pointer(self, type, quals, declname=None): + if isinstance(type, model.RawFunctionType): + return type.as_function_pointer() + if (isinstance(type, model.StructOrUnionOrEnum) and + type.name.startswith('$') and type.name[1:].isdigit() and + type.forcename is None and declname is not None): + return model.NamedPointerType(type, declname, quals) + return model.PointerType(type, quals) + + def _get_type_and_quals(self, typenode, name=None, partial_length_ok=False): + # first, dereference typedefs, if we have it already parsed, we're good + if (isinstance(typenode, pycparser.c_ast.TypeDecl) and + isinstance(typenode.type, pycparser.c_ast.IdentifierType) and + len(typenode.type.names) == 1 and + ('typedef ' + typenode.type.names[0]) in self._declarations): + tp, quals = self._declarations['typedef ' + typenode.type.names[0]] + quals |= self._extract_quals(typenode) + return tp, quals + # + if isinstance(typenode, pycparser.c_ast.ArrayDecl): + # array type + if typenode.dim is None: + length = None + else: + length = self._parse_constant( + typenode.dim, partial_length_ok=partial_length_ok) + tp, quals = self._get_type_and_quals(typenode.type, + partial_length_ok=partial_length_ok) + return model.ArrayType(tp, length), quals + # + if isinstance(typenode, pycparser.c_ast.PtrDecl): + # pointer type + itemtype, itemquals = self._get_type_and_quals(typenode.type) + tp = self._get_type_pointer(itemtype, itemquals, declname=name) + quals = self._extract_quals(typenode) + return tp, quals + # + if isinstance(typenode, pycparser.c_ast.TypeDecl): + quals = self._extract_quals(typenode) + type = typenode.type + if isinstance(type, pycparser.c_ast.IdentifierType): + # assume a primitive type. get it from .names, but reduce + # synonyms to a single chosen combination + names = list(type.names) + if names != ['signed', 'char']: # keep this unmodified + prefixes = {} + while names: + name = names[0] + if name in ('short', 'long', 'signed', 'unsigned'): + prefixes[name] = prefixes.get(name, 0) + 1 + del names[0] + else: + break + # ignore the 'signed' prefix below, and reorder the others + newnames = [] + for prefix in ('unsigned', 'short', 'long'): + for i in range(prefixes.get(prefix, 0)): + newnames.append(prefix) + if not names: + names = ['int'] # implicitly + if names == ['int']: # but kill it if 'short' or 'long' + if 'short' in prefixes or 'long' in prefixes: + names = [] + names = newnames + names + ident = ' '.join(names) + if ident == 'void': + return model.void_type, quals + if ident == '__dotdotdot__': + raise FFIError(':%d: bad usage of "..."' % + typenode.coord.line) + tp0, quals0 = resolve_common_type(self, ident) + return tp0, (quals | quals0) + # + if isinstance(type, pycparser.c_ast.Struct): + # 'struct foobar' + tp = self._get_struct_union_enum_type('struct', type, name) + return tp, quals + # + if isinstance(type, pycparser.c_ast.Union): + # 'union foobar' + tp = self._get_struct_union_enum_type('union', type, name) + return tp, quals + # + if isinstance(type, pycparser.c_ast.Enum): + # 'enum foobar' + tp = self._get_struct_union_enum_type('enum', type, name) + return tp, quals + # + if isinstance(typenode, pycparser.c_ast.FuncDecl): + # a function type + return self._parse_function_type(typenode, name), 0 + # + # nested anonymous structs or unions end up here + if isinstance(typenode, pycparser.c_ast.Struct): + return self._get_struct_union_enum_type('struct', typenode, name, + nested=True), 0 + if isinstance(typenode, pycparser.c_ast.Union): + return self._get_struct_union_enum_type('union', typenode, name, + nested=True), 0 + # + raise FFIError(":%d: bad or unsupported type declaration" % + typenode.coord.line) + + def _parse_function_type(self, typenode, funcname=None): + params = list(getattr(typenode.args, 'params', [])) + for i, arg in enumerate(params): + if not hasattr(arg, 'type'): + raise CDefError("%s arg %d: unknown type '%s'" + " (if you meant to use the old C syntax of giving" + " untyped arguments, it is not supported)" + % (funcname or 'in expression', i + 1, + getattr(arg, 'name', '?'))) + ellipsis = ( + len(params) > 0 and + isinstance(params[-1].type, pycparser.c_ast.TypeDecl) and + isinstance(params[-1].type.type, + pycparser.c_ast.IdentifierType) and + params[-1].type.type.names == ['__dotdotdot__']) + if ellipsis: + params.pop() + if not params: + raise CDefError( + "%s: a function with only '(...)' as argument" + " is not correct C" % (funcname or 'in expression')) + args = [self._as_func_arg(*self._get_type_and_quals(argdeclnode.type)) + for argdeclnode in params] + if not ellipsis and args == [model.void_type]: + args = [] + result, quals = self._get_type_and_quals(typenode.type) + # the 'quals' on the result type are ignored. HACK: we absure them + # to detect __stdcall functions: we textually replace "__stdcall" + # with "volatile volatile const" above. + abi = None + if hasattr(typenode.type, 'quals'): # else, probable syntax error anyway + if typenode.type.quals[-3:] == ['volatile', 'volatile', 'const']: + abi = '__stdcall' + return model.RawFunctionType(tuple(args), result, ellipsis, abi) + + def _as_func_arg(self, type, quals): + if isinstance(type, model.ArrayType): + return model.PointerType(type.item, quals) + elif isinstance(type, model.RawFunctionType): + return type.as_function_pointer() + else: + return type + + def _get_struct_union_enum_type(self, kind, type, name=None, nested=False): + # First, a level of caching on the exact 'type' node of the AST. + # This is obscure, but needed because pycparser "unrolls" declarations + # such as "typedef struct { } foo_t, *foo_p" and we end up with + # an AST that is not a tree, but a DAG, with the "type" node of the + # two branches foo_t and foo_p of the trees being the same node. + # It's a bit silly but detecting "DAG-ness" in the AST tree seems + # to be the only way to distinguish this case from two independent + # structs. See test_struct_with_two_usages. + try: + return self._structnode2type[type] + except KeyError: + pass + # + # Note that this must handle parsing "struct foo" any number of + # times and always return the same StructType object. Additionally, + # one of these times (not necessarily the first), the fields of + # the struct can be specified with "struct foo { ...fields... }". + # If no name is given, then we have to create a new anonymous struct + # with no caching; in this case, the fields are either specified + # right now or never. + # + force_name = name + name = type.name + # + # get the type or create it if needed + if name is None: + # 'force_name' is used to guess a more readable name for + # anonymous structs, for the common case "typedef struct { } foo". + if force_name is not None: + explicit_name = '$%s' % force_name + else: + self._anonymous_counter += 1 + explicit_name = '$%d' % self._anonymous_counter + tp = None + else: + explicit_name = name + key = '%s %s' % (kind, name) + tp, _ = self._declarations.get(key, (None, None)) + # + if tp is None: + if kind == 'struct': + tp = model.StructType(explicit_name, None, None, None) + elif kind == 'union': + tp = model.UnionType(explicit_name, None, None, None) + elif kind == 'enum': + if explicit_name == '__dotdotdot__': + raise CDefError("Enums cannot be declared with ...") + tp = self._build_enum_type(explicit_name, type.values) + else: + raise AssertionError("kind = %r" % (kind,)) + if name is not None: + self._declare(key, tp) + else: + if kind == 'enum' and type.values is not None: + raise NotImplementedError( + "enum %s: the '{}' declaration should appear on the first " + "time the enum is mentioned, not later" % explicit_name) + if not tp.forcename: + tp.force_the_name(force_name) + if tp.forcename and '$' in tp.name: + self._declare('anonymous %s' % tp.forcename, tp) + # + self._structnode2type[type] = tp + # + # enums: done here + if kind == 'enum': + return tp + # + # is there a 'type.decls'? If yes, then this is the place in the + # C sources that declare the fields. If no, then just return the + # existing type, possibly still incomplete. + if type.decls is None: + return tp + # + if tp.fldnames is not None: + raise CDefError("duplicate declaration of struct %s" % name) + fldnames = [] + fldtypes = [] + fldbitsize = [] + fldquals = [] + for decl in type.decls: + if (isinstance(decl.type, pycparser.c_ast.IdentifierType) and + ''.join(decl.type.names) == '__dotdotdot__'): + # XXX pycparser is inconsistent: 'names' should be a list + # of strings, but is sometimes just one string. Use + # str.join() as a way to cope with both. + self._make_partial(tp, nested) + continue + if decl.bitsize is None: + bitsize = -1 + else: + bitsize = self._parse_constant(decl.bitsize) + self._partial_length = False + type, fqual = self._get_type_and_quals(decl.type, + partial_length_ok=True) + if self._partial_length: + self._make_partial(tp, nested) + if isinstance(type, model.StructType) and type.partial: + self._make_partial(tp, nested) + fldnames.append(decl.name or '') + fldtypes.append(type) + fldbitsize.append(bitsize) + fldquals.append(fqual) + tp.fldnames = tuple(fldnames) + tp.fldtypes = tuple(fldtypes) + tp.fldbitsize = tuple(fldbitsize) + tp.fldquals = tuple(fldquals) + if fldbitsize != [-1] * len(fldbitsize): + if isinstance(tp, model.StructType) and tp.partial: + raise NotImplementedError("%s: using both bitfields and '...;'" + % (tp,)) + tp.packed = self._options.get('packed') + if tp.completed: # must be re-completed: it is not opaque any more + tp.completed = 0 + self._recomplete.append(tp) + return tp + + def _make_partial(self, tp, nested): + if not isinstance(tp, model.StructOrUnion): + raise CDefError("%s cannot be partial" % (tp,)) + if not tp.has_c_name() and not nested: + raise NotImplementedError("%s is partial but has no C name" %(tp,)) + tp.partial = True + + def _parse_constant(self, exprnode, partial_length_ok=False): + # for now, limited to expressions that are an immediate number + # or positive/negative number + if isinstance(exprnode, pycparser.c_ast.Constant): + s = exprnode.value + if s.startswith('0'): + if s.startswith('0x') or s.startswith('0X'): + return int(s, 16) + return int(s, 8) + elif '1' <= s[0] <= '9': + return int(s, 10) + elif s[0] == "'" and s[-1] == "'" and ( + len(s) == 3 or (len(s) == 4 and s[1] == "\\")): + return ord(s[-2]) + else: + raise CDefError("invalid constant %r" % (s,)) + # + if (isinstance(exprnode, pycparser.c_ast.UnaryOp) and + exprnode.op == '+'): + return self._parse_constant(exprnode.expr) + # + if (isinstance(exprnode, pycparser.c_ast.UnaryOp) and + exprnode.op == '-'): + return -self._parse_constant(exprnode.expr) + # load previously defined int constant + if (isinstance(exprnode, pycparser.c_ast.ID) and + exprnode.name in self._int_constants): + return self._int_constants[exprnode.name] + # + if (isinstance(exprnode, pycparser.c_ast.ID) and + exprnode.name == '__dotdotdotarray__'): + if partial_length_ok: + self._partial_length = True + return '...' + raise FFIError(":%d: unsupported '[...]' here, cannot derive " + "the actual array length in this context" + % exprnode.coord.line) + # + if (isinstance(exprnode, pycparser.c_ast.BinaryOp) and + exprnode.op == '+'): + return (self._parse_constant(exprnode.left) + + self._parse_constant(exprnode.right)) + # + if (isinstance(exprnode, pycparser.c_ast.BinaryOp) and + exprnode.op == '-'): + return (self._parse_constant(exprnode.left) - + self._parse_constant(exprnode.right)) + # + raise FFIError(":%d: unsupported expression: expected a " + "simple numeric constant" % exprnode.coord.line) + + def _build_enum_type(self, explicit_name, decls): + if decls is not None: + partial = False + enumerators = [] + enumvalues = [] + nextenumvalue = 0 + for enum in decls.enumerators: + if _r_enum_dotdotdot.match(enum.name): + partial = True + continue + if enum.value is not None: + nextenumvalue = self._parse_constant(enum.value) + enumerators.append(enum.name) + enumvalues.append(nextenumvalue) + self._add_constants(enum.name, nextenumvalue) + nextenumvalue += 1 + enumerators = tuple(enumerators) + enumvalues = tuple(enumvalues) + tp = model.EnumType(explicit_name, enumerators, enumvalues) + tp.partial = partial + else: # opaque enum + tp = model.EnumType(explicit_name, (), ()) + return tp + + def include(self, other): + for name, (tp, quals) in other._declarations.items(): + if name.startswith('anonymous $enum_$'): + continue # fix for test_anonymous_enum_include + kind = name.split(' ', 1)[0] + if kind in ('struct', 'union', 'enum', 'anonymous', 'typedef'): + self._declare(name, tp, included=True, quals=quals) + for k, v in other._int_constants.items(): + self._add_constants(k, v) + + def _get_unknown_type(self, decl): + typenames = decl.type.type.names + if typenames == ['__dotdotdot__']: + return model.unknown_type(decl.name) + + if typenames == ['__dotdotdotint__']: + if self._uses_new_feature is None: + self._uses_new_feature = "'typedef int... %s'" % decl.name + return model.UnknownIntegerType(decl.name) + + if typenames == ['__dotdotdotfloat__']: + # note: not for 'long double' so far + if self._uses_new_feature is None: + self._uses_new_feature = "'typedef float... %s'" % decl.name + return model.UnknownFloatType(decl.name) + + raise FFIError(':%d: unsupported usage of "..." in typedef' + % decl.coord.line) + + def _get_unknown_ptr_type(self, decl): + if decl.type.type.type.names == ['__dotdotdot__']: + return model.unknown_ptr_type(decl.name) + raise FFIError(':%d: unsupported usage of "..." in typedef' + % decl.coord.line) diff --git a/website/web/Lib/site-packages/cffi/error.py b/website/web/Lib/site-packages/cffi/error.py new file mode 100644 index 000000000..ec1996484 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/error.py @@ -0,0 +1,23 @@ + +class FFIError(Exception): + pass + +class CDefError(Exception): + def __str__(self): + try: + current_decl = self.args[1] + filename = current_decl.coord.file + linenum = current_decl.coord.line + prefix = '%s:%d: ' % (filename, linenum) + except (AttributeError, TypeError, IndexError): + prefix = '' + return '%s%s' % (prefix, self.args[0]) + +class VerificationError(Exception): + """ An error raised when verification fails + """ + +class VerificationMissing(Exception): + """ An error raised when incomplete structures are passed into + cdef, but no verification has been done + """ diff --git a/website/web/Lib/site-packages/cffi/ffiplatform.py b/website/web/Lib/site-packages/cffi/ffiplatform.py new file mode 100644 index 000000000..85313460a --- /dev/null +++ b/website/web/Lib/site-packages/cffi/ffiplatform.py @@ -0,0 +1,127 @@ +import sys, os +from .error import VerificationError + + +LIST_OF_FILE_NAMES = ['sources', 'include_dirs', 'library_dirs', + 'extra_objects', 'depends'] + +def get_extension(srcfilename, modname, sources=(), **kwds): + _hack_at_distutils() + from distutils.core import Extension + allsources = [srcfilename] + for src in sources: + allsources.append(os.path.normpath(src)) + return Extension(name=modname, sources=allsources, **kwds) + +def compile(tmpdir, ext, compiler_verbose=0, debug=None): + """Compile a C extension module using distutils.""" + + _hack_at_distutils() + saved_environ = os.environ.copy() + try: + outputfilename = _build(tmpdir, ext, compiler_verbose, debug) + outputfilename = os.path.abspath(outputfilename) + finally: + # workaround for a distutils bugs where some env vars can + # become longer and longer every time it is used + for key, value in saved_environ.items(): + if os.environ.get(key) != value: + os.environ[key] = value + return outputfilename + +def _build(tmpdir, ext, compiler_verbose=0, debug=None): + # XXX compact but horrible :-( + from distutils.core import Distribution + import distutils.errors, distutils.log + # + dist = Distribution({'ext_modules': [ext]}) + dist.parse_config_files() + options = dist.get_option_dict('build_ext') + if debug is None: + debug = sys.flags.debug + options['debug'] = ('ffiplatform', debug) + options['force'] = ('ffiplatform', True) + options['build_lib'] = ('ffiplatform', tmpdir) + options['build_temp'] = ('ffiplatform', tmpdir) + # + try: + old_level = distutils.log.set_threshold(0) or 0 + try: + distutils.log.set_verbosity(compiler_verbose) + dist.run_command('build_ext') + cmd_obj = dist.get_command_obj('build_ext') + [soname] = cmd_obj.get_outputs() + finally: + distutils.log.set_threshold(old_level) + except (distutils.errors.CompileError, + distutils.errors.LinkError) as e: + raise VerificationError('%s: %s' % (e.__class__.__name__, e)) + # + return soname + +try: + from os.path import samefile +except ImportError: + def samefile(f1, f2): + return os.path.abspath(f1) == os.path.abspath(f2) + +def maybe_relative_path(path): + if not os.path.isabs(path): + return path # already relative + dir = path + names = [] + while True: + prevdir = dir + dir, name = os.path.split(prevdir) + if dir == prevdir or not dir: + return path # failed to make it relative + names.append(name) + try: + if samefile(dir, os.curdir): + names.reverse() + return os.path.join(*names) + except OSError: + pass + +# ____________________________________________________________ + +try: + int_or_long = (int, long) + import cStringIO +except NameError: + int_or_long = int # Python 3 + import io as cStringIO + +def _flatten(x, f): + if isinstance(x, str): + f.write('%ds%s' % (len(x), x)) + elif isinstance(x, dict): + keys = sorted(x.keys()) + f.write('%dd' % len(keys)) + for key in keys: + _flatten(key, f) + _flatten(x[key], f) + elif isinstance(x, (list, tuple)): + f.write('%dl' % len(x)) + for value in x: + _flatten(value, f) + elif isinstance(x, int_or_long): + f.write('%di' % (x,)) + else: + raise TypeError( + "the keywords to verify() contains unsupported object %r" % (x,)) + +def flatten(x): + f = cStringIO.StringIO() + _flatten(x, f) + return f.getvalue() + +def _hack_at_distutils(): + # Windows-only workaround for some configurations: see + # https://bugs.python.org/issue23246 (Python 2.7 with + # a specific MS compiler suite download) + if sys.platform == "win32": + try: + import setuptools # for side-effects, patches distutils + except ImportError: + pass diff --git a/website/web/Lib/site-packages/cffi/lock.py b/website/web/Lib/site-packages/cffi/lock.py new file mode 100644 index 000000000..db91b7158 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/lock.py @@ -0,0 +1,30 @@ +import sys + +if sys.version_info < (3,): + try: + from thread import allocate_lock + except ImportError: + from dummy_thread import allocate_lock +else: + try: + from _thread import allocate_lock + except ImportError: + from _dummy_thread import allocate_lock + + +##import sys +##l1 = allocate_lock + +##class allocate_lock(object): +## def __init__(self): +## self._real = l1() +## def __enter__(self): +## for i in range(4, 0, -1): +## print sys._getframe(i).f_code +## print +## return self._real.__enter__() +## def __exit__(self, *args): +## return self._real.__exit__(*args) +## def acquire(self, f): +## assert f is False +## return self._real.acquire(f) diff --git a/website/web/Lib/site-packages/cffi/model.py b/website/web/Lib/site-packages/cffi/model.py new file mode 100644 index 000000000..fb30f7d8b --- /dev/null +++ b/website/web/Lib/site-packages/cffi/model.py @@ -0,0 +1,612 @@ +import types +import weakref + +from .lock import allocate_lock +from .error import CDefError, VerificationError, VerificationMissing + +# type qualifiers +Q_CONST = 0x01 +Q_RESTRICT = 0x02 +Q_VOLATILE = 0x04 + +def qualify(quals, replace_with): + if quals & Q_CONST: + replace_with = ' const ' + replace_with.lstrip() + if quals & Q_VOLATILE: + replace_with = ' volatile ' + replace_with.lstrip() + if quals & Q_RESTRICT: + # It seems that __restrict is supported by gcc and msvc. + # If you hit some different compiler, add a #define in + # _cffi_include.h for it (and in its copies, documented there) + replace_with = ' __restrict ' + replace_with.lstrip() + return replace_with + + +class BaseTypeByIdentity(object): + is_array_type = False + is_raw_function = False + + def get_c_name(self, replace_with='', context='a C file', quals=0): + result = self.c_name_with_marker + assert result.count('&') == 1 + # some logic duplication with ffi.getctype()... :-( + replace_with = replace_with.strip() + if replace_with: + if replace_with.startswith('*') and '&[' in result: + replace_with = '(%s)' % replace_with + elif not replace_with[0] in '[(': + replace_with = ' ' + replace_with + replace_with = qualify(quals, replace_with) + result = result.replace('&', replace_with) + if '$' in result: + raise VerificationError( + "cannot generate '%s' in %s: unknown type name" + % (self._get_c_name(), context)) + return result + + def _get_c_name(self): + return self.c_name_with_marker.replace('&', '') + + def has_c_name(self): + return '$' not in self._get_c_name() + + def is_integer_type(self): + return False + + def get_cached_btype(self, ffi, finishlist, can_delay=False): + try: + BType = ffi._cached_btypes[self] + except KeyError: + BType = self.build_backend_type(ffi, finishlist) + BType2 = ffi._cached_btypes.setdefault(self, BType) + assert BType2 is BType + return BType + + def __repr__(self): + return '<%s>' % (self._get_c_name(),) + + def _get_items(self): + return [(name, getattr(self, name)) for name in self._attrs_] + + +class BaseType(BaseTypeByIdentity): + + def __eq__(self, other): + return (self.__class__ == other.__class__ and + self._get_items() == other._get_items()) + + def __ne__(self, other): + return not self == other + + def __hash__(self): + return hash((self.__class__, tuple(self._get_items()))) + + +class VoidType(BaseType): + _attrs_ = () + + def __init__(self): + self.c_name_with_marker = 'void&' + + def build_backend_type(self, ffi, finishlist): + return global_cache(self, ffi, 'new_void_type') + +void_type = VoidType() + + +class BasePrimitiveType(BaseType): + def is_complex_type(self): + return False + + +class PrimitiveType(BasePrimitiveType): + _attrs_ = ('name',) + + ALL_PRIMITIVE_TYPES = { + 'char': 'c', + 'short': 'i', + 'int': 'i', + 'long': 'i', + 'long long': 'i', + 'signed char': 'i', + 'unsigned char': 'i', + 'unsigned short': 'i', + 'unsigned int': 'i', + 'unsigned long': 'i', + 'unsigned long long': 'i', + 'float': 'f', + 'double': 'f', + 'long double': 'f', + 'float _Complex': 'j', + 'double _Complex': 'j', + '_Bool': 'i', + # the following types are not primitive in the C sense + 'wchar_t': 'c', + 'char16_t': 'c', + 'char32_t': 'c', + 'int8_t': 'i', + 'uint8_t': 'i', + 'int16_t': 'i', + 'uint16_t': 'i', + 'int32_t': 'i', + 'uint32_t': 'i', + 'int64_t': 'i', + 'uint64_t': 'i', + 'int_least8_t': 'i', + 'uint_least8_t': 'i', + 'int_least16_t': 'i', + 'uint_least16_t': 'i', + 'int_least32_t': 'i', + 'uint_least32_t': 'i', + 'int_least64_t': 'i', + 'uint_least64_t': 'i', + 'int_fast8_t': 'i', + 'uint_fast8_t': 'i', + 'int_fast16_t': 'i', + 'uint_fast16_t': 'i', + 'int_fast32_t': 'i', + 'uint_fast32_t': 'i', + 'int_fast64_t': 'i', + 'uint_fast64_t': 'i', + 'intptr_t': 'i', + 'uintptr_t': 'i', + 'intmax_t': 'i', + 'uintmax_t': 'i', + 'ptrdiff_t': 'i', + 'size_t': 'i', + 'ssize_t': 'i', + } + + def __init__(self, name): + assert name in self.ALL_PRIMITIVE_TYPES + self.name = name + self.c_name_with_marker = name + '&' + + def is_char_type(self): + return self.ALL_PRIMITIVE_TYPES[self.name] == 'c' + def is_integer_type(self): + return self.ALL_PRIMITIVE_TYPES[self.name] == 'i' + def is_float_type(self): + return self.ALL_PRIMITIVE_TYPES[self.name] == 'f' + def is_complex_type(self): + return self.ALL_PRIMITIVE_TYPES[self.name] == 'j' + + def build_backend_type(self, ffi, finishlist): + return global_cache(self, ffi, 'new_primitive_type', self.name) + + +class UnknownIntegerType(BasePrimitiveType): + _attrs_ = ('name',) + + def __init__(self, name): + self.name = name + self.c_name_with_marker = name + '&' + + def is_integer_type(self): + return True + + def build_backend_type(self, ffi, finishlist): + raise NotImplementedError("integer type '%s' can only be used after " + "compilation" % self.name) + +class UnknownFloatType(BasePrimitiveType): + _attrs_ = ('name', ) + + def __init__(self, name): + self.name = name + self.c_name_with_marker = name + '&' + + def build_backend_type(self, ffi, finishlist): + raise NotImplementedError("float type '%s' can only be used after " + "compilation" % self.name) + + +class BaseFunctionType(BaseType): + _attrs_ = ('args', 'result', 'ellipsis', 'abi') + + def __init__(self, args, result, ellipsis, abi=None): + self.args = args + self.result = result + self.ellipsis = ellipsis + self.abi = abi + # + reprargs = [arg._get_c_name() for arg in self.args] + if self.ellipsis: + reprargs.append('...') + reprargs = reprargs or ['void'] + replace_with = self._base_pattern % (', '.join(reprargs),) + if abi is not None: + replace_with = replace_with[:1] + abi + ' ' + replace_with[1:] + self.c_name_with_marker = ( + self.result.c_name_with_marker.replace('&', replace_with)) + + +class RawFunctionType(BaseFunctionType): + # Corresponds to a C type like 'int(int)', which is the C type of + # a function, but not a pointer-to-function. The backend has no + # notion of such a type; it's used temporarily by parsing. + _base_pattern = '(&)(%s)' + is_raw_function = True + + def build_backend_type(self, ffi, finishlist): + raise CDefError("cannot render the type %r: it is a function " + "type, not a pointer-to-function type" % (self,)) + + def as_function_pointer(self): + return FunctionPtrType(self.args, self.result, self.ellipsis, self.abi) + + +class FunctionPtrType(BaseFunctionType): + _base_pattern = '(*&)(%s)' + + def build_backend_type(self, ffi, finishlist): + result = self.result.get_cached_btype(ffi, finishlist) + args = [] + for tp in self.args: + args.append(tp.get_cached_btype(ffi, finishlist)) + abi_args = () + if self.abi == "__stdcall": + if not self.ellipsis: # __stdcall ignored for variadic funcs + try: + abi_args = (ffi._backend.FFI_STDCALL,) + except AttributeError: + pass + return global_cache(self, ffi, 'new_function_type', + tuple(args), result, self.ellipsis, *abi_args) + + def as_raw_function(self): + return RawFunctionType(self.args, self.result, self.ellipsis, self.abi) + + +class PointerType(BaseType): + _attrs_ = ('totype', 'quals') + + def __init__(self, totype, quals=0): + self.totype = totype + self.quals = quals + extra = qualify(quals, " *&") + if totype.is_array_type: + extra = "(%s)" % (extra.lstrip(),) + self.c_name_with_marker = totype.c_name_with_marker.replace('&', extra) + + def build_backend_type(self, ffi, finishlist): + BItem = self.totype.get_cached_btype(ffi, finishlist, can_delay=True) + return global_cache(self, ffi, 'new_pointer_type', BItem) + +voidp_type = PointerType(void_type) + +def ConstPointerType(totype): + return PointerType(totype, Q_CONST) + +const_voidp_type = ConstPointerType(void_type) + + +class NamedPointerType(PointerType): + _attrs_ = ('totype', 'name') + + def __init__(self, totype, name, quals=0): + PointerType.__init__(self, totype, quals) + self.name = name + self.c_name_with_marker = name + '&' + + +class ArrayType(BaseType): + _attrs_ = ('item', 'length') + is_array_type = True + + def __init__(self, item, length): + self.item = item + self.length = length + # + if length is None: + brackets = '&[]' + elif length == '...': + brackets = '&[/*...*/]' + else: + brackets = '&[%s]' % length + self.c_name_with_marker = ( + self.item.c_name_with_marker.replace('&', brackets)) + + def resolve_length(self, newlength): + return ArrayType(self.item, newlength) + + def build_backend_type(self, ffi, finishlist): + if self.length == '...': + raise CDefError("cannot render the type %r: unknown length" % + (self,)) + self.item.get_cached_btype(ffi, finishlist) # force the item BType + BPtrItem = PointerType(self.item).get_cached_btype(ffi, finishlist) + return global_cache(self, ffi, 'new_array_type', BPtrItem, self.length) + +char_array_type = ArrayType(PrimitiveType('char'), None) + + +class StructOrUnionOrEnum(BaseTypeByIdentity): + _attrs_ = ('name',) + forcename = None + + def build_c_name_with_marker(self): + name = self.forcename or '%s %s' % (self.kind, self.name) + self.c_name_with_marker = name + '&' + + def force_the_name(self, forcename): + self.forcename = forcename + self.build_c_name_with_marker() + + def get_official_name(self): + assert self.c_name_with_marker.endswith('&') + return self.c_name_with_marker[:-1] + + +class StructOrUnion(StructOrUnionOrEnum): + fixedlayout = None + completed = 0 + partial = False + packed = False + + def __init__(self, name, fldnames, fldtypes, fldbitsize, fldquals=None): + self.name = name + self.fldnames = fldnames + self.fldtypes = fldtypes + self.fldbitsize = fldbitsize + self.fldquals = fldquals + self.build_c_name_with_marker() + + def has_anonymous_struct_fields(self): + if self.fldtypes is None: + return False + for name, type in zip(self.fldnames, self.fldtypes): + if name == '' and isinstance(type, StructOrUnion): + return True + return False + + def enumfields(self): + fldquals = self.fldquals + if fldquals is None: + fldquals = (0,) * len(self.fldnames) + for name, type, bitsize, quals in zip(self.fldnames, self.fldtypes, + self.fldbitsize, fldquals): + if name == '' and isinstance(type, StructOrUnion): + # nested anonymous struct/union + for result in type.enumfields(): + yield result + else: + yield (name, type, bitsize, quals) + + def force_flatten(self): + # force the struct or union to have a declaration that lists + # directly all fields returned by enumfields(), flattening + # nested anonymous structs/unions. + names = [] + types = [] + bitsizes = [] + fldquals = [] + for name, type, bitsize, quals in self.enumfields(): + names.append(name) + types.append(type) + bitsizes.append(bitsize) + fldquals.append(quals) + self.fldnames = tuple(names) + self.fldtypes = tuple(types) + self.fldbitsize = tuple(bitsizes) + self.fldquals = tuple(fldquals) + + def get_cached_btype(self, ffi, finishlist, can_delay=False): + BType = StructOrUnionOrEnum.get_cached_btype(self, ffi, finishlist, + can_delay) + if not can_delay: + self.finish_backend_type(ffi, finishlist) + return BType + + def finish_backend_type(self, ffi, finishlist): + if self.completed: + if self.completed != 2: + raise NotImplementedError("recursive structure declaration " + "for '%s'" % (self.name,)) + return + BType = ffi._cached_btypes[self] + # + self.completed = 1 + # + if self.fldtypes is None: + pass # not completing it: it's an opaque struct + # + elif self.fixedlayout is None: + fldtypes = [tp.get_cached_btype(ffi, finishlist) + for tp in self.fldtypes] + lst = list(zip(self.fldnames, fldtypes, self.fldbitsize)) + sflags = 0 + if self.packed: + sflags = 8 # SF_PACKED + ffi._backend.complete_struct_or_union(BType, lst, self, + -1, -1, sflags) + # + else: + fldtypes = [] + fieldofs, fieldsize, totalsize, totalalignment = self.fixedlayout + for i in range(len(self.fldnames)): + fsize = fieldsize[i] + ftype = self.fldtypes[i] + # + if isinstance(ftype, ArrayType) and ftype.length == '...': + # fix the length to match the total size + BItemType = ftype.item.get_cached_btype(ffi, finishlist) + nlen, nrest = divmod(fsize, ffi.sizeof(BItemType)) + if nrest != 0: + self._verification_error( + "field '%s.%s' has a bogus size?" % ( + self.name, self.fldnames[i] or '{}')) + ftype = ftype.resolve_length(nlen) + self.fldtypes = (self.fldtypes[:i] + (ftype,) + + self.fldtypes[i+1:]) + # + BFieldType = ftype.get_cached_btype(ffi, finishlist) + if isinstance(ftype, ArrayType) and ftype.length is None: + assert fsize == 0 + else: + bitemsize = ffi.sizeof(BFieldType) + if bitemsize != fsize: + self._verification_error( + "field '%s.%s' is declared as %d bytes, but is " + "really %d bytes" % (self.name, + self.fldnames[i] or '{}', + bitemsize, fsize)) + fldtypes.append(BFieldType) + # + lst = list(zip(self.fldnames, fldtypes, self.fldbitsize, fieldofs)) + ffi._backend.complete_struct_or_union(BType, lst, self, + totalsize, totalalignment) + self.completed = 2 + + def _verification_error(self, msg): + raise VerificationError(msg) + + def check_not_partial(self): + if self.partial and self.fixedlayout is None: + raise VerificationMissing(self._get_c_name()) + + def build_backend_type(self, ffi, finishlist): + self.check_not_partial() + finishlist.append(self) + # + return global_cache(self, ffi, 'new_%s_type' % self.kind, + self.get_official_name(), key=self) + + +class StructType(StructOrUnion): + kind = 'struct' + + +class UnionType(StructOrUnion): + kind = 'union' + + +class EnumType(StructOrUnionOrEnum): + kind = 'enum' + partial = False + partial_resolved = False + + def __init__(self, name, enumerators, enumvalues, baseinttype=None): + self.name = name + self.enumerators = enumerators + self.enumvalues = enumvalues + self.baseinttype = baseinttype + self.build_c_name_with_marker() + + def force_the_name(self, forcename): + StructOrUnionOrEnum.force_the_name(self, forcename) + if self.forcename is None: + name = self.get_official_name() + self.forcename = '$' + name.replace(' ', '_') + + def check_not_partial(self): + if self.partial and not self.partial_resolved: + raise VerificationMissing(self._get_c_name()) + + def build_backend_type(self, ffi, finishlist): + self.check_not_partial() + base_btype = self.build_baseinttype(ffi, finishlist) + return global_cache(self, ffi, 'new_enum_type', + self.get_official_name(), + self.enumerators, self.enumvalues, + base_btype, key=self) + + def build_baseinttype(self, ffi, finishlist): + if self.baseinttype is not None: + return self.baseinttype.get_cached_btype(ffi, finishlist) + # + if self.enumvalues: + smallest_value = min(self.enumvalues) + largest_value = max(self.enumvalues) + else: + import warnings + try: + # XXX! The goal is to ensure that the warnings.warn() + # will not suppress the warning. We want to get it + # several times if we reach this point several times. + __warningregistry__.clear() + except NameError: + pass + warnings.warn("%r has no values explicitly defined; " + "guessing that it is equivalent to 'unsigned int'" + % self._get_c_name()) + smallest_value = largest_value = 0 + if smallest_value < 0: # needs a signed type + sign = 1 + candidate1 = PrimitiveType("int") + candidate2 = PrimitiveType("long") + else: + sign = 0 + candidate1 = PrimitiveType("unsigned int") + candidate2 = PrimitiveType("unsigned long") + btype1 = candidate1.get_cached_btype(ffi, finishlist) + btype2 = candidate2.get_cached_btype(ffi, finishlist) + size1 = ffi.sizeof(btype1) + size2 = ffi.sizeof(btype2) + if (smallest_value >= ((-1) << (8*size1-1)) and + largest_value < (1 << (8*size1-sign))): + return btype1 + if (smallest_value >= ((-1) << (8*size2-1)) and + largest_value < (1 << (8*size2-sign))): + return btype2 + raise CDefError("%s values don't all fit into either 'long' " + "or 'unsigned long'" % self._get_c_name()) + +def unknown_type(name, structname=None): + if structname is None: + structname = '$%s' % name + tp = StructType(structname, None, None, None) + tp.force_the_name(name) + tp.origin = "unknown_type" + return tp + +def unknown_ptr_type(name, structname=None): + if structname is None: + structname = '$$%s' % name + tp = StructType(structname, None, None, None) + return NamedPointerType(tp, name) + + +global_lock = allocate_lock() +_typecache_cffi_backend = weakref.WeakValueDictionary() + +def get_typecache(backend): + # returns _typecache_cffi_backend if backend is the _cffi_backend + # module, or type(backend).__typecache if backend is an instance of + # CTypesBackend (or some FakeBackend class during tests) + if isinstance(backend, types.ModuleType): + return _typecache_cffi_backend + with global_lock: + if not hasattr(type(backend), '__typecache'): + type(backend).__typecache = weakref.WeakValueDictionary() + return type(backend).__typecache + +def global_cache(srctype, ffi, funcname, *args, **kwds): + key = kwds.pop('key', (funcname, args)) + assert not kwds + try: + return ffi._typecache[key] + except KeyError: + pass + try: + res = getattr(ffi._backend, funcname)(*args) + except NotImplementedError as e: + raise NotImplementedError("%s: %r: %s" % (funcname, srctype, e)) + # note that setdefault() on WeakValueDictionary is not atomic + # and contains a rare bug (http://bugs.python.org/issue19542); + # we have to use a lock and do it ourselves + cache = ffi._typecache + with global_lock: + res1 = cache.get(key) + if res1 is None: + cache[key] = res + return res + else: + return res1 + +def pointer_cache(ffi, BType): + return global_cache('?', ffi, 'new_pointer_type', BType) + +def attach_exception_info(e, name): + if e.args and type(e.args[0]) is str: + e.args = ('%s: %s' % (name, e.args[0]),) + e.args[1:] diff --git a/website/web/Lib/site-packages/cffi/parse_c_type.h b/website/web/Lib/site-packages/cffi/parse_c_type.h new file mode 100644 index 000000000..84e4ef856 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/parse_c_type.h @@ -0,0 +1,181 @@ + +/* This part is from file 'cffi/parse_c_type.h'. It is copied at the + beginning of C sources generated by CFFI's ffi.set_source(). */ + +typedef void *_cffi_opcode_t; + +#define _CFFI_OP(opcode, arg) (_cffi_opcode_t)(opcode | (((uintptr_t)(arg)) << 8)) +#define _CFFI_GETOP(cffi_opcode) ((unsigned char)(uintptr_t)cffi_opcode) +#define _CFFI_GETARG(cffi_opcode) (((intptr_t)cffi_opcode) >> 8) + +#define _CFFI_OP_PRIMITIVE 1 +#define _CFFI_OP_POINTER 3 +#define _CFFI_OP_ARRAY 5 +#define _CFFI_OP_OPEN_ARRAY 7 +#define _CFFI_OP_STRUCT_UNION 9 +#define _CFFI_OP_ENUM 11 +#define _CFFI_OP_FUNCTION 13 +#define _CFFI_OP_FUNCTION_END 15 +#define _CFFI_OP_NOOP 17 +#define _CFFI_OP_BITFIELD 19 +#define _CFFI_OP_TYPENAME 21 +#define _CFFI_OP_CPYTHON_BLTN_V 23 // varargs +#define _CFFI_OP_CPYTHON_BLTN_N 25 // noargs +#define _CFFI_OP_CPYTHON_BLTN_O 27 // O (i.e. a single arg) +#define _CFFI_OP_CONSTANT 29 +#define _CFFI_OP_CONSTANT_INT 31 +#define _CFFI_OP_GLOBAL_VAR 33 +#define _CFFI_OP_DLOPEN_FUNC 35 +#define _CFFI_OP_DLOPEN_CONST 37 +#define _CFFI_OP_GLOBAL_VAR_F 39 +#define _CFFI_OP_EXTERN_PYTHON 41 + +#define _CFFI_PRIM_VOID 0 +#define _CFFI_PRIM_BOOL 1 +#define _CFFI_PRIM_CHAR 2 +#define _CFFI_PRIM_SCHAR 3 +#define _CFFI_PRIM_UCHAR 4 +#define _CFFI_PRIM_SHORT 5 +#define _CFFI_PRIM_USHORT 6 +#define _CFFI_PRIM_INT 7 +#define _CFFI_PRIM_UINT 8 +#define _CFFI_PRIM_LONG 9 +#define _CFFI_PRIM_ULONG 10 +#define _CFFI_PRIM_LONGLONG 11 +#define _CFFI_PRIM_ULONGLONG 12 +#define _CFFI_PRIM_FLOAT 13 +#define _CFFI_PRIM_DOUBLE 14 +#define _CFFI_PRIM_LONGDOUBLE 15 + +#define _CFFI_PRIM_WCHAR 16 +#define _CFFI_PRIM_INT8 17 +#define _CFFI_PRIM_UINT8 18 +#define _CFFI_PRIM_INT16 19 +#define _CFFI_PRIM_UINT16 20 +#define _CFFI_PRIM_INT32 21 +#define _CFFI_PRIM_UINT32 22 +#define _CFFI_PRIM_INT64 23 +#define _CFFI_PRIM_UINT64 24 +#define _CFFI_PRIM_INTPTR 25 +#define _CFFI_PRIM_UINTPTR 26 +#define _CFFI_PRIM_PTRDIFF 27 +#define _CFFI_PRIM_SIZE 28 +#define _CFFI_PRIM_SSIZE 29 +#define _CFFI_PRIM_INT_LEAST8 30 +#define _CFFI_PRIM_UINT_LEAST8 31 +#define _CFFI_PRIM_INT_LEAST16 32 +#define _CFFI_PRIM_UINT_LEAST16 33 +#define _CFFI_PRIM_INT_LEAST32 34 +#define _CFFI_PRIM_UINT_LEAST32 35 +#define _CFFI_PRIM_INT_LEAST64 36 +#define _CFFI_PRIM_UINT_LEAST64 37 +#define _CFFI_PRIM_INT_FAST8 38 +#define _CFFI_PRIM_UINT_FAST8 39 +#define _CFFI_PRIM_INT_FAST16 40 +#define _CFFI_PRIM_UINT_FAST16 41 +#define _CFFI_PRIM_INT_FAST32 42 +#define _CFFI_PRIM_UINT_FAST32 43 +#define _CFFI_PRIM_INT_FAST64 44 +#define _CFFI_PRIM_UINT_FAST64 45 +#define _CFFI_PRIM_INTMAX 46 +#define _CFFI_PRIM_UINTMAX 47 +#define _CFFI_PRIM_FLOATCOMPLEX 48 +#define _CFFI_PRIM_DOUBLECOMPLEX 49 +#define _CFFI_PRIM_CHAR16 50 +#define _CFFI_PRIM_CHAR32 51 + +#define _CFFI__NUM_PRIM 52 +#define _CFFI__UNKNOWN_PRIM (-1) +#define _CFFI__UNKNOWN_FLOAT_PRIM (-2) +#define _CFFI__UNKNOWN_LONG_DOUBLE (-3) + +#define _CFFI__IO_FILE_STRUCT (-1) + + +struct _cffi_global_s { + const char *name; + void *address; + _cffi_opcode_t type_op; + void *size_or_direct_fn; // OP_GLOBAL_VAR: size, or 0 if unknown + // OP_CPYTHON_BLTN_*: addr of direct function +}; + +struct _cffi_getconst_s { + unsigned long long value; + const struct _cffi_type_context_s *ctx; + int gindex; +}; + +struct _cffi_struct_union_s { + const char *name; + int type_index; // -> _cffi_types, on a OP_STRUCT_UNION + int flags; // _CFFI_F_* flags below + size_t size; + int alignment; + int first_field_index; // -> _cffi_fields array + int num_fields; +}; +#define _CFFI_F_UNION 0x01 // is a union, not a struct +#define _CFFI_F_CHECK_FIELDS 0x02 // complain if fields are not in the + // "standard layout" or if some are missing +#define _CFFI_F_PACKED 0x04 // for CHECK_FIELDS, assume a packed struct +#define _CFFI_F_EXTERNAL 0x08 // in some other ffi.include() +#define _CFFI_F_OPAQUE 0x10 // opaque + +struct _cffi_field_s { + const char *name; + size_t field_offset; + size_t field_size; + _cffi_opcode_t field_type_op; +}; + +struct _cffi_enum_s { + const char *name; + int type_index; // -> _cffi_types, on a OP_ENUM + int type_prim; // _CFFI_PRIM_xxx + const char *enumerators; // comma-delimited string +}; + +struct _cffi_typename_s { + const char *name; + int type_index; /* if opaque, points to a possibly artificial + OP_STRUCT which is itself opaque */ +}; + +struct _cffi_type_context_s { + _cffi_opcode_t *types; + const struct _cffi_global_s *globals; + const struct _cffi_field_s *fields; + const struct _cffi_struct_union_s *struct_unions; + const struct _cffi_enum_s *enums; + const struct _cffi_typename_s *typenames; + int num_globals; + int num_struct_unions; + int num_enums; + int num_typenames; + const char *const *includes; + int num_types; + int flags; /* future extension */ +}; + +struct _cffi_parse_info_s { + const struct _cffi_type_context_s *ctx; + _cffi_opcode_t *output; + unsigned int output_size; + size_t error_location; + const char *error_message; +}; + +struct _cffi_externpy_s { + const char *name; + size_t size_of_result; + void *reserved1, *reserved2; +}; + +#ifdef _CFFI_INTERNAL +static int parse_c_type(struct _cffi_parse_info_s *info, const char *input); +static int search_in_globals(const struct _cffi_type_context_s *ctx, + const char *search, size_t search_len); +static int search_in_struct_unions(const struct _cffi_type_context_s *ctx, + const char *search, size_t search_len); +#endif diff --git a/website/web/Lib/site-packages/cffi/recompiler.py b/website/web/Lib/site-packages/cffi/recompiler.py new file mode 100644 index 000000000..821be16dd --- /dev/null +++ b/website/web/Lib/site-packages/cffi/recompiler.py @@ -0,0 +1,1555 @@ +import os, sys, io +from . import ffiplatform, model +from .error import VerificationError +from .cffi_opcode import * + +VERSION_BASE = 0x2601 +VERSION_EMBEDDED = 0x2701 +VERSION_CHAR16CHAR32 = 0x2801 + + +class GlobalExpr: + def __init__(self, name, address, type_op, size=0, check_value=0): + self.name = name + self.address = address + self.type_op = type_op + self.size = size + self.check_value = check_value + + def as_c_expr(self): + return ' { "%s", (void *)%s, %s, (void *)%s },' % ( + self.name, self.address, self.type_op.as_c_expr(), self.size) + + def as_python_expr(self): + return "b'%s%s',%d" % (self.type_op.as_python_bytes(), self.name, + self.check_value) + +class FieldExpr: + def __init__(self, name, field_offset, field_size, fbitsize, field_type_op): + self.name = name + self.field_offset = field_offset + self.field_size = field_size + self.fbitsize = fbitsize + self.field_type_op = field_type_op + + def as_c_expr(self): + spaces = " " * len(self.name) + return (' { "%s", %s,\n' % (self.name, self.field_offset) + + ' %s %s,\n' % (spaces, self.field_size) + + ' %s %s },' % (spaces, self.field_type_op.as_c_expr())) + + def as_python_expr(self): + raise NotImplementedError + + def as_field_python_expr(self): + if self.field_type_op.op == OP_NOOP: + size_expr = '' + elif self.field_type_op.op == OP_BITFIELD: + size_expr = format_four_bytes(self.fbitsize) + else: + raise NotImplementedError + return "b'%s%s%s'" % (self.field_type_op.as_python_bytes(), + size_expr, + self.name) + +class StructUnionExpr: + def __init__(self, name, type_index, flags, size, alignment, comment, + first_field_index, c_fields): + self.name = name + self.type_index = type_index + self.flags = flags + self.size = size + self.alignment = alignment + self.comment = comment + self.first_field_index = first_field_index + self.c_fields = c_fields + + def as_c_expr(self): + return (' { "%s", %d, %s,' % (self.name, self.type_index, self.flags) + + '\n %s, %s, ' % (self.size, self.alignment) + + '%d, %d ' % (self.first_field_index, len(self.c_fields)) + + ('/* %s */ ' % self.comment if self.comment else '') + + '},') + + def as_python_expr(self): + flags = eval(self.flags, G_FLAGS) + fields_expr = [c_field.as_field_python_expr() + for c_field in self.c_fields] + return "(b'%s%s%s',%s)" % ( + format_four_bytes(self.type_index), + format_four_bytes(flags), + self.name, + ','.join(fields_expr)) + +class EnumExpr: + def __init__(self, name, type_index, size, signed, allenums): + self.name = name + self.type_index = type_index + self.size = size + self.signed = signed + self.allenums = allenums + + def as_c_expr(self): + return (' { "%s", %d, _cffi_prim_int(%s, %s),\n' + ' "%s" },' % (self.name, self.type_index, + self.size, self.signed, self.allenums)) + + def as_python_expr(self): + prim_index = { + (1, 0): PRIM_UINT8, (1, 1): PRIM_INT8, + (2, 0): PRIM_UINT16, (2, 1): PRIM_INT16, + (4, 0): PRIM_UINT32, (4, 1): PRIM_INT32, + (8, 0): PRIM_UINT64, (8, 1): PRIM_INT64, + }[self.size, self.signed] + return "b'%s%s%s\\x00%s'" % (format_four_bytes(self.type_index), + format_four_bytes(prim_index), + self.name, self.allenums) + +class TypenameExpr: + def __init__(self, name, type_index): + self.name = name + self.type_index = type_index + + def as_c_expr(self): + return ' { "%s", %d },' % (self.name, self.type_index) + + def as_python_expr(self): + return "b'%s%s'" % (format_four_bytes(self.type_index), self.name) + + +# ____________________________________________________________ + + +class Recompiler: + _num_externpy = 0 + + def __init__(self, ffi, module_name, target_is_python=False): + self.ffi = ffi + self.module_name = module_name + self.target_is_python = target_is_python + self._version = VERSION_BASE + + def needs_version(self, ver): + self._version = max(self._version, ver) + + def collect_type_table(self): + self._typesdict = {} + self._generate("collecttype") + # + all_decls = sorted(self._typesdict, key=str) + # + # prepare all FUNCTION bytecode sequences first + self.cffi_types = [] + for tp in all_decls: + if tp.is_raw_function: + assert self._typesdict[tp] is None + self._typesdict[tp] = len(self.cffi_types) + self.cffi_types.append(tp) # placeholder + for tp1 in tp.args: + assert isinstance(tp1, (model.VoidType, + model.BasePrimitiveType, + model.PointerType, + model.StructOrUnionOrEnum, + model.FunctionPtrType)) + if self._typesdict[tp1] is None: + self._typesdict[tp1] = len(self.cffi_types) + self.cffi_types.append(tp1) # placeholder + self.cffi_types.append('END') # placeholder + # + # prepare all OTHER bytecode sequences + for tp in all_decls: + if not tp.is_raw_function and self._typesdict[tp] is None: + self._typesdict[tp] = len(self.cffi_types) + self.cffi_types.append(tp) # placeholder + if tp.is_array_type and tp.length is not None: + self.cffi_types.append('LEN') # placeholder + assert None not in self._typesdict.values() + # + # collect all structs and unions and enums + self._struct_unions = {} + self._enums = {} + for tp in all_decls: + if isinstance(tp, model.StructOrUnion): + self._struct_unions[tp] = None + elif isinstance(tp, model.EnumType): + self._enums[tp] = None + for i, tp in enumerate(sorted(self._struct_unions, + key=lambda tp: tp.name)): + self._struct_unions[tp] = i + for i, tp in enumerate(sorted(self._enums, + key=lambda tp: tp.name)): + self._enums[tp] = i + # + # emit all bytecode sequences now + for tp in all_decls: + method = getattr(self, '_emit_bytecode_' + tp.__class__.__name__) + method(tp, self._typesdict[tp]) + # + # consistency check + for op in self.cffi_types: + assert isinstance(op, CffiOp) + self.cffi_types = tuple(self.cffi_types) # don't change any more + + def _do_collect_type(self, tp): + if not isinstance(tp, model.BaseTypeByIdentity): + if isinstance(tp, tuple): + for x in tp: + self._do_collect_type(x) + return + if tp not in self._typesdict: + self._typesdict[tp] = None + if isinstance(tp, model.FunctionPtrType): + self._do_collect_type(tp.as_raw_function()) + elif isinstance(tp, model.StructOrUnion): + if tp.fldtypes is not None and ( + tp not in self.ffi._parser._included_declarations): + for name1, tp1, _, _ in tp.enumfields(): + self._do_collect_type(self._field_type(tp, name1, tp1)) + else: + for _, x in tp._get_items(): + self._do_collect_type(x) + + def _generate(self, step_name): + lst = self.ffi._parser._declarations.items() + for name, (tp, quals) in sorted(lst): + kind, realname = name.split(' ', 1) + try: + method = getattr(self, '_generate_cpy_%s_%s' % (kind, + step_name)) + except AttributeError: + raise VerificationError( + "not implemented in recompile(): %r" % name) + try: + self._current_quals = quals + method(tp, realname) + except Exception as e: + model.attach_exception_info(e, name) + raise + + # ---------- + + ALL_STEPS = ["global", "field", "struct_union", "enum", "typename"] + + def collect_step_tables(self): + # collect the declarations for '_cffi_globals', '_cffi_typenames', etc. + self._lsts = {} + for step_name in self.ALL_STEPS: + self._lsts[step_name] = [] + self._seen_struct_unions = set() + self._generate("ctx") + self._add_missing_struct_unions() + # + for step_name in self.ALL_STEPS: + lst = self._lsts[step_name] + if step_name != "field": + lst.sort(key=lambda entry: entry.name) + self._lsts[step_name] = tuple(lst) # don't change any more + # + # check for a possible internal inconsistency: _cffi_struct_unions + # should have been generated with exactly self._struct_unions + lst = self._lsts["struct_union"] + for tp, i in self._struct_unions.items(): + assert i < len(lst) + assert lst[i].name == tp.name + assert len(lst) == len(self._struct_unions) + # same with enums + lst = self._lsts["enum"] + for tp, i in self._enums.items(): + assert i < len(lst) + assert lst[i].name == tp.name + assert len(lst) == len(self._enums) + + # ---------- + + def _prnt(self, what=''): + self._f.write(what + '\n') + + def write_source_to_f(self, f, preamble): + if self.target_is_python: + assert preamble is None + self.write_py_source_to_f(f) + else: + assert preamble is not None + self.write_c_source_to_f(f, preamble) + + def _rel_readlines(self, filename): + g = open(os.path.join(os.path.dirname(__file__), filename), 'r') + lines = g.readlines() + g.close() + return lines + + def write_c_source_to_f(self, f, preamble): + self._f = f + prnt = self._prnt + if self.ffi._embedding is not None: + prnt('#define _CFFI_USE_EMBEDDING') + # + # first the '#include' (actually done by inlining the file's content) + lines = self._rel_readlines('_cffi_include.h') + i = lines.index('#include "parse_c_type.h"\n') + lines[i:i+1] = self._rel_readlines('parse_c_type.h') + prnt(''.join(lines)) + # + # if we have ffi._embedding != None, we give it here as a macro + # and include an extra file + base_module_name = self.module_name.split('.')[-1] + if self.ffi._embedding is not None: + prnt('#define _CFFI_MODULE_NAME "%s"' % (self.module_name,)) + prnt('static const char _CFFI_PYTHON_STARTUP_CODE[] = {') + self._print_string_literal_in_array(self.ffi._embedding) + prnt('0 };') + prnt('#ifdef PYPY_VERSION') + prnt('# define _CFFI_PYTHON_STARTUP_FUNC _cffi_pypyinit_%s' % ( + base_module_name,)) + prnt('#elif PY_MAJOR_VERSION >= 3') + prnt('# define _CFFI_PYTHON_STARTUP_FUNC PyInit_%s' % ( + base_module_name,)) + prnt('#else') + prnt('# define _CFFI_PYTHON_STARTUP_FUNC init%s' % ( + base_module_name,)) + prnt('#endif') + lines = self._rel_readlines('_embedding.h') + i = lines.index('#include "_cffi_errors.h"\n') + lines[i:i+1] = self._rel_readlines('_cffi_errors.h') + prnt(''.join(lines)) + self.needs_version(VERSION_EMBEDDED) + # + # then paste the C source given by the user, verbatim. + prnt('/************************************************************/') + prnt() + prnt(preamble) + prnt() + prnt('/************************************************************/') + prnt() + # + # the declaration of '_cffi_types' + prnt('static void *_cffi_types[] = {') + typeindex2type = dict([(i, tp) for (tp, i) in self._typesdict.items()]) + for i, op in enumerate(self.cffi_types): + comment = '' + if i in typeindex2type: + comment = ' // ' + typeindex2type[i]._get_c_name() + prnt('/* %2d */ %s,%s' % (i, op.as_c_expr(), comment)) + if not self.cffi_types: + prnt(' 0') + prnt('};') + prnt() + # + # call generate_cpy_xxx_decl(), for every xxx found from + # ffi._parser._declarations. This generates all the functions. + self._seen_constants = set() + self._generate("decl") + # + # the declaration of '_cffi_globals' and '_cffi_typenames' + nums = {} + for step_name in self.ALL_STEPS: + lst = self._lsts[step_name] + nums[step_name] = len(lst) + if nums[step_name] > 0: + prnt('static const struct _cffi_%s_s _cffi_%ss[] = {' % ( + step_name, step_name)) + for entry in lst: + prnt(entry.as_c_expr()) + prnt('};') + prnt() + # + # the declaration of '_cffi_includes' + if self.ffi._included_ffis: + prnt('static const char * const _cffi_includes[] = {') + for ffi_to_include in self.ffi._included_ffis: + try: + included_module_name, included_source = ( + ffi_to_include._assigned_source[:2]) + except AttributeError: + raise VerificationError( + "ffi object %r includes %r, but the latter has not " + "been prepared with set_source()" % ( + self.ffi, ffi_to_include,)) + if included_source is None: + raise VerificationError( + "not implemented yet: ffi.include() of a Python-based " + "ffi inside a C-based ffi") + prnt(' "%s",' % (included_module_name,)) + prnt(' NULL') + prnt('};') + prnt() + # + # the declaration of '_cffi_type_context' + prnt('static const struct _cffi_type_context_s _cffi_type_context = {') + prnt(' _cffi_types,') + for step_name in self.ALL_STEPS: + if nums[step_name] > 0: + prnt(' _cffi_%ss,' % step_name) + else: + prnt(' NULL, /* no %ss */' % step_name) + for step_name in self.ALL_STEPS: + if step_name != "field": + prnt(' %d, /* num_%ss */' % (nums[step_name], step_name)) + if self.ffi._included_ffis: + prnt(' _cffi_includes,') + else: + prnt(' NULL, /* no includes */') + prnt(' %d, /* num_types */' % (len(self.cffi_types),)) + flags = 0 + if self._num_externpy: + flags |= 1 # set to mean that we use extern "Python" + prnt(' %d, /* flags */' % flags) + prnt('};') + prnt() + # + # the init function + prnt('#ifdef __GNUC__') + prnt('# pragma GCC visibility push(default) /* for -fvisibility= */') + prnt('#endif') + prnt() + prnt('#ifdef PYPY_VERSION') + prnt('PyMODINIT_FUNC') + prnt('_cffi_pypyinit_%s(const void *p[])' % (base_module_name,)) + prnt('{') + if self._num_externpy: + prnt(' if (((intptr_t)p[0]) >= 0x0A03) {') + prnt(' _cffi_call_python_org = ' + '(void(*)(struct _cffi_externpy_s *, char *))p[1];') + prnt(' }') + prnt(' p[0] = (const void *)0x%x;' % self._version) + prnt(' p[1] = &_cffi_type_context;') + prnt('#if PY_MAJOR_VERSION >= 3') + prnt(' return NULL;') + prnt('#endif') + prnt('}') + # on Windows, distutils insists on putting init_cffi_xyz in + # 'export_symbols', so instead of fighting it, just give up and + # give it one + prnt('# ifdef _MSC_VER') + prnt(' PyMODINIT_FUNC') + prnt('# if PY_MAJOR_VERSION >= 3') + prnt(' PyInit_%s(void) { return NULL; }' % (base_module_name,)) + prnt('# else') + prnt(' init%s(void) { }' % (base_module_name,)) + prnt('# endif') + prnt('# endif') + prnt('#elif PY_MAJOR_VERSION >= 3') + prnt('PyMODINIT_FUNC') + prnt('PyInit_%s(void)' % (base_module_name,)) + prnt('{') + prnt(' return _cffi_init("%s", 0x%x, &_cffi_type_context);' % ( + self.module_name, self._version)) + prnt('}') + prnt('#else') + prnt('PyMODINIT_FUNC') + prnt('init%s(void)' % (base_module_name,)) + prnt('{') + prnt(' _cffi_init("%s", 0x%x, &_cffi_type_context);' % ( + self.module_name, self._version)) + prnt('}') + prnt('#endif') + prnt() + prnt('#ifdef __GNUC__') + prnt('# pragma GCC visibility pop') + prnt('#endif') + self._version = None + + def _to_py(self, x): + if isinstance(x, str): + return "b'%s'" % (x,) + if isinstance(x, (list, tuple)): + rep = [self._to_py(item) for item in x] + if len(rep) == 1: + rep.append('') + return "(%s)" % (','.join(rep),) + return x.as_python_expr() # Py2: unicode unexpected; Py3: bytes unexp. + + def write_py_source_to_f(self, f): + self._f = f + prnt = self._prnt + # + # header + prnt("# auto-generated file") + prnt("import _cffi_backend") + # + # the 'import' of the included ffis + num_includes = len(self.ffi._included_ffis or ()) + for i in range(num_includes): + ffi_to_include = self.ffi._included_ffis[i] + try: + included_module_name, included_source = ( + ffi_to_include._assigned_source[:2]) + except AttributeError: + raise VerificationError( + "ffi object %r includes %r, but the latter has not " + "been prepared with set_source()" % ( + self.ffi, ffi_to_include,)) + if included_source is not None: + raise VerificationError( + "not implemented yet: ffi.include() of a C-based " + "ffi inside a Python-based ffi") + prnt('from %s import ffi as _ffi%d' % (included_module_name, i)) + prnt() + prnt("ffi = _cffi_backend.FFI('%s'," % (self.module_name,)) + prnt(" _version = 0x%x," % (self._version,)) + self._version = None + # + # the '_types' keyword argument + self.cffi_types = tuple(self.cffi_types) # don't change any more + types_lst = [op.as_python_bytes() for op in self.cffi_types] + prnt(' _types = %s,' % (self._to_py(''.join(types_lst)),)) + typeindex2type = dict([(i, tp) for (tp, i) in self._typesdict.items()]) + # + # the keyword arguments from ALL_STEPS + for step_name in self.ALL_STEPS: + lst = self._lsts[step_name] + if len(lst) > 0 and step_name != "field": + prnt(' _%ss = %s,' % (step_name, self._to_py(lst))) + # + # the '_includes' keyword argument + if num_includes > 0: + prnt(' _includes = (%s,),' % ( + ', '.join(['_ffi%d' % i for i in range(num_includes)]),)) + # + # the footer + prnt(')') + + # ---------- + + def _gettypenum(self, type): + # a KeyError here is a bug. please report it! :-) + return self._typesdict[type] + + def _convert_funcarg_to_c(self, tp, fromvar, tovar, errcode): + extraarg = '' + if isinstance(tp, model.BasePrimitiveType) and not tp.is_complex_type(): + if tp.is_integer_type() and tp.name != '_Bool': + converter = '_cffi_to_c_int' + extraarg = ', %s' % tp.name + elif isinstance(tp, model.UnknownFloatType): + # don't check with is_float_type(): it may be a 'long + # double' here, and _cffi_to_c_double would loose precision + converter = '(%s)_cffi_to_c_double' % (tp.get_c_name(''),) + else: + cname = tp.get_c_name('') + converter = '(%s)_cffi_to_c_%s' % (cname, + tp.name.replace(' ', '_')) + if cname in ('char16_t', 'char32_t'): + self.needs_version(VERSION_CHAR16CHAR32) + errvalue = '-1' + # + elif isinstance(tp, model.PointerType): + self._convert_funcarg_to_c_ptr_or_array(tp, fromvar, + tovar, errcode) + return + # + elif (isinstance(tp, model.StructOrUnionOrEnum) or + isinstance(tp, model.BasePrimitiveType)): + # a struct (not a struct pointer) as a function argument; + # or, a complex (the same code works) + self._prnt(' if (_cffi_to_c((char *)&%s, _cffi_type(%d), %s) < 0)' + % (tovar, self._gettypenum(tp), fromvar)) + self._prnt(' %s;' % errcode) + return + # + elif isinstance(tp, model.FunctionPtrType): + converter = '(%s)_cffi_to_c_pointer' % tp.get_c_name('') + extraarg = ', _cffi_type(%d)' % self._gettypenum(tp) + errvalue = 'NULL' + # + else: + raise NotImplementedError(tp) + # + self._prnt(' %s = %s(%s%s);' % (tovar, converter, fromvar, extraarg)) + self._prnt(' if (%s == (%s)%s && PyErr_Occurred())' % ( + tovar, tp.get_c_name(''), errvalue)) + self._prnt(' %s;' % errcode) + + def _extra_local_variables(self, tp, localvars): + if isinstance(tp, model.PointerType): + localvars.add('Py_ssize_t datasize') + + def _convert_funcarg_to_c_ptr_or_array(self, tp, fromvar, tovar, errcode): + self._prnt(' datasize = _cffi_prepare_pointer_call_argument(') + self._prnt(' _cffi_type(%d), %s, (char **)&%s);' % ( + self._gettypenum(tp), fromvar, tovar)) + self._prnt(' if (datasize != 0) {') + self._prnt(' if (datasize < 0)') + self._prnt(' %s;' % errcode) + self._prnt(' %s = (%s)alloca((size_t)datasize);' % ( + tovar, tp.get_c_name(''))) + self._prnt(' memset((void *)%s, 0, (size_t)datasize);' % (tovar,)) + self._prnt(' if (_cffi_convert_array_from_object(' + '(char *)%s, _cffi_type(%d), %s) < 0)' % ( + tovar, self._gettypenum(tp), fromvar)) + self._prnt(' %s;' % errcode) + self._prnt(' }') + + def _convert_expr_from_c(self, tp, var, context): + if isinstance(tp, model.BasePrimitiveType): + if tp.is_integer_type() and tp.name != '_Bool': + return '_cffi_from_c_int(%s, %s)' % (var, tp.name) + elif isinstance(tp, model.UnknownFloatType): + return '_cffi_from_c_double(%s)' % (var,) + elif tp.name != 'long double' and not tp.is_complex_type(): + cname = tp.name.replace(' ', '_') + if cname in ('char16_t', 'char32_t'): + self.needs_version(VERSION_CHAR16CHAR32) + return '_cffi_from_c_%s(%s)' % (cname, var) + else: + return '_cffi_from_c_deref((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, (model.PointerType, model.FunctionPtrType)): + return '_cffi_from_c_pointer((char *)%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, model.ArrayType): + return '_cffi_from_c_pointer((char *)%s, _cffi_type(%d))' % ( + var, self._gettypenum(model.PointerType(tp.item))) + elif isinstance(tp, model.StructOrUnion): + if tp.fldnames is None: + raise TypeError("'%s' is used as %s, but is opaque" % ( + tp._get_c_name(), context)) + return '_cffi_from_c_struct((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, model.EnumType): + return '_cffi_from_c_deref((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + else: + raise NotImplementedError(tp) + + # ---------- + # typedefs + + def _typedef_type(self, tp, name): + return self._global_type(tp, "(*(%s *)0)" % (name,)) + + def _generate_cpy_typedef_collecttype(self, tp, name): + self._do_collect_type(self._typedef_type(tp, name)) + + def _generate_cpy_typedef_decl(self, tp, name): + pass + + def _typedef_ctx(self, tp, name): + type_index = self._typesdict[tp] + self._lsts["typename"].append(TypenameExpr(name, type_index)) + + def _generate_cpy_typedef_ctx(self, tp, name): + tp = self._typedef_type(tp, name) + self._typedef_ctx(tp, name) + if getattr(tp, "origin", None) == "unknown_type": + self._struct_ctx(tp, tp.name, approxname=None) + elif isinstance(tp, model.NamedPointerType): + self._struct_ctx(tp.totype, tp.totype.name, approxname=tp.name, + named_ptr=tp) + + # ---------- + # function declarations + + def _generate_cpy_function_collecttype(self, tp, name): + self._do_collect_type(tp.as_raw_function()) + if tp.ellipsis and not self.target_is_python: + self._do_collect_type(tp) + + def _generate_cpy_function_decl(self, tp, name): + assert not self.target_is_python + assert isinstance(tp, model.FunctionPtrType) + if tp.ellipsis: + # cannot support vararg functions better than this: check for its + # exact type (including the fixed arguments), and build it as a + # constant function pointer (no CPython wrapper) + self._generate_cpy_constant_decl(tp, name) + return + prnt = self._prnt + numargs = len(tp.args) + if numargs == 0: + argname = 'noarg' + elif numargs == 1: + argname = 'arg0' + else: + argname = 'args' + # + # ------------------------------ + # the 'd' version of the function, only for addressof(lib, 'func') + arguments = [] + call_arguments = [] + context = 'argument of %s' % name + for i, type in enumerate(tp.args): + arguments.append(type.get_c_name(' x%d' % i, context)) + call_arguments.append('x%d' % i) + repr_arguments = ', '.join(arguments) + repr_arguments = repr_arguments or 'void' + if tp.abi: + abi = tp.abi + ' ' + else: + abi = '' + name_and_arguments = '%s_cffi_d_%s(%s)' % (abi, name, repr_arguments) + prnt('static %s' % (tp.result.get_c_name(name_and_arguments),)) + prnt('{') + call_arguments = ', '.join(call_arguments) + result_code = 'return ' + if isinstance(tp.result, model.VoidType): + result_code = '' + prnt(' %s%s(%s);' % (result_code, name, call_arguments)) + prnt('}') + # + prnt('#ifndef PYPY_VERSION') # ------------------------------ + # + prnt('static PyObject *') + prnt('_cffi_f_%s(PyObject *self, PyObject *%s)' % (name, argname)) + prnt('{') + # + context = 'argument of %s' % name + for i, type in enumerate(tp.args): + arg = type.get_c_name(' x%d' % i, context) + prnt(' %s;' % arg) + # + localvars = set() + for type in tp.args: + self._extra_local_variables(type, localvars) + for decl in localvars: + prnt(' %s;' % (decl,)) + # + if not isinstance(tp.result, model.VoidType): + result_code = 'result = ' + context = 'result of %s' % name + result_decl = ' %s;' % tp.result.get_c_name(' result', context) + prnt(result_decl) + else: + result_decl = None + result_code = '' + # + if len(tp.args) > 1: + rng = range(len(tp.args)) + for i in rng: + prnt(' PyObject *arg%d;' % i) + prnt() + prnt(' if (!PyArg_UnpackTuple(args, "%s", %d, %d, %s))' % ( + name, len(rng), len(rng), + ', '.join(['&arg%d' % i for i in rng]))) + prnt(' return NULL;') + prnt() + # + for i, type in enumerate(tp.args): + self._convert_funcarg_to_c(type, 'arg%d' % i, 'x%d' % i, + 'return NULL') + prnt() + # + prnt(' Py_BEGIN_ALLOW_THREADS') + prnt(' _cffi_restore_errno();') + call_arguments = ['x%d' % i for i in range(len(tp.args))] + call_arguments = ', '.join(call_arguments) + prnt(' { %s%s(%s); }' % (result_code, name, call_arguments)) + prnt(' _cffi_save_errno();') + prnt(' Py_END_ALLOW_THREADS') + prnt() + # + prnt(' (void)self; /* unused */') + if numargs == 0: + prnt(' (void)noarg; /* unused */') + if result_code: + prnt(' return %s;' % + self._convert_expr_from_c(tp.result, 'result', 'result type')) + else: + prnt(' Py_INCREF(Py_None);') + prnt(' return Py_None;') + prnt('}') + # + prnt('#else') # ------------------------------ + # + # the PyPy version: need to replace struct/union arguments with + # pointers, and if the result is a struct/union, insert a first + # arg that is a pointer to the result. We also do that for + # complex args and return type. + def need_indirection(type): + return (isinstance(type, model.StructOrUnion) or + (isinstance(type, model.PrimitiveType) and + type.is_complex_type())) + difference = False + arguments = [] + call_arguments = [] + context = 'argument of %s' % name + for i, type in enumerate(tp.args): + indirection = '' + if need_indirection(type): + indirection = '*' + difference = True + arg = type.get_c_name(' %sx%d' % (indirection, i), context) + arguments.append(arg) + call_arguments.append('%sx%d' % (indirection, i)) + tp_result = tp.result + if need_indirection(tp_result): + context = 'result of %s' % name + arg = tp_result.get_c_name(' *result', context) + arguments.insert(0, arg) + tp_result = model.void_type + result_decl = None + result_code = '*result = ' + difference = True + if difference: + repr_arguments = ', '.join(arguments) + repr_arguments = repr_arguments or 'void' + name_and_arguments = '%s_cffi_f_%s(%s)' % (abi, name, + repr_arguments) + prnt('static %s' % (tp_result.get_c_name(name_and_arguments),)) + prnt('{') + if result_decl: + prnt(result_decl) + call_arguments = ', '.join(call_arguments) + prnt(' { %s%s(%s); }' % (result_code, name, call_arguments)) + if result_decl: + prnt(' return result;') + prnt('}') + else: + prnt('# define _cffi_f_%s _cffi_d_%s' % (name, name)) + # + prnt('#endif') # ------------------------------ + prnt() + + def _generate_cpy_function_ctx(self, tp, name): + if tp.ellipsis and not self.target_is_python: + self._generate_cpy_constant_ctx(tp, name) + return + type_index = self._typesdict[tp.as_raw_function()] + numargs = len(tp.args) + if self.target_is_python: + meth_kind = OP_DLOPEN_FUNC + elif numargs == 0: + meth_kind = OP_CPYTHON_BLTN_N # 'METH_NOARGS' + elif numargs == 1: + meth_kind = OP_CPYTHON_BLTN_O # 'METH_O' + else: + meth_kind = OP_CPYTHON_BLTN_V # 'METH_VARARGS' + self._lsts["global"].append( + GlobalExpr(name, '_cffi_f_%s' % name, + CffiOp(meth_kind, type_index), + size='_cffi_d_%s' % name)) + + # ---------- + # named structs or unions + + def _field_type(self, tp_struct, field_name, tp_field): + if isinstance(tp_field, model.ArrayType): + actual_length = tp_field.length + if actual_length == '...': + ptr_struct_name = tp_struct.get_c_name('*') + actual_length = '_cffi_array_len(((%s)0)->%s)' % ( + ptr_struct_name, field_name) + tp_item = self._field_type(tp_struct, '%s[0]' % field_name, + tp_field.item) + tp_field = model.ArrayType(tp_item, actual_length) + return tp_field + + def _struct_collecttype(self, tp): + self._do_collect_type(tp) + + def _struct_decl(self, tp, cname, approxname): + if tp.fldtypes is None: + return + prnt = self._prnt + checkfuncname = '_cffi_checkfld_%s' % (approxname,) + prnt('_CFFI_UNUSED_FN') + prnt('static void %s(%s *p)' % (checkfuncname, cname)) + prnt('{') + prnt(' /* only to generate compile-time warnings or errors */') + prnt(' (void)p;') + for fname, ftype, fbitsize, fqual in tp.enumfields(): + try: + if ftype.is_integer_type() or fbitsize >= 0: + # accept all integers, but complain on float or double + prnt(" (void)((p->%s) | 0); /* check that '%s.%s' is " + "an integer */" % (fname, cname, fname)) + continue + # only accept exactly the type declared, except that '[]' + # is interpreted as a '*' and so will match any array length. + # (It would also match '*', but that's harder to detect...) + while (isinstance(ftype, model.ArrayType) + and (ftype.length is None or ftype.length == '...')): + ftype = ftype.item + fname = fname + '[0]' + prnt(' { %s = &p->%s; (void)tmp; }' % ( + ftype.get_c_name('*tmp', 'field %r'%fname, quals=fqual), + fname)) + except VerificationError as e: + prnt(' /* %s */' % str(e)) # cannot verify it, ignore + prnt('}') + prnt('struct _cffi_align_%s { char x; %s y; };' % (approxname, cname)) + prnt() + + def _struct_ctx(self, tp, cname, approxname, named_ptr=None): + type_index = self._typesdict[tp] + reason_for_not_expanding = None + flags = [] + if isinstance(tp, model.UnionType): + flags.append("_CFFI_F_UNION") + if tp.fldtypes is None: + flags.append("_CFFI_F_OPAQUE") + reason_for_not_expanding = "opaque" + if (tp not in self.ffi._parser._included_declarations and + (named_ptr is None or + named_ptr not in self.ffi._parser._included_declarations)): + if tp.fldtypes is None: + pass # opaque + elif tp.partial or tp.has_anonymous_struct_fields(): + pass # field layout obtained silently from the C compiler + else: + flags.append("_CFFI_F_CHECK_FIELDS") + if tp.packed: + flags.append("_CFFI_F_PACKED") + else: + flags.append("_CFFI_F_EXTERNAL") + reason_for_not_expanding = "external" + flags = '|'.join(flags) or '0' + c_fields = [] + if reason_for_not_expanding is None: + enumfields = list(tp.enumfields()) + for fldname, fldtype, fbitsize, fqual in enumfields: + fldtype = self._field_type(tp, fldname, fldtype) + self._check_not_opaque(fldtype, + "field '%s.%s'" % (tp.name, fldname)) + # cname is None for _add_missing_struct_unions() only + op = OP_NOOP + if fbitsize >= 0: + op = OP_BITFIELD + size = '%d /* bits */' % fbitsize + elif cname is None or ( + isinstance(fldtype, model.ArrayType) and + fldtype.length is None): + size = '(size_t)-1' + else: + size = 'sizeof(((%s)0)->%s)' % ( + tp.get_c_name('*') if named_ptr is None + else named_ptr.name, + fldname) + if cname is None or fbitsize >= 0: + offset = '(size_t)-1' + elif named_ptr is not None: + offset = '((char *)&((%s)0)->%s) - (char *)0' % ( + named_ptr.name, fldname) + else: + offset = 'offsetof(%s, %s)' % (tp.get_c_name(''), fldname) + c_fields.append( + FieldExpr(fldname, offset, size, fbitsize, + CffiOp(op, self._typesdict[fldtype]))) + first_field_index = len(self._lsts["field"]) + self._lsts["field"].extend(c_fields) + # + if cname is None: # unknown name, for _add_missing_struct_unions + size = '(size_t)-2' + align = -2 + comment = "unnamed" + else: + if named_ptr is not None: + size = 'sizeof(*(%s)0)' % (named_ptr.name,) + align = '-1 /* unknown alignment */' + else: + size = 'sizeof(%s)' % (cname,) + align = 'offsetof(struct _cffi_align_%s, y)' % (approxname,) + comment = None + else: + size = '(size_t)-1' + align = -1 + first_field_index = -1 + comment = reason_for_not_expanding + self._lsts["struct_union"].append( + StructUnionExpr(tp.name, type_index, flags, size, align, comment, + first_field_index, c_fields)) + self._seen_struct_unions.add(tp) + + def _check_not_opaque(self, tp, location): + while isinstance(tp, model.ArrayType): + tp = tp.item + if isinstance(tp, model.StructOrUnion) and tp.fldtypes is None: + raise TypeError( + "%s is of an opaque type (not declared in cdef())" % location) + + def _add_missing_struct_unions(self): + # not very nice, but some struct declarations might be missing + # because they don't have any known C name. Check that they are + # not partial (we can't complete or verify them!) and emit them + # anonymously. + lst = list(self._struct_unions.items()) + lst.sort(key=lambda tp_order: tp_order[1]) + for tp, order in lst: + if tp not in self._seen_struct_unions: + if tp.partial: + raise NotImplementedError("internal inconsistency: %r is " + "partial but was not seen at " + "this point" % (tp,)) + if tp.name.startswith('$') and tp.name[1:].isdigit(): + approxname = tp.name[1:] + elif tp.name == '_IO_FILE' and tp.forcename == 'FILE': + approxname = 'FILE' + self._typedef_ctx(tp, 'FILE') + else: + raise NotImplementedError("internal inconsistency: %r" % + (tp,)) + self._struct_ctx(tp, None, approxname) + + def _generate_cpy_struct_collecttype(self, tp, name): + self._struct_collecttype(tp) + _generate_cpy_union_collecttype = _generate_cpy_struct_collecttype + + def _struct_names(self, tp): + cname = tp.get_c_name('') + if ' ' in cname: + return cname, cname.replace(' ', '_') + else: + return cname, '_' + cname + + def _generate_cpy_struct_decl(self, tp, name): + self._struct_decl(tp, *self._struct_names(tp)) + _generate_cpy_union_decl = _generate_cpy_struct_decl + + def _generate_cpy_struct_ctx(self, tp, name): + self._struct_ctx(tp, *self._struct_names(tp)) + _generate_cpy_union_ctx = _generate_cpy_struct_ctx + + # ---------- + # 'anonymous' declarations. These are produced for anonymous structs + # or unions; the 'name' is obtained by a typedef. + + def _generate_cpy_anonymous_collecttype(self, tp, name): + if isinstance(tp, model.EnumType): + self._generate_cpy_enum_collecttype(tp, name) + else: + self._struct_collecttype(tp) + + def _generate_cpy_anonymous_decl(self, tp, name): + if isinstance(tp, model.EnumType): + self._generate_cpy_enum_decl(tp) + else: + self._struct_decl(tp, name, 'typedef_' + name) + + def _generate_cpy_anonymous_ctx(self, tp, name): + if isinstance(tp, model.EnumType): + self._enum_ctx(tp, name) + else: + self._struct_ctx(tp, name, 'typedef_' + name) + + # ---------- + # constants, declared with "static const ..." + + def _generate_cpy_const(self, is_int, name, tp=None, category='const', + check_value=None): + if (category, name) in self._seen_constants: + raise VerificationError( + "duplicate declaration of %s '%s'" % (category, name)) + self._seen_constants.add((category, name)) + # + prnt = self._prnt + funcname = '_cffi_%s_%s' % (category, name) + if is_int: + prnt('static int %s(unsigned long long *o)' % funcname) + prnt('{') + prnt(' int n = (%s) <= 0;' % (name,)) + prnt(' *o = (unsigned long long)((%s) | 0);' + ' /* check that %s is an integer */' % (name, name)) + if check_value is not None: + if check_value > 0: + check_value = '%dU' % (check_value,) + prnt(' if (!_cffi_check_int(*o, n, %s))' % (check_value,)) + prnt(' n |= 2;') + prnt(' return n;') + prnt('}') + else: + assert check_value is None + prnt('static void %s(char *o)' % funcname) + prnt('{') + prnt(' *(%s)o = %s;' % (tp.get_c_name('*'), name)) + prnt('}') + prnt() + + def _generate_cpy_constant_collecttype(self, tp, name): + is_int = tp.is_integer_type() + if not is_int or self.target_is_python: + self._do_collect_type(tp) + + def _generate_cpy_constant_decl(self, tp, name): + is_int = tp.is_integer_type() + self._generate_cpy_const(is_int, name, tp) + + def _generate_cpy_constant_ctx(self, tp, name): + if not self.target_is_python and tp.is_integer_type(): + type_op = CffiOp(OP_CONSTANT_INT, -1) + else: + if self.target_is_python: + const_kind = OP_DLOPEN_CONST + else: + const_kind = OP_CONSTANT + type_index = self._typesdict[tp] + type_op = CffiOp(const_kind, type_index) + self._lsts["global"].append( + GlobalExpr(name, '_cffi_const_%s' % name, type_op)) + + # ---------- + # enums + + def _generate_cpy_enum_collecttype(self, tp, name): + self._do_collect_type(tp) + + def _generate_cpy_enum_decl(self, tp, name=None): + for enumerator in tp.enumerators: + self._generate_cpy_const(True, enumerator) + + def _enum_ctx(self, tp, cname): + type_index = self._typesdict[tp] + type_op = CffiOp(OP_ENUM, -1) + if self.target_is_python: + tp.check_not_partial() + for enumerator, enumvalue in zip(tp.enumerators, tp.enumvalues): + self._lsts["global"].append( + GlobalExpr(enumerator, '_cffi_const_%s' % enumerator, type_op, + check_value=enumvalue)) + # + if cname is not None and '$' not in cname and not self.target_is_python: + size = "sizeof(%s)" % cname + signed = "((%s)-1) <= 0" % cname + else: + basetp = tp.build_baseinttype(self.ffi, []) + size = self.ffi.sizeof(basetp) + signed = int(int(self.ffi.cast(basetp, -1)) < 0) + allenums = ",".join(tp.enumerators) + self._lsts["enum"].append( + EnumExpr(tp.name, type_index, size, signed, allenums)) + + def _generate_cpy_enum_ctx(self, tp, name): + self._enum_ctx(tp, tp._get_c_name()) + + # ---------- + # macros: for now only for integers + + def _generate_cpy_macro_collecttype(self, tp, name): + pass + + def _generate_cpy_macro_decl(self, tp, name): + if tp == '...': + check_value = None + else: + check_value = tp # an integer + self._generate_cpy_const(True, name, check_value=check_value) + + def _generate_cpy_macro_ctx(self, tp, name): + if tp == '...': + if self.target_is_python: + raise VerificationError( + "cannot use the syntax '...' in '#define %s ...' when " + "using the ABI mode" % (name,)) + check_value = None + else: + check_value = tp # an integer + type_op = CffiOp(OP_CONSTANT_INT, -1) + self._lsts["global"].append( + GlobalExpr(name, '_cffi_const_%s' % name, type_op, + check_value=check_value)) + + # ---------- + # global variables + + def _global_type(self, tp, global_name): + if isinstance(tp, model.ArrayType): + actual_length = tp.length + if actual_length == '...': + actual_length = '_cffi_array_len(%s)' % (global_name,) + tp_item = self._global_type(tp.item, '%s[0]' % global_name) + tp = model.ArrayType(tp_item, actual_length) + return tp + + def _generate_cpy_variable_collecttype(self, tp, name): + self._do_collect_type(self._global_type(tp, name)) + + def _generate_cpy_variable_decl(self, tp, name): + prnt = self._prnt + tp = self._global_type(tp, name) + if isinstance(tp, model.ArrayType) and tp.length is None: + tp = tp.item + ampersand = '' + else: + ampersand = '&' + # This code assumes that casts from "tp *" to "void *" is a + # no-op, i.e. a function that returns a "tp *" can be called + # as if it returned a "void *". This should be generally true + # on any modern machine. The only exception to that rule (on + # uncommon architectures, and as far as I can tell) might be + # if 'tp' were a function type, but that is not possible here. + # (If 'tp' is a function _pointer_ type, then casts from "fn_t + # **" to "void *" are again no-ops, as far as I can tell.) + decl = '*_cffi_var_%s(void)' % (name,) + prnt('static ' + tp.get_c_name(decl, quals=self._current_quals)) + prnt('{') + prnt(' return %s(%s);' % (ampersand, name)) + prnt('}') + prnt() + + def _generate_cpy_variable_ctx(self, tp, name): + tp = self._global_type(tp, name) + type_index = self._typesdict[tp] + if self.target_is_python: + op = OP_GLOBAL_VAR + else: + op = OP_GLOBAL_VAR_F + self._lsts["global"].append( + GlobalExpr(name, '_cffi_var_%s' % name, CffiOp(op, type_index))) + + # ---------- + # extern "Python" + + def _generate_cpy_extern_python_collecttype(self, tp, name): + assert isinstance(tp, model.FunctionPtrType) + self._do_collect_type(tp) + _generate_cpy_dllexport_python_collecttype = \ + _generate_cpy_extern_python_plus_c_collecttype = \ + _generate_cpy_extern_python_collecttype + + def _extern_python_decl(self, tp, name, tag_and_space): + prnt = self._prnt + if isinstance(tp.result, model.VoidType): + size_of_result = '0' + else: + context = 'result of %s' % name + size_of_result = '(int)sizeof(%s)' % ( + tp.result.get_c_name('', context),) + prnt('static struct _cffi_externpy_s _cffi_externpy__%s =' % name) + prnt(' { "%s.%s", %s };' % (self.module_name, name, size_of_result)) + prnt() + # + arguments = [] + context = 'argument of %s' % name + for i, type in enumerate(tp.args): + arg = type.get_c_name(' a%d' % i, context) + arguments.append(arg) + # + repr_arguments = ', '.join(arguments) + repr_arguments = repr_arguments or 'void' + name_and_arguments = '%s(%s)' % (name, repr_arguments) + if tp.abi == "__stdcall": + name_and_arguments = '_cffi_stdcall ' + name_and_arguments + # + def may_need_128_bits(tp): + return (isinstance(tp, model.PrimitiveType) and + tp.name == 'long double') + # + size_of_a = max(len(tp.args)*8, 8) + if may_need_128_bits(tp.result): + size_of_a = max(size_of_a, 16) + if isinstance(tp.result, model.StructOrUnion): + size_of_a = 'sizeof(%s) > %d ? sizeof(%s) : %d' % ( + tp.result.get_c_name(''), size_of_a, + tp.result.get_c_name(''), size_of_a) + prnt('%s%s' % (tag_and_space, tp.result.get_c_name(name_and_arguments))) + prnt('{') + prnt(' char a[%s];' % size_of_a) + prnt(' char *p = a;') + for i, type in enumerate(tp.args): + arg = 'a%d' % i + if (isinstance(type, model.StructOrUnion) or + may_need_128_bits(type)): + arg = '&' + arg + type = model.PointerType(type) + prnt(' *(%s)(p + %d) = %s;' % (type.get_c_name('*'), i*8, arg)) + prnt(' _cffi_call_python(&_cffi_externpy__%s, p);' % name) + if not isinstance(tp.result, model.VoidType): + prnt(' return *(%s)p;' % (tp.result.get_c_name('*'),)) + prnt('}') + prnt() + self._num_externpy += 1 + + def _generate_cpy_extern_python_decl(self, tp, name): + self._extern_python_decl(tp, name, 'static ') + + def _generate_cpy_dllexport_python_decl(self, tp, name): + self._extern_python_decl(tp, name, 'CFFI_DLLEXPORT ') + + def _generate_cpy_extern_python_plus_c_decl(self, tp, name): + self._extern_python_decl(tp, name, '') + + def _generate_cpy_extern_python_ctx(self, tp, name): + if self.target_is_python: + raise VerificationError( + "cannot use 'extern \"Python\"' in the ABI mode") + if tp.ellipsis: + raise NotImplementedError("a vararg function is extern \"Python\"") + type_index = self._typesdict[tp] + type_op = CffiOp(OP_EXTERN_PYTHON, type_index) + self._lsts["global"].append( + GlobalExpr(name, '&_cffi_externpy__%s' % name, type_op, name)) + + _generate_cpy_dllexport_python_ctx = \ + _generate_cpy_extern_python_plus_c_ctx = \ + _generate_cpy_extern_python_ctx + + def _print_string_literal_in_array(self, s): + prnt = self._prnt + prnt('// # NB. this is not a string because of a size limit in MSVC') + for line in s.splitlines(True): + prnt(('// ' + line).rstrip()) + printed_line = '' + for c in line: + if len(printed_line) >= 76: + prnt(printed_line) + printed_line = '' + printed_line += '%d,' % (ord(c),) + prnt(printed_line) + + # ---------- + # emitting the opcodes for individual types + + def _emit_bytecode_VoidType(self, tp, index): + self.cffi_types[index] = CffiOp(OP_PRIMITIVE, PRIM_VOID) + + def _emit_bytecode_PrimitiveType(self, tp, index): + prim_index = PRIMITIVE_TO_INDEX[tp.name] + self.cffi_types[index] = CffiOp(OP_PRIMITIVE, prim_index) + + def _emit_bytecode_UnknownIntegerType(self, tp, index): + s = ('_cffi_prim_int(sizeof(%s), (\n' + ' ((%s)-1) | 0 /* check that %s is an integer type */\n' + ' ) <= 0)' % (tp.name, tp.name, tp.name)) + self.cffi_types[index] = CffiOp(OP_PRIMITIVE, s) + + def _emit_bytecode_UnknownFloatType(self, tp, index): + s = ('_cffi_prim_float(sizeof(%s) *\n' + ' (((%s)1) / 2) * 2 /* integer => 0, float => 1 */\n' + ' )' % (tp.name, tp.name)) + self.cffi_types[index] = CffiOp(OP_PRIMITIVE, s) + + def _emit_bytecode_RawFunctionType(self, tp, index): + self.cffi_types[index] = CffiOp(OP_FUNCTION, self._typesdict[tp.result]) + index += 1 + for tp1 in tp.args: + realindex = self._typesdict[tp1] + if index != realindex: + if isinstance(tp1, model.PrimitiveType): + self._emit_bytecode_PrimitiveType(tp1, index) + else: + self.cffi_types[index] = CffiOp(OP_NOOP, realindex) + index += 1 + flags = int(tp.ellipsis) + if tp.abi is not None: + if tp.abi == '__stdcall': + flags |= 2 + else: + raise NotImplementedError("abi=%r" % (tp.abi,)) + self.cffi_types[index] = CffiOp(OP_FUNCTION_END, flags) + + def _emit_bytecode_PointerType(self, tp, index): + self.cffi_types[index] = CffiOp(OP_POINTER, self._typesdict[tp.totype]) + + _emit_bytecode_ConstPointerType = _emit_bytecode_PointerType + _emit_bytecode_NamedPointerType = _emit_bytecode_PointerType + + def _emit_bytecode_FunctionPtrType(self, tp, index): + raw = tp.as_raw_function() + self.cffi_types[index] = CffiOp(OP_POINTER, self._typesdict[raw]) + + def _emit_bytecode_ArrayType(self, tp, index): + item_index = self._typesdict[tp.item] + if tp.length is None: + self.cffi_types[index] = CffiOp(OP_OPEN_ARRAY, item_index) + elif tp.length == '...': + raise VerificationError( + "type %s badly placed: the '...' array length can only be " + "used on global arrays or on fields of structures" % ( + str(tp).replace('/*...*/', '...'),)) + else: + assert self.cffi_types[index + 1] == 'LEN' + self.cffi_types[index] = CffiOp(OP_ARRAY, item_index) + self.cffi_types[index + 1] = CffiOp(None, str(tp.length)) + + def _emit_bytecode_StructType(self, tp, index): + struct_index = self._struct_unions[tp] + self.cffi_types[index] = CffiOp(OP_STRUCT_UNION, struct_index) + _emit_bytecode_UnionType = _emit_bytecode_StructType + + def _emit_bytecode_EnumType(self, tp, index): + enum_index = self._enums[tp] + self.cffi_types[index] = CffiOp(OP_ENUM, enum_index) + + +if sys.version_info >= (3,): + NativeIO = io.StringIO +else: + class NativeIO(io.BytesIO): + def write(self, s): + if isinstance(s, unicode): + s = s.encode('ascii') + super(NativeIO, self).write(s) + +def _make_c_or_py_source(ffi, module_name, preamble, target_file, verbose): + if verbose: + print("generating %s" % (target_file,)) + recompiler = Recompiler(ffi, module_name, + target_is_python=(preamble is None)) + recompiler.collect_type_table() + recompiler.collect_step_tables() + f = NativeIO() + recompiler.write_source_to_f(f, preamble) + output = f.getvalue() + try: + with open(target_file, 'r') as f1: + if f1.read(len(output) + 1) != output: + raise IOError + if verbose: + print("(already up-to-date)") + return False # already up-to-date + except IOError: + tmp_file = '%s.~%d' % (target_file, os.getpid()) + with open(tmp_file, 'w') as f1: + f1.write(output) + try: + os.rename(tmp_file, target_file) + except OSError: + os.unlink(target_file) + os.rename(tmp_file, target_file) + return True + +def make_c_source(ffi, module_name, preamble, target_c_file, verbose=False): + assert preamble is not None + return _make_c_or_py_source(ffi, module_name, preamble, target_c_file, + verbose) + +def make_py_source(ffi, module_name, target_py_file, verbose=False): + return _make_c_or_py_source(ffi, module_name, None, target_py_file, + verbose) + +def _modname_to_file(outputdir, modname, extension): + parts = modname.split('.') + try: + os.makedirs(os.path.join(outputdir, *parts[:-1])) + except OSError: + pass + parts[-1] += extension + return os.path.join(outputdir, *parts), parts + + +# Aaargh. Distutils is not tested at all for the purpose of compiling +# DLLs that are not extension modules. Here are some hacks to work +# around that, in the _patch_for_*() functions... + +def _patch_meth(patchlist, cls, name, new_meth): + old = getattr(cls, name) + patchlist.append((cls, name, old)) + setattr(cls, name, new_meth) + return old + +def _unpatch_meths(patchlist): + for cls, name, old_meth in reversed(patchlist): + setattr(cls, name, old_meth) + +def _patch_for_embedding(patchlist): + if sys.platform == 'win32': + # we must not remove the manifest when building for embedding! + from distutils.msvc9compiler import MSVCCompiler + _patch_meth(patchlist, MSVCCompiler, '_remove_visual_c_ref', + lambda self, manifest_file: manifest_file) + + if sys.platform == 'darwin': + # we must not make a '-bundle', but a '-dynamiclib' instead + from distutils.ccompiler import CCompiler + def my_link_shared_object(self, *args, **kwds): + if '-bundle' in self.linker_so: + self.linker_so = list(self.linker_so) + i = self.linker_so.index('-bundle') + self.linker_so[i] = '-dynamiclib' + return old_link_shared_object(self, *args, **kwds) + old_link_shared_object = _patch_meth(patchlist, CCompiler, + 'link_shared_object', + my_link_shared_object) + +def _patch_for_target(patchlist, target): + from distutils.command.build_ext import build_ext + # if 'target' is different from '*', we need to patch some internal + # method to just return this 'target' value, instead of having it + # built from module_name + if target.endswith('.*'): + target = target[:-2] + if sys.platform == 'win32': + target += '.dll' + elif sys.platform == 'darwin': + target += '.dylib' + else: + target += '.so' + _patch_meth(patchlist, build_ext, 'get_ext_filename', + lambda self, ext_name: target) + + +def recompile(ffi, module_name, preamble, tmpdir='.', call_c_compiler=True, + c_file=None, source_extension='.c', extradir=None, + compiler_verbose=1, target=None, debug=None, **kwds): + if not isinstance(module_name, str): + module_name = module_name.encode('ascii') + if ffi._windows_unicode: + ffi._apply_windows_unicode(kwds) + if preamble is not None: + embedding = (ffi._embedding is not None) + if embedding: + ffi._apply_embedding_fix(kwds) + if c_file is None: + c_file, parts = _modname_to_file(tmpdir, module_name, + source_extension) + if extradir: + parts = [extradir] + parts + ext_c_file = os.path.join(*parts) + else: + ext_c_file = c_file + # + if target is None: + if embedding: + target = '%s.*' % module_name + else: + target = '*' + # + ext = ffiplatform.get_extension(ext_c_file, module_name, **kwds) + updated = make_c_source(ffi, module_name, preamble, c_file, + verbose=compiler_verbose) + if call_c_compiler: + patchlist = [] + cwd = os.getcwd() + try: + if embedding: + _patch_for_embedding(patchlist) + if target != '*': + _patch_for_target(patchlist, target) + if compiler_verbose: + if tmpdir == '.': + msg = 'the current directory is' + else: + msg = 'setting the current directory to' + print('%s %r' % (msg, os.path.abspath(tmpdir))) + os.chdir(tmpdir) + outputfilename = ffiplatform.compile('.', ext, + compiler_verbose, debug) + finally: + os.chdir(cwd) + _unpatch_meths(patchlist) + return outputfilename + else: + return ext, updated + else: + if c_file is None: + c_file, _ = _modname_to_file(tmpdir, module_name, '.py') + updated = make_py_source(ffi, module_name, c_file, + verbose=compiler_verbose) + if call_c_compiler: + return c_file + else: + return None, updated + +def _verify(ffi, module_name, preamble, *args, **kwds): + # FOR TESTS ONLY + from testing.udir import udir + import imp + assert module_name not in sys.modules, "module name conflict: %r" % ( + module_name,) + kwds.setdefault('tmpdir', str(udir)) + outputfilename = recompile(ffi, module_name, preamble, *args, **kwds) + module = imp.load_dynamic(module_name, outputfilename) + # + # hack hack hack: copy all *bound methods* from module.ffi back to the + # ffi instance. Then calls like ffi.new() will invoke module.ffi.new(). + for name in dir(module.ffi): + if not name.startswith('_'): + attr = getattr(module.ffi, name) + if attr is not getattr(ffi, name, object()): + setattr(ffi, name, attr) + def typeof_disabled(*args, **kwds): + raise NotImplementedError + ffi._typeof = typeof_disabled + for name in dir(ffi): + if not name.startswith('_') and not hasattr(module.ffi, name): + setattr(ffi, name, NotImplemented) + return module.lib diff --git a/website/web/Lib/site-packages/cffi/setuptools_ext.py b/website/web/Lib/site-packages/cffi/setuptools_ext.py new file mode 100644 index 000000000..dd1b946c0 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/setuptools_ext.py @@ -0,0 +1,193 @@ +import os +import sys + +try: + basestring +except NameError: + # Python 3.x + basestring = str + +def error(msg): + from distutils.errors import DistutilsSetupError + raise DistutilsSetupError(msg) + + +def execfile(filename, glob): + # We use execfile() (here rewritten for Python 3) instead of + # __import__() to load the build script. The problem with + # a normal import is that in some packages, the intermediate + # __init__.py files may already try to import the file that + # we are generating. + with open(filename) as f: + src = f.read() + src += '\n' # Python 2.6 compatibility + code = compile(src, filename, 'exec') + exec(code, glob, glob) + + +def add_cffi_module(dist, mod_spec): + from cffi.api import FFI + + if not isinstance(mod_spec, basestring): + error("argument to 'cffi_modules=...' must be a str or a list of str," + " not %r" % (type(mod_spec).__name__,)) + mod_spec = str(mod_spec) + try: + build_file_name, ffi_var_name = mod_spec.split(':') + except ValueError: + error("%r must be of the form 'path/build.py:ffi_variable'" % + (mod_spec,)) + if not os.path.exists(build_file_name): + ext = '' + rewritten = build_file_name.replace('.', '/') + '.py' + if os.path.exists(rewritten): + ext = ' (rewrite cffi_modules to [%r])' % ( + rewritten + ':' + ffi_var_name,) + error("%r does not name an existing file%s" % (build_file_name, ext)) + + mod_vars = {'__name__': '__cffi__', '__file__': build_file_name} + execfile(build_file_name, mod_vars) + + try: + ffi = mod_vars[ffi_var_name] + except KeyError: + error("%r: object %r not found in module" % (mod_spec, + ffi_var_name)) + if not isinstance(ffi, FFI): + ffi = ffi() # maybe it's a function instead of directly an ffi + if not isinstance(ffi, FFI): + error("%r is not an FFI instance (got %r)" % (mod_spec, + type(ffi).__name__)) + if not hasattr(ffi, '_assigned_source'): + error("%r: the set_source() method was not called" % (mod_spec,)) + module_name, source, source_extension, kwds = ffi._assigned_source + if ffi._windows_unicode: + kwds = kwds.copy() + ffi._apply_windows_unicode(kwds) + + if source is None: + _add_py_module(dist, ffi, module_name) + else: + _add_c_module(dist, ffi, module_name, source, source_extension, kwds) + +def _set_py_limited_api(Extension, kwds): + """ + Add py_limited_api to kwds if setuptools >= 26 is in use. + Do not alter the setting if it already exists. + Setuptools takes care of ignoring the flag on Python 2 and PyPy. + + CPython itself should ignore the flag in a debugging version + (by not listing .abi3.so in the extensions it supports), but + it doesn't so far, creating troubles. That's why we check + for "not hasattr(sys, 'gettotalrefcount')" (the 2.7 compatible equivalent + of 'd' not in sys.abiflags). (http://bugs.python.org/issue28401) + + On Windows, it's better not to use py_limited_api until issue #355 + can be resolved (by having virtualenv copy PYTHON3.DLL). See also + the start of _cffi_include.h. + """ + if ('py_limited_api' not in kwds and not hasattr(sys, 'gettotalrefcount') + and sys.platform != 'win32'): + import setuptools + try: + setuptools_major_version = int(setuptools.__version__.partition('.')[0]) + if setuptools_major_version >= 26: + kwds['py_limited_api'] = True + except ValueError: # certain development versions of setuptools + # If we don't know the version number of setuptools, we + # try to set 'py_limited_api' anyway. At worst, we get a + # warning. + kwds['py_limited_api'] = True + return kwds + +def _add_c_module(dist, ffi, module_name, source, source_extension, kwds): + from distutils.core import Extension + # We are a setuptools extension. Need this build_ext for py_limited_api. + from setuptools.command.build_ext import build_ext + from distutils.dir_util import mkpath + from distutils import log + from cffi import recompiler + + allsources = ['$PLACEHOLDER'] + allsources.extend(kwds.pop('sources', [])) + kwds = _set_py_limited_api(Extension, kwds) + ext = Extension(name=module_name, sources=allsources, **kwds) + + def make_mod(tmpdir, pre_run=None): + c_file = os.path.join(tmpdir, module_name + source_extension) + log.info("generating cffi module %r" % c_file) + mkpath(tmpdir) + # a setuptools-only, API-only hook: called with the "ext" and "ffi" + # arguments just before we turn the ffi into C code. To use it, + # subclass the 'distutils.command.build_ext.build_ext' class and + # add a method 'def pre_run(self, ext, ffi)'. + if pre_run is not None: + pre_run(ext, ffi) + updated = recompiler.make_c_source(ffi, module_name, source, c_file) + if not updated: + log.info("already up-to-date") + return c_file + + if dist.ext_modules is None: + dist.ext_modules = [] + dist.ext_modules.append(ext) + + base_class = dist.cmdclass.get('build_ext', build_ext) + class build_ext_make_mod(base_class): + def run(self): + if ext.sources[0] == '$PLACEHOLDER': + pre_run = getattr(self, 'pre_run', None) + ext.sources[0] = make_mod(self.build_temp, pre_run) + base_class.run(self) + dist.cmdclass['build_ext'] = build_ext_make_mod + # NB. multiple runs here will create multiple 'build_ext_make_mod' + # classes. Even in this case the 'build_ext' command should be + # run once; but just in case, the logic above does nothing if + # called again. + + +def _add_py_module(dist, ffi, module_name): + from distutils.dir_util import mkpath + from distutils.command.build_py import build_py + from distutils.command.build_ext import build_ext + from distutils import log + from cffi import recompiler + + def generate_mod(py_file): + log.info("generating cffi module %r" % py_file) + mkpath(os.path.dirname(py_file)) + updated = recompiler.make_py_source(ffi, module_name, py_file) + if not updated: + log.info("already up-to-date") + + base_class = dist.cmdclass.get('build_py', build_py) + class build_py_make_mod(base_class): + def run(self): + base_class.run(self) + module_path = module_name.split('.') + module_path[-1] += '.py' + generate_mod(os.path.join(self.build_lib, *module_path)) + dist.cmdclass['build_py'] = build_py_make_mod + + # the following is only for "build_ext -i" + base_class_2 = dist.cmdclass.get('build_ext', build_ext) + class build_ext_make_mod(base_class_2): + def run(self): + base_class_2.run(self) + if self.inplace: + # from get_ext_fullpath() in distutils/command/build_ext.py + module_path = module_name.split('.') + package = '.'.join(module_path[:-1]) + build_py = self.get_finalized_command('build_py') + package_dir = build_py.get_package_dir(package) + file_name = module_path[-1] + '.py' + generate_mod(os.path.join(package_dir, file_name)) + dist.cmdclass['build_ext'] = build_ext_make_mod + +def cffi_modules(dist, attr, value): + assert attr == 'cffi_modules' + if isinstance(value, basestring): + value = [value] + + for cffi_module in value: + add_cffi_module(dist, cffi_module) diff --git a/website/web/Lib/site-packages/cffi/vengine_cpy.py b/website/web/Lib/site-packages/cffi/vengine_cpy.py new file mode 100644 index 000000000..536f11f80 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/vengine_cpy.py @@ -0,0 +1,1015 @@ +# +# DEPRECATED: implementation for ffi.verify() +# +import sys, imp +from . import model +from .error import VerificationError + + +class VCPythonEngine(object): + _class_key = 'x' + _gen_python_module = True + + def __init__(self, verifier): + self.verifier = verifier + self.ffi = verifier.ffi + self._struct_pending_verification = {} + self._types_of_builtin_functions = {} + + def patch_extension_kwds(self, kwds): + pass + + def find_module(self, module_name, path, so_suffixes): + try: + f, filename, descr = imp.find_module(module_name, path) + except ImportError: + return None + if f is not None: + f.close() + # Note that after a setuptools installation, there are both .py + # and .so files with the same basename. The code here relies on + # imp.find_module() locating the .so in priority. + if descr[0] not in so_suffixes: + return None + return filename + + def collect_types(self): + self._typesdict = {} + self._generate("collecttype") + + def _prnt(self, what=''): + self._f.write(what + '\n') + + def _gettypenum(self, type): + # a KeyError here is a bug. please report it! :-) + return self._typesdict[type] + + def _do_collect_type(self, tp): + if ((not isinstance(tp, model.PrimitiveType) + or tp.name == 'long double') + and tp not in self._typesdict): + num = len(self._typesdict) + self._typesdict[tp] = num + + def write_source_to_f(self): + self.collect_types() + # + # The new module will have a _cffi_setup() function that receives + # objects from the ffi world, and that calls some setup code in + # the module. This setup code is split in several independent + # functions, e.g. one per constant. The functions are "chained" + # by ending in a tail call to each other. + # + # This is further split in two chained lists, depending on if we + # can do it at import-time or if we must wait for _cffi_setup() to + # provide us with the objects. This is needed because we + # need the values of the enum constants in order to build the + # that we may have to pass to _cffi_setup(). + # + # The following two 'chained_list_constants' items contains + # the head of these two chained lists, as a string that gives the + # call to do, if any. + self._chained_list_constants = ['((void)lib,0)', '((void)lib,0)'] + # + prnt = self._prnt + # first paste some standard set of lines that are mostly '#define' + prnt(cffimod_header) + prnt() + # then paste the C source given by the user, verbatim. + prnt(self.verifier.preamble) + prnt() + # + # call generate_cpy_xxx_decl(), for every xxx found from + # ffi._parser._declarations. This generates all the functions. + self._generate("decl") + # + # implement the function _cffi_setup_custom() as calling the + # head of the chained list. + self._generate_setup_custom() + prnt() + # + # produce the method table, including the entries for the + # generated Python->C function wrappers, which are done + # by generate_cpy_function_method(). + prnt('static PyMethodDef _cffi_methods[] = {') + self._generate("method") + prnt(' {"_cffi_setup", _cffi_setup, METH_VARARGS, NULL},') + prnt(' {NULL, NULL, 0, NULL} /* Sentinel */') + prnt('};') + prnt() + # + # standard init. + modname = self.verifier.get_module_name() + constants = self._chained_list_constants[False] + prnt('#if PY_MAJOR_VERSION >= 3') + prnt() + prnt('static struct PyModuleDef _cffi_module_def = {') + prnt(' PyModuleDef_HEAD_INIT,') + prnt(' "%s",' % modname) + prnt(' NULL,') + prnt(' -1,') + prnt(' _cffi_methods,') + prnt(' NULL, NULL, NULL, NULL') + prnt('};') + prnt() + prnt('PyMODINIT_FUNC') + prnt('PyInit_%s(void)' % modname) + prnt('{') + prnt(' PyObject *lib;') + prnt(' lib = PyModule_Create(&_cffi_module_def);') + prnt(' if (lib == NULL)') + prnt(' return NULL;') + prnt(' if (%s < 0 || _cffi_init() < 0) {' % (constants,)) + prnt(' Py_DECREF(lib);') + prnt(' return NULL;') + prnt(' }') + prnt(' return lib;') + prnt('}') + prnt() + prnt('#else') + prnt() + prnt('PyMODINIT_FUNC') + prnt('init%s(void)' % modname) + prnt('{') + prnt(' PyObject *lib;') + prnt(' lib = Py_InitModule("%s", _cffi_methods);' % modname) + prnt(' if (lib == NULL)') + prnt(' return;') + prnt(' if (%s < 0 || _cffi_init() < 0)' % (constants,)) + prnt(' return;') + prnt(' return;') + prnt('}') + prnt() + prnt('#endif') + + def load_library(self, flags=None): + # XXX review all usages of 'self' here! + # import it as a new extension module + imp.acquire_lock() + try: + if hasattr(sys, "getdlopenflags"): + previous_flags = sys.getdlopenflags() + try: + if hasattr(sys, "setdlopenflags") and flags is not None: + sys.setdlopenflags(flags) + module = imp.load_dynamic(self.verifier.get_module_name(), + self.verifier.modulefilename) + except ImportError as e: + error = "importing %r: %s" % (self.verifier.modulefilename, e) + raise VerificationError(error) + finally: + if hasattr(sys, "setdlopenflags"): + sys.setdlopenflags(previous_flags) + finally: + imp.release_lock() + # + # call loading_cpy_struct() to get the struct layout inferred by + # the C compiler + self._load(module, 'loading') + # + # the C code will need the objects. Collect them in + # order in a list. + revmapping = dict([(value, key) + for (key, value) in self._typesdict.items()]) + lst = [revmapping[i] for i in range(len(revmapping))] + lst = list(map(self.ffi._get_cached_btype, lst)) + # + # build the FFILibrary class and instance and call _cffi_setup(). + # this will set up some fields like '_cffi_types', and only then + # it will invoke the chained list of functions that will really + # build (notably) the constant objects, as if they are + # pointers, and store them as attributes on the 'library' object. + class FFILibrary(object): + _cffi_python_module = module + _cffi_ffi = self.ffi + _cffi_dir = [] + def __dir__(self): + return FFILibrary._cffi_dir + list(self.__dict__) + library = FFILibrary() + if module._cffi_setup(lst, VerificationError, library): + import warnings + warnings.warn("reimporting %r might overwrite older definitions" + % (self.verifier.get_module_name())) + # + # finally, call the loaded_cpy_xxx() functions. This will perform + # the final adjustments, like copying the Python->C wrapper + # functions from the module to the 'library' object, and setting + # up the FFILibrary class with properties for the global C variables. + self._load(module, 'loaded', library=library) + module._cffi_original_ffi = self.ffi + module._cffi_types_of_builtin_funcs = self._types_of_builtin_functions + return library + + def _get_declarations(self): + lst = [(key, tp) for (key, (tp, qual)) in + self.ffi._parser._declarations.items()] + lst.sort() + return lst + + def _generate(self, step_name): + for name, tp in self._get_declarations(): + kind, realname = name.split(' ', 1) + try: + method = getattr(self, '_generate_cpy_%s_%s' % (kind, + step_name)) + except AttributeError: + raise VerificationError( + "not implemented in verify(): %r" % name) + try: + method(tp, realname) + except Exception as e: + model.attach_exception_info(e, name) + raise + + def _load(self, module, step_name, **kwds): + for name, tp in self._get_declarations(): + kind, realname = name.split(' ', 1) + method = getattr(self, '_%s_cpy_%s' % (step_name, kind)) + try: + method(tp, realname, module, **kwds) + except Exception as e: + model.attach_exception_info(e, name) + raise + + def _generate_nothing(self, tp, name): + pass + + def _loaded_noop(self, tp, name, module, **kwds): + pass + + # ---------- + + def _convert_funcarg_to_c(self, tp, fromvar, tovar, errcode): + extraarg = '' + if isinstance(tp, model.PrimitiveType): + if tp.is_integer_type() and tp.name != '_Bool': + converter = '_cffi_to_c_int' + extraarg = ', %s' % tp.name + else: + converter = '(%s)_cffi_to_c_%s' % (tp.get_c_name(''), + tp.name.replace(' ', '_')) + errvalue = '-1' + # + elif isinstance(tp, model.PointerType): + self._convert_funcarg_to_c_ptr_or_array(tp, fromvar, + tovar, errcode) + return + # + elif isinstance(tp, (model.StructOrUnion, model.EnumType)): + # a struct (not a struct pointer) as a function argument + self._prnt(' if (_cffi_to_c((char *)&%s, _cffi_type(%d), %s) < 0)' + % (tovar, self._gettypenum(tp), fromvar)) + self._prnt(' %s;' % errcode) + return + # + elif isinstance(tp, model.FunctionPtrType): + converter = '(%s)_cffi_to_c_pointer' % tp.get_c_name('') + extraarg = ', _cffi_type(%d)' % self._gettypenum(tp) + errvalue = 'NULL' + # + else: + raise NotImplementedError(tp) + # + self._prnt(' %s = %s(%s%s);' % (tovar, converter, fromvar, extraarg)) + self._prnt(' if (%s == (%s)%s && PyErr_Occurred())' % ( + tovar, tp.get_c_name(''), errvalue)) + self._prnt(' %s;' % errcode) + + def _extra_local_variables(self, tp, localvars): + if isinstance(tp, model.PointerType): + localvars.add('Py_ssize_t datasize') + + def _convert_funcarg_to_c_ptr_or_array(self, tp, fromvar, tovar, errcode): + self._prnt(' datasize = _cffi_prepare_pointer_call_argument(') + self._prnt(' _cffi_type(%d), %s, (char **)&%s);' % ( + self._gettypenum(tp), fromvar, tovar)) + self._prnt(' if (datasize != 0) {') + self._prnt(' if (datasize < 0)') + self._prnt(' %s;' % errcode) + self._prnt(' %s = alloca((size_t)datasize);' % (tovar,)) + self._prnt(' memset((void *)%s, 0, (size_t)datasize);' % (tovar,)) + self._prnt(' if (_cffi_convert_array_from_object(' + '(char *)%s, _cffi_type(%d), %s) < 0)' % ( + tovar, self._gettypenum(tp), fromvar)) + self._prnt(' %s;' % errcode) + self._prnt(' }') + + def _convert_expr_from_c(self, tp, var, context): + if isinstance(tp, model.PrimitiveType): + if tp.is_integer_type() and tp.name != '_Bool': + return '_cffi_from_c_int(%s, %s)' % (var, tp.name) + elif tp.name != 'long double': + return '_cffi_from_c_%s(%s)' % (tp.name.replace(' ', '_'), var) + else: + return '_cffi_from_c_deref((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, (model.PointerType, model.FunctionPtrType)): + return '_cffi_from_c_pointer((char *)%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, model.ArrayType): + return '_cffi_from_c_pointer((char *)%s, _cffi_type(%d))' % ( + var, self._gettypenum(model.PointerType(tp.item))) + elif isinstance(tp, model.StructOrUnion): + if tp.fldnames is None: + raise TypeError("'%s' is used as %s, but is opaque" % ( + tp._get_c_name(), context)) + return '_cffi_from_c_struct((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + elif isinstance(tp, model.EnumType): + return '_cffi_from_c_deref((char *)&%s, _cffi_type(%d))' % ( + var, self._gettypenum(tp)) + else: + raise NotImplementedError(tp) + + # ---------- + # typedefs: generates no code so far + + _generate_cpy_typedef_collecttype = _generate_nothing + _generate_cpy_typedef_decl = _generate_nothing + _generate_cpy_typedef_method = _generate_nothing + _loading_cpy_typedef = _loaded_noop + _loaded_cpy_typedef = _loaded_noop + + # ---------- + # function declarations + + def _generate_cpy_function_collecttype(self, tp, name): + assert isinstance(tp, model.FunctionPtrType) + if tp.ellipsis: + self._do_collect_type(tp) + else: + # don't call _do_collect_type(tp) in this common case, + # otherwise test_autofilled_struct_as_argument fails + for type in tp.args: + self._do_collect_type(type) + self._do_collect_type(tp.result) + + def _generate_cpy_function_decl(self, tp, name): + assert isinstance(tp, model.FunctionPtrType) + if tp.ellipsis: + # cannot support vararg functions better than this: check for its + # exact type (including the fixed arguments), and build it as a + # constant function pointer (no CPython wrapper) + self._generate_cpy_const(False, name, tp) + return + prnt = self._prnt + numargs = len(tp.args) + if numargs == 0: + argname = 'noarg' + elif numargs == 1: + argname = 'arg0' + else: + argname = 'args' + prnt('static PyObject *') + prnt('_cffi_f_%s(PyObject *self, PyObject *%s)' % (name, argname)) + prnt('{') + # + context = 'argument of %s' % name + for i, type in enumerate(tp.args): + prnt(' %s;' % type.get_c_name(' x%d' % i, context)) + # + localvars = set() + for type in tp.args: + self._extra_local_variables(type, localvars) + for decl in localvars: + prnt(' %s;' % (decl,)) + # + if not isinstance(tp.result, model.VoidType): + result_code = 'result = ' + context = 'result of %s' % name + prnt(' %s;' % tp.result.get_c_name(' result', context)) + else: + result_code = '' + # + if len(tp.args) > 1: + rng = range(len(tp.args)) + for i in rng: + prnt(' PyObject *arg%d;' % i) + prnt() + prnt(' if (!PyArg_ParseTuple(args, "%s:%s", %s))' % ( + 'O' * numargs, name, ', '.join(['&arg%d' % i for i in rng]))) + prnt(' return NULL;') + prnt() + # + for i, type in enumerate(tp.args): + self._convert_funcarg_to_c(type, 'arg%d' % i, 'x%d' % i, + 'return NULL') + prnt() + # + prnt(' Py_BEGIN_ALLOW_THREADS') + prnt(' _cffi_restore_errno();') + prnt(' { %s%s(%s); }' % ( + result_code, name, + ', '.join(['x%d' % i for i in range(len(tp.args))]))) + prnt(' _cffi_save_errno();') + prnt(' Py_END_ALLOW_THREADS') + prnt() + # + prnt(' (void)self; /* unused */') + if numargs == 0: + prnt(' (void)noarg; /* unused */') + if result_code: + prnt(' return %s;' % + self._convert_expr_from_c(tp.result, 'result', 'result type')) + else: + prnt(' Py_INCREF(Py_None);') + prnt(' return Py_None;') + prnt('}') + prnt() + + def _generate_cpy_function_method(self, tp, name): + if tp.ellipsis: + return + numargs = len(tp.args) + if numargs == 0: + meth = 'METH_NOARGS' + elif numargs == 1: + meth = 'METH_O' + else: + meth = 'METH_VARARGS' + self._prnt(' {"%s", _cffi_f_%s, %s, NULL},' % (name, name, meth)) + + _loading_cpy_function = _loaded_noop + + def _loaded_cpy_function(self, tp, name, module, library): + if tp.ellipsis: + return + func = getattr(module, name) + setattr(library, name, func) + self._types_of_builtin_functions[func] = tp + + # ---------- + # named structs + + _generate_cpy_struct_collecttype = _generate_nothing + def _generate_cpy_struct_decl(self, tp, name): + assert name == tp.name + self._generate_struct_or_union_decl(tp, 'struct', name) + def _generate_cpy_struct_method(self, tp, name): + self._generate_struct_or_union_method(tp, 'struct', name) + def _loading_cpy_struct(self, tp, name, module): + self._loading_struct_or_union(tp, 'struct', name, module) + def _loaded_cpy_struct(self, tp, name, module, **kwds): + self._loaded_struct_or_union(tp) + + _generate_cpy_union_collecttype = _generate_nothing + def _generate_cpy_union_decl(self, tp, name): + assert name == tp.name + self._generate_struct_or_union_decl(tp, 'union', name) + def _generate_cpy_union_method(self, tp, name): + self._generate_struct_or_union_method(tp, 'union', name) + def _loading_cpy_union(self, tp, name, module): + self._loading_struct_or_union(tp, 'union', name, module) + def _loaded_cpy_union(self, tp, name, module, **kwds): + self._loaded_struct_or_union(tp) + + def _generate_struct_or_union_decl(self, tp, prefix, name): + if tp.fldnames is None: + return # nothing to do with opaque structs + checkfuncname = '_cffi_check_%s_%s' % (prefix, name) + layoutfuncname = '_cffi_layout_%s_%s' % (prefix, name) + cname = ('%s %s' % (prefix, name)).strip() + # + prnt = self._prnt + prnt('static void %s(%s *p)' % (checkfuncname, cname)) + prnt('{') + prnt(' /* only to generate compile-time warnings or errors */') + prnt(' (void)p;') + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if (isinstance(ftype, model.PrimitiveType) + and ftype.is_integer_type()) or fbitsize >= 0: + # accept all integers, but complain on float or double + prnt(' (void)((p->%s) << 1);' % fname) + else: + # only accept exactly the type declared. + try: + prnt(' { %s = &p->%s; (void)tmp; }' % ( + ftype.get_c_name('*tmp', 'field %r'%fname, quals=fqual), + fname)) + except VerificationError as e: + prnt(' /* %s */' % str(e)) # cannot verify it, ignore + prnt('}') + prnt('static PyObject *') + prnt('%s(PyObject *self, PyObject *noarg)' % (layoutfuncname,)) + prnt('{') + prnt(' struct _cffi_aligncheck { char x; %s y; };' % cname) + prnt(' static Py_ssize_t nums[] = {') + prnt(' sizeof(%s),' % cname) + prnt(' offsetof(struct _cffi_aligncheck, y),') + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if fbitsize >= 0: + continue # xxx ignore fbitsize for now + prnt(' offsetof(%s, %s),' % (cname, fname)) + if isinstance(ftype, model.ArrayType) and ftype.length is None: + prnt(' 0, /* %s */' % ftype._get_c_name()) + else: + prnt(' sizeof(((%s *)0)->%s),' % (cname, fname)) + prnt(' -1') + prnt(' };') + prnt(' (void)self; /* unused */') + prnt(' (void)noarg; /* unused */') + prnt(' return _cffi_get_struct_layout(nums);') + prnt(' /* the next line is not executed, but compiled */') + prnt(' %s(0);' % (checkfuncname,)) + prnt('}') + prnt() + + def _generate_struct_or_union_method(self, tp, prefix, name): + if tp.fldnames is None: + return # nothing to do with opaque structs + layoutfuncname = '_cffi_layout_%s_%s' % (prefix, name) + self._prnt(' {"%s", %s, METH_NOARGS, NULL},' % (layoutfuncname, + layoutfuncname)) + + def _loading_struct_or_union(self, tp, prefix, name, module): + if tp.fldnames is None: + return # nothing to do with opaque structs + layoutfuncname = '_cffi_layout_%s_%s' % (prefix, name) + # + function = getattr(module, layoutfuncname) + layout = function() + if isinstance(tp, model.StructOrUnion) and tp.partial: + # use the function()'s sizes and offsets to guide the + # layout of the struct + totalsize = layout[0] + totalalignment = layout[1] + fieldofs = layout[2::2] + fieldsize = layout[3::2] + tp.force_flatten() + assert len(fieldofs) == len(fieldsize) == len(tp.fldnames) + tp.fixedlayout = fieldofs, fieldsize, totalsize, totalalignment + else: + cname = ('%s %s' % (prefix, name)).strip() + self._struct_pending_verification[tp] = layout, cname + + def _loaded_struct_or_union(self, tp): + if tp.fldnames is None: + return # nothing to do with opaque structs + self.ffi._get_cached_btype(tp) # force 'fixedlayout' to be considered + + if tp in self._struct_pending_verification: + # check that the layout sizes and offsets match the real ones + def check(realvalue, expectedvalue, msg): + if realvalue != expectedvalue: + raise VerificationError( + "%s (we have %d, but C compiler says %d)" + % (msg, expectedvalue, realvalue)) + ffi = self.ffi + BStruct = ffi._get_cached_btype(tp) + layout, cname = self._struct_pending_verification.pop(tp) + check(layout[0], ffi.sizeof(BStruct), "wrong total size") + check(layout[1], ffi.alignof(BStruct), "wrong total alignment") + i = 2 + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if fbitsize >= 0: + continue # xxx ignore fbitsize for now + check(layout[i], ffi.offsetof(BStruct, fname), + "wrong offset for field %r" % (fname,)) + if layout[i+1] != 0: + BField = ffi._get_cached_btype(ftype) + check(layout[i+1], ffi.sizeof(BField), + "wrong size for field %r" % (fname,)) + i += 2 + assert i == len(layout) + + # ---------- + # 'anonymous' declarations. These are produced for anonymous structs + # or unions; the 'name' is obtained by a typedef. + + _generate_cpy_anonymous_collecttype = _generate_nothing + + def _generate_cpy_anonymous_decl(self, tp, name): + if isinstance(tp, model.EnumType): + self._generate_cpy_enum_decl(tp, name, '') + else: + self._generate_struct_or_union_decl(tp, '', name) + + def _generate_cpy_anonymous_method(self, tp, name): + if not isinstance(tp, model.EnumType): + self._generate_struct_or_union_method(tp, '', name) + + def _loading_cpy_anonymous(self, tp, name, module): + if isinstance(tp, model.EnumType): + self._loading_cpy_enum(tp, name, module) + else: + self._loading_struct_or_union(tp, '', name, module) + + def _loaded_cpy_anonymous(self, tp, name, module, **kwds): + if isinstance(tp, model.EnumType): + self._loaded_cpy_enum(tp, name, module, **kwds) + else: + self._loaded_struct_or_union(tp) + + # ---------- + # constants, likely declared with '#define' + + def _generate_cpy_const(self, is_int, name, tp=None, category='const', + vartp=None, delayed=True, size_too=False, + check_value=None): + prnt = self._prnt + funcname = '_cffi_%s_%s' % (category, name) + prnt('static int %s(PyObject *lib)' % funcname) + prnt('{') + prnt(' PyObject *o;') + prnt(' int res;') + if not is_int: + prnt(' %s;' % (vartp or tp).get_c_name(' i', name)) + else: + assert category == 'const' + # + if check_value is not None: + self._check_int_constant_value(name, check_value) + # + if not is_int: + if category == 'var': + realexpr = '&' + name + else: + realexpr = name + prnt(' i = (%s);' % (realexpr,)) + prnt(' o = %s;' % (self._convert_expr_from_c(tp, 'i', + 'variable type'),)) + assert delayed + else: + prnt(' o = _cffi_from_c_int_const(%s);' % name) + prnt(' if (o == NULL)') + prnt(' return -1;') + if size_too: + prnt(' {') + prnt(' PyObject *o1 = o;') + prnt(' o = Py_BuildValue("On", o1, (Py_ssize_t)sizeof(%s));' + % (name,)) + prnt(' Py_DECREF(o1);') + prnt(' if (o == NULL)') + prnt(' return -1;') + prnt(' }') + prnt(' res = PyObject_SetAttrString(lib, "%s", o);' % name) + prnt(' Py_DECREF(o);') + prnt(' if (res < 0)') + prnt(' return -1;') + prnt(' return %s;' % self._chained_list_constants[delayed]) + self._chained_list_constants[delayed] = funcname + '(lib)' + prnt('}') + prnt() + + def _generate_cpy_constant_collecttype(self, tp, name): + is_int = isinstance(tp, model.PrimitiveType) and tp.is_integer_type() + if not is_int: + self._do_collect_type(tp) + + def _generate_cpy_constant_decl(self, tp, name): + is_int = isinstance(tp, model.PrimitiveType) and tp.is_integer_type() + self._generate_cpy_const(is_int, name, tp) + + _generate_cpy_constant_method = _generate_nothing + _loading_cpy_constant = _loaded_noop + _loaded_cpy_constant = _loaded_noop + + # ---------- + # enums + + def _check_int_constant_value(self, name, value, err_prefix=''): + prnt = self._prnt + if value <= 0: + prnt(' if ((%s) > 0 || (long)(%s) != %dL) {' % ( + name, name, value)) + else: + prnt(' if ((%s) <= 0 || (unsigned long)(%s) != %dUL) {' % ( + name, name, value)) + prnt(' char buf[64];') + prnt(' if ((%s) <= 0)' % name) + prnt(' snprintf(buf, 63, "%%ld", (long)(%s));' % name) + prnt(' else') + prnt(' snprintf(buf, 63, "%%lu", (unsigned long)(%s));' % + name) + prnt(' PyErr_Format(_cffi_VerificationError,') + prnt(' "%s%s has the real value %s, not %s",') + prnt(' "%s", "%s", buf, "%d");' % ( + err_prefix, name, value)) + prnt(' return -1;') + prnt(' }') + + def _enum_funcname(self, prefix, name): + # "$enum_$1" => "___D_enum____D_1" + name = name.replace('$', '___D_') + return '_cffi_e_%s_%s' % (prefix, name) + + def _generate_cpy_enum_decl(self, tp, name, prefix='enum'): + if tp.partial: + for enumerator in tp.enumerators: + self._generate_cpy_const(True, enumerator, delayed=False) + return + # + funcname = self._enum_funcname(prefix, name) + prnt = self._prnt + prnt('static int %s(PyObject *lib)' % funcname) + prnt('{') + for enumerator, enumvalue in zip(tp.enumerators, tp.enumvalues): + self._check_int_constant_value(enumerator, enumvalue, + "enum %s: " % name) + prnt(' return %s;' % self._chained_list_constants[True]) + self._chained_list_constants[True] = funcname + '(lib)' + prnt('}') + prnt() + + _generate_cpy_enum_collecttype = _generate_nothing + _generate_cpy_enum_method = _generate_nothing + + def _loading_cpy_enum(self, tp, name, module): + if tp.partial: + enumvalues = [getattr(module, enumerator) + for enumerator in tp.enumerators] + tp.enumvalues = tuple(enumvalues) + tp.partial_resolved = True + + def _loaded_cpy_enum(self, tp, name, module, library): + for enumerator, enumvalue in zip(tp.enumerators, tp.enumvalues): + setattr(library, enumerator, enumvalue) + + # ---------- + # macros: for now only for integers + + def _generate_cpy_macro_decl(self, tp, name): + if tp == '...': + check_value = None + else: + check_value = tp # an integer + self._generate_cpy_const(True, name, check_value=check_value) + + _generate_cpy_macro_collecttype = _generate_nothing + _generate_cpy_macro_method = _generate_nothing + _loading_cpy_macro = _loaded_noop + _loaded_cpy_macro = _loaded_noop + + # ---------- + # global variables + + def _generate_cpy_variable_collecttype(self, tp, name): + if isinstance(tp, model.ArrayType): + tp_ptr = model.PointerType(tp.item) + else: + tp_ptr = model.PointerType(tp) + self._do_collect_type(tp_ptr) + + def _generate_cpy_variable_decl(self, tp, name): + if isinstance(tp, model.ArrayType): + tp_ptr = model.PointerType(tp.item) + self._generate_cpy_const(False, name, tp, vartp=tp_ptr, + size_too = (tp.length == '...')) + else: + tp_ptr = model.PointerType(tp) + self._generate_cpy_const(False, name, tp_ptr, category='var') + + _generate_cpy_variable_method = _generate_nothing + _loading_cpy_variable = _loaded_noop + + def _loaded_cpy_variable(self, tp, name, module, library): + value = getattr(library, name) + if isinstance(tp, model.ArrayType): # int a[5] is "constant" in the + # sense that "a=..." is forbidden + if tp.length == '...': + assert isinstance(value, tuple) + (value, size) = value + BItemType = self.ffi._get_cached_btype(tp.item) + length, rest = divmod(size, self.ffi.sizeof(BItemType)) + if rest != 0: + raise VerificationError( + "bad size: %r does not seem to be an array of %s" % + (name, tp.item)) + tp = tp.resolve_length(length) + # 'value' is a which we have to replace with + # a if the N is actually known + if tp.length is not None: + BArray = self.ffi._get_cached_btype(tp) + value = self.ffi.cast(BArray, value) + setattr(library, name, value) + return + # remove ptr= from the library instance, and replace + # it by a property on the class, which reads/writes into ptr[0]. + ptr = value + delattr(library, name) + def getter(library): + return ptr[0] + def setter(library, value): + ptr[0] = value + setattr(type(library), name, property(getter, setter)) + type(library)._cffi_dir.append(name) + + # ---------- + + def _generate_setup_custom(self): + prnt = self._prnt + prnt('static int _cffi_setup_custom(PyObject *lib)') + prnt('{') + prnt(' return %s;' % self._chained_list_constants[True]) + prnt('}') + +cffimod_header = r''' +#include +#include + +/* this block of #ifs should be kept exactly identical between + c/_cffi_backend.c, cffi/vengine_cpy.py, cffi/vengine_gen.py + and cffi/_cffi_include.h */ +#if defined(_MSC_VER) +# include /* for alloca() */ +# if _MSC_VER < 1600 /* MSVC < 2010 */ + typedef __int8 int8_t; + typedef __int16 int16_t; + typedef __int32 int32_t; + typedef __int64 int64_t; + typedef unsigned __int8 uint8_t; + typedef unsigned __int16 uint16_t; + typedef unsigned __int32 uint32_t; + typedef unsigned __int64 uint64_t; + typedef __int8 int_least8_t; + typedef __int16 int_least16_t; + typedef __int32 int_least32_t; + typedef __int64 int_least64_t; + typedef unsigned __int8 uint_least8_t; + typedef unsigned __int16 uint_least16_t; + typedef unsigned __int32 uint_least32_t; + typedef unsigned __int64 uint_least64_t; + typedef __int8 int_fast8_t; + typedef __int16 int_fast16_t; + typedef __int32 int_fast32_t; + typedef __int64 int_fast64_t; + typedef unsigned __int8 uint_fast8_t; + typedef unsigned __int16 uint_fast16_t; + typedef unsigned __int32 uint_fast32_t; + typedef unsigned __int64 uint_fast64_t; + typedef __int64 intmax_t; + typedef unsigned __int64 uintmax_t; +# else +# include +# endif +# if _MSC_VER < 1800 /* MSVC < 2013 */ +# ifndef __cplusplus + typedef unsigned char _Bool; +# endif +# endif +#else +# include +# if (defined (__SVR4) && defined (__sun)) || defined(_AIX) || defined(__hpux) +# include +# endif +#endif + +#if PY_MAJOR_VERSION < 3 +# undef PyCapsule_CheckExact +# undef PyCapsule_GetPointer +# define PyCapsule_CheckExact(capsule) (PyCObject_Check(capsule)) +# define PyCapsule_GetPointer(capsule, name) \ + (PyCObject_AsVoidPtr(capsule)) +#endif + +#if PY_MAJOR_VERSION >= 3 +# define PyInt_FromLong PyLong_FromLong +#endif + +#define _cffi_from_c_double PyFloat_FromDouble +#define _cffi_from_c_float PyFloat_FromDouble +#define _cffi_from_c_long PyInt_FromLong +#define _cffi_from_c_ulong PyLong_FromUnsignedLong +#define _cffi_from_c_longlong PyLong_FromLongLong +#define _cffi_from_c_ulonglong PyLong_FromUnsignedLongLong +#define _cffi_from_c__Bool PyBool_FromLong + +#define _cffi_to_c_double PyFloat_AsDouble +#define _cffi_to_c_float PyFloat_AsDouble + +#define _cffi_from_c_int_const(x) \ + (((x) > 0) ? \ + ((unsigned long long)(x) <= (unsigned long long)LONG_MAX) ? \ + PyInt_FromLong((long)(x)) : \ + PyLong_FromUnsignedLongLong((unsigned long long)(x)) : \ + ((long long)(x) >= (long long)LONG_MIN) ? \ + PyInt_FromLong((long)(x)) : \ + PyLong_FromLongLong((long long)(x))) + +#define _cffi_from_c_int(x, type) \ + (((type)-1) > 0 ? /* unsigned */ \ + (sizeof(type) < sizeof(long) ? \ + PyInt_FromLong((long)x) : \ + sizeof(type) == sizeof(long) ? \ + PyLong_FromUnsignedLong((unsigned long)x) : \ + PyLong_FromUnsignedLongLong((unsigned long long)x)) : \ + (sizeof(type) <= sizeof(long) ? \ + PyInt_FromLong((long)x) : \ + PyLong_FromLongLong((long long)x))) + +#define _cffi_to_c_int(o, type) \ + ((type)( \ + sizeof(type) == 1 ? (((type)-1) > 0 ? (type)_cffi_to_c_u8(o) \ + : (type)_cffi_to_c_i8(o)) : \ + sizeof(type) == 2 ? (((type)-1) > 0 ? (type)_cffi_to_c_u16(o) \ + : (type)_cffi_to_c_i16(o)) : \ + sizeof(type) == 4 ? (((type)-1) > 0 ? (type)_cffi_to_c_u32(o) \ + : (type)_cffi_to_c_i32(o)) : \ + sizeof(type) == 8 ? (((type)-1) > 0 ? (type)_cffi_to_c_u64(o) \ + : (type)_cffi_to_c_i64(o)) : \ + (Py_FatalError("unsupported size for type " #type), (type)0))) + +#define _cffi_to_c_i8 \ + ((int(*)(PyObject *))_cffi_exports[1]) +#define _cffi_to_c_u8 \ + ((int(*)(PyObject *))_cffi_exports[2]) +#define _cffi_to_c_i16 \ + ((int(*)(PyObject *))_cffi_exports[3]) +#define _cffi_to_c_u16 \ + ((int(*)(PyObject *))_cffi_exports[4]) +#define _cffi_to_c_i32 \ + ((int(*)(PyObject *))_cffi_exports[5]) +#define _cffi_to_c_u32 \ + ((unsigned int(*)(PyObject *))_cffi_exports[6]) +#define _cffi_to_c_i64 \ + ((long long(*)(PyObject *))_cffi_exports[7]) +#define _cffi_to_c_u64 \ + ((unsigned long long(*)(PyObject *))_cffi_exports[8]) +#define _cffi_to_c_char \ + ((int(*)(PyObject *))_cffi_exports[9]) +#define _cffi_from_c_pointer \ + ((PyObject *(*)(char *, CTypeDescrObject *))_cffi_exports[10]) +#define _cffi_to_c_pointer \ + ((char *(*)(PyObject *, CTypeDescrObject *))_cffi_exports[11]) +#define _cffi_get_struct_layout \ + ((PyObject *(*)(Py_ssize_t[]))_cffi_exports[12]) +#define _cffi_restore_errno \ + ((void(*)(void))_cffi_exports[13]) +#define _cffi_save_errno \ + ((void(*)(void))_cffi_exports[14]) +#define _cffi_from_c_char \ + ((PyObject *(*)(char))_cffi_exports[15]) +#define _cffi_from_c_deref \ + ((PyObject *(*)(char *, CTypeDescrObject *))_cffi_exports[16]) +#define _cffi_to_c \ + ((int(*)(char *, CTypeDescrObject *, PyObject *))_cffi_exports[17]) +#define _cffi_from_c_struct \ + ((PyObject *(*)(char *, CTypeDescrObject *))_cffi_exports[18]) +#define _cffi_to_c_wchar_t \ + ((wchar_t(*)(PyObject *))_cffi_exports[19]) +#define _cffi_from_c_wchar_t \ + ((PyObject *(*)(wchar_t))_cffi_exports[20]) +#define _cffi_to_c_long_double \ + ((long double(*)(PyObject *))_cffi_exports[21]) +#define _cffi_to_c__Bool \ + ((_Bool(*)(PyObject *))_cffi_exports[22]) +#define _cffi_prepare_pointer_call_argument \ + ((Py_ssize_t(*)(CTypeDescrObject *, PyObject *, char **))_cffi_exports[23]) +#define _cffi_convert_array_from_object \ + ((int(*)(char *, CTypeDescrObject *, PyObject *))_cffi_exports[24]) +#define _CFFI_NUM_EXPORTS 25 + +typedef struct _ctypedescr CTypeDescrObject; + +static void *_cffi_exports[_CFFI_NUM_EXPORTS]; +static PyObject *_cffi_types, *_cffi_VerificationError; + +static int _cffi_setup_custom(PyObject *lib); /* forward */ + +static PyObject *_cffi_setup(PyObject *self, PyObject *args) +{ + PyObject *library; + int was_alive = (_cffi_types != NULL); + (void)self; /* unused */ + if (!PyArg_ParseTuple(args, "OOO", &_cffi_types, &_cffi_VerificationError, + &library)) + return NULL; + Py_INCREF(_cffi_types); + Py_INCREF(_cffi_VerificationError); + if (_cffi_setup_custom(library) < 0) + return NULL; + return PyBool_FromLong(was_alive); +} + +static int _cffi_init(void) +{ + PyObject *module, *c_api_object = NULL; + + module = PyImport_ImportModule("_cffi_backend"); + if (module == NULL) + goto failure; + + c_api_object = PyObject_GetAttrString(module, "_C_API"); + if (c_api_object == NULL) + goto failure; + if (!PyCapsule_CheckExact(c_api_object)) { + PyErr_SetNone(PyExc_ImportError); + goto failure; + } + memcpy(_cffi_exports, PyCapsule_GetPointer(c_api_object, "cffi"), + _CFFI_NUM_EXPORTS * sizeof(void *)); + + Py_DECREF(module); + Py_DECREF(c_api_object); + return 0; + + failure: + Py_XDECREF(module); + Py_XDECREF(c_api_object); + return -1; +} + +#define _cffi_type(num) ((CTypeDescrObject *)PyList_GET_ITEM(_cffi_types, num)) + +/**********/ +''' diff --git a/website/web/Lib/site-packages/cffi/vengine_gen.py b/website/web/Lib/site-packages/cffi/vengine_gen.py new file mode 100644 index 000000000..a64ff644f --- /dev/null +++ b/website/web/Lib/site-packages/cffi/vengine_gen.py @@ -0,0 +1,675 @@ +# +# DEPRECATED: implementation for ffi.verify() +# +import sys, os +import types + +from . import model +from .error import VerificationError + + +class VGenericEngine(object): + _class_key = 'g' + _gen_python_module = False + + def __init__(self, verifier): + self.verifier = verifier + self.ffi = verifier.ffi + self.export_symbols = [] + self._struct_pending_verification = {} + + def patch_extension_kwds(self, kwds): + # add 'export_symbols' to the dictionary. Note that we add the + # list before filling it. When we fill it, it will thus also show + # up in kwds['export_symbols']. + kwds.setdefault('export_symbols', self.export_symbols) + + def find_module(self, module_name, path, so_suffixes): + for so_suffix in so_suffixes: + basename = module_name + so_suffix + if path is None: + path = sys.path + for dirname in path: + filename = os.path.join(dirname, basename) + if os.path.isfile(filename): + return filename + + def collect_types(self): + pass # not needed in the generic engine + + def _prnt(self, what=''): + self._f.write(what + '\n') + + def write_source_to_f(self): + prnt = self._prnt + # first paste some standard set of lines that are mostly '#include' + prnt(cffimod_header) + # then paste the C source given by the user, verbatim. + prnt(self.verifier.preamble) + # + # call generate_gen_xxx_decl(), for every xxx found from + # ffi._parser._declarations. This generates all the functions. + self._generate('decl') + # + # on Windows, distutils insists on putting init_cffi_xyz in + # 'export_symbols', so instead of fighting it, just give up and + # give it one + if sys.platform == 'win32': + if sys.version_info >= (3,): + prefix = 'PyInit_' + else: + prefix = 'init' + modname = self.verifier.get_module_name() + prnt("void %s%s(void) { }\n" % (prefix, modname)) + + def load_library(self, flags=0): + # import it with the CFFI backend + backend = self.ffi._backend + # needs to make a path that contains '/', on Posix + filename = os.path.join(os.curdir, self.verifier.modulefilename) + module = backend.load_library(filename, flags) + # + # call loading_gen_struct() to get the struct layout inferred by + # the C compiler + self._load(module, 'loading') + + # build the FFILibrary class and instance, this is a module subclass + # because modules are expected to have usually-constant-attributes and + # in PyPy this means the JIT is able to treat attributes as constant, + # which we want. + class FFILibrary(types.ModuleType): + _cffi_generic_module = module + _cffi_ffi = self.ffi + _cffi_dir = [] + def __dir__(self): + return FFILibrary._cffi_dir + library = FFILibrary("") + # + # finally, call the loaded_gen_xxx() functions. This will set + # up the 'library' object. + self._load(module, 'loaded', library=library) + return library + + def _get_declarations(self): + lst = [(key, tp) for (key, (tp, qual)) in + self.ffi._parser._declarations.items()] + lst.sort() + return lst + + def _generate(self, step_name): + for name, tp in self._get_declarations(): + kind, realname = name.split(' ', 1) + try: + method = getattr(self, '_generate_gen_%s_%s' % (kind, + step_name)) + except AttributeError: + raise VerificationError( + "not implemented in verify(): %r" % name) + try: + method(tp, realname) + except Exception as e: + model.attach_exception_info(e, name) + raise + + def _load(self, module, step_name, **kwds): + for name, tp in self._get_declarations(): + kind, realname = name.split(' ', 1) + method = getattr(self, '_%s_gen_%s' % (step_name, kind)) + try: + method(tp, realname, module, **kwds) + except Exception as e: + model.attach_exception_info(e, name) + raise + + def _generate_nothing(self, tp, name): + pass + + def _loaded_noop(self, tp, name, module, **kwds): + pass + + # ---------- + # typedefs: generates no code so far + + _generate_gen_typedef_decl = _generate_nothing + _loading_gen_typedef = _loaded_noop + _loaded_gen_typedef = _loaded_noop + + # ---------- + # function declarations + + def _generate_gen_function_decl(self, tp, name): + assert isinstance(tp, model.FunctionPtrType) + if tp.ellipsis: + # cannot support vararg functions better than this: check for its + # exact type (including the fixed arguments), and build it as a + # constant function pointer (no _cffi_f_%s wrapper) + self._generate_gen_const(False, name, tp) + return + prnt = self._prnt + numargs = len(tp.args) + argnames = [] + for i, type in enumerate(tp.args): + indirection = '' + if isinstance(type, model.StructOrUnion): + indirection = '*' + argnames.append('%sx%d' % (indirection, i)) + context = 'argument of %s' % name + arglist = [type.get_c_name(' %s' % arg, context) + for type, arg in zip(tp.args, argnames)] + tpresult = tp.result + if isinstance(tpresult, model.StructOrUnion): + arglist.insert(0, tpresult.get_c_name(' *r', context)) + tpresult = model.void_type + arglist = ', '.join(arglist) or 'void' + wrappername = '_cffi_f_%s' % name + self.export_symbols.append(wrappername) + if tp.abi: + abi = tp.abi + ' ' + else: + abi = '' + funcdecl = ' %s%s(%s)' % (abi, wrappername, arglist) + context = 'result of %s' % name + prnt(tpresult.get_c_name(funcdecl, context)) + prnt('{') + # + if isinstance(tp.result, model.StructOrUnion): + result_code = '*r = ' + elif not isinstance(tp.result, model.VoidType): + result_code = 'return ' + else: + result_code = '' + prnt(' %s%s(%s);' % (result_code, name, ', '.join(argnames))) + prnt('}') + prnt() + + _loading_gen_function = _loaded_noop + + def _loaded_gen_function(self, tp, name, module, library): + assert isinstance(tp, model.FunctionPtrType) + if tp.ellipsis: + newfunction = self._load_constant(False, tp, name, module) + else: + indirections = [] + base_tp = tp + if (any(isinstance(typ, model.StructOrUnion) for typ in tp.args) + or isinstance(tp.result, model.StructOrUnion)): + indirect_args = [] + for i, typ in enumerate(tp.args): + if isinstance(typ, model.StructOrUnion): + typ = model.PointerType(typ) + indirections.append((i, typ)) + indirect_args.append(typ) + indirect_result = tp.result + if isinstance(indirect_result, model.StructOrUnion): + if indirect_result.fldtypes is None: + raise TypeError("'%s' is used as result type, " + "but is opaque" % ( + indirect_result._get_c_name(),)) + indirect_result = model.PointerType(indirect_result) + indirect_args.insert(0, indirect_result) + indirections.insert(0, ("result", indirect_result)) + indirect_result = model.void_type + tp = model.FunctionPtrType(tuple(indirect_args), + indirect_result, tp.ellipsis) + BFunc = self.ffi._get_cached_btype(tp) + wrappername = '_cffi_f_%s' % name + newfunction = module.load_function(BFunc, wrappername) + for i, typ in indirections: + newfunction = self._make_struct_wrapper(newfunction, i, typ, + base_tp) + setattr(library, name, newfunction) + type(library)._cffi_dir.append(name) + + def _make_struct_wrapper(self, oldfunc, i, tp, base_tp): + backend = self.ffi._backend + BType = self.ffi._get_cached_btype(tp) + if i == "result": + ffi = self.ffi + def newfunc(*args): + res = ffi.new(BType) + oldfunc(res, *args) + return res[0] + else: + def newfunc(*args): + args = args[:i] + (backend.newp(BType, args[i]),) + args[i+1:] + return oldfunc(*args) + newfunc._cffi_base_type = base_tp + return newfunc + + # ---------- + # named structs + + def _generate_gen_struct_decl(self, tp, name): + assert name == tp.name + self._generate_struct_or_union_decl(tp, 'struct', name) + + def _loading_gen_struct(self, tp, name, module): + self._loading_struct_or_union(tp, 'struct', name, module) + + def _loaded_gen_struct(self, tp, name, module, **kwds): + self._loaded_struct_or_union(tp) + + def _generate_gen_union_decl(self, tp, name): + assert name == tp.name + self._generate_struct_or_union_decl(tp, 'union', name) + + def _loading_gen_union(self, tp, name, module): + self._loading_struct_or_union(tp, 'union', name, module) + + def _loaded_gen_union(self, tp, name, module, **kwds): + self._loaded_struct_or_union(tp) + + def _generate_struct_or_union_decl(self, tp, prefix, name): + if tp.fldnames is None: + return # nothing to do with opaque structs + checkfuncname = '_cffi_check_%s_%s' % (prefix, name) + layoutfuncname = '_cffi_layout_%s_%s' % (prefix, name) + cname = ('%s %s' % (prefix, name)).strip() + # + prnt = self._prnt + prnt('static void %s(%s *p)' % (checkfuncname, cname)) + prnt('{') + prnt(' /* only to generate compile-time warnings or errors */') + prnt(' (void)p;') + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if (isinstance(ftype, model.PrimitiveType) + and ftype.is_integer_type()) or fbitsize >= 0: + # accept all integers, but complain on float or double + prnt(' (void)((p->%s) << 1);' % fname) + else: + # only accept exactly the type declared. + try: + prnt(' { %s = &p->%s; (void)tmp; }' % ( + ftype.get_c_name('*tmp', 'field %r'%fname, quals=fqual), + fname)) + except VerificationError as e: + prnt(' /* %s */' % str(e)) # cannot verify it, ignore + prnt('}') + self.export_symbols.append(layoutfuncname) + prnt('intptr_t %s(intptr_t i)' % (layoutfuncname,)) + prnt('{') + prnt(' struct _cffi_aligncheck { char x; %s y; };' % cname) + prnt(' static intptr_t nums[] = {') + prnt(' sizeof(%s),' % cname) + prnt(' offsetof(struct _cffi_aligncheck, y),') + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if fbitsize >= 0: + continue # xxx ignore fbitsize for now + prnt(' offsetof(%s, %s),' % (cname, fname)) + if isinstance(ftype, model.ArrayType) and ftype.length is None: + prnt(' 0, /* %s */' % ftype._get_c_name()) + else: + prnt(' sizeof(((%s *)0)->%s),' % (cname, fname)) + prnt(' -1') + prnt(' };') + prnt(' return nums[i];') + prnt(' /* the next line is not executed, but compiled */') + prnt(' %s(0);' % (checkfuncname,)) + prnt('}') + prnt() + + def _loading_struct_or_union(self, tp, prefix, name, module): + if tp.fldnames is None: + return # nothing to do with opaque structs + layoutfuncname = '_cffi_layout_%s_%s' % (prefix, name) + # + BFunc = self.ffi._typeof_locked("intptr_t(*)(intptr_t)")[0] + function = module.load_function(BFunc, layoutfuncname) + layout = [] + num = 0 + while True: + x = function(num) + if x < 0: break + layout.append(x) + num += 1 + if isinstance(tp, model.StructOrUnion) and tp.partial: + # use the function()'s sizes and offsets to guide the + # layout of the struct + totalsize = layout[0] + totalalignment = layout[1] + fieldofs = layout[2::2] + fieldsize = layout[3::2] + tp.force_flatten() + assert len(fieldofs) == len(fieldsize) == len(tp.fldnames) + tp.fixedlayout = fieldofs, fieldsize, totalsize, totalalignment + else: + cname = ('%s %s' % (prefix, name)).strip() + self._struct_pending_verification[tp] = layout, cname + + def _loaded_struct_or_union(self, tp): + if tp.fldnames is None: + return # nothing to do with opaque structs + self.ffi._get_cached_btype(tp) # force 'fixedlayout' to be considered + + if tp in self._struct_pending_verification: + # check that the layout sizes and offsets match the real ones + def check(realvalue, expectedvalue, msg): + if realvalue != expectedvalue: + raise VerificationError( + "%s (we have %d, but C compiler says %d)" + % (msg, expectedvalue, realvalue)) + ffi = self.ffi + BStruct = ffi._get_cached_btype(tp) + layout, cname = self._struct_pending_verification.pop(tp) + check(layout[0], ffi.sizeof(BStruct), "wrong total size") + check(layout[1], ffi.alignof(BStruct), "wrong total alignment") + i = 2 + for fname, ftype, fbitsize, fqual in tp.enumfields(): + if fbitsize >= 0: + continue # xxx ignore fbitsize for now + check(layout[i], ffi.offsetof(BStruct, fname), + "wrong offset for field %r" % (fname,)) + if layout[i+1] != 0: + BField = ffi._get_cached_btype(ftype) + check(layout[i+1], ffi.sizeof(BField), + "wrong size for field %r" % (fname,)) + i += 2 + assert i == len(layout) + + # ---------- + # 'anonymous' declarations. These are produced for anonymous structs + # or unions; the 'name' is obtained by a typedef. + + def _generate_gen_anonymous_decl(self, tp, name): + if isinstance(tp, model.EnumType): + self._generate_gen_enum_decl(tp, name, '') + else: + self._generate_struct_or_union_decl(tp, '', name) + + def _loading_gen_anonymous(self, tp, name, module): + if isinstance(tp, model.EnumType): + self._loading_gen_enum(tp, name, module, '') + else: + self._loading_struct_or_union(tp, '', name, module) + + def _loaded_gen_anonymous(self, tp, name, module, **kwds): + if isinstance(tp, model.EnumType): + self._loaded_gen_enum(tp, name, module, **kwds) + else: + self._loaded_struct_or_union(tp) + + # ---------- + # constants, likely declared with '#define' + + def _generate_gen_const(self, is_int, name, tp=None, category='const', + check_value=None): + prnt = self._prnt + funcname = '_cffi_%s_%s' % (category, name) + self.export_symbols.append(funcname) + if check_value is not None: + assert is_int + assert category == 'const' + prnt('int %s(char *out_error)' % funcname) + prnt('{') + self._check_int_constant_value(name, check_value) + prnt(' return 0;') + prnt('}') + elif is_int: + assert category == 'const' + prnt('int %s(long long *out_value)' % funcname) + prnt('{') + prnt(' *out_value = (long long)(%s);' % (name,)) + prnt(' return (%s) <= 0;' % (name,)) + prnt('}') + else: + assert tp is not None + assert check_value is None + if category == 'var': + ampersand = '&' + else: + ampersand = '' + extra = '' + if category == 'const' and isinstance(tp, model.StructOrUnion): + extra = 'const *' + ampersand = '&' + prnt(tp.get_c_name(' %s%s(void)' % (extra, funcname), name)) + prnt('{') + prnt(' return (%s%s);' % (ampersand, name)) + prnt('}') + prnt() + + def _generate_gen_constant_decl(self, tp, name): + is_int = isinstance(tp, model.PrimitiveType) and tp.is_integer_type() + self._generate_gen_const(is_int, name, tp) + + _loading_gen_constant = _loaded_noop + + def _load_constant(self, is_int, tp, name, module, check_value=None): + funcname = '_cffi_const_%s' % name + if check_value is not None: + assert is_int + self._load_known_int_constant(module, funcname) + value = check_value + elif is_int: + BType = self.ffi._typeof_locked("long long*")[0] + BFunc = self.ffi._typeof_locked("int(*)(long long*)")[0] + function = module.load_function(BFunc, funcname) + p = self.ffi.new(BType) + negative = function(p) + value = int(p[0]) + if value < 0 and not negative: + BLongLong = self.ffi._typeof_locked("long long")[0] + value += (1 << (8*self.ffi.sizeof(BLongLong))) + else: + assert check_value is None + fntypeextra = '(*)(void)' + if isinstance(tp, model.StructOrUnion): + fntypeextra = '*' + fntypeextra + BFunc = self.ffi._typeof_locked(tp.get_c_name(fntypeextra, name))[0] + function = module.load_function(BFunc, funcname) + value = function() + if isinstance(tp, model.StructOrUnion): + value = value[0] + return value + + def _loaded_gen_constant(self, tp, name, module, library): + is_int = isinstance(tp, model.PrimitiveType) and tp.is_integer_type() + value = self._load_constant(is_int, tp, name, module) + setattr(library, name, value) + type(library)._cffi_dir.append(name) + + # ---------- + # enums + + def _check_int_constant_value(self, name, value): + prnt = self._prnt + if value <= 0: + prnt(' if ((%s) > 0 || (long)(%s) != %dL) {' % ( + name, name, value)) + else: + prnt(' if ((%s) <= 0 || (unsigned long)(%s) != %dUL) {' % ( + name, name, value)) + prnt(' char buf[64];') + prnt(' if ((%s) <= 0)' % name) + prnt(' sprintf(buf, "%%ld", (long)(%s));' % name) + prnt(' else') + prnt(' sprintf(buf, "%%lu", (unsigned long)(%s));' % + name) + prnt(' sprintf(out_error, "%s has the real value %s, not %s",') + prnt(' "%s", buf, "%d");' % (name[:100], value)) + prnt(' return -1;') + prnt(' }') + + def _load_known_int_constant(self, module, funcname): + BType = self.ffi._typeof_locked("char[]")[0] + BFunc = self.ffi._typeof_locked("int(*)(char*)")[0] + function = module.load_function(BFunc, funcname) + p = self.ffi.new(BType, 256) + if function(p) < 0: + error = self.ffi.string(p) + if sys.version_info >= (3,): + error = str(error, 'utf-8') + raise VerificationError(error) + + def _enum_funcname(self, prefix, name): + # "$enum_$1" => "___D_enum____D_1" + name = name.replace('$', '___D_') + return '_cffi_e_%s_%s' % (prefix, name) + + def _generate_gen_enum_decl(self, tp, name, prefix='enum'): + if tp.partial: + for enumerator in tp.enumerators: + self._generate_gen_const(True, enumerator) + return + # + funcname = self._enum_funcname(prefix, name) + self.export_symbols.append(funcname) + prnt = self._prnt + prnt('int %s(char *out_error)' % funcname) + prnt('{') + for enumerator, enumvalue in zip(tp.enumerators, tp.enumvalues): + self._check_int_constant_value(enumerator, enumvalue) + prnt(' return 0;') + prnt('}') + prnt() + + def _loading_gen_enum(self, tp, name, module, prefix='enum'): + if tp.partial: + enumvalues = [self._load_constant(True, tp, enumerator, module) + for enumerator in tp.enumerators] + tp.enumvalues = tuple(enumvalues) + tp.partial_resolved = True + else: + funcname = self._enum_funcname(prefix, name) + self._load_known_int_constant(module, funcname) + + def _loaded_gen_enum(self, tp, name, module, library): + for enumerator, enumvalue in zip(tp.enumerators, tp.enumvalues): + setattr(library, enumerator, enumvalue) + type(library)._cffi_dir.append(enumerator) + + # ---------- + # macros: for now only for integers + + def _generate_gen_macro_decl(self, tp, name): + if tp == '...': + check_value = None + else: + check_value = tp # an integer + self._generate_gen_const(True, name, check_value=check_value) + + _loading_gen_macro = _loaded_noop + + def _loaded_gen_macro(self, tp, name, module, library): + if tp == '...': + check_value = None + else: + check_value = tp # an integer + value = self._load_constant(True, tp, name, module, + check_value=check_value) + setattr(library, name, value) + type(library)._cffi_dir.append(name) + + # ---------- + # global variables + + def _generate_gen_variable_decl(self, tp, name): + if isinstance(tp, model.ArrayType): + if tp.length == '...': + prnt = self._prnt + funcname = '_cffi_sizeof_%s' % (name,) + self.export_symbols.append(funcname) + prnt("size_t %s(void)" % funcname) + prnt("{") + prnt(" return sizeof(%s);" % (name,)) + prnt("}") + tp_ptr = model.PointerType(tp.item) + self._generate_gen_const(False, name, tp_ptr) + else: + tp_ptr = model.PointerType(tp) + self._generate_gen_const(False, name, tp_ptr, category='var') + + _loading_gen_variable = _loaded_noop + + def _loaded_gen_variable(self, tp, name, module, library): + if isinstance(tp, model.ArrayType): # int a[5] is "constant" in the + # sense that "a=..." is forbidden + if tp.length == '...': + funcname = '_cffi_sizeof_%s' % (name,) + BFunc = self.ffi._typeof_locked('size_t(*)(void)')[0] + function = module.load_function(BFunc, funcname) + size = function() + BItemType = self.ffi._get_cached_btype(tp.item) + length, rest = divmod(size, self.ffi.sizeof(BItemType)) + if rest != 0: + raise VerificationError( + "bad size: %r does not seem to be an array of %s" % + (name, tp.item)) + tp = tp.resolve_length(length) + tp_ptr = model.PointerType(tp.item) + value = self._load_constant(False, tp_ptr, name, module) + # 'value' is a which we have to replace with + # a if the N is actually known + if tp.length is not None: + BArray = self.ffi._get_cached_btype(tp) + value = self.ffi.cast(BArray, value) + setattr(library, name, value) + type(library)._cffi_dir.append(name) + return + # remove ptr= from the library instance, and replace + # it by a property on the class, which reads/writes into ptr[0]. + funcname = '_cffi_var_%s' % name + BFunc = self.ffi._typeof_locked(tp.get_c_name('*(*)(void)', name))[0] + function = module.load_function(BFunc, funcname) + ptr = function() + def getter(library): + return ptr[0] + def setter(library, value): + ptr[0] = value + setattr(type(library), name, property(getter, setter)) + type(library)._cffi_dir.append(name) + +cffimod_header = r''' +#include +#include +#include +#include +#include /* XXX for ssize_t on some platforms */ + +/* this block of #ifs should be kept exactly identical between + c/_cffi_backend.c, cffi/vengine_cpy.py, cffi/vengine_gen.py + and cffi/_cffi_include.h */ +#if defined(_MSC_VER) +# include /* for alloca() */ +# if _MSC_VER < 1600 /* MSVC < 2010 */ + typedef __int8 int8_t; + typedef __int16 int16_t; + typedef __int32 int32_t; + typedef __int64 int64_t; + typedef unsigned __int8 uint8_t; + typedef unsigned __int16 uint16_t; + typedef unsigned __int32 uint32_t; + typedef unsigned __int64 uint64_t; + typedef __int8 int_least8_t; + typedef __int16 int_least16_t; + typedef __int32 int_least32_t; + typedef __int64 int_least64_t; + typedef unsigned __int8 uint_least8_t; + typedef unsigned __int16 uint_least16_t; + typedef unsigned __int32 uint_least32_t; + typedef unsigned __int64 uint_least64_t; + typedef __int8 int_fast8_t; + typedef __int16 int_fast16_t; + typedef __int32 int_fast32_t; + typedef __int64 int_fast64_t; + typedef unsigned __int8 uint_fast8_t; + typedef unsigned __int16 uint_fast16_t; + typedef unsigned __int32 uint_fast32_t; + typedef unsigned __int64 uint_fast64_t; + typedef __int64 intmax_t; + typedef unsigned __int64 uintmax_t; +# else +# include +# endif +# if _MSC_VER < 1800 /* MSVC < 2013 */ +# ifndef __cplusplus + typedef unsigned char _Bool; +# endif +# endif +#else +# include +# if (defined (__SVR4) && defined (__sun)) || defined(_AIX) || defined(__hpux) +# include +# endif +#endif +''' diff --git a/website/web/Lib/site-packages/cffi/verifier.py b/website/web/Lib/site-packages/cffi/verifier.py new file mode 100644 index 000000000..59b78c216 --- /dev/null +++ b/website/web/Lib/site-packages/cffi/verifier.py @@ -0,0 +1,306 @@ +# +# DEPRECATED: implementation for ffi.verify() +# +import sys, os, binascii, shutil, io +from . import __version_verifier_modules__ +from . import ffiplatform +from .error import VerificationError + +if sys.version_info >= (3, 3): + import importlib.machinery + def _extension_suffixes(): + return importlib.machinery.EXTENSION_SUFFIXES[:] +else: + import imp + def _extension_suffixes(): + return [suffix for suffix, _, type in imp.get_suffixes() + if type == imp.C_EXTENSION] + + +if sys.version_info >= (3,): + NativeIO = io.StringIO +else: + class NativeIO(io.BytesIO): + def write(self, s): + if isinstance(s, unicode): + s = s.encode('ascii') + super(NativeIO, self).write(s) + + +class Verifier(object): + + def __init__(self, ffi, preamble, tmpdir=None, modulename=None, + ext_package=None, tag='', force_generic_engine=False, + source_extension='.c', flags=None, relative_to=None, **kwds): + if ffi._parser._uses_new_feature: + raise VerificationError( + "feature not supported with ffi.verify(), but only " + "with ffi.set_source(): %s" % (ffi._parser._uses_new_feature,)) + self.ffi = ffi + self.preamble = preamble + if not modulename: + flattened_kwds = ffiplatform.flatten(kwds) + vengine_class = _locate_engine_class(ffi, force_generic_engine) + self._vengine = vengine_class(self) + self._vengine.patch_extension_kwds(kwds) + self.flags = flags + self.kwds = self.make_relative_to(kwds, relative_to) + # + if modulename: + if tag: + raise TypeError("can't specify both 'modulename' and 'tag'") + else: + key = '\x00'.join([sys.version[:3], __version_verifier_modules__, + preamble, flattened_kwds] + + ffi._cdefsources) + if sys.version_info >= (3,): + key = key.encode('utf-8') + k1 = hex(binascii.crc32(key[0::2]) & 0xffffffff) + k1 = k1.lstrip('0x').rstrip('L') + k2 = hex(binascii.crc32(key[1::2]) & 0xffffffff) + k2 = k2.lstrip('0').rstrip('L') + modulename = '_cffi_%s_%s%s%s' % (tag, self._vengine._class_key, + k1, k2) + suffix = _get_so_suffixes()[0] + self.tmpdir = tmpdir or _caller_dir_pycache() + self.sourcefilename = os.path.join(self.tmpdir, modulename + source_extension) + self.modulefilename = os.path.join(self.tmpdir, modulename + suffix) + self.ext_package = ext_package + self._has_source = False + self._has_module = False + + def write_source(self, file=None): + """Write the C source code. It is produced in 'self.sourcefilename', + which can be tweaked beforehand.""" + with self.ffi._lock: + if self._has_source and file is None: + raise VerificationError( + "source code already written") + self._write_source(file) + + def compile_module(self): + """Write the C source code (if not done already) and compile it. + This produces a dynamic link library in 'self.modulefilename'.""" + with self.ffi._lock: + if self._has_module: + raise VerificationError("module already compiled") + if not self._has_source: + self._write_source() + self._compile_module() + + def load_library(self): + """Get a C module from this Verifier instance. + Returns an instance of a FFILibrary class that behaves like the + objects returned by ffi.dlopen(), but that delegates all + operations to the C module. If necessary, the C code is written + and compiled first. + """ + with self.ffi._lock: + if not self._has_module: + self._locate_module() + if not self._has_module: + if not self._has_source: + self._write_source() + self._compile_module() + return self._load_library() + + def get_module_name(self): + basename = os.path.basename(self.modulefilename) + # kill both the .so extension and the other .'s, as introduced + # by Python 3: 'basename.cpython-33m.so' + basename = basename.split('.', 1)[0] + # and the _d added in Python 2 debug builds --- but try to be + # conservative and not kill a legitimate _d + if basename.endswith('_d') and hasattr(sys, 'gettotalrefcount'): + basename = basename[:-2] + return basename + + def get_extension(self): + ffiplatform._hack_at_distutils() # backward compatibility hack + if not self._has_source: + with self.ffi._lock: + if not self._has_source: + self._write_source() + sourcename = ffiplatform.maybe_relative_path(self.sourcefilename) + modname = self.get_module_name() + return ffiplatform.get_extension(sourcename, modname, **self.kwds) + + def generates_python_module(self): + return self._vengine._gen_python_module + + def make_relative_to(self, kwds, relative_to): + if relative_to and os.path.dirname(relative_to): + dirname = os.path.dirname(relative_to) + kwds = kwds.copy() + for key in ffiplatform.LIST_OF_FILE_NAMES: + if key in kwds: + lst = kwds[key] + if not isinstance(lst, (list, tuple)): + raise TypeError("keyword '%s' should be a list or tuple" + % (key,)) + lst = [os.path.join(dirname, fn) for fn in lst] + kwds[key] = lst + return kwds + + # ---------- + + def _locate_module(self): + if not os.path.isfile(self.modulefilename): + if self.ext_package: + try: + pkg = __import__(self.ext_package, None, None, ['__doc__']) + except ImportError: + return # cannot import the package itself, give up + # (e.g. it might be called differently before installation) + path = pkg.__path__ + else: + path = None + filename = self._vengine.find_module(self.get_module_name(), path, + _get_so_suffixes()) + if filename is None: + return + self.modulefilename = filename + self._vengine.collect_types() + self._has_module = True + + def _write_source_to(self, file): + self._vengine._f = file + try: + self._vengine.write_source_to_f() + finally: + del self._vengine._f + + def _write_source(self, file=None): + if file is not None: + self._write_source_to(file) + else: + # Write our source file to an in memory file. + f = NativeIO() + self._write_source_to(f) + source_data = f.getvalue() + + # Determine if this matches the current file + if os.path.exists(self.sourcefilename): + with open(self.sourcefilename, "r") as fp: + needs_written = not (fp.read() == source_data) + else: + needs_written = True + + # Actually write the file out if it doesn't match + if needs_written: + _ensure_dir(self.sourcefilename) + with open(self.sourcefilename, "w") as fp: + fp.write(source_data) + + # Set this flag + self._has_source = True + + def _compile_module(self): + # compile this C source + tmpdir = os.path.dirname(self.sourcefilename) + outputfilename = ffiplatform.compile(tmpdir, self.get_extension()) + try: + same = ffiplatform.samefile(outputfilename, self.modulefilename) + except OSError: + same = False + if not same: + _ensure_dir(self.modulefilename) + shutil.move(outputfilename, self.modulefilename) + self._has_module = True + + def _load_library(self): + assert self._has_module + if self.flags is not None: + return self._vengine.load_library(self.flags) + else: + return self._vengine.load_library() + +# ____________________________________________________________ + +_FORCE_GENERIC_ENGINE = False # for tests + +def _locate_engine_class(ffi, force_generic_engine): + if _FORCE_GENERIC_ENGINE: + force_generic_engine = True + if not force_generic_engine: + if '__pypy__' in sys.builtin_module_names: + force_generic_engine = True + else: + try: + import _cffi_backend + except ImportError: + _cffi_backend = '?' + if ffi._backend is not _cffi_backend: + force_generic_engine = True + if force_generic_engine: + from . import vengine_gen + return vengine_gen.VGenericEngine + else: + from . import vengine_cpy + return vengine_cpy.VCPythonEngine + +# ____________________________________________________________ + +_TMPDIR = None + +def _caller_dir_pycache(): + if _TMPDIR: + return _TMPDIR + result = os.environ.get('CFFI_TMPDIR') + if result: + return result + filename = sys._getframe(2).f_code.co_filename + return os.path.abspath(os.path.join(os.path.dirname(filename), + '__pycache__')) + +def set_tmpdir(dirname): + """Set the temporary directory to use instead of __pycache__.""" + global _TMPDIR + _TMPDIR = dirname + +def cleanup_tmpdir(tmpdir=None, keep_so=False): + """Clean up the temporary directory by removing all files in it + called `_cffi_*.{c,so}` as well as the `build` subdirectory.""" + tmpdir = tmpdir or _caller_dir_pycache() + try: + filelist = os.listdir(tmpdir) + except OSError: + return + if keep_so: + suffix = '.c' # only remove .c files + else: + suffix = _get_so_suffixes()[0].lower() + for fn in filelist: + if fn.lower().startswith('_cffi_') and ( + fn.lower().endswith(suffix) or fn.lower().endswith('.c')): + try: + os.unlink(os.path.join(tmpdir, fn)) + except OSError: + pass + clean_dir = [os.path.join(tmpdir, 'build')] + for dir in clean_dir: + try: + for fn in os.listdir(dir): + fn = os.path.join(dir, fn) + if os.path.isdir(fn): + clean_dir.append(fn) + else: + os.unlink(fn) + except OSError: + pass + +def _get_so_suffixes(): + suffixes = _extension_suffixes() + if not suffixes: + # bah, no C_EXTENSION available. Occurs on pypy without cpyext + if sys.platform == 'win32': + suffixes = [".pyd"] + else: + suffixes = [".so"] + + return suffixes + +def _ensure_dir(filename): + dirname = os.path.dirname(filename) + if dirname and not os.path.isdir(dirname): + os.makedirs(dirname) diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/DESCRIPTION.rst b/website/web/Lib/site-packages/click-6.7.dist-info/DESCRIPTION.rst new file mode 100644 index 000000000..e1187231a --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/DESCRIPTION.rst @@ -0,0 +1,3 @@ +UNKNOWN + + diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/INSTALLER b/website/web/Lib/site-packages/click-6.7.dist-info/INSTALLER new file mode 100644 index 000000000..a1b589e38 --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/INSTALLER @@ -0,0 +1 @@ +pip diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/METADATA b/website/web/Lib/site-packages/click-6.7.dist-info/METADATA new file mode 100644 index 000000000..1f108853b --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/METADATA @@ -0,0 +1,16 @@ +Metadata-Version: 2.0 +Name: click +Version: 6.7 +Summary: A simple wrapper around optparse for powerful command line utilities. +Home-page: http://github.com/mitsuhiko/click +Author: Armin Ronacher +Author-email: armin.ronacher@active-4.com +License: UNKNOWN +Platform: UNKNOWN +Classifier: License :: OSI Approved :: BSD License +Classifier: Programming Language :: Python +Classifier: Programming Language :: Python :: 3 + +UNKNOWN + + diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/RECORD b/website/web/Lib/site-packages/click-6.7.dist-info/RECORD new file mode 100644 index 000000000..6eaa8b20b --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/RECORD @@ -0,0 +1,41 @@ +click/__init__.py,sha256=k8R00cFKWI8dhDVKQeLBlAdNh1CxerMEDRiGnr32gdw,2858 +click/_bashcomplete.py,sha256=82rMiibtEurdwBq60NHXVCBuGXJHDpblFO9o2YxJDF0,2423 +click/_compat.py,sha256=j59MpzxYGE-fTGj0A5sg8UI8GhHod1XMojiCA0jvbL0,21011 +click/_termui_impl.py,sha256=Ol1JJhvBRw3l8j1WIU0tOWjQtxxmwGE44lFDbzDqzoA,16395 +click/_textwrap.py,sha256=gwS4m7bdQiJnzaDG8osFcRb-5vn4t4l2qSCy-5csCEc,1198 +click/_unicodefun.py,sha256=A3UOzJw6lEZyol2SBg3fNXgweTutaOzkJ61OB7vik3Y,4204 +click/_winconsole.py,sha256=MzG46DEYPoRyx4SO7EIhFuFZHESgooAfJLIukbB6p5c,7790 +click/core.py,sha256=M0nJ6Kkye7XZXYG7HCbkJWSfy14WHV6bQmGLACrOhKw,70254 +click/decorators.py,sha256=y7CX2needh8iRWafj-QS_hGQFsN24eyXAhx5Y2ATwas,10941 +click/exceptions.py,sha256=rOa0pP3PbSy0_AAPOW9irBEM8AJ3BySN-4z2VUwFVo4,6788 +click/formatting.py,sha256=eh-cypTUAhpI3HD-K4ZpR3vCiURIO62xXvKkR3tNUTM,8889 +click/globals.py,sha256=PAgnKvGxq4YuEIldw3lgYOGBLYwsyxnm1IByBX3BFXo,1515 +click/parser.py,sha256=i01xgYuIA6AwQWEXjshwHSwnTR3gUep4FxJIfyW4ta4,15510 +click/termui.py,sha256=Bp99MSWQtyoWe1_7HggDmA77n--3KLxu7NsZMFMaCUo,21008 +click/testing.py,sha256=kJ9mjtJgwNAlkgKcFf9-ISxufmaPDbbuOHVC9WIvKdY,11002 +click/types.py,sha256=ZGb2lmFs5Vwd9loTRIMbGcqhPVOql8mGoBhWBRT6V4E,18864 +click/utils.py,sha256=1jalPlkUU28JReTEQeeSFtbJd-SirYWBNfjtELBKzT4,14916 +click-6.7.dist-info/DESCRIPTION.rst,sha256=OCTuuN6LcWulhHS3d5rfjdsQtW22n7HENFRh6jC6ego,10 +click-6.7.dist-info/METADATA,sha256=l6lAyogIUXiHKUK_rWguef-EMcvO5C6bXzFCNCcblbQ,424 +click-6.7.dist-info/RECORD,, +click-6.7.dist-info/WHEEL,sha256=5wvfB7GvgZAbKBSE9uX9Zbi6LCL-_KgezgHblXhCRnM,113 +click-6.7.dist-info/metadata.json,sha256=qg0uO6amNHkIkOxnmWX7Xa_DNQMQ62Q6drivuP9Gh1c,571 +click-6.7.dist-info/top_level.txt,sha256=J1ZQogalYS4pphY_lPECoNMfw0HzTSrZglC4Yfwo4xA,6 +click-6.7.dist-info/INSTALLER,sha256=zuuue4knoyJ-UwPPXg8fezS7VCrXJQrAP7zeNuwvFQg,4 +click/__pycache__/core.cpython-36.pyc,, +click/__pycache__/decorators.cpython-36.pyc,, +click/__pycache__/exceptions.cpython-36.pyc,, +click/__pycache__/formatting.cpython-36.pyc,, +click/__pycache__/globals.cpython-36.pyc,, +click/__pycache__/parser.cpython-36.pyc,, +click/__pycache__/termui.cpython-36.pyc,, +click/__pycache__/testing.cpython-36.pyc,, +click/__pycache__/types.cpython-36.pyc,, +click/__pycache__/utils.cpython-36.pyc,, +click/__pycache__/_bashcomplete.cpython-36.pyc,, +click/__pycache__/_compat.cpython-36.pyc,, +click/__pycache__/_termui_impl.cpython-36.pyc,, +click/__pycache__/_textwrap.cpython-36.pyc,, +click/__pycache__/_unicodefun.cpython-36.pyc,, +click/__pycache__/_winconsole.cpython-36.pyc,, +click/__pycache__/__init__.cpython-36.pyc,, diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/WHEEL b/website/web/Lib/site-packages/click-6.7.dist-info/WHEEL new file mode 100644 index 000000000..7bf9daa1a --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/WHEEL @@ -0,0 +1,6 @@ +Wheel-Version: 1.0 +Generator: bdist_wheel (0.30.0.a0) +Root-Is-Purelib: true +Tag: py2-none-any +Tag: py3-none-any + diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/metadata.json b/website/web/Lib/site-packages/click-6.7.dist-info/metadata.json new file mode 100644 index 000000000..0a4cfb189 --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/metadata.json @@ -0,0 +1 @@ +{"classifiers": ["License :: OSI Approved :: BSD License", "Programming Language :: Python", "Programming Language :: Python :: 3"], "extensions": {"python.details": {"contacts": [{"email": "armin.ronacher@active-4.com", "name": "Armin Ronacher", "role": "author"}], "document_names": {"description": "DESCRIPTION.rst"}, "project_urls": {"Home": "http://github.com/mitsuhiko/click"}}}, "generator": "bdist_wheel (0.30.0.a0)", "metadata_version": "2.0", "name": "click", "summary": "A simple wrapper around optparse for powerful command line utilities.", "version": "6.7"} \ No newline at end of file diff --git a/website/web/Lib/site-packages/click-6.7.dist-info/top_level.txt b/website/web/Lib/site-packages/click-6.7.dist-info/top_level.txt new file mode 100644 index 000000000..dca9a9096 --- /dev/null +++ b/website/web/Lib/site-packages/click-6.7.dist-info/top_level.txt @@ -0,0 +1 @@ +click diff --git a/website/web/Lib/site-packages/click/__init__.py b/website/web/Lib/site-packages/click/__init__.py new file mode 100644 index 000000000..971e55d0a --- /dev/null +++ b/website/web/Lib/site-packages/click/__init__.py @@ -0,0 +1,98 @@ +# -*- coding: utf-8 -*- +""" + click + ~~~~~ + + Click is a simple Python module that wraps the stdlib's optparse to make + writing command line scripts fun. Unlike other modules, it's based around + a simple API that does not come with too much magic and is composable. + + In case optparse ever gets removed from the stdlib, it will be shipped by + this module. + + :copyright: (c) 2014 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +# Core classes +from .core import Context, BaseCommand, Command, MultiCommand, Group, \ + CommandCollection, Parameter, Option, Argument + +# Globals +from .globals import get_current_context + +# Decorators +from .decorators import pass_context, pass_obj, make_pass_decorator, \ + command, group, argument, option, confirmation_option, \ + password_option, version_option, help_option + +# Types +from .types import ParamType, File, Path, Choice, IntRange, Tuple, \ + STRING, INT, FLOAT, BOOL, UUID, UNPROCESSED + +# Utilities +from .utils import echo, get_binary_stream, get_text_stream, open_file, \ + format_filename, get_app_dir, get_os_args + +# Terminal functions +from .termui import prompt, confirm, get_terminal_size, echo_via_pager, \ + progressbar, clear, style, unstyle, secho, edit, launch, getchar, \ + pause + +# Exceptions +from .exceptions import ClickException, UsageError, BadParameter, \ + FileError, Abort, NoSuchOption, BadOptionUsage, BadArgumentUsage, \ + MissingParameter + +# Formatting +from .formatting import HelpFormatter, wrap_text + +# Parsing +from .parser import OptionParser + + +__all__ = [ + # Core classes + 'Context', 'BaseCommand', 'Command', 'MultiCommand', 'Group', + 'CommandCollection', 'Parameter', 'Option', 'Argument', + + # Globals + 'get_current_context', + + # Decorators + 'pass_context', 'pass_obj', 'make_pass_decorator', 'command', 'group', + 'argument', 'option', 'confirmation_option', 'password_option', + 'version_option', 'help_option', + + # Types + 'ParamType', 'File', 'Path', 'Choice', 'IntRange', 'Tuple', 'STRING', + 'INT', 'FLOAT', 'BOOL', 'UUID', 'UNPROCESSED', + + # Utilities + 'echo', 'get_binary_stream', 'get_text_stream', 'open_file', + 'format_filename', 'get_app_dir', 'get_os_args', + + # Terminal functions + 'prompt', 'confirm', 'get_terminal_size', 'echo_via_pager', + 'progressbar', 'clear', 'style', 'unstyle', 'secho', 'edit', 'launch', + 'getchar', 'pause', + + # Exceptions + 'ClickException', 'UsageError', 'BadParameter', 'FileError', + 'Abort', 'NoSuchOption', 'BadOptionUsage', 'BadArgumentUsage', + 'MissingParameter', + + # Formatting + 'HelpFormatter', 'wrap_text', + + # Parsing + 'OptionParser', +] + + +# Controls if click should emit the warning about the use of unicode +# literals. +disable_unicode_literals_warning = False + + +__version__ = '6.7' diff --git a/website/web/Lib/site-packages/click/_bashcomplete.py b/website/web/Lib/site-packages/click/_bashcomplete.py new file mode 100644 index 000000000..d9d26d28b --- /dev/null +++ b/website/web/Lib/site-packages/click/_bashcomplete.py @@ -0,0 +1,83 @@ +import os +import re +from .utils import echo +from .parser import split_arg_string +from .core import MultiCommand, Option + + +COMPLETION_SCRIPT = ''' +%(complete_func)s() { + COMPREPLY=( $( env COMP_WORDS="${COMP_WORDS[*]}" \\ + COMP_CWORD=$COMP_CWORD \\ + %(autocomplete_var)s=complete $1 ) ) + return 0 +} + +complete -F %(complete_func)s -o default %(script_names)s +''' + +_invalid_ident_char_re = re.compile(r'[^a-zA-Z0-9_]') + + +def get_completion_script(prog_name, complete_var): + cf_name = _invalid_ident_char_re.sub('', prog_name.replace('-', '_')) + return (COMPLETION_SCRIPT % { + 'complete_func': '_%s_completion' % cf_name, + 'script_names': prog_name, + 'autocomplete_var': complete_var, + }).strip() + ';' + + +def resolve_ctx(cli, prog_name, args): + ctx = cli.make_context(prog_name, args, resilient_parsing=True) + while ctx.protected_args + ctx.args and isinstance(ctx.command, MultiCommand): + a = ctx.protected_args + ctx.args + cmd = ctx.command.get_command(ctx, a[0]) + if cmd is None: + return None + ctx = cmd.make_context(a[0], a[1:], parent=ctx, resilient_parsing=True) + return ctx + + +def get_choices(cli, prog_name, args, incomplete): + ctx = resolve_ctx(cli, prog_name, args) + if ctx is None: + return + + choices = [] + if incomplete and not incomplete[:1].isalnum(): + for param in ctx.command.params: + if not isinstance(param, Option): + continue + choices.extend(param.opts) + choices.extend(param.secondary_opts) + elif isinstance(ctx.command, MultiCommand): + choices.extend(ctx.command.list_commands(ctx)) + + for item in choices: + if item.startswith(incomplete): + yield item + + +def do_complete(cli, prog_name): + cwords = split_arg_string(os.environ['COMP_WORDS']) + cword = int(os.environ['COMP_CWORD']) + args = cwords[1:cword] + try: + incomplete = cwords[cword] + except IndexError: + incomplete = '' + + for item in get_choices(cli, prog_name, args, incomplete): + echo(item) + + return True + + +def bashcomplete(cli, prog_name, complete_var, complete_instr): + if complete_instr == 'source': + echo(get_completion_script(prog_name, complete_var)) + return True + elif complete_instr == 'complete': + return do_complete(cli, prog_name) + return False diff --git a/website/web/Lib/site-packages/click/_compat.py b/website/web/Lib/site-packages/click/_compat.py new file mode 100644 index 000000000..2b43412c4 --- /dev/null +++ b/website/web/Lib/site-packages/click/_compat.py @@ -0,0 +1,648 @@ +import re +import io +import os +import sys +import codecs +from weakref import WeakKeyDictionary + + +PY2 = sys.version_info[0] == 2 +WIN = sys.platform.startswith('win') +DEFAULT_COLUMNS = 80 + + +_ansi_re = re.compile('\033\[((?:\d|;)*)([a-zA-Z])') + + +def get_filesystem_encoding(): + return sys.getfilesystemencoding() or sys.getdefaultencoding() + + +def _make_text_stream(stream, encoding, errors): + if encoding is None: + encoding = get_best_encoding(stream) + if errors is None: + errors = 'replace' + return _NonClosingTextIOWrapper(stream, encoding, errors, + line_buffering=True) + + +def is_ascii_encoding(encoding): + """Checks if a given encoding is ascii.""" + try: + return codecs.lookup(encoding).name == 'ascii' + except LookupError: + return False + + +def get_best_encoding(stream): + """Returns the default stream encoding if not found.""" + rv = getattr(stream, 'encoding', None) or sys.getdefaultencoding() + if is_ascii_encoding(rv): + return 'utf-8' + return rv + + +class _NonClosingTextIOWrapper(io.TextIOWrapper): + + def __init__(self, stream, encoding, errors, **extra): + self._stream = stream = _FixupStream(stream) + io.TextIOWrapper.__init__(self, stream, encoding, errors, **extra) + + # The io module is a place where the Python 3 text behavior + # was forced upon Python 2, so we need to unbreak + # it to look like Python 2. + if PY2: + def write(self, x): + if isinstance(x, str) or is_bytes(x): + try: + self.flush() + except Exception: + pass + return self.buffer.write(str(x)) + return io.TextIOWrapper.write(self, x) + + def writelines(self, lines): + for line in lines: + self.write(line) + + def __del__(self): + try: + self.detach() + except Exception: + pass + + def isatty(self): + # https://bitbucket.org/pypy/pypy/issue/1803 + return self._stream.isatty() + + +class _FixupStream(object): + """The new io interface needs more from streams than streams + traditionally implement. As such, this fix-up code is necessary in + some circumstances. + """ + + def __init__(self, stream): + self._stream = stream + + def __getattr__(self, name): + return getattr(self._stream, name) + + def read1(self, size): + f = getattr(self._stream, 'read1', None) + if f is not None: + return f(size) + # We only dispatch to readline instead of read in Python 2 as we + # do not want cause problems with the different implementation + # of line buffering. + if PY2: + return self._stream.readline(size) + return self._stream.read(size) + + def readable(self): + x = getattr(self._stream, 'readable', None) + if x is not None: + return x() + try: + self._stream.read(0) + except Exception: + return False + return True + + def writable(self): + x = getattr(self._stream, 'writable', None) + if x is not None: + return x() + try: + self._stream.write('') + except Exception: + try: + self._stream.write(b'') + except Exception: + return False + return True + + def seekable(self): + x = getattr(self._stream, 'seekable', None) + if x is not None: + return x() + try: + self._stream.seek(self._stream.tell()) + except Exception: + return False + return True + + +if PY2: + text_type = unicode + bytes = str + raw_input = raw_input + string_types = (str, unicode) + iteritems = lambda x: x.iteritems() + range_type = xrange + + def is_bytes(x): + return isinstance(x, (buffer, bytearray)) + + _identifier_re = re.compile(r'^[a-zA-Z_][a-zA-Z0-9_]*$') + + # For Windows, we need to force stdout/stdin/stderr to binary if it's + # fetched for that. This obviously is not the most correct way to do + # it as it changes global state. Unfortunately, there does not seem to + # be a clear better way to do it as just reopening the file in binary + # mode does not change anything. + # + # An option would be to do what Python 3 does and to open the file as + # binary only, patch it back to the system, and then use a wrapper + # stream that converts newlines. It's not quite clear what's the + # correct option here. + # + # This code also lives in _winconsole for the fallback to the console + # emulation stream. + # + # There are also Windows environments where the `msvcrt` module is not + # available (which is why we use try-catch instead of the WIN variable + # here), such as the Google App Engine development server on Windows. In + # those cases there is just nothing we can do. + try: + import msvcrt + except ImportError: + set_binary_mode = lambda x: x + else: + def set_binary_mode(f): + try: + fileno = f.fileno() + except Exception: + pass + else: + msvcrt.setmode(fileno, os.O_BINARY) + return f + + def isidentifier(x): + return _identifier_re.search(x) is not None + + def get_binary_stdin(): + return set_binary_mode(sys.stdin) + + def get_binary_stdout(): + return set_binary_mode(sys.stdout) + + def get_binary_stderr(): + return set_binary_mode(sys.stderr) + + def get_text_stdin(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stdin, encoding, errors) + if rv is not None: + return rv + return _make_text_stream(sys.stdin, encoding, errors) + + def get_text_stdout(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stdout, encoding, errors) + if rv is not None: + return rv + return _make_text_stream(sys.stdout, encoding, errors) + + def get_text_stderr(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stderr, encoding, errors) + if rv is not None: + return rv + return _make_text_stream(sys.stderr, encoding, errors) + + def filename_to_ui(value): + if isinstance(value, bytes): + value = value.decode(get_filesystem_encoding(), 'replace') + return value +else: + import io + text_type = str + raw_input = input + string_types = (str,) + range_type = range + isidentifier = lambda x: x.isidentifier() + iteritems = lambda x: iter(x.items()) + + def is_bytes(x): + return isinstance(x, (bytes, memoryview, bytearray)) + + def _is_binary_reader(stream, default=False): + try: + return isinstance(stream.read(0), bytes) + except Exception: + return default + # This happens in some cases where the stream was already + # closed. In this case, we assume the default. + + def _is_binary_writer(stream, default=False): + try: + stream.write(b'') + except Exception: + try: + stream.write('') + return False + except Exception: + pass + return default + return True + + def _find_binary_reader(stream): + # We need to figure out if the given stream is already binary. + # This can happen because the official docs recommend detaching + # the streams to get binary streams. Some code might do this, so + # we need to deal with this case explicitly. + if _is_binary_reader(stream, False): + return stream + + buf = getattr(stream, 'buffer', None) + + # Same situation here; this time we assume that the buffer is + # actually binary in case it's closed. + if buf is not None and _is_binary_reader(buf, True): + return buf + + def _find_binary_writer(stream): + # We need to figure out if the given stream is already binary. + # This can happen because the official docs recommend detatching + # the streams to get binary streams. Some code might do this, so + # we need to deal with this case explicitly. + if _is_binary_writer(stream, False): + return stream + + buf = getattr(stream, 'buffer', None) + + # Same situation here; this time we assume that the buffer is + # actually binary in case it's closed. + if buf is not None and _is_binary_writer(buf, True): + return buf + + def _stream_is_misconfigured(stream): + """A stream is misconfigured if its encoding is ASCII.""" + # If the stream does not have an encoding set, we assume it's set + # to ASCII. This appears to happen in certain unittest + # environments. It's not quite clear what the correct behavior is + # but this at least will force Click to recover somehow. + return is_ascii_encoding(getattr(stream, 'encoding', None) or 'ascii') + + def _is_compatible_text_stream(stream, encoding, errors): + stream_encoding = getattr(stream, 'encoding', None) + stream_errors = getattr(stream, 'errors', None) + + # Perfect match. + if stream_encoding == encoding and stream_errors == errors: + return True + + # Otherwise, it's only a compatible stream if we did not ask for + # an encoding. + if encoding is None: + return stream_encoding is not None + + return False + + def _force_correct_text_reader(text_reader, encoding, errors): + if _is_binary_reader(text_reader, False): + binary_reader = text_reader + else: + # If there is no target encoding set, we need to verify that the + # reader is not actually misconfigured. + if encoding is None and not _stream_is_misconfigured(text_reader): + return text_reader + + if _is_compatible_text_stream(text_reader, encoding, errors): + return text_reader + + # If the reader has no encoding, we try to find the underlying + # binary reader for it. If that fails because the environment is + # misconfigured, we silently go with the same reader because this + # is too common to happen. In that case, mojibake is better than + # exceptions. + binary_reader = _find_binary_reader(text_reader) + if binary_reader is None: + return text_reader + + # At this point, we default the errors to replace instead of strict + # because nobody handles those errors anyways and at this point + # we're so fundamentally fucked that nothing can repair it. + if errors is None: + errors = 'replace' + return _make_text_stream(binary_reader, encoding, errors) + + def _force_correct_text_writer(text_writer, encoding, errors): + if _is_binary_writer(text_writer, False): + binary_writer = text_writer + else: + # If there is no target encoding set, we need to verify that the + # writer is not actually misconfigured. + if encoding is None and not _stream_is_misconfigured(text_writer): + return text_writer + + if _is_compatible_text_stream(text_writer, encoding, errors): + return text_writer + + # If the writer has no encoding, we try to find the underlying + # binary writer for it. If that fails because the environment is + # misconfigured, we silently go with the same writer because this + # is too common to happen. In that case, mojibake is better than + # exceptions. + binary_writer = _find_binary_writer(text_writer) + if binary_writer is None: + return text_writer + + # At this point, we default the errors to replace instead of strict + # because nobody handles those errors anyways and at this point + # we're so fundamentally fucked that nothing can repair it. + if errors is None: + errors = 'replace' + return _make_text_stream(binary_writer, encoding, errors) + + def get_binary_stdin(): + reader = _find_binary_reader(sys.stdin) + if reader is None: + raise RuntimeError('Was not able to determine binary ' + 'stream for sys.stdin.') + return reader + + def get_binary_stdout(): + writer = _find_binary_writer(sys.stdout) + if writer is None: + raise RuntimeError('Was not able to determine binary ' + 'stream for sys.stdout.') + return writer + + def get_binary_stderr(): + writer = _find_binary_writer(sys.stderr) + if writer is None: + raise RuntimeError('Was not able to determine binary ' + 'stream for sys.stderr.') + return writer + + def get_text_stdin(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stdin, encoding, errors) + if rv is not None: + return rv + return _force_correct_text_reader(sys.stdin, encoding, errors) + + def get_text_stdout(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stdout, encoding, errors) + if rv is not None: + return rv + return _force_correct_text_writer(sys.stdout, encoding, errors) + + def get_text_stderr(encoding=None, errors=None): + rv = _get_windows_console_stream(sys.stderr, encoding, errors) + if rv is not None: + return rv + return _force_correct_text_writer(sys.stderr, encoding, errors) + + def filename_to_ui(value): + if isinstance(value, bytes): + value = value.decode(get_filesystem_encoding(), 'replace') + else: + value = value.encode('utf-8', 'surrogateescape') \ + .decode('utf-8', 'replace') + return value + + +def get_streerror(e, default=None): + if hasattr(e, 'strerror'): + msg = e.strerror + else: + if default is not None: + msg = default + else: + msg = str(e) + if isinstance(msg, bytes): + msg = msg.decode('utf-8', 'replace') + return msg + + +def open_stream(filename, mode='r', encoding=None, errors='strict', + atomic=False): + # Standard streams first. These are simple because they don't need + # special handling for the atomic flag. It's entirely ignored. + if filename == '-': + if 'w' in mode: + if 'b' in mode: + return get_binary_stdout(), False + return get_text_stdout(encoding=encoding, errors=errors), False + if 'b' in mode: + return get_binary_stdin(), False + return get_text_stdin(encoding=encoding, errors=errors), False + + # Non-atomic writes directly go out through the regular open functions. + if not atomic: + if encoding is None: + return open(filename, mode), True + return io.open(filename, mode, encoding=encoding, errors=errors), True + + # Some usability stuff for atomic writes + if 'a' in mode: + raise ValueError( + 'Appending to an existing file is not supported, because that ' + 'would involve an expensive `copy`-operation to a temporary ' + 'file. Open the file in normal `w`-mode and copy explicitly ' + 'if that\'s what you\'re after.' + ) + if 'x' in mode: + raise ValueError('Use the `overwrite`-parameter instead.') + if 'w' not in mode: + raise ValueError('Atomic writes only make sense with `w`-mode.') + + # Atomic writes are more complicated. They work by opening a file + # as a proxy in the same folder and then using the fdopen + # functionality to wrap it in a Python file. Then we wrap it in an + # atomic file that moves the file over on close. + import tempfile + fd, tmp_filename = tempfile.mkstemp(dir=os.path.dirname(filename), + prefix='.__atomic-write') + + if encoding is not None: + f = io.open(fd, mode, encoding=encoding, errors=errors) + else: + f = os.fdopen(fd, mode) + + return _AtomicFile(f, tmp_filename, filename), True + + +# Used in a destructor call, needs extra protection from interpreter cleanup. +if hasattr(os, 'replace'): + _replace = os.replace + _can_replace = True +else: + _replace = os.rename + _can_replace = not WIN + + +class _AtomicFile(object): + + def __init__(self, f, tmp_filename, real_filename): + self._f = f + self._tmp_filename = tmp_filename + self._real_filename = real_filename + self.closed = False + + @property + def name(self): + return self._real_filename + + def close(self, delete=False): + if self.closed: + return + self._f.close() + if not _can_replace: + try: + os.remove(self._real_filename) + except OSError: + pass + _replace(self._tmp_filename, self._real_filename) + self.closed = True + + def __getattr__(self, name): + return getattr(self._f, name) + + def __enter__(self): + return self + + def __exit__(self, exc_type, exc_value, tb): + self.close(delete=exc_type is not None) + + def __repr__(self): + return repr(self._f) + + +auto_wrap_for_ansi = None +colorama = None +get_winterm_size = None + + +def strip_ansi(value): + return _ansi_re.sub('', value) + + +def should_strip_ansi(stream=None, color=None): + if color is None: + if stream is None: + stream = sys.stdin + return not isatty(stream) + return not color + + +# If we're on Windows, we provide transparent integration through +# colorama. This will make ANSI colors through the echo function +# work automatically. +if WIN: + # Windows has a smaller terminal + DEFAULT_COLUMNS = 79 + + from ._winconsole import _get_windows_console_stream + + def _get_argv_encoding(): + import locale + return locale.getpreferredencoding() + + if PY2: + def raw_input(prompt=''): + sys.stderr.flush() + if prompt: + stdout = _default_text_stdout() + stdout.write(prompt) + stdin = _default_text_stdin() + return stdin.readline().rstrip('\r\n') + + try: + import colorama + except ImportError: + pass + else: + _ansi_stream_wrappers = WeakKeyDictionary() + + def auto_wrap_for_ansi(stream, color=None): + """This function wraps a stream so that calls through colorama + are issued to the win32 console API to recolor on demand. It + also ensures to reset the colors if a write call is interrupted + to not destroy the console afterwards. + """ + try: + cached = _ansi_stream_wrappers.get(stream) + except Exception: + cached = None + if cached is not None: + return cached + strip = should_strip_ansi(stream, color) + ansi_wrapper = colorama.AnsiToWin32(stream, strip=strip) + rv = ansi_wrapper.stream + _write = rv.write + + def _safe_write(s): + try: + return _write(s) + except: + ansi_wrapper.reset_all() + raise + + rv.write = _safe_write + try: + _ansi_stream_wrappers[stream] = rv + except Exception: + pass + return rv + + def get_winterm_size(): + win = colorama.win32.GetConsoleScreenBufferInfo( + colorama.win32.STDOUT).srWindow + return win.Right - win.Left, win.Bottom - win.Top +else: + def _get_argv_encoding(): + return getattr(sys.stdin, 'encoding', None) or get_filesystem_encoding() + + _get_windows_console_stream = lambda *x: None + + +def term_len(x): + return len(strip_ansi(x)) + + +def isatty(stream): + try: + return stream.isatty() + except Exception: + return False + + +def _make_cached_stream_func(src_func, wrapper_func): + cache = WeakKeyDictionary() + def func(): + stream = src_func() + try: + rv = cache.get(stream) + except Exception: + rv = None + if rv is not None: + return rv + rv = wrapper_func() + try: + cache[stream] = rv + except Exception: + pass + return rv + return func + + +_default_text_stdin = _make_cached_stream_func( + lambda: sys.stdin, get_text_stdin) +_default_text_stdout = _make_cached_stream_func( + lambda: sys.stdout, get_text_stdout) +_default_text_stderr = _make_cached_stream_func( + lambda: sys.stderr, get_text_stderr) + + +binary_streams = { + 'stdin': get_binary_stdin, + 'stdout': get_binary_stdout, + 'stderr': get_binary_stderr, +} + +text_streams = { + 'stdin': get_text_stdin, + 'stdout': get_text_stdout, + 'stderr': get_text_stderr, +} diff --git a/website/web/Lib/site-packages/click/_termui_impl.py b/website/web/Lib/site-packages/click/_termui_impl.py new file mode 100644 index 000000000..7cfd3d5c4 --- /dev/null +++ b/website/web/Lib/site-packages/click/_termui_impl.py @@ -0,0 +1,547 @@ +""" + click._termui_impl + ~~~~~~~~~~~~~~~~~~ + + This module contains implementations for the termui module. To keep the + import time of Click down, some infrequently used functionality is placed + in this module and only imported as needed. + + :copyright: (c) 2014 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +import os +import sys +import time +import math +from ._compat import _default_text_stdout, range_type, PY2, isatty, \ + open_stream, strip_ansi, term_len, get_best_encoding, WIN +from .utils import echo +from .exceptions import ClickException + + +if os.name == 'nt': + BEFORE_BAR = '\r' + AFTER_BAR = '\n' +else: + BEFORE_BAR = '\r\033[?25l' + AFTER_BAR = '\033[?25h\n' + + +def _length_hint(obj): + """Returns the length hint of an object.""" + try: + return len(obj) + except (AttributeError, TypeError): + try: + get_hint = type(obj).__length_hint__ + except AttributeError: + return None + try: + hint = get_hint(obj) + except TypeError: + return None + if hint is NotImplemented or \ + not isinstance(hint, (int, long)) or \ + hint < 0: + return None + return hint + + +class ProgressBar(object): + + def __init__(self, iterable, length=None, fill_char='#', empty_char=' ', + bar_template='%(bar)s', info_sep=' ', show_eta=True, + show_percent=None, show_pos=False, item_show_func=None, + label=None, file=None, color=None, width=30): + self.fill_char = fill_char + self.empty_char = empty_char + self.bar_template = bar_template + self.info_sep = info_sep + self.show_eta = show_eta + self.show_percent = show_percent + self.show_pos = show_pos + self.item_show_func = item_show_func + self.label = label or '' + if file is None: + file = _default_text_stdout() + self.file = file + self.color = color + self.width = width + self.autowidth = width == 0 + + if length is None: + length = _length_hint(iterable) + if iterable is None: + if length is None: + raise TypeError('iterable or length is required') + iterable = range_type(length) + self.iter = iter(iterable) + self.length = length + self.length_known = length is not None + self.pos = 0 + self.avg = [] + self.start = self.last_eta = time.time() + self.eta_known = False + self.finished = False + self.max_width = None + self.entered = False + self.current_item = None + self.is_hidden = not isatty(self.file) + self._last_line = None + + def __enter__(self): + self.entered = True + self.render_progress() + return self + + def __exit__(self, exc_type, exc_value, tb): + self.render_finish() + + def __iter__(self): + if not self.entered: + raise RuntimeError('You need to use progress bars in a with block.') + self.render_progress() + return self + + def render_finish(self): + if self.is_hidden: + return + self.file.write(AFTER_BAR) + self.file.flush() + + @property + def pct(self): + if self.finished: + return 1.0 + return min(self.pos / (float(self.length) or 1), 1.0) + + @property + def time_per_iteration(self): + if not self.avg: + return 0.0 + return sum(self.avg) / float(len(self.avg)) + + @property + def eta(self): + if self.length_known and not self.finished: + return self.time_per_iteration * (self.length - self.pos) + return 0.0 + + def format_eta(self): + if self.eta_known: + t = self.eta + 1 + seconds = t % 60 + t /= 60 + minutes = t % 60 + t /= 60 + hours = t % 24 + t /= 24 + if t > 0: + days = t + return '%dd %02d:%02d:%02d' % (days, hours, minutes, seconds) + else: + return '%02d:%02d:%02d' % (hours, minutes, seconds) + return '' + + def format_pos(self): + pos = str(self.pos) + if self.length_known: + pos += '/%s' % self.length + return pos + + def format_pct(self): + return ('% 4d%%' % int(self.pct * 100))[1:] + + def format_progress_line(self): + show_percent = self.show_percent + + info_bits = [] + if self.length_known: + bar_length = int(self.pct * self.width) + bar = self.fill_char * bar_length + bar += self.empty_char * (self.width - bar_length) + if show_percent is None: + show_percent = not self.show_pos + else: + if self.finished: + bar = self.fill_char * self.width + else: + bar = list(self.empty_char * (self.width or 1)) + if self.time_per_iteration != 0: + bar[int((math.cos(self.pos * self.time_per_iteration) + / 2.0 + 0.5) * self.width)] = self.fill_char + bar = ''.join(bar) + + if self.show_pos: + info_bits.append(self.format_pos()) + if show_percent: + info_bits.append(self.format_pct()) + if self.show_eta and self.eta_known and not self.finished: + info_bits.append(self.format_eta()) + if self.item_show_func is not None: + item_info = self.item_show_func(self.current_item) + if item_info is not None: + info_bits.append(item_info) + + return (self.bar_template % { + 'label': self.label, + 'bar': bar, + 'info': self.info_sep.join(info_bits) + }).rstrip() + + def render_progress(self): + from .termui import get_terminal_size + nl = False + + if self.is_hidden: + buf = [self.label] + nl = True + else: + buf = [] + # Update width in case the terminal has been resized + if self.autowidth: + old_width = self.width + self.width = 0 + clutter_length = term_len(self.format_progress_line()) + new_width = max(0, get_terminal_size()[0] - clutter_length) + if new_width < old_width: + buf.append(BEFORE_BAR) + buf.append(' ' * self.max_width) + self.max_width = new_width + self.width = new_width + + clear_width = self.width + if self.max_width is not None: + clear_width = self.max_width + + buf.append(BEFORE_BAR) + line = self.format_progress_line() + line_len = term_len(line) + if self.max_width is None or self.max_width < line_len: + self.max_width = line_len + buf.append(line) + + buf.append(' ' * (clear_width - line_len)) + line = ''.join(buf) + + # Render the line only if it changed. + if line != self._last_line: + self._last_line = line + echo(line, file=self.file, color=self.color, nl=nl) + self.file.flush() + + def make_step(self, n_steps): + self.pos += n_steps + if self.length_known and self.pos >= self.length: + self.finished = True + + if (time.time() - self.last_eta) < 1.0: + return + + self.last_eta = time.time() + self.avg = self.avg[-6:] + [-(self.start - time.time()) / (self.pos)] + + self.eta_known = self.length_known + + def update(self, n_steps): + self.make_step(n_steps) + self.render_progress() + + def finish(self): + self.eta_known = 0 + self.current_item = None + self.finished = True + + def next(self): + if self.is_hidden: + return next(self.iter) + try: + rv = next(self.iter) + self.current_item = rv + except StopIteration: + self.finish() + self.render_progress() + raise StopIteration() + else: + self.update(1) + return rv + + if not PY2: + __next__ = next + del next + + +def pager(text, color=None): + """Decide what method to use for paging through text.""" + stdout = _default_text_stdout() + if not isatty(sys.stdin) or not isatty(stdout): + return _nullpager(stdout, text, color) + pager_cmd = (os.environ.get('PAGER', None) or '').strip() + if pager_cmd: + if WIN: + return _tempfilepager(text, pager_cmd, color) + return _pipepager(text, pager_cmd, color) + if os.environ.get('TERM') in ('dumb', 'emacs'): + return _nullpager(stdout, text, color) + if WIN or sys.platform.startswith('os2'): + return _tempfilepager(text, 'more <', color) + if hasattr(os, 'system') and os.system('(less) 2>/dev/null') == 0: + return _pipepager(text, 'less', color) + + import tempfile + fd, filename = tempfile.mkstemp() + os.close(fd) + try: + if hasattr(os, 'system') and os.system('more "%s"' % filename) == 0: + return _pipepager(text, 'more', color) + return _nullpager(stdout, text, color) + finally: + os.unlink(filename) + + +def _pipepager(text, cmd, color): + """Page through text by feeding it to another program. Invoking a + pager through this might support colors. + """ + import subprocess + env = dict(os.environ) + + # If we're piping to less we might support colors under the + # condition that + cmd_detail = cmd.rsplit('/', 1)[-1].split() + if color is None and cmd_detail[0] == 'less': + less_flags = os.environ.get('LESS', '') + ' '.join(cmd_detail[1:]) + if not less_flags: + env['LESS'] = '-R' + color = True + elif 'r' in less_flags or 'R' in less_flags: + color = True + + if not color: + text = strip_ansi(text) + + c = subprocess.Popen(cmd, shell=True, stdin=subprocess.PIPE, + env=env) + encoding = get_best_encoding(c.stdin) + try: + c.stdin.write(text.encode(encoding, 'replace')) + c.stdin.close() + except (IOError, KeyboardInterrupt): + pass + + # Less doesn't respect ^C, but catches it for its own UI purposes (aborting + # search or other commands inside less). + # + # That means when the user hits ^C, the parent process (click) terminates, + # but less is still alive, paging the output and messing up the terminal. + # + # If the user wants to make the pager exit on ^C, they should set + # `LESS='-K'`. It's not our decision to make. + while True: + try: + c.wait() + except KeyboardInterrupt: + pass + else: + break + + +def _tempfilepager(text, cmd, color): + """Page through text by invoking a program on a temporary file.""" + import tempfile + filename = tempfile.mktemp() + if not color: + text = strip_ansi(text) + encoding = get_best_encoding(sys.stdout) + with open_stream(filename, 'wb')[0] as f: + f.write(text.encode(encoding)) + try: + os.system(cmd + ' "' + filename + '"') + finally: + os.unlink(filename) + + +def _nullpager(stream, text, color): + """Simply print unformatted text. This is the ultimate fallback.""" + if not color: + text = strip_ansi(text) + stream.write(text) + + +class Editor(object): + + def __init__(self, editor=None, env=None, require_save=True, + extension='.txt'): + self.editor = editor + self.env = env + self.require_save = require_save + self.extension = extension + + def get_editor(self): + if self.editor is not None: + return self.editor + for key in 'VISUAL', 'EDITOR': + rv = os.environ.get(key) + if rv: + return rv + if WIN: + return 'notepad' + for editor in 'vim', 'nano': + if os.system('which %s >/dev/null 2>&1' % editor) == 0: + return editor + return 'vi' + + def edit_file(self, filename): + import subprocess + editor = self.get_editor() + if self.env: + environ = os.environ.copy() + environ.update(self.env) + else: + environ = None + try: + c = subprocess.Popen('%s "%s"' % (editor, filename), + env=environ, shell=True) + exit_code = c.wait() + if exit_code != 0: + raise ClickException('%s: Editing failed!' % editor) + except OSError as e: + raise ClickException('%s: Editing failed: %s' % (editor, e)) + + def edit(self, text): + import tempfile + + text = text or '' + if text and not text.endswith('\n'): + text += '\n' + + fd, name = tempfile.mkstemp(prefix='editor-', suffix=self.extension) + try: + if WIN: + encoding = 'utf-8-sig' + text = text.replace('\n', '\r\n') + else: + encoding = 'utf-8' + text = text.encode(encoding) + + f = os.fdopen(fd, 'wb') + f.write(text) + f.close() + timestamp = os.path.getmtime(name) + + self.edit_file(name) + + if self.require_save \ + and os.path.getmtime(name) == timestamp: + return None + + f = open(name, 'rb') + try: + rv = f.read() + finally: + f.close() + return rv.decode('utf-8-sig').replace('\r\n', '\n') + finally: + os.unlink(name) + + +def open_url(url, wait=False, locate=False): + import subprocess + + def _unquote_file(url): + try: + import urllib + except ImportError: + import urllib + if url.startswith('file://'): + url = urllib.unquote(url[7:]) + return url + + if sys.platform == 'darwin': + args = ['open'] + if wait: + args.append('-W') + if locate: + args.append('-R') + args.append(_unquote_file(url)) + null = open('/dev/null', 'w') + try: + return subprocess.Popen(args, stderr=null).wait() + finally: + null.close() + elif WIN: + if locate: + url = _unquote_file(url) + args = 'explorer /select,"%s"' % _unquote_file( + url.replace('"', '')) + else: + args = 'start %s "" "%s"' % ( + wait and '/WAIT' or '', url.replace('"', '')) + return os.system(args) + + try: + if locate: + url = os.path.dirname(_unquote_file(url)) or '.' + else: + url = _unquote_file(url) + c = subprocess.Popen(['xdg-open', url]) + if wait: + return c.wait() + return 0 + except OSError: + if url.startswith(('http://', 'https://')) and not locate and not wait: + import webbrowser + webbrowser.open(url) + return 0 + return 1 + + +def _translate_ch_to_exc(ch): + if ch == '\x03': + raise KeyboardInterrupt() + if ch == '\x04': + raise EOFError() + + +if WIN: + import msvcrt + + def getchar(echo): + rv = msvcrt.getch() + if echo: + msvcrt.putchar(rv) + _translate_ch_to_exc(rv) + if PY2: + enc = getattr(sys.stdin, 'encoding', None) + if enc is not None: + rv = rv.decode(enc, 'replace') + else: + rv = rv.decode('cp1252', 'replace') + return rv +else: + import tty + import termios + + def getchar(echo): + if not isatty(sys.stdin): + f = open('/dev/tty') + fd = f.fileno() + else: + fd = sys.stdin.fileno() + f = None + try: + old_settings = termios.tcgetattr(fd) + try: + tty.setraw(fd) + ch = os.read(fd, 32) + if echo and isatty(sys.stdout): + sys.stdout.write(ch) + finally: + termios.tcsetattr(fd, termios.TCSADRAIN, old_settings) + sys.stdout.flush() + if f is not None: + f.close() + except termios.error: + pass + _translate_ch_to_exc(ch) + return ch.decode(get_best_encoding(sys.stdin), 'replace') diff --git a/website/web/Lib/site-packages/click/_textwrap.py b/website/web/Lib/site-packages/click/_textwrap.py new file mode 100644 index 000000000..7e776031e --- /dev/null +++ b/website/web/Lib/site-packages/click/_textwrap.py @@ -0,0 +1,38 @@ +import textwrap +from contextlib import contextmanager + + +class TextWrapper(textwrap.TextWrapper): + + def _handle_long_word(self, reversed_chunks, cur_line, cur_len, width): + space_left = max(width - cur_len, 1) + + if self.break_long_words: + last = reversed_chunks[-1] + cut = last[:space_left] + res = last[space_left:] + cur_line.append(cut) + reversed_chunks[-1] = res + elif not cur_line: + cur_line.append(reversed_chunks.pop()) + + @contextmanager + def extra_indent(self, indent): + old_initial_indent = self.initial_indent + old_subsequent_indent = self.subsequent_indent + self.initial_indent += indent + self.subsequent_indent += indent + try: + yield + finally: + self.initial_indent = old_initial_indent + self.subsequent_indent = old_subsequent_indent + + def indent_only(self, text): + rv = [] + for idx, line in enumerate(text.splitlines()): + indent = self.initial_indent + if idx > 0: + indent = self.subsequent_indent + rv.append(indent + line) + return '\n'.join(rv) diff --git a/website/web/Lib/site-packages/click/_unicodefun.py b/website/web/Lib/site-packages/click/_unicodefun.py new file mode 100644 index 000000000..9e17a384e --- /dev/null +++ b/website/web/Lib/site-packages/click/_unicodefun.py @@ -0,0 +1,118 @@ +import os +import sys +import codecs + +from ._compat import PY2 + + +# If someone wants to vendor click, we want to ensure the +# correct package is discovered. Ideally we could use a +# relative import here but unfortunately Python does not +# support that. +click = sys.modules[__name__.rsplit('.', 1)[0]] + + +def _find_unicode_literals_frame(): + import __future__ + frm = sys._getframe(1) + idx = 1 + while frm is not None: + if frm.f_globals.get('__name__', '').startswith('click.'): + frm = frm.f_back + idx += 1 + elif frm.f_code.co_flags & __future__.unicode_literals.compiler_flag: + return idx + else: + break + return 0 + + +def _check_for_unicode_literals(): + if not __debug__: + return + if not PY2 or click.disable_unicode_literals_warning: + return + bad_frame = _find_unicode_literals_frame() + if bad_frame <= 0: + return + from warnings import warn + warn(Warning('Click detected the use of the unicode_literals ' + '__future__ import. This is heavily discouraged ' + 'because it can introduce subtle bugs in your ' + 'code. You should instead use explicit u"" literals ' + 'for your unicode strings. For more information see ' + 'http://click.pocoo.org/python3/'), + stacklevel=bad_frame) + + +def _verify_python3_env(): + """Ensures that the environment is good for unicode on Python 3.""" + if PY2: + return + try: + import locale + fs_enc = codecs.lookup(locale.getpreferredencoding()).name + except Exception: + fs_enc = 'ascii' + if fs_enc != 'ascii': + return + + extra = '' + if os.name == 'posix': + import subprocess + rv = subprocess.Popen(['locale', '-a'], stdout=subprocess.PIPE, + stderr=subprocess.PIPE).communicate()[0] + good_locales = set() + has_c_utf8 = False + + # Make sure we're operating on text here. + if isinstance(rv, bytes): + rv = rv.decode('ascii', 'replace') + + for line in rv.splitlines(): + locale = line.strip() + if locale.lower().endswith(('.utf-8', '.utf8')): + good_locales.add(locale) + if locale.lower() in ('c.utf8', 'c.utf-8'): + has_c_utf8 = True + + extra += '\n\n' + if not good_locales: + extra += ( + 'Additional information: on this system no suitable UTF-8\n' + 'locales were discovered. This most likely requires resolving\n' + 'by reconfiguring the locale system.' + ) + elif has_c_utf8: + extra += ( + 'This system supports the C.UTF-8 locale which is recommended.\n' + 'You might be able to resolve your issue by exporting the\n' + 'following environment variables:\n\n' + ' export LC_ALL=C.UTF-8\n' + ' export LANG=C.UTF-8' + ) + else: + extra += ( + 'This system lists a couple of UTF-8 supporting locales that\n' + 'you can pick from. The following suitable locales where\n' + 'discovered: %s' + ) % ', '.join(sorted(good_locales)) + + bad_locale = None + for locale in os.environ.get('LC_ALL'), os.environ.get('LANG'): + if locale and locale.lower().endswith(('.utf-8', '.utf8')): + bad_locale = locale + if locale is not None: + break + if bad_locale is not None: + extra += ( + '\n\nClick discovered that you exported a UTF-8 locale\n' + 'but the locale system could not pick up from it because\n' + 'it does not exist. The exported locale is "%s" but it\n' + 'is not supported' + ) % bad_locale + + raise RuntimeError('Click will abort further execution because Python 3 ' + 'was configured to use ASCII as encoding for the ' + 'environment. Consult http://click.pocoo.org/python3/' + 'for mitigation steps.' + extra) diff --git a/website/web/Lib/site-packages/click/_winconsole.py b/website/web/Lib/site-packages/click/_winconsole.py new file mode 100644 index 000000000..9aed94216 --- /dev/null +++ b/website/web/Lib/site-packages/click/_winconsole.py @@ -0,0 +1,273 @@ +# -*- coding: utf-8 -*- +# This module is based on the excellent work by Adam Bartoš who +# provided a lot of what went into the implementation here in +# the discussion to issue1602 in the Python bug tracker. +# +# There are some general differences in regards to how this works +# compared to the original patches as we do not need to patch +# the entire interpreter but just work in our little world of +# echo and prmopt. + +import io +import os +import sys +import zlib +import time +import ctypes +import msvcrt +from click._compat import _NonClosingTextIOWrapper, text_type, PY2 +from ctypes import byref, POINTER, c_int, c_char, c_char_p, \ + c_void_p, py_object, c_ssize_t, c_ulong, windll, WINFUNCTYPE +try: + from ctypes import pythonapi + PyObject_GetBuffer = pythonapi.PyObject_GetBuffer + PyBuffer_Release = pythonapi.PyBuffer_Release +except ImportError: + pythonapi = None +from ctypes.wintypes import LPWSTR, LPCWSTR + + +c_ssize_p = POINTER(c_ssize_t) + +kernel32 = windll.kernel32 +GetStdHandle = kernel32.GetStdHandle +ReadConsoleW = kernel32.ReadConsoleW +WriteConsoleW = kernel32.WriteConsoleW +GetLastError = kernel32.GetLastError +GetCommandLineW = WINFUNCTYPE(LPWSTR)( + ('GetCommandLineW', windll.kernel32)) +CommandLineToArgvW = WINFUNCTYPE( + POINTER(LPWSTR), LPCWSTR, POINTER(c_int))( + ('CommandLineToArgvW', windll.shell32)) + + +STDIN_HANDLE = GetStdHandle(-10) +STDOUT_HANDLE = GetStdHandle(-11) +STDERR_HANDLE = GetStdHandle(-12) + + +PyBUF_SIMPLE = 0 +PyBUF_WRITABLE = 1 + +ERROR_SUCCESS = 0 +ERROR_NOT_ENOUGH_MEMORY = 8 +ERROR_OPERATION_ABORTED = 995 + +STDIN_FILENO = 0 +STDOUT_FILENO = 1 +STDERR_FILENO = 2 + +EOF = b'\x1a' +MAX_BYTES_WRITTEN = 32767 + + +class Py_buffer(ctypes.Structure): + _fields_ = [ + ('buf', c_void_p), + ('obj', py_object), + ('len', c_ssize_t), + ('itemsize', c_ssize_t), + ('readonly', c_int), + ('ndim', c_int), + ('format', c_char_p), + ('shape', c_ssize_p), + ('strides', c_ssize_p), + ('suboffsets', c_ssize_p), + ('internal', c_void_p) + ] + + if PY2: + _fields_.insert(-1, ('smalltable', c_ssize_t * 2)) + + +# On PyPy we cannot get buffers so our ability to operate here is +# serverly limited. +if pythonapi is None: + get_buffer = None +else: + def get_buffer(obj, writable=False): + buf = Py_buffer() + flags = PyBUF_WRITABLE if writable else PyBUF_SIMPLE + PyObject_GetBuffer(py_object(obj), byref(buf), flags) + try: + buffer_type = c_char * buf.len + return buffer_type.from_address(buf.buf) + finally: + PyBuffer_Release(byref(buf)) + + +class _WindowsConsoleRawIOBase(io.RawIOBase): + + def __init__(self, handle): + self.handle = handle + + def isatty(self): + io.RawIOBase.isatty(self) + return True + + +class _WindowsConsoleReader(_WindowsConsoleRawIOBase): + + def readable(self): + return True + + def readinto(self, b): + bytes_to_be_read = len(b) + if not bytes_to_be_read: + return 0 + elif bytes_to_be_read % 2: + raise ValueError('cannot read odd number of bytes from ' + 'UTF-16-LE encoded console') + + buffer = get_buffer(b, writable=True) + code_units_to_be_read = bytes_to_be_read // 2 + code_units_read = c_ulong() + + rv = ReadConsoleW(self.handle, buffer, code_units_to_be_read, + byref(code_units_read), None) + if GetLastError() == ERROR_OPERATION_ABORTED: + # wait for KeyboardInterrupt + time.sleep(0.1) + if not rv: + raise OSError('Windows error: %s' % GetLastError()) + + if buffer[0] == EOF: + return 0 + return 2 * code_units_read.value + + +class _WindowsConsoleWriter(_WindowsConsoleRawIOBase): + + def writable(self): + return True + + @staticmethod + def _get_error_message(errno): + if errno == ERROR_SUCCESS: + return 'ERROR_SUCCESS' + elif errno == ERROR_NOT_ENOUGH_MEMORY: + return 'ERROR_NOT_ENOUGH_MEMORY' + return 'Windows error %s' % errno + + def write(self, b): + bytes_to_be_written = len(b) + buf = get_buffer(b) + code_units_to_be_written = min(bytes_to_be_written, + MAX_BYTES_WRITTEN) // 2 + code_units_written = c_ulong() + + WriteConsoleW(self.handle, buf, code_units_to_be_written, + byref(code_units_written), None) + bytes_written = 2 * code_units_written.value + + if bytes_written == 0 and bytes_to_be_written > 0: + raise OSError(self._get_error_message(GetLastError())) + return bytes_written + + +class ConsoleStream(object): + + def __init__(self, text_stream, byte_stream): + self._text_stream = text_stream + self.buffer = byte_stream + + @property + def name(self): + return self.buffer.name + + def write(self, x): + if isinstance(x, text_type): + return self._text_stream.write(x) + try: + self.flush() + except Exception: + pass + return self.buffer.write(x) + + def writelines(self, lines): + for line in lines: + self.write(line) + + def __getattr__(self, name): + return getattr(self._text_stream, name) + + def isatty(self): + return self.buffer.isatty() + + def __repr__(self): + return '' % ( + self.name, + self.encoding, + ) + + +def _get_text_stdin(buffer_stream): + text_stream = _NonClosingTextIOWrapper( + io.BufferedReader(_WindowsConsoleReader(STDIN_HANDLE)), + 'utf-16-le', 'strict', line_buffering=True) + return ConsoleStream(text_stream, buffer_stream) + + +def _get_text_stdout(buffer_stream): + text_stream = _NonClosingTextIOWrapper( + _WindowsConsoleWriter(STDOUT_HANDLE), + 'utf-16-le', 'strict', line_buffering=True) + return ConsoleStream(text_stream, buffer_stream) + + +def _get_text_stderr(buffer_stream): + text_stream = _NonClosingTextIOWrapper( + _WindowsConsoleWriter(STDERR_HANDLE), + 'utf-16-le', 'strict', line_buffering=True) + return ConsoleStream(text_stream, buffer_stream) + + +if PY2: + def _hash_py_argv(): + return zlib.crc32('\x00'.join(sys.argv[1:])) + + _initial_argv_hash = _hash_py_argv() + + def _get_windows_argv(): + argc = c_int(0) + argv_unicode = CommandLineToArgvW(GetCommandLineW(), byref(argc)) + argv = [argv_unicode[i] for i in range(0, argc.value)] + + if not hasattr(sys, 'frozen'): + argv = argv[1:] + while len(argv) > 0: + arg = argv[0] + if not arg.startswith('-') or arg == '-': + break + argv = argv[1:] + if arg.startswith(('-c', '-m')): + break + + return argv[1:] + + +_stream_factories = { + 0: _get_text_stdin, + 1: _get_text_stdout, + 2: _get_text_stderr, +} + + +def _get_windows_console_stream(f, encoding, errors): + if get_buffer is not None and \ + encoding in ('utf-16-le', None) \ + and errors in ('strict', None) and \ + hasattr(f, 'isatty') and f.isatty(): + func = _stream_factories.get(f.fileno()) + if func is not None: + if not PY2: + f = getattr(f, 'buffer') + if f is None: + return None + else: + # If we are on Python 2 we need to set the stream that we + # deal with to binary mode as otherwise the exercise if a + # bit moot. The same problems apply as for + # get_binary_stdin and friends from _compat. + msvcrt.setmode(f.fileno(), os.O_BINARY) + return func(f) diff --git a/website/web/Lib/site-packages/click/core.py b/website/web/Lib/site-packages/click/core.py new file mode 100644 index 000000000..745645147 --- /dev/null +++ b/website/web/Lib/site-packages/click/core.py @@ -0,0 +1,1744 @@ +import errno +import os +import sys +from contextlib import contextmanager +from itertools import repeat +from functools import update_wrapper + +from .types import convert_type, IntRange, BOOL +from .utils import make_str, make_default_short_help, echo, get_os_args +from .exceptions import ClickException, UsageError, BadParameter, Abort, \ + MissingParameter +from .termui import prompt, confirm +from .formatting import HelpFormatter, join_options +from .parser import OptionParser, split_opt +from .globals import push_context, pop_context + +from ._compat import PY2, isidentifier, iteritems +from ._unicodefun import _check_for_unicode_literals, _verify_python3_env + + +_missing = object() + + +SUBCOMMAND_METAVAR = 'COMMAND [ARGS]...' +SUBCOMMANDS_METAVAR = 'COMMAND1 [ARGS]... [COMMAND2 [ARGS]...]...' + + +def _bashcomplete(cmd, prog_name, complete_var=None): + """Internal handler for the bash completion support.""" + if complete_var is None: + complete_var = '_%s_COMPLETE' % (prog_name.replace('-', '_')).upper() + complete_instr = os.environ.get(complete_var) + if not complete_instr: + return + + from ._bashcomplete import bashcomplete + if bashcomplete(cmd, prog_name, complete_var, complete_instr): + sys.exit(1) + + +def _check_multicommand(base_command, cmd_name, cmd, register=False): + if not base_command.chain or not isinstance(cmd, MultiCommand): + return + if register: + hint = 'It is not possible to add multi commands as children to ' \ + 'another multi command that is in chain mode' + else: + hint = 'Found a multi command as subcommand to a multi command ' \ + 'that is in chain mode. This is not supported' + raise RuntimeError('%s. Command "%s" is set to chain and "%s" was ' + 'added as subcommand but it in itself is a ' + 'multi command. ("%s" is a %s within a chained ' + '%s named "%s"). This restriction was supposed to ' + 'be lifted in 6.0 but the fix was flawed. This ' + 'will be fixed in Click 7.0' % ( + hint, base_command.name, cmd_name, + cmd_name, cmd.__class__.__name__, + base_command.__class__.__name__, + base_command.name)) + + +def batch(iterable, batch_size): + return list(zip(*repeat(iter(iterable), batch_size))) + + +def invoke_param_callback(callback, ctx, param, value): + code = getattr(callback, '__code__', None) + args = getattr(code, 'co_argcount', 3) + + if args < 3: + # This will become a warning in Click 3.0: + from warnings import warn + warn(Warning('Invoked legacy parameter callback "%s". The new ' + 'signature for such callbacks starting with ' + 'click 2.0 is (ctx, param, value).' + % callback), stacklevel=3) + return callback(ctx, value) + return callback(ctx, param, value) + + +@contextmanager +def augment_usage_errors(ctx, param=None): + """Context manager that attaches extra information to exceptions that + fly. + """ + try: + yield + except BadParameter as e: + if e.ctx is None: + e.ctx = ctx + if param is not None and e.param is None: + e.param = param + raise + except UsageError as e: + if e.ctx is None: + e.ctx = ctx + raise + + +def iter_params_for_processing(invocation_order, declaration_order): + """Given a sequence of parameters in the order as should be considered + for processing and an iterable of parameters that exist, this returns + a list in the correct order as they should be processed. + """ + def sort_key(item): + try: + idx = invocation_order.index(item) + except ValueError: + idx = float('inf') + return (not item.is_eager, idx) + + return sorted(declaration_order, key=sort_key) + + +class Context(object): + """The context is a special internal object that holds state relevant + for the script execution at every single level. It's normally invisible + to commands unless they opt-in to getting access to it. + + The context is useful as it can pass internal objects around and can + control special execution features such as reading data from + environment variables. + + A context can be used as context manager in which case it will call + :meth:`close` on teardown. + + .. versionadded:: 2.0 + Added the `resilient_parsing`, `help_option_names`, + `token_normalize_func` parameters. + + .. versionadded:: 3.0 + Added the `allow_extra_args` and `allow_interspersed_args` + parameters. + + .. versionadded:: 4.0 + Added the `color`, `ignore_unknown_options`, and + `max_content_width` parameters. + + :param command: the command class for this context. + :param parent: the parent context. + :param info_name: the info name for this invocation. Generally this + is the most descriptive name for the script or + command. For the toplevel script it is usually + the name of the script, for commands below it it's + the name of the script. + :param obj: an arbitrary object of user data. + :param auto_envvar_prefix: the prefix to use for automatic environment + variables. If this is `None` then reading + from environment variables is disabled. This + does not affect manually set environment + variables which are always read. + :param default_map: a dictionary (like object) with default values + for parameters. + :param terminal_width: the width of the terminal. The default is + inherit from parent context. If no context + defines the terminal width then auto + detection will be applied. + :param max_content_width: the maximum width for content rendered by + Click (this currently only affects help + pages). This defaults to 80 characters if + not overridden. In other words: even if the + terminal is larger than that, Click will not + format things wider than 80 characters by + default. In addition to that, formatters might + add some safety mapping on the right. + :param resilient_parsing: if this flag is enabled then Click will + parse without any interactivity or callback + invocation. This is useful for implementing + things such as completion support. + :param allow_extra_args: if this is set to `True` then extra arguments + at the end will not raise an error and will be + kept on the context. The default is to inherit + from the command. + :param allow_interspersed_args: if this is set to `False` then options + and arguments cannot be mixed. The + default is to inherit from the command. + :param ignore_unknown_options: instructs click to ignore options it does + not know and keeps them for later + processing. + :param help_option_names: optionally a list of strings that define how + the default help parameter is named. The + default is ``['--help']``. + :param token_normalize_func: an optional function that is used to + normalize tokens (options, choices, + etc.). This for instance can be used to + implement case insensitive behavior. + :param color: controls if the terminal supports ANSI colors or not. The + default is autodetection. This is only needed if ANSI + codes are used in texts that Click prints which is by + default not the case. This for instance would affect + help output. + """ + + def __init__(self, command, parent=None, info_name=None, obj=None, + auto_envvar_prefix=None, default_map=None, + terminal_width=None, max_content_width=None, + resilient_parsing=False, allow_extra_args=None, + allow_interspersed_args=None, + ignore_unknown_options=None, help_option_names=None, + token_normalize_func=None, color=None): + #: the parent context or `None` if none exists. + self.parent = parent + #: the :class:`Command` for this context. + self.command = command + #: the descriptive information name + self.info_name = info_name + #: the parsed parameters except if the value is hidden in which + #: case it's not remembered. + self.params = {} + #: the leftover arguments. + self.args = [] + #: protected arguments. These are arguments that are prepended + #: to `args` when certain parsing scenarios are encountered but + #: must be never propagated to another arguments. This is used + #: to implement nested parsing. + self.protected_args = [] + if obj is None and parent is not None: + obj = parent.obj + #: the user object stored. + self.obj = obj + self._meta = getattr(parent, 'meta', {}) + + #: A dictionary (-like object) with defaults for parameters. + if default_map is None \ + and parent is not None \ + and parent.default_map is not None: + default_map = parent.default_map.get(info_name) + self.default_map = default_map + + #: This flag indicates if a subcommand is going to be executed. A + #: group callback can use this information to figure out if it's + #: being executed directly or because the execution flow passes + #: onwards to a subcommand. By default it's None, but it can be + #: the name of the subcommand to execute. + #: + #: If chaining is enabled this will be set to ``'*'`` in case + #: any commands are executed. It is however not possible to + #: figure out which ones. If you require this knowledge you + #: should use a :func:`resultcallback`. + self.invoked_subcommand = None + + if terminal_width is None and parent is not None: + terminal_width = parent.terminal_width + #: The width of the terminal (None is autodetection). + self.terminal_width = terminal_width + + if max_content_width is None and parent is not None: + max_content_width = parent.max_content_width + #: The maximum width of formatted content (None implies a sensible + #: default which is 80 for most things). + self.max_content_width = max_content_width + + if allow_extra_args is None: + allow_extra_args = command.allow_extra_args + #: Indicates if the context allows extra args or if it should + #: fail on parsing. + #: + #: .. versionadded:: 3.0 + self.allow_extra_args = allow_extra_args + + if allow_interspersed_args is None: + allow_interspersed_args = command.allow_interspersed_args + #: Indicates if the context allows mixing of arguments and + #: options or not. + #: + #: .. versionadded:: 3.0 + self.allow_interspersed_args = allow_interspersed_args + + if ignore_unknown_options is None: + ignore_unknown_options = command.ignore_unknown_options + #: Instructs click to ignore options that a command does not + #: understand and will store it on the context for later + #: processing. This is primarily useful for situations where you + #: want to call into external programs. Generally this pattern is + #: strongly discouraged because it's not possibly to losslessly + #: forward all arguments. + #: + #: .. versionadded:: 4.0 + self.ignore_unknown_options = ignore_unknown_options + + if help_option_names is None: + if parent is not None: + help_option_names = parent.help_option_names + else: + help_option_names = ['--help'] + + #: The names for the help options. + self.help_option_names = help_option_names + + if token_normalize_func is None and parent is not None: + token_normalize_func = parent.token_normalize_func + + #: An optional normalization function for tokens. This is + #: options, choices, commands etc. + self.token_normalize_func = token_normalize_func + + #: Indicates if resilient parsing is enabled. In that case Click + #: will do its best to not cause any failures. + self.resilient_parsing = resilient_parsing + + # If there is no envvar prefix yet, but the parent has one and + # the command on this level has a name, we can expand the envvar + # prefix automatically. + if auto_envvar_prefix is None: + if parent is not None \ + and parent.auto_envvar_prefix is not None and \ + self.info_name is not None: + auto_envvar_prefix = '%s_%s' % (parent.auto_envvar_prefix, + self.info_name.upper()) + else: + self.auto_envvar_prefix = auto_envvar_prefix.upper() + self.auto_envvar_prefix = auto_envvar_prefix + + if color is None and parent is not None: + color = parent.color + + #: Controls if styling output is wanted or not. + self.color = color + + self._close_callbacks = [] + self._depth = 0 + + def __enter__(self): + self._depth += 1 + push_context(self) + return self + + def __exit__(self, exc_type, exc_value, tb): + self._depth -= 1 + if self._depth == 0: + self.close() + pop_context() + + @contextmanager + def scope(self, cleanup=True): + """This helper method can be used with the context object to promote + it to the current thread local (see :func:`get_current_context`). + The default behavior of this is to invoke the cleanup functions which + can be disabled by setting `cleanup` to `False`. The cleanup + functions are typically used for things such as closing file handles. + + If the cleanup is intended the context object can also be directly + used as a context manager. + + Example usage:: + + with ctx.scope(): + assert get_current_context() is ctx + + This is equivalent:: + + with ctx: + assert get_current_context() is ctx + + .. versionadded:: 5.0 + + :param cleanup: controls if the cleanup functions should be run or + not. The default is to run these functions. In + some situations the context only wants to be + temporarily pushed in which case this can be disabled. + Nested pushes automatically defer the cleanup. + """ + if not cleanup: + self._depth += 1 + try: + with self as rv: + yield rv + finally: + if not cleanup: + self._depth -= 1 + + @property + def meta(self): + """This is a dictionary which is shared with all the contexts + that are nested. It exists so that click utiltiies can store some + state here if they need to. It is however the responsibility of + that code to manage this dictionary well. + + The keys are supposed to be unique dotted strings. For instance + module paths are a good choice for it. What is stored in there is + irrelevant for the operation of click. However what is important is + that code that places data here adheres to the general semantics of + the system. + + Example usage:: + + LANG_KEY = __name__ + '.lang' + + def set_language(value): + ctx = get_current_context() + ctx.meta[LANG_KEY] = value + + def get_language(): + return get_current_context().meta.get(LANG_KEY, 'en_US') + + .. versionadded:: 5.0 + """ + return self._meta + + def make_formatter(self): + """Creates the formatter for the help and usage output.""" + return HelpFormatter(width=self.terminal_width, + max_width=self.max_content_width) + + def call_on_close(self, f): + """This decorator remembers a function as callback that should be + executed when the context tears down. This is most useful to bind + resource handling to the script execution. For instance, file objects + opened by the :class:`File` type will register their close callbacks + here. + + :param f: the function to execute on teardown. + """ + self._close_callbacks.append(f) + return f + + def close(self): + """Invokes all close callbacks.""" + for cb in self._close_callbacks: + cb() + self._close_callbacks = [] + + @property + def command_path(self): + """The computed command path. This is used for the ``usage`` + information on the help page. It's automatically created by + combining the info names of the chain of contexts to the root. + """ + rv = '' + if self.info_name is not None: + rv = self.info_name + if self.parent is not None: + rv = self.parent.command_path + ' ' + rv + return rv.lstrip() + + def find_root(self): + """Finds the outermost context.""" + node = self + while node.parent is not None: + node = node.parent + return node + + def find_object(self, object_type): + """Finds the closest object of a given type.""" + node = self + while node is not None: + if isinstance(node.obj, object_type): + return node.obj + node = node.parent + + def ensure_object(self, object_type): + """Like :meth:`find_object` but sets the innermost object to a + new instance of `object_type` if it does not exist. + """ + rv = self.find_object(object_type) + if rv is None: + self.obj = rv = object_type() + return rv + + def lookup_default(self, name): + """Looks up the default for a parameter name. This by default + looks into the :attr:`default_map` if available. + """ + if self.default_map is not None: + rv = self.default_map.get(name) + if callable(rv): + rv = rv() + return rv + + def fail(self, message): + """Aborts the execution of the program with a specific error + message. + + :param message: the error message to fail with. + """ + raise UsageError(message, self) + + def abort(self): + """Aborts the script.""" + raise Abort() + + def exit(self, code=0): + """Exits the application with a given exit code.""" + sys.exit(code) + + def get_usage(self): + """Helper method to get formatted usage string for the current + context and command. + """ + return self.command.get_usage(self) + + def get_help(self): + """Helper method to get formatted help page for the current + context and command. + """ + return self.command.get_help(self) + + def invoke(*args, **kwargs): + """Invokes a command callback in exactly the way it expects. There + are two ways to invoke this method: + + 1. the first argument can be a callback and all other arguments and + keyword arguments are forwarded directly to the function. + 2. the first argument is a click command object. In that case all + arguments are forwarded as well but proper click parameters + (options and click arguments) must be keyword arguments and Click + will fill in defaults. + + Note that before Click 3.2 keyword arguments were not properly filled + in against the intention of this code and no context was created. For + more information about this change and why it was done in a bugfix + release see :ref:`upgrade-to-3.2`. + """ + self, callback = args[:2] + ctx = self + + # It's also possible to invoke another command which might or + # might not have a callback. In that case we also fill + # in defaults and make a new context for this command. + if isinstance(callback, Command): + other_cmd = callback + callback = other_cmd.callback + ctx = Context(other_cmd, info_name=other_cmd.name, parent=self) + if callback is None: + raise TypeError('The given command does not have a ' + 'callback that can be invoked.') + + for param in other_cmd.params: + if param.name not in kwargs and param.expose_value: + kwargs[param.name] = param.get_default(ctx) + + args = args[2:] + with augment_usage_errors(self): + with ctx: + return callback(*args, **kwargs) + + def forward(*args, **kwargs): + """Similar to :meth:`invoke` but fills in default keyword + arguments from the current context if the other command expects + it. This cannot invoke callbacks directly, only other commands. + """ + self, cmd = args[:2] + + # It's also possible to invoke another command which might or + # might not have a callback. + if not isinstance(cmd, Command): + raise TypeError('Callback is not a command.') + + for param in self.params: + if param not in kwargs: + kwargs[param] = self.params[param] + + return self.invoke(cmd, **kwargs) + + +class BaseCommand(object): + """The base command implements the minimal API contract of commands. + Most code will never use this as it does not implement a lot of useful + functionality but it can act as the direct subclass of alternative + parsing methods that do not depend on the Click parser. + + For instance, this can be used to bridge Click and other systems like + argparse or docopt. + + Because base commands do not implement a lot of the API that other + parts of Click take for granted, they are not supported for all + operations. For instance, they cannot be used with the decorators + usually and they have no built-in callback system. + + .. versionchanged:: 2.0 + Added the `context_settings` parameter. + + :param name: the name of the command to use unless a group overrides it. + :param context_settings: an optional dictionary with defaults that are + passed to the context object. + """ + #: the default for the :attr:`Context.allow_extra_args` flag. + allow_extra_args = False + #: the default for the :attr:`Context.allow_interspersed_args` flag. + allow_interspersed_args = True + #: the default for the :attr:`Context.ignore_unknown_options` flag. + ignore_unknown_options = False + + def __init__(self, name, context_settings=None): + #: the name the command thinks it has. Upon registering a command + #: on a :class:`Group` the group will default the command name + #: with this information. You should instead use the + #: :class:`Context`\'s :attr:`~Context.info_name` attribute. + self.name = name + if context_settings is None: + context_settings = {} + #: an optional dictionary with defaults passed to the context. + self.context_settings = context_settings + + def get_usage(self, ctx): + raise NotImplementedError('Base commands cannot get usage') + + def get_help(self, ctx): + raise NotImplementedError('Base commands cannot get help') + + def make_context(self, info_name, args, parent=None, **extra): + """This function when given an info name and arguments will kick + off the parsing and create a new :class:`Context`. It does not + invoke the actual command callback though. + + :param info_name: the info name for this invokation. Generally this + is the most descriptive name for the script or + command. For the toplevel script it's usually + the name of the script, for commands below it it's + the name of the script. + :param args: the arguments to parse as list of strings. + :param parent: the parent context if available. + :param extra: extra keyword arguments forwarded to the context + constructor. + """ + for key, value in iteritems(self.context_settings): + if key not in extra: + extra[key] = value + ctx = Context(self, info_name=info_name, parent=parent, **extra) + with ctx.scope(cleanup=False): + self.parse_args(ctx, args) + return ctx + + def parse_args(self, ctx, args): + """Given a context and a list of arguments this creates the parser + and parses the arguments, then modifies the context as necessary. + This is automatically invoked by :meth:`make_context`. + """ + raise NotImplementedError('Base commands do not know how to parse ' + 'arguments.') + + def invoke(self, ctx): + """Given a context, this invokes the command. The default + implementation is raising a not implemented error. + """ + raise NotImplementedError('Base commands are not invokable by default') + + def main(self, args=None, prog_name=None, complete_var=None, + standalone_mode=True, **extra): + """This is the way to invoke a script with all the bells and + whistles as a command line application. This will always terminate + the application after a call. If this is not wanted, ``SystemExit`` + needs to be caught. + + This method is also available by directly calling the instance of + a :class:`Command`. + + .. versionadded:: 3.0 + Added the `standalone_mode` flag to control the standalone mode. + + :param args: the arguments that should be used for parsing. If not + provided, ``sys.argv[1:]`` is used. + :param prog_name: the program name that should be used. By default + the program name is constructed by taking the file + name from ``sys.argv[0]``. + :param complete_var: the environment variable that controls the + bash completion support. The default is + ``"__COMPLETE"`` with prog name in + uppercase. + :param standalone_mode: the default behavior is to invoke the script + in standalone mode. Click will then + handle exceptions and convert them into + error messages and the function will never + return but shut down the interpreter. If + this is set to `False` they will be + propagated to the caller and the return + value of this function is the return value + of :meth:`invoke`. + :param extra: extra keyword arguments are forwarded to the context + constructor. See :class:`Context` for more information. + """ + # If we are in Python 3, we will verify that the environment is + # sane at this point of reject further execution to avoid a + # broken script. + if not PY2: + _verify_python3_env() + else: + _check_for_unicode_literals() + + if args is None: + args = get_os_args() + else: + args = list(args) + + if prog_name is None: + prog_name = make_str(os.path.basename( + sys.argv and sys.argv[0] or __file__)) + + # Hook for the Bash completion. This only activates if the Bash + # completion is actually enabled, otherwise this is quite a fast + # noop. + _bashcomplete(self, prog_name, complete_var) + + try: + try: + with self.make_context(prog_name, args, **extra) as ctx: + rv = self.invoke(ctx) + if not standalone_mode: + return rv + ctx.exit() + except (EOFError, KeyboardInterrupt): + echo(file=sys.stderr) + raise Abort() + except ClickException as e: + if not standalone_mode: + raise + e.show() + sys.exit(e.exit_code) + except IOError as e: + if e.errno == errno.EPIPE: + sys.exit(1) + else: + raise + except Abort: + if not standalone_mode: + raise + echo('Aborted!', file=sys.stderr) + sys.exit(1) + + def __call__(self, *args, **kwargs): + """Alias for :meth:`main`.""" + return self.main(*args, **kwargs) + + +class Command(BaseCommand): + """Commands are the basic building block of command line interfaces in + Click. A basic command handles command line parsing and might dispatch + more parsing to commands nested below it. + + .. versionchanged:: 2.0 + Added the `context_settings` parameter. + + :param name: the name of the command to use unless a group overrides it. + :param context_settings: an optional dictionary with defaults that are + passed to the context object. + :param callback: the callback to invoke. This is optional. + :param params: the parameters to register with this command. This can + be either :class:`Option` or :class:`Argument` objects. + :param help: the help string to use for this command. + :param epilog: like the help string but it's printed at the end of the + help page after everything else. + :param short_help: the short help to use for this command. This is + shown on the command listing of the parent command. + :param add_help_option: by default each command registers a ``--help`` + option. This can be disabled by this parameter. + """ + + def __init__(self, name, context_settings=None, callback=None, + params=None, help=None, epilog=None, short_help=None, + options_metavar='[OPTIONS]', add_help_option=True): + BaseCommand.__init__(self, name, context_settings) + #: the callback to execute when the command fires. This might be + #: `None` in which case nothing happens. + self.callback = callback + #: the list of parameters for this command in the order they + #: should show up in the help page and execute. Eager parameters + #: will automatically be handled before non eager ones. + self.params = params or [] + self.help = help + self.epilog = epilog + self.options_metavar = options_metavar + if short_help is None and help: + short_help = make_default_short_help(help) + self.short_help = short_help + self.add_help_option = add_help_option + + def get_usage(self, ctx): + formatter = ctx.make_formatter() + self.format_usage(ctx, formatter) + return formatter.getvalue().rstrip('\n') + + def get_params(self, ctx): + rv = self.params + help_option = self.get_help_option(ctx) + if help_option is not None: + rv = rv + [help_option] + return rv + + def format_usage(self, ctx, formatter): + """Writes the usage line into the formatter.""" + pieces = self.collect_usage_pieces(ctx) + formatter.write_usage(ctx.command_path, ' '.join(pieces)) + + def collect_usage_pieces(self, ctx): + """Returns all the pieces that go into the usage line and returns + it as a list of strings. + """ + rv = [self.options_metavar] + for param in self.get_params(ctx): + rv.extend(param.get_usage_pieces(ctx)) + return rv + + def get_help_option_names(self, ctx): + """Returns the names for the help option.""" + all_names = set(ctx.help_option_names) + for param in self.params: + all_names.difference_update(param.opts) + all_names.difference_update(param.secondary_opts) + return all_names + + def get_help_option(self, ctx): + """Returns the help option object.""" + help_options = self.get_help_option_names(ctx) + if not help_options or not self.add_help_option: + return + + def show_help(ctx, param, value): + if value and not ctx.resilient_parsing: + echo(ctx.get_help(), color=ctx.color) + ctx.exit() + return Option(help_options, is_flag=True, + is_eager=True, expose_value=False, + callback=show_help, + help='Show this message and exit.') + + def make_parser(self, ctx): + """Creates the underlying option parser for this command.""" + parser = OptionParser(ctx) + parser.allow_interspersed_args = ctx.allow_interspersed_args + parser.ignore_unknown_options = ctx.ignore_unknown_options + for param in self.get_params(ctx): + param.add_to_parser(parser, ctx) + return parser + + def get_help(self, ctx): + """Formats the help into a string and returns it. This creates a + formatter and will call into the following formatting methods: + """ + formatter = ctx.make_formatter() + self.format_help(ctx, formatter) + return formatter.getvalue().rstrip('\n') + + def format_help(self, ctx, formatter): + """Writes the help into the formatter if it exists. + + This calls into the following methods: + + - :meth:`format_usage` + - :meth:`format_help_text` + - :meth:`format_options` + - :meth:`format_epilog` + """ + self.format_usage(ctx, formatter) + self.format_help_text(ctx, formatter) + self.format_options(ctx, formatter) + self.format_epilog(ctx, formatter) + + def format_help_text(self, ctx, formatter): + """Writes the help text to the formatter if it exists.""" + if self.help: + formatter.write_paragraph() + with formatter.indentation(): + formatter.write_text(self.help) + + def format_options(self, ctx, formatter): + """Writes all the options into the formatter if they exist.""" + opts = [] + for param in self.get_params(ctx): + rv = param.get_help_record(ctx) + if rv is not None: + opts.append(rv) + + if opts: + with formatter.section('Options'): + formatter.write_dl(opts) + + def format_epilog(self, ctx, formatter): + """Writes the epilog into the formatter if it exists.""" + if self.epilog: + formatter.write_paragraph() + with formatter.indentation(): + formatter.write_text(self.epilog) + + def parse_args(self, ctx, args): + parser = self.make_parser(ctx) + opts, args, param_order = parser.parse_args(args=args) + + for param in iter_params_for_processing( + param_order, self.get_params(ctx)): + value, args = param.handle_parse_result(ctx, opts, args) + + if args and not ctx.allow_extra_args and not ctx.resilient_parsing: + ctx.fail('Got unexpected extra argument%s (%s)' + % (len(args) != 1 and 's' or '', + ' '.join(map(make_str, args)))) + + ctx.args = args + return args + + def invoke(self, ctx): + """Given a context, this invokes the attached callback (if it exists) + in the right way. + """ + if self.callback is not None: + return ctx.invoke(self.callback, **ctx.params) + + +class MultiCommand(Command): + """A multi command is the basic implementation of a command that + dispatches to subcommands. The most common version is the + :class:`Group`. + + :param invoke_without_command: this controls how the multi command itself + is invoked. By default it's only invoked + if a subcommand is provided. + :param no_args_is_help: this controls what happens if no arguments are + provided. This option is enabled by default if + `invoke_without_command` is disabled or disabled + if it's enabled. If enabled this will add + ``--help`` as argument if no arguments are + passed. + :param subcommand_metavar: the string that is used in the documentation + to indicate the subcommand place. + :param chain: if this is set to `True` chaining of multiple subcommands + is enabled. This restricts the form of commands in that + they cannot have optional arguments but it allows + multiple commands to be chained together. + :param result_callback: the result callback to attach to this multi + command. + """ + allow_extra_args = True + allow_interspersed_args = False + + def __init__(self, name=None, invoke_without_command=False, + no_args_is_help=None, subcommand_metavar=None, + chain=False, result_callback=None, **attrs): + Command.__init__(self, name, **attrs) + if no_args_is_help is None: + no_args_is_help = not invoke_without_command + self.no_args_is_help = no_args_is_help + self.invoke_without_command = invoke_without_command + if subcommand_metavar is None: + if chain: + subcommand_metavar = SUBCOMMANDS_METAVAR + else: + subcommand_metavar = SUBCOMMAND_METAVAR + self.subcommand_metavar = subcommand_metavar + self.chain = chain + #: The result callback that is stored. This can be set or + #: overridden with the :func:`resultcallback` decorator. + self.result_callback = result_callback + + if self.chain: + for param in self.params: + if isinstance(param, Argument) and not param.required: + raise RuntimeError('Multi commands in chain mode cannot ' + 'have optional arguments.') + + def collect_usage_pieces(self, ctx): + rv = Command.collect_usage_pieces(self, ctx) + rv.append(self.subcommand_metavar) + return rv + + def format_options(self, ctx, formatter): + Command.format_options(self, ctx, formatter) + self.format_commands(ctx, formatter) + + def resultcallback(self, replace=False): + """Adds a result callback to the chain command. By default if a + result callback is already registered this will chain them but + this can be disabled with the `replace` parameter. The result + callback is invoked with the return value of the subcommand + (or the list of return values from all subcommands if chaining + is enabled) as well as the parameters as they would be passed + to the main callback. + + Example:: + + @click.group() + @click.option('-i', '--input', default=23) + def cli(input): + return 42 + + @cli.resultcallback() + def process_result(result, input): + return result + input + + .. versionadded:: 3.0 + + :param replace: if set to `True` an already existing result + callback will be removed. + """ + def decorator(f): + old_callback = self.result_callback + if old_callback is None or replace: + self.result_callback = f + return f + def function(__value, *args, **kwargs): + return f(old_callback(__value, *args, **kwargs), + *args, **kwargs) + self.result_callback = rv = update_wrapper(function, f) + return rv + return decorator + + def format_commands(self, ctx, formatter): + """Extra format methods for multi methods that adds all the commands + after the options. + """ + rows = [] + for subcommand in self.list_commands(ctx): + cmd = self.get_command(ctx, subcommand) + # What is this, the tool lied about a command. Ignore it + if cmd is None: + continue + + help = cmd.short_help or '' + rows.append((subcommand, help)) + + if rows: + with formatter.section('Commands'): + formatter.write_dl(rows) + + def parse_args(self, ctx, args): + if not args and self.no_args_is_help and not ctx.resilient_parsing: + echo(ctx.get_help(), color=ctx.color) + ctx.exit() + + rest = Command.parse_args(self, ctx, args) + if self.chain: + ctx.protected_args = rest + ctx.args = [] + elif rest: + ctx.protected_args, ctx.args = rest[:1], rest[1:] + + return ctx.args + + def invoke(self, ctx): + def _process_result(value): + if self.result_callback is not None: + value = ctx.invoke(self.result_callback, value, + **ctx.params) + return value + + if not ctx.protected_args: + # If we are invoked without command the chain flag controls + # how this happens. If we are not in chain mode, the return + # value here is the return value of the command. + # If however we are in chain mode, the return value is the + # return value of the result processor invoked with an empty + # list (which means that no subcommand actually was executed). + if self.invoke_without_command: + if not self.chain: + return Command.invoke(self, ctx) + with ctx: + Command.invoke(self, ctx) + return _process_result([]) + ctx.fail('Missing command.') + + # Fetch args back out + args = ctx.protected_args + ctx.args + ctx.args = [] + ctx.protected_args = [] + + # If we're not in chain mode, we only allow the invocation of a + # single command but we also inform the current context about the + # name of the command to invoke. + if not self.chain: + # Make sure the context is entered so we do not clean up + # resources until the result processor has worked. + with ctx: + cmd_name, cmd, args = self.resolve_command(ctx, args) + ctx.invoked_subcommand = cmd_name + Command.invoke(self, ctx) + sub_ctx = cmd.make_context(cmd_name, args, parent=ctx) + with sub_ctx: + return _process_result(sub_ctx.command.invoke(sub_ctx)) + + # In chain mode we create the contexts step by step, but after the + # base command has been invoked. Because at that point we do not + # know the subcommands yet, the invoked subcommand attribute is + # set to ``*`` to inform the command that subcommands are executed + # but nothing else. + with ctx: + ctx.invoked_subcommand = args and '*' or None + Command.invoke(self, ctx) + + # Otherwise we make every single context and invoke them in a + # chain. In that case the return value to the result processor + # is the list of all invoked subcommand's results. + contexts = [] + while args: + cmd_name, cmd, args = self.resolve_command(ctx, args) + sub_ctx = cmd.make_context(cmd_name, args, parent=ctx, + allow_extra_args=True, + allow_interspersed_args=False) + contexts.append(sub_ctx) + args, sub_ctx.args = sub_ctx.args, [] + + rv = [] + for sub_ctx in contexts: + with sub_ctx: + rv.append(sub_ctx.command.invoke(sub_ctx)) + return _process_result(rv) + + def resolve_command(self, ctx, args): + cmd_name = make_str(args[0]) + original_cmd_name = cmd_name + + # Get the command + cmd = self.get_command(ctx, cmd_name) + + # If we can't find the command but there is a normalization + # function available, we try with that one. + if cmd is None and ctx.token_normalize_func is not None: + cmd_name = ctx.token_normalize_func(cmd_name) + cmd = self.get_command(ctx, cmd_name) + + # If we don't find the command we want to show an error message + # to the user that it was not provided. However, there is + # something else we should do: if the first argument looks like + # an option we want to kick off parsing again for arguments to + # resolve things like --help which now should go to the main + # place. + if cmd is None: + if split_opt(cmd_name)[0]: + self.parse_args(ctx, ctx.args) + ctx.fail('No such command "%s".' % original_cmd_name) + + return cmd_name, cmd, args[1:] + + def get_command(self, ctx, cmd_name): + """Given a context and a command name, this returns a + :class:`Command` object if it exists or returns `None`. + """ + raise NotImplementedError() + + def list_commands(self, ctx): + """Returns a list of subcommand names in the order they should + appear. + """ + return [] + + +class Group(MultiCommand): + """A group allows a command to have subcommands attached. This is the + most common way to implement nesting in Click. + + :param commands: a dictionary of commands. + """ + + def __init__(self, name=None, commands=None, **attrs): + MultiCommand.__init__(self, name, **attrs) + #: the registered subcommands by their exported names. + self.commands = commands or {} + + def add_command(self, cmd, name=None): + """Registers another :class:`Command` with this group. If the name + is not provided, the name of the command is used. + """ + name = name or cmd.name + if name is None: + raise TypeError('Command has no name.') + _check_multicommand(self, name, cmd, register=True) + self.commands[name] = cmd + + def command(self, *args, **kwargs): + """A shortcut decorator for declaring and attaching a command to + the group. This takes the same arguments as :func:`command` but + immediately registers the created command with this instance by + calling into :meth:`add_command`. + """ + def decorator(f): + cmd = command(*args, **kwargs)(f) + self.add_command(cmd) + return cmd + return decorator + + def group(self, *args, **kwargs): + """A shortcut decorator for declaring and attaching a group to + the group. This takes the same arguments as :func:`group` but + immediately registers the created command with this instance by + calling into :meth:`add_command`. + """ + def decorator(f): + cmd = group(*args, **kwargs)(f) + self.add_command(cmd) + return cmd + return decorator + + def get_command(self, ctx, cmd_name): + return self.commands.get(cmd_name) + + def list_commands(self, ctx): + return sorted(self.commands) + + +class CommandCollection(MultiCommand): + """A command collection is a multi command that merges multiple multi + commands together into one. This is a straightforward implementation + that accepts a list of different multi commands as sources and + provides all the commands for each of them. + """ + + def __init__(self, name=None, sources=None, **attrs): + MultiCommand.__init__(self, name, **attrs) + #: The list of registered multi commands. + self.sources = sources or [] + + def add_source(self, multi_cmd): + """Adds a new multi command to the chain dispatcher.""" + self.sources.append(multi_cmd) + + def get_command(self, ctx, cmd_name): + for source in self.sources: + rv = source.get_command(ctx, cmd_name) + if rv is not None: + if self.chain: + _check_multicommand(self, cmd_name, rv) + return rv + + def list_commands(self, ctx): + rv = set() + for source in self.sources: + rv.update(source.list_commands(ctx)) + return sorted(rv) + + +class Parameter(object): + """A parameter to a command comes in two versions: they are either + :class:`Option`\s or :class:`Argument`\s. Other subclasses are currently + not supported by design as some of the internals for parsing are + intentionally not finalized. + + Some settings are supported by both options and arguments. + + .. versionchanged:: 2.0 + Changed signature for parameter callback to also be passed the + parameter. In Click 2.0, the old callback format will still work, + but it will raise a warning to give you change to migrate the + code easier. + + :param param_decls: the parameter declarations for this option or + argument. This is a list of flags or argument + names. + :param type: the type that should be used. Either a :class:`ParamType` + or a Python type. The later is converted into the former + automatically if supported. + :param required: controls if this is optional or not. + :param default: the default value if omitted. This can also be a callable, + in which case it's invoked when the default is needed + without any arguments. + :param callback: a callback that should be executed after the parameter + was matched. This is called as ``fn(ctx, param, + value)`` and needs to return the value. Before Click + 2.0, the signature was ``(ctx, value)``. + :param nargs: the number of arguments to match. If not ``1`` the return + value is a tuple instead of single value. The default for + nargs is ``1`` (except if the type is a tuple, then it's + the arity of the tuple). + :param metavar: how the value is represented in the help page. + :param expose_value: if this is `True` then the value is passed onwards + to the command callback and stored on the context, + otherwise it's skipped. + :param is_eager: eager values are processed before non eager ones. This + should not be set for arguments or it will inverse the + order of processing. + :param envvar: a string or list of strings that are environment variables + that should be checked. + """ + param_type_name = 'parameter' + + def __init__(self, param_decls=None, type=None, required=False, + default=None, callback=None, nargs=None, metavar=None, + expose_value=True, is_eager=False, envvar=None): + self.name, self.opts, self.secondary_opts = \ + self._parse_decls(param_decls or (), expose_value) + + self.type = convert_type(type, default) + + # Default nargs to what the type tells us if we have that + # information available. + if nargs is None: + if self.type.is_composite: + nargs = self.type.arity + else: + nargs = 1 + + self.required = required + self.callback = callback + self.nargs = nargs + self.multiple = False + self.expose_value = expose_value + self.default = default + self.is_eager = is_eager + self.metavar = metavar + self.envvar = envvar + + @property + def human_readable_name(self): + """Returns the human readable name of this parameter. This is the + same as the name for options, but the metavar for arguments. + """ + return self.name + + def make_metavar(self): + if self.metavar is not None: + return self.metavar + metavar = self.type.get_metavar(self) + if metavar is None: + metavar = self.type.name.upper() + if self.nargs != 1: + metavar += '...' + return metavar + + def get_default(self, ctx): + """Given a context variable this calculates the default value.""" + # Otherwise go with the regular default. + if callable(self.default): + rv = self.default() + else: + rv = self.default + return self.type_cast_value(ctx, rv) + + def add_to_parser(self, parser, ctx): + pass + + def consume_value(self, ctx, opts): + value = opts.get(self.name) + if value is None: + value = ctx.lookup_default(self.name) + if value is None: + value = self.value_from_envvar(ctx) + return value + + def type_cast_value(self, ctx, value): + """Given a value this runs it properly through the type system. + This automatically handles things like `nargs` and `multiple` as + well as composite types. + """ + if self.type.is_composite: + if self.nargs <= 1: + raise TypeError('Attempted to invoke composite type ' + 'but nargs has been set to %s. This is ' + 'not supported; nargs needs to be set to ' + 'a fixed value > 1.' % self.nargs) + if self.multiple: + return tuple(self.type(x or (), self, ctx) for x in value or ()) + return self.type(value or (), self, ctx) + + def _convert(value, level): + if level == 0: + return self.type(value, self, ctx) + return tuple(_convert(x, level - 1) for x in value or ()) + return _convert(value, (self.nargs != 1) + bool(self.multiple)) + + def process_value(self, ctx, value): + """Given a value and context this runs the logic to convert the + value as necessary. + """ + # If the value we were given is None we do nothing. This way + # code that calls this can easily figure out if something was + # not provided. Otherwise it would be converted into an empty + # tuple for multiple invocations which is inconvenient. + if value is not None: + return self.type_cast_value(ctx, value) + + def value_is_missing(self, value): + if value is None: + return True + if (self.nargs != 1 or self.multiple) and value == (): + return True + return False + + def full_process_value(self, ctx, value): + value = self.process_value(ctx, value) + + if value is None: + value = self.get_default(ctx) + + if self.required and self.value_is_missing(value): + raise MissingParameter(ctx=ctx, param=self) + + return value + + def resolve_envvar_value(self, ctx): + if self.envvar is None: + return + if isinstance(self.envvar, (tuple, list)): + for envvar in self.envvar: + rv = os.environ.get(envvar) + if rv is not None: + return rv + else: + return os.environ.get(self.envvar) + + def value_from_envvar(self, ctx): + rv = self.resolve_envvar_value(ctx) + if rv is not None and self.nargs != 1: + rv = self.type.split_envvar_value(rv) + return rv + + def handle_parse_result(self, ctx, opts, args): + with augment_usage_errors(ctx, param=self): + value = self.consume_value(ctx, opts) + try: + value = self.full_process_value(ctx, value) + except Exception: + if not ctx.resilient_parsing: + raise + value = None + if self.callback is not None: + try: + value = invoke_param_callback( + self.callback, ctx, self, value) + except Exception: + if not ctx.resilient_parsing: + raise + + if self.expose_value: + ctx.params[self.name] = value + return value, args + + def get_help_record(self, ctx): + pass + + def get_usage_pieces(self, ctx): + return [] + + +class Option(Parameter): + """Options are usually optional values on the command line and + have some extra features that arguments don't have. + + All other parameters are passed onwards to the parameter constructor. + + :param show_default: controls if the default value should be shown on the + help page. Normally, defaults are not shown. + :param prompt: if set to `True` or a non empty string then the user will + be prompted for input if not set. If set to `True` the + prompt will be the option name capitalized. + :param confirmation_prompt: if set then the value will need to be confirmed + if it was prompted for. + :param hide_input: if this is `True` then the input on the prompt will be + hidden from the user. This is useful for password + input. + :param is_flag: forces this option to act as a flag. The default is + auto detection. + :param flag_value: which value should be used for this flag if it's + enabled. This is set to a boolean automatically if + the option string contains a slash to mark two options. + :param multiple: if this is set to `True` then the argument is accepted + multiple times and recorded. This is similar to ``nargs`` + in how it works but supports arbitrary number of + arguments. + :param count: this flag makes an option increment an integer. + :param allow_from_autoenv: if this is enabled then the value of this + parameter will be pulled from an environment + variable in case a prefix is defined on the + context. + :param help: the help string. + """ + param_type_name = 'option' + + def __init__(self, param_decls=None, show_default=False, + prompt=False, confirmation_prompt=False, + hide_input=False, is_flag=None, flag_value=None, + multiple=False, count=False, allow_from_autoenv=True, + type=None, help=None, **attrs): + default_is_missing = attrs.get('default', _missing) is _missing + Parameter.__init__(self, param_decls, type=type, **attrs) + + if prompt is True: + prompt_text = self.name.replace('_', ' ').capitalize() + elif prompt is False: + prompt_text = None + else: + prompt_text = prompt + self.prompt = prompt_text + self.confirmation_prompt = confirmation_prompt + self.hide_input = hide_input + + # Flags + if is_flag is None: + if flag_value is not None: + is_flag = True + else: + is_flag = bool(self.secondary_opts) + if is_flag and default_is_missing: + self.default = False + if flag_value is None: + flag_value = not self.default + self.is_flag = is_flag + self.flag_value = flag_value + if self.is_flag and isinstance(self.flag_value, bool) \ + and type is None: + self.type = BOOL + self.is_bool_flag = True + else: + self.is_bool_flag = False + + # Counting + self.count = count + if count: + if type is None: + self.type = IntRange(min=0) + if default_is_missing: + self.default = 0 + + self.multiple = multiple + self.allow_from_autoenv = allow_from_autoenv + self.help = help + self.show_default = show_default + + # Sanity check for stuff we don't support + if __debug__: + if self.nargs < 0: + raise TypeError('Options cannot have nargs < 0') + if self.prompt and self.is_flag and not self.is_bool_flag: + raise TypeError('Cannot prompt for flags that are not bools.') + if not self.is_bool_flag and self.secondary_opts: + raise TypeError('Got secondary option for non boolean flag.') + if self.is_bool_flag and self.hide_input \ + and self.prompt is not None: + raise TypeError('Hidden input does not work with boolean ' + 'flag prompts.') + if self.count: + if self.multiple: + raise TypeError('Options cannot be multiple and count ' + 'at the same time.') + elif self.is_flag: + raise TypeError('Options cannot be count and flags at ' + 'the same time.') + + def _parse_decls(self, decls, expose_value): + opts = [] + secondary_opts = [] + name = None + possible_names = [] + + for decl in decls: + if isidentifier(decl): + if name is not None: + raise TypeError('Name defined twice') + name = decl + else: + split_char = decl[:1] == '/' and ';' or '/' + if split_char in decl: + first, second = decl.split(split_char, 1) + first = first.rstrip() + if first: + possible_names.append(split_opt(first)) + opts.append(first) + second = second.lstrip() + if second: + secondary_opts.append(second.lstrip()) + else: + possible_names.append(split_opt(decl)) + opts.append(decl) + + if name is None and possible_names: + possible_names.sort(key=lambda x: len(x[0])) + name = possible_names[-1][1].replace('-', '_').lower() + if not isidentifier(name): + name = None + + if name is None: + if not expose_value: + return None, opts, secondary_opts + raise TypeError('Could not determine name for option') + + if not opts and not secondary_opts: + raise TypeError('No options defined but a name was passed (%s). ' + 'Did you mean to declare an argument instead ' + 'of an option?' % name) + + return name, opts, secondary_opts + + def add_to_parser(self, parser, ctx): + kwargs = { + 'dest': self.name, + 'nargs': self.nargs, + 'obj': self, + } + + if self.multiple: + action = 'append' + elif self.count: + action = 'count' + else: + action = 'store' + + if self.is_flag: + kwargs.pop('nargs', None) + if self.is_bool_flag and self.secondary_opts: + parser.add_option(self.opts, action=action + '_const', + const=True, **kwargs) + parser.add_option(self.secondary_opts, action=action + + '_const', const=False, **kwargs) + else: + parser.add_option(self.opts, action=action + '_const', + const=self.flag_value, + **kwargs) + else: + kwargs['action'] = action + parser.add_option(self.opts, **kwargs) + + def get_help_record(self, ctx): + any_prefix_is_slash = [] + + def _write_opts(opts): + rv, any_slashes = join_options(opts) + if any_slashes: + any_prefix_is_slash[:] = [True] + if not self.is_flag and not self.count: + rv += ' ' + self.make_metavar() + return rv + + rv = [_write_opts(self.opts)] + if self.secondary_opts: + rv.append(_write_opts(self.secondary_opts)) + + help = self.help or '' + extra = [] + if self.default is not None and self.show_default: + extra.append('default: %s' % ( + ', '.join('%s' % d for d in self.default) + if isinstance(self.default, (list, tuple)) + else self.default, )) + if self.required: + extra.append('required') + if extra: + help = '%s[%s]' % (help and help + ' ' or '', '; '.join(extra)) + + return ((any_prefix_is_slash and '; ' or ' / ').join(rv), help) + + def get_default(self, ctx): + # If we're a non boolean flag out default is more complex because + # we need to look at all flags in the same group to figure out + # if we're the the default one in which case we return the flag + # value as default. + if self.is_flag and not self.is_bool_flag: + for param in ctx.command.params: + if param.name == self.name and param.default: + return param.flag_value + return None + return Parameter.get_default(self, ctx) + + def prompt_for_value(self, ctx): + """This is an alternative flow that can be activated in the full + value processing if a value does not exist. It will prompt the + user until a valid value exists and then returns the processed + value as result. + """ + # Calculate the default before prompting anything to be stable. + default = self.get_default(ctx) + + # If this is a prompt for a flag we need to handle this + # differently. + if self.is_bool_flag: + return confirm(self.prompt, default) + + return prompt(self.prompt, default=default, + hide_input=self.hide_input, + confirmation_prompt=self.confirmation_prompt, + value_proc=lambda x: self.process_value(ctx, x)) + + def resolve_envvar_value(self, ctx): + rv = Parameter.resolve_envvar_value(self, ctx) + if rv is not None: + return rv + if self.allow_from_autoenv and \ + ctx.auto_envvar_prefix is not None: + envvar = '%s_%s' % (ctx.auto_envvar_prefix, self.name.upper()) + return os.environ.get(envvar) + + def value_from_envvar(self, ctx): + rv = self.resolve_envvar_value(ctx) + if rv is None: + return None + value_depth = (self.nargs != 1) + bool(self.multiple) + if value_depth > 0 and rv is not None: + rv = self.type.split_envvar_value(rv) + if self.multiple and self.nargs != 1: + rv = batch(rv, self.nargs) + return rv + + def full_process_value(self, ctx, value): + if value is None and self.prompt is not None \ + and not ctx.resilient_parsing: + return self.prompt_for_value(ctx) + return Parameter.full_process_value(self, ctx, value) + + +class Argument(Parameter): + """Arguments are positional parameters to a command. They generally + provide fewer features than options but can have infinite ``nargs`` + and are required by default. + + All parameters are passed onwards to the parameter constructor. + """ + param_type_name = 'argument' + + def __init__(self, param_decls, required=None, **attrs): + if required is None: + if attrs.get('default') is not None: + required = False + else: + required = attrs.get('nargs', 1) > 0 + Parameter.__init__(self, param_decls, required=required, **attrs) + if self.default is not None and self.nargs < 0: + raise TypeError('nargs=-1 in combination with a default value ' + 'is not supported.') + + @property + def human_readable_name(self): + if self.metavar is not None: + return self.metavar + return self.name.upper() + + def make_metavar(self): + if self.metavar is not None: + return self.metavar + var = self.name.upper() + if not self.required: + var = '[%s]' % var + if self.nargs != 1: + var += '...' + return var + + def _parse_decls(self, decls, expose_value): + if not decls: + if not expose_value: + return None, [], [] + raise TypeError('Could not determine name for argument') + if len(decls) == 1: + name = arg = decls[0] + name = name.replace('-', '_').lower() + elif len(decls) == 2: + name, arg = decls + else: + raise TypeError('Arguments take exactly one or two ' + 'parameter declarations, got %d' % len(decls)) + return name, [arg], [] + + def get_usage_pieces(self, ctx): + return [self.make_metavar()] + + def add_to_parser(self, parser, ctx): + parser.add_argument(dest=self.name, nargs=self.nargs, + obj=self) + + +# Circular dependency between decorators and core +from .decorators import command, group diff --git a/website/web/Lib/site-packages/click/decorators.py b/website/web/Lib/site-packages/click/decorators.py new file mode 100644 index 000000000..989345265 --- /dev/null +++ b/website/web/Lib/site-packages/click/decorators.py @@ -0,0 +1,304 @@ +import sys +import inspect + +from functools import update_wrapper + +from ._compat import iteritems +from ._unicodefun import _check_for_unicode_literals +from .utils import echo +from .globals import get_current_context + + +def pass_context(f): + """Marks a callback as wanting to receive the current context + object as first argument. + """ + def new_func(*args, **kwargs): + return f(get_current_context(), *args, **kwargs) + return update_wrapper(new_func, f) + + +def pass_obj(f): + """Similar to :func:`pass_context`, but only pass the object on the + context onwards (:attr:`Context.obj`). This is useful if that object + represents the state of a nested system. + """ + def new_func(*args, **kwargs): + return f(get_current_context().obj, *args, **kwargs) + return update_wrapper(new_func, f) + + +def make_pass_decorator(object_type, ensure=False): + """Given an object type this creates a decorator that will work + similar to :func:`pass_obj` but instead of passing the object of the + current context, it will find the innermost context of type + :func:`object_type`. + + This generates a decorator that works roughly like this:: + + from functools import update_wrapper + + def decorator(f): + @pass_context + def new_func(ctx, *args, **kwargs): + obj = ctx.find_object(object_type) + return ctx.invoke(f, obj, *args, **kwargs) + return update_wrapper(new_func, f) + return decorator + + :param object_type: the type of the object to pass. + :param ensure: if set to `True`, a new object will be created and + remembered on the context if it's not there yet. + """ + def decorator(f): + def new_func(*args, **kwargs): + ctx = get_current_context() + if ensure: + obj = ctx.ensure_object(object_type) + else: + obj = ctx.find_object(object_type) + if obj is None: + raise RuntimeError('Managed to invoke callback without a ' + 'context object of type %r existing' + % object_type.__name__) + return ctx.invoke(f, obj, *args[1:], **kwargs) + return update_wrapper(new_func, f) + return decorator + + +def _make_command(f, name, attrs, cls): + if isinstance(f, Command): + raise TypeError('Attempted to convert a callback into a ' + 'command twice.') + try: + params = f.__click_params__ + params.reverse() + del f.__click_params__ + except AttributeError: + params = [] + help = attrs.get('help') + if help is None: + help = inspect.getdoc(f) + if isinstance(help, bytes): + help = help.decode('utf-8') + else: + help = inspect.cleandoc(help) + attrs['help'] = help + _check_for_unicode_literals() + return cls(name=name or f.__name__.lower(), + callback=f, params=params, **attrs) + + +def command(name=None, cls=None, **attrs): + """Creates a new :class:`Command` and uses the decorated function as + callback. This will also automatically attach all decorated + :func:`option`\s and :func:`argument`\s as parameters to the command. + + The name of the command defaults to the name of the function. If you + want to change that, you can pass the intended name as the first + argument. + + All keyword arguments are forwarded to the underlying command class. + + Once decorated the function turns into a :class:`Command` instance + that can be invoked as a command line utility or be attached to a + command :class:`Group`. + + :param name: the name of the command. This defaults to the function + name. + :param cls: the command class to instantiate. This defaults to + :class:`Command`. + """ + if cls is None: + cls = Command + def decorator(f): + cmd = _make_command(f, name, attrs, cls) + cmd.__doc__ = f.__doc__ + return cmd + return decorator + + +def group(name=None, **attrs): + """Creates a new :class:`Group` with a function as callback. This + works otherwise the same as :func:`command` just that the `cls` + parameter is set to :class:`Group`. + """ + attrs.setdefault('cls', Group) + return command(name, **attrs) + + +def _param_memo(f, param): + if isinstance(f, Command): + f.params.append(param) + else: + if not hasattr(f, '__click_params__'): + f.__click_params__ = [] + f.__click_params__.append(param) + + +def argument(*param_decls, **attrs): + """Attaches an argument to the command. All positional arguments are + passed as parameter declarations to :class:`Argument`; all keyword + arguments are forwarded unchanged (except ``cls``). + This is equivalent to creating an :class:`Argument` instance manually + and attaching it to the :attr:`Command.params` list. + + :param cls: the argument class to instantiate. This defaults to + :class:`Argument`. + """ + def decorator(f): + ArgumentClass = attrs.pop('cls', Argument) + _param_memo(f, ArgumentClass(param_decls, **attrs)) + return f + return decorator + + +def option(*param_decls, **attrs): + """Attaches an option to the command. All positional arguments are + passed as parameter declarations to :class:`Option`; all keyword + arguments are forwarded unchanged (except ``cls``). + This is equivalent to creating an :class:`Option` instance manually + and attaching it to the :attr:`Command.params` list. + + :param cls: the option class to instantiate. This defaults to + :class:`Option`. + """ + def decorator(f): + if 'help' in attrs: + attrs['help'] = inspect.cleandoc(attrs['help']) + OptionClass = attrs.pop('cls', Option) + _param_memo(f, OptionClass(param_decls, **attrs)) + return f + return decorator + + +def confirmation_option(*param_decls, **attrs): + """Shortcut for confirmation prompts that can be ignored by passing + ``--yes`` as parameter. + + This is equivalent to decorating a function with :func:`option` with + the following parameters:: + + def callback(ctx, param, value): + if not value: + ctx.abort() + + @click.command() + @click.option('--yes', is_flag=True, callback=callback, + expose_value=False, prompt='Do you want to continue?') + def dropdb(): + pass + """ + def decorator(f): + def callback(ctx, param, value): + if not value: + ctx.abort() + attrs.setdefault('is_flag', True) + attrs.setdefault('callback', callback) + attrs.setdefault('expose_value', False) + attrs.setdefault('prompt', 'Do you want to continue?') + attrs.setdefault('help', 'Confirm the action without prompting.') + return option(*(param_decls or ('--yes',)), **attrs)(f) + return decorator + + +def password_option(*param_decls, **attrs): + """Shortcut for password prompts. + + This is equivalent to decorating a function with :func:`option` with + the following parameters:: + + @click.command() + @click.option('--password', prompt=True, confirmation_prompt=True, + hide_input=True) + def changeadmin(password): + pass + """ + def decorator(f): + attrs.setdefault('prompt', True) + attrs.setdefault('confirmation_prompt', True) + attrs.setdefault('hide_input', True) + return option(*(param_decls or ('--password',)), **attrs)(f) + return decorator + + +def version_option(version=None, *param_decls, **attrs): + """Adds a ``--version`` option which immediately ends the program + printing out the version number. This is implemented as an eager + option that prints the version and exits the program in the callback. + + :param version: the version number to show. If not provided Click + attempts an auto discovery via setuptools. + :param prog_name: the name of the program (defaults to autodetection) + :param message: custom message to show instead of the default + (``'%(prog)s, version %(version)s'``) + :param others: everything else is forwarded to :func:`option`. + """ + if version is None: + module = sys._getframe(1).f_globals.get('__name__') + def decorator(f): + prog_name = attrs.pop('prog_name', None) + message = attrs.pop('message', '%(prog)s, version %(version)s') + + def callback(ctx, param, value): + if not value or ctx.resilient_parsing: + return + prog = prog_name + if prog is None: + prog = ctx.find_root().info_name + ver = version + if ver is None: + try: + import pkg_resources + except ImportError: + pass + else: + for dist in pkg_resources.working_set: + scripts = dist.get_entry_map().get('console_scripts') or {} + for script_name, entry_point in iteritems(scripts): + if entry_point.module_name == module: + ver = dist.version + break + if ver is None: + raise RuntimeError('Could not determine version') + echo(message % { + 'prog': prog, + 'version': ver, + }, color=ctx.color) + ctx.exit() + + attrs.setdefault('is_flag', True) + attrs.setdefault('expose_value', False) + attrs.setdefault('is_eager', True) + attrs.setdefault('help', 'Show the version and exit.') + attrs['callback'] = callback + return option(*(param_decls or ('--version',)), **attrs)(f) + return decorator + + +def help_option(*param_decls, **attrs): + """Adds a ``--help`` option which immediately ends the program + printing out the help page. This is usually unnecessary to add as + this is added by default to all commands unless suppressed. + + Like :func:`version_option`, this is implemented as eager option that + prints in the callback and exits. + + All arguments are forwarded to :func:`option`. + """ + def decorator(f): + def callback(ctx, param, value): + if value and not ctx.resilient_parsing: + echo(ctx.get_help(), color=ctx.color) + ctx.exit() + attrs.setdefault('is_flag', True) + attrs.setdefault('expose_value', False) + attrs.setdefault('help', 'Show this message and exit.') + attrs.setdefault('is_eager', True) + attrs['callback'] = callback + return option(*(param_decls or ('--help',)), **attrs)(f) + return decorator + + +# Circular dependencies between core and decorators +from .core import Command, Group, Argument, Option diff --git a/website/web/Lib/site-packages/click/exceptions.py b/website/web/Lib/site-packages/click/exceptions.py new file mode 100644 index 000000000..74a4542bb --- /dev/null +++ b/website/web/Lib/site-packages/click/exceptions.py @@ -0,0 +1,201 @@ +from ._compat import PY2, filename_to_ui, get_text_stderr +from .utils import echo + + +class ClickException(Exception): + """An exception that Click can handle and show to the user.""" + + #: The exit code for this exception + exit_code = 1 + + def __init__(self, message): + if PY2: + if message is not None: + message = message.encode('utf-8') + Exception.__init__(self, message) + self.message = message + + def format_message(self): + return self.message + + def show(self, file=None): + if file is None: + file = get_text_stderr() + echo('Error: %s' % self.format_message(), file=file) + + +class UsageError(ClickException): + """An internal exception that signals a usage error. This typically + aborts any further handling. + + :param message: the error message to display. + :param ctx: optionally the context that caused this error. Click will + fill in the context automatically in some situations. + """ + exit_code = 2 + + def __init__(self, message, ctx=None): + ClickException.__init__(self, message) + self.ctx = ctx + + def show(self, file=None): + if file is None: + file = get_text_stderr() + color = None + if self.ctx is not None: + color = self.ctx.color + echo(self.ctx.get_usage() + '\n', file=file, color=color) + echo('Error: %s' % self.format_message(), file=file, color=color) + + +class BadParameter(UsageError): + """An exception that formats out a standardized error message for a + bad parameter. This is useful when thrown from a callback or type as + Click will attach contextual information to it (for instance, which + parameter it is). + + .. versionadded:: 2.0 + + :param param: the parameter object that caused this error. This can + be left out, and Click will attach this info itself + if possible. + :param param_hint: a string that shows up as parameter name. This + can be used as alternative to `param` in cases + where custom validation should happen. If it is + a string it's used as such, if it's a list then + each item is quoted and separated. + """ + + def __init__(self, message, ctx=None, param=None, + param_hint=None): + UsageError.__init__(self, message, ctx) + self.param = param + self.param_hint = param_hint + + def format_message(self): + if self.param_hint is not None: + param_hint = self.param_hint + elif self.param is not None: + param_hint = self.param.opts or [self.param.human_readable_name] + else: + return 'Invalid value: %s' % self.message + if isinstance(param_hint, (tuple, list)): + param_hint = ' / '.join('"%s"' % x for x in param_hint) + return 'Invalid value for %s: %s' % (param_hint, self.message) + + +class MissingParameter(BadParameter): + """Raised if click required an option or argument but it was not + provided when invoking the script. + + .. versionadded:: 4.0 + + :param param_type: a string that indicates the type of the parameter. + The default is to inherit the parameter type from + the given `param`. Valid values are ``'parameter'``, + ``'option'`` or ``'argument'``. + """ + + def __init__(self, message=None, ctx=None, param=None, + param_hint=None, param_type=None): + BadParameter.__init__(self, message, ctx, param, param_hint) + self.param_type = param_type + + def format_message(self): + if self.param_hint is not None: + param_hint = self.param_hint + elif self.param is not None: + param_hint = self.param.opts or [self.param.human_readable_name] + else: + param_hint = None + if isinstance(param_hint, (tuple, list)): + param_hint = ' / '.join('"%s"' % x for x in param_hint) + + param_type = self.param_type + if param_type is None and self.param is not None: + param_type = self.param.param_type_name + + msg = self.message + if self.param is not None: + msg_extra = self.param.type.get_missing_message(self.param) + if msg_extra: + if msg: + msg += '. ' + msg_extra + else: + msg = msg_extra + + return 'Missing %s%s%s%s' % ( + param_type, + param_hint and ' %s' % param_hint or '', + msg and '. ' or '.', + msg or '', + ) + + +class NoSuchOption(UsageError): + """Raised if click attempted to handle an option that does not + exist. + + .. versionadded:: 4.0 + """ + + def __init__(self, option_name, message=None, possibilities=None, + ctx=None): + if message is None: + message = 'no such option: %s' % option_name + UsageError.__init__(self, message, ctx) + self.option_name = option_name + self.possibilities = possibilities + + def format_message(self): + bits = [self.message] + if self.possibilities: + if len(self.possibilities) == 1: + bits.append('Did you mean %s?' % self.possibilities[0]) + else: + possibilities = sorted(self.possibilities) + bits.append('(Possible options: %s)' % ', '.join(possibilities)) + return ' '.join(bits) + + +class BadOptionUsage(UsageError): + """Raised if an option is generally supplied but the use of the option + was incorrect. This is for instance raised if the number of arguments + for an option is not correct. + + .. versionadded:: 4.0 + """ + + def __init__(self, message, ctx=None): + UsageError.__init__(self, message, ctx) + + +class BadArgumentUsage(UsageError): + """Raised if an argument is generally supplied but the use of the argument + was incorrect. This is for instance raised if the number of values + for an argument is not correct. + + .. versionadded:: 6.0 + """ + + def __init__(self, message, ctx=None): + UsageError.__init__(self, message, ctx) + + +class FileError(ClickException): + """Raised if a file cannot be opened.""" + + def __init__(self, filename, hint=None): + ui_filename = filename_to_ui(filename) + if hint is None: + hint = 'unknown error' + ClickException.__init__(self, hint) + self.ui_filename = ui_filename + self.filename = filename + + def format_message(self): + return 'Could not open file %s: %s' % (self.ui_filename, self.message) + + +class Abort(RuntimeError): + """An internal signalling exception that signals Click to abort.""" diff --git a/website/web/Lib/site-packages/click/formatting.py b/website/web/Lib/site-packages/click/formatting.py new file mode 100644 index 000000000..a3d6a4d38 --- /dev/null +++ b/website/web/Lib/site-packages/click/formatting.py @@ -0,0 +1,256 @@ +from contextlib import contextmanager +from .termui import get_terminal_size +from .parser import split_opt +from ._compat import term_len + + +# Can force a width. This is used by the test system +FORCED_WIDTH = None + + +def measure_table(rows): + widths = {} + for row in rows: + for idx, col in enumerate(row): + widths[idx] = max(widths.get(idx, 0), term_len(col)) + return tuple(y for x, y in sorted(widths.items())) + + +def iter_rows(rows, col_count): + for row in rows: + row = tuple(row) + yield row + ('',) * (col_count - len(row)) + + +def wrap_text(text, width=78, initial_indent='', subsequent_indent='', + preserve_paragraphs=False): + """A helper function that intelligently wraps text. By default, it + assumes that it operates on a single paragraph of text but if the + `preserve_paragraphs` parameter is provided it will intelligently + handle paragraphs (defined by two empty lines). + + If paragraphs are handled, a paragraph can be prefixed with an empty + line containing the ``\\b`` character (``\\x08``) to indicate that + no rewrapping should happen in that block. + + :param text: the text that should be rewrapped. + :param width: the maximum width for the text. + :param initial_indent: the initial indent that should be placed on the + first line as a string. + :param subsequent_indent: the indent string that should be placed on + each consecutive line. + :param preserve_paragraphs: if this flag is set then the wrapping will + intelligently handle paragraphs. + """ + from ._textwrap import TextWrapper + text = text.expandtabs() + wrapper = TextWrapper(width, initial_indent=initial_indent, + subsequent_indent=subsequent_indent, + replace_whitespace=False) + if not preserve_paragraphs: + return wrapper.fill(text) + + p = [] + buf = [] + indent = None + + def _flush_par(): + if not buf: + return + if buf[0].strip() == '\b': + p.append((indent or 0, True, '\n'.join(buf[1:]))) + else: + p.append((indent or 0, False, ' '.join(buf))) + del buf[:] + + for line in text.splitlines(): + if not line: + _flush_par() + indent = None + else: + if indent is None: + orig_len = term_len(line) + line = line.lstrip() + indent = orig_len - term_len(line) + buf.append(line) + _flush_par() + + rv = [] + for indent, raw, text in p: + with wrapper.extra_indent(' ' * indent): + if raw: + rv.append(wrapper.indent_only(text)) + else: + rv.append(wrapper.fill(text)) + + return '\n\n'.join(rv) + + +class HelpFormatter(object): + """This class helps with formatting text-based help pages. It's + usually just needed for very special internal cases, but it's also + exposed so that developers can write their own fancy outputs. + + At present, it always writes into memory. + + :param indent_increment: the additional increment for each level. + :param width: the width for the text. This defaults to the terminal + width clamped to a maximum of 78. + """ + + def __init__(self, indent_increment=2, width=None, max_width=None): + self.indent_increment = indent_increment + if max_width is None: + max_width = 80 + if width is None: + width = FORCED_WIDTH + if width is None: + width = max(min(get_terminal_size()[0], max_width) - 2, 50) + self.width = width + self.current_indent = 0 + self.buffer = [] + + def write(self, string): + """Writes a unicode string into the internal buffer.""" + self.buffer.append(string) + + def indent(self): + """Increases the indentation.""" + self.current_indent += self.indent_increment + + def dedent(self): + """Decreases the indentation.""" + self.current_indent -= self.indent_increment + + def write_usage(self, prog, args='', prefix='Usage: '): + """Writes a usage line into the buffer. + + :param prog: the program name. + :param args: whitespace separated list of arguments. + :param prefix: the prefix for the first line. + """ + usage_prefix = '%*s%s ' % (self.current_indent, prefix, prog) + text_width = self.width - self.current_indent + + if text_width >= (term_len(usage_prefix) + 20): + # The arguments will fit to the right of the prefix. + indent = ' ' * term_len(usage_prefix) + self.write(wrap_text(args, text_width, + initial_indent=usage_prefix, + subsequent_indent=indent)) + else: + # The prefix is too long, put the arguments on the next line. + self.write(usage_prefix) + self.write('\n') + indent = ' ' * (max(self.current_indent, term_len(prefix)) + 4) + self.write(wrap_text(args, text_width, + initial_indent=indent, + subsequent_indent=indent)) + + self.write('\n') + + def write_heading(self, heading): + """Writes a heading into the buffer.""" + self.write('%*s%s:\n' % (self.current_indent, '', heading)) + + def write_paragraph(self): + """Writes a paragraph into the buffer.""" + if self.buffer: + self.write('\n') + + def write_text(self, text): + """Writes re-indented text into the buffer. This rewraps and + preserves paragraphs. + """ + text_width = max(self.width - self.current_indent, 11) + indent = ' ' * self.current_indent + self.write(wrap_text(text, text_width, + initial_indent=indent, + subsequent_indent=indent, + preserve_paragraphs=True)) + self.write('\n') + + def write_dl(self, rows, col_max=30, col_spacing=2): + """Writes a definition list into the buffer. This is how options + and commands are usually formatted. + + :param rows: a list of two item tuples for the terms and values. + :param col_max: the maximum width of the first column. + :param col_spacing: the number of spaces between the first and + second column. + """ + rows = list(rows) + widths = measure_table(rows) + if len(widths) != 2: + raise TypeError('Expected two columns for definition list') + + first_col = min(widths[0], col_max) + col_spacing + + for first, second in iter_rows(rows, len(widths)): + self.write('%*s%s' % (self.current_indent, '', first)) + if not second: + self.write('\n') + continue + if term_len(first) <= first_col - col_spacing: + self.write(' ' * (first_col - term_len(first))) + else: + self.write('\n') + self.write(' ' * (first_col + self.current_indent)) + + text_width = max(self.width - first_col - 2, 10) + lines = iter(wrap_text(second, text_width).splitlines()) + if lines: + self.write(next(lines) + '\n') + for line in lines: + self.write('%*s%s\n' % ( + first_col + self.current_indent, '', line)) + else: + self.write('\n') + + @contextmanager + def section(self, name): + """Helpful context manager that writes a paragraph, a heading, + and the indents. + + :param name: the section name that is written as heading. + """ + self.write_paragraph() + self.write_heading(name) + self.indent() + try: + yield + finally: + self.dedent() + + @contextmanager + def indentation(self): + """A context manager that increases the indentation.""" + self.indent() + try: + yield + finally: + self.dedent() + + def getvalue(self): + """Returns the buffer contents.""" + return ''.join(self.buffer) + + +def join_options(options): + """Given a list of option strings this joins them in the most appropriate + way and returns them in the form ``(formatted_string, + any_prefix_is_slash)`` where the second item in the tuple is a flag that + indicates if any of the option prefixes was a slash. + """ + rv = [] + any_prefix_is_slash = False + for opt in options: + prefix = split_opt(opt)[0] + if prefix == '/': + any_prefix_is_slash = True + rv.append((len(prefix), opt)) + + rv.sort(key=lambda x: x[0]) + + rv = ', '.join(x[1] for x in rv) + return rv, any_prefix_is_slash diff --git a/website/web/Lib/site-packages/click/globals.py b/website/web/Lib/site-packages/click/globals.py new file mode 100644 index 000000000..14338e6bb --- /dev/null +++ b/website/web/Lib/site-packages/click/globals.py @@ -0,0 +1,48 @@ +from threading import local + + +_local = local() + + +def get_current_context(silent=False): + """Returns the current click context. This can be used as a way to + access the current context object from anywhere. This is a more implicit + alternative to the :func:`pass_context` decorator. This function is + primarily useful for helpers such as :func:`echo` which might be + interested in changing it's behavior based on the current context. + + To push the current context, :meth:`Context.scope` can be used. + + .. versionadded:: 5.0 + + :param silent: is set to `True` the return value is `None` if no context + is available. The default behavior is to raise a + :exc:`RuntimeError`. + """ + try: + return getattr(_local, 'stack')[-1] + except (AttributeError, IndexError): + if not silent: + raise RuntimeError('There is no active click context.') + + +def push_context(ctx): + """Pushes a new context to the current stack.""" + _local.__dict__.setdefault('stack', []).append(ctx) + + +def pop_context(): + """Removes the top level from the stack.""" + _local.stack.pop() + + +def resolve_color_default(color=None): + """"Internal helper to get the default value of the color flag. If a + value is passed it's returned unchanged, otherwise it's looked up from + the current context. + """ + if color is not None: + return color + ctx = get_current_context(silent=True) + if ctx is not None: + return ctx.color diff --git a/website/web/Lib/site-packages/click/parser.py b/website/web/Lib/site-packages/click/parser.py new file mode 100644 index 000000000..9775c9ff9 --- /dev/null +++ b/website/web/Lib/site-packages/click/parser.py @@ -0,0 +1,426 @@ +# -*- coding: utf-8 -*- +""" + click.parser + ~~~~~~~~~~~~ + + This module started out as largely a copy paste from the stdlib's + optparse module with the features removed that we do not need from + optparse because we implement them in Click on a higher level (for + instance type handling, help formatting and a lot more). + + The plan is to remove more and more from here over time. + + The reason this is a different module and not optparse from the stdlib + is that there are differences in 2.x and 3.x about the error messages + generated and optparse in the stdlib uses gettext for no good reason + and might cause us issues. +""" +import re +from collections import deque +from .exceptions import UsageError, NoSuchOption, BadOptionUsage, \ + BadArgumentUsage + + +def _unpack_args(args, nargs_spec): + """Given an iterable of arguments and an iterable of nargs specifications, + it returns a tuple with all the unpacked arguments at the first index + and all remaining arguments as the second. + + The nargs specification is the number of arguments that should be consumed + or `-1` to indicate that this position should eat up all the remainders. + + Missing items are filled with `None`. + """ + args = deque(args) + nargs_spec = deque(nargs_spec) + rv = [] + spos = None + + def _fetch(c): + try: + if spos is None: + return c.popleft() + else: + return c.pop() + except IndexError: + return None + + while nargs_spec: + nargs = _fetch(nargs_spec) + if nargs == 1: + rv.append(_fetch(args)) + elif nargs > 1: + x = [_fetch(args) for _ in range(nargs)] + # If we're reversed, we're pulling in the arguments in reverse, + # so we need to turn them around. + if spos is not None: + x.reverse() + rv.append(tuple(x)) + elif nargs < 0: + if spos is not None: + raise TypeError('Cannot have two nargs < 0') + spos = len(rv) + rv.append(None) + + # spos is the position of the wildcard (star). If it's not `None`, + # we fill it with the remainder. + if spos is not None: + rv[spos] = tuple(args) + args = [] + rv[spos + 1:] = reversed(rv[spos + 1:]) + + return tuple(rv), list(args) + + +def _error_opt_args(nargs, opt): + if nargs == 1: + raise BadOptionUsage('%s option requires an argument' % opt) + raise BadOptionUsage('%s option requires %d arguments' % (opt, nargs)) + + +def split_opt(opt): + first = opt[:1] + if first.isalnum(): + return '', opt + if opt[1:2] == first: + return opt[:2], opt[2:] + return first, opt[1:] + + +def normalize_opt(opt, ctx): + if ctx is None or ctx.token_normalize_func is None: + return opt + prefix, opt = split_opt(opt) + return prefix + ctx.token_normalize_func(opt) + + +def split_arg_string(string): + """Given an argument string this attempts to split it into small parts.""" + rv = [] + for match in re.finditer(r"('([^'\\]*(?:\\.[^'\\]*)*)'" + r'|"([^"\\]*(?:\\.[^"\\]*)*)"' + r'|\S+)\s*', string, re.S): + arg = match.group().strip() + if arg[:1] == arg[-1:] and arg[:1] in '"\'': + arg = arg[1:-1].encode('ascii', 'backslashreplace') \ + .decode('unicode-escape') + try: + arg = type(string)(arg) + except UnicodeError: + pass + rv.append(arg) + return rv + + +class Option(object): + + def __init__(self, opts, dest, action=None, nargs=1, const=None, obj=None): + self._short_opts = [] + self._long_opts = [] + self.prefixes = set() + + for opt in opts: + prefix, value = split_opt(opt) + if not prefix: + raise ValueError('Invalid start character for option (%s)' + % opt) + self.prefixes.add(prefix[0]) + if len(prefix) == 1 and len(value) == 1: + self._short_opts.append(opt) + else: + self._long_opts.append(opt) + self.prefixes.add(prefix) + + if action is None: + action = 'store' + + self.dest = dest + self.action = action + self.nargs = nargs + self.const = const + self.obj = obj + + @property + def takes_value(self): + return self.action in ('store', 'append') + + def process(self, value, state): + if self.action == 'store': + state.opts[self.dest] = value + elif self.action == 'store_const': + state.opts[self.dest] = self.const + elif self.action == 'append': + state.opts.setdefault(self.dest, []).append(value) + elif self.action == 'append_const': + state.opts.setdefault(self.dest, []).append(self.const) + elif self.action == 'count': + state.opts[self.dest] = state.opts.get(self.dest, 0) + 1 + else: + raise ValueError('unknown action %r' % self.action) + state.order.append(self.obj) + + +class Argument(object): + + def __init__(self, dest, nargs=1, obj=None): + self.dest = dest + self.nargs = nargs + self.obj = obj + + def process(self, value, state): + if self.nargs > 1: + holes = sum(1 for x in value if x is None) + if holes == len(value): + value = None + elif holes != 0: + raise BadArgumentUsage('argument %s takes %d values' + % (self.dest, self.nargs)) + state.opts[self.dest] = value + state.order.append(self.obj) + + +class ParsingState(object): + + def __init__(self, rargs): + self.opts = {} + self.largs = [] + self.rargs = rargs + self.order = [] + + +class OptionParser(object): + """The option parser is an internal class that is ultimately used to + parse options and arguments. It's modelled after optparse and brings + a similar but vastly simplified API. It should generally not be used + directly as the high level Click classes wrap it for you. + + It's not nearly as extensible as optparse or argparse as it does not + implement features that are implemented on a higher level (such as + types or defaults). + + :param ctx: optionally the :class:`~click.Context` where this parser + should go with. + """ + + def __init__(self, ctx=None): + #: The :class:`~click.Context` for this parser. This might be + #: `None` for some advanced use cases. + self.ctx = ctx + #: This controls how the parser deals with interspersed arguments. + #: If this is set to `False`, the parser will stop on the first + #: non-option. Click uses this to implement nested subcommands + #: safely. + self.allow_interspersed_args = True + #: This tells the parser how to deal with unknown options. By + #: default it will error out (which is sensible), but there is a + #: second mode where it will ignore it and continue processing + #: after shifting all the unknown options into the resulting args. + self.ignore_unknown_options = False + if ctx is not None: + self.allow_interspersed_args = ctx.allow_interspersed_args + self.ignore_unknown_options = ctx.ignore_unknown_options + self._short_opt = {} + self._long_opt = {} + self._opt_prefixes = set(['-', '--']) + self._args = [] + + def add_option(self, opts, dest, action=None, nargs=1, const=None, + obj=None): + """Adds a new option named `dest` to the parser. The destination + is not inferred (unlike with optparse) and needs to be explicitly + provided. Action can be any of ``store``, ``store_const``, + ``append``, ``appnd_const`` or ``count``. + + The `obj` can be used to identify the option in the order list + that is returned from the parser. + """ + if obj is None: + obj = dest + opts = [normalize_opt(opt, self.ctx) for opt in opts] + option = Option(opts, dest, action=action, nargs=nargs, + const=const, obj=obj) + self._opt_prefixes.update(option.prefixes) + for opt in option._short_opts: + self._short_opt[opt] = option + for opt in option._long_opts: + self._long_opt[opt] = option + + def add_argument(self, dest, nargs=1, obj=None): + """Adds a positional argument named `dest` to the parser. + + The `obj` can be used to identify the option in the order list + that is returned from the parser. + """ + if obj is None: + obj = dest + self._args.append(Argument(dest=dest, nargs=nargs, obj=obj)) + + def parse_args(self, args): + """Parses positional arguments and returns ``(values, args, order)`` + for the parsed options and arguments as well as the leftover + arguments if there are any. The order is a list of objects as they + appear on the command line. If arguments appear multiple times they + will be memorized multiple times as well. + """ + state = ParsingState(args) + try: + self._process_args_for_options(state) + self._process_args_for_args(state) + except UsageError: + if self.ctx is None or not self.ctx.resilient_parsing: + raise + return state.opts, state.largs, state.order + + def _process_args_for_args(self, state): + pargs, args = _unpack_args(state.largs + state.rargs, + [x.nargs for x in self._args]) + + for idx, arg in enumerate(self._args): + arg.process(pargs[idx], state) + + state.largs = args + state.rargs = [] + + def _process_args_for_options(self, state): + while state.rargs: + arg = state.rargs.pop(0) + arglen = len(arg) + # Double dashes always handled explicitly regardless of what + # prefixes are valid. + if arg == '--': + return + elif arg[:1] in self._opt_prefixes and arglen > 1: + self._process_opts(arg, state) + elif self.allow_interspersed_args: + state.largs.append(arg) + else: + state.rargs.insert(0, arg) + return + + # Say this is the original argument list: + # [arg0, arg1, ..., arg(i-1), arg(i), arg(i+1), ..., arg(N-1)] + # ^ + # (we are about to process arg(i)). + # + # Then rargs is [arg(i), ..., arg(N-1)] and largs is a *subset* of + # [arg0, ..., arg(i-1)] (any options and their arguments will have + # been removed from largs). + # + # The while loop will usually consume 1 or more arguments per pass. + # If it consumes 1 (eg. arg is an option that takes no arguments), + # then after _process_arg() is done the situation is: + # + # largs = subset of [arg0, ..., arg(i)] + # rargs = [arg(i+1), ..., arg(N-1)] + # + # If allow_interspersed_args is false, largs will always be + # *empty* -- still a subset of [arg0, ..., arg(i-1)], but + # not a very interesting subset! + + def _match_long_opt(self, opt, explicit_value, state): + if opt not in self._long_opt: + possibilities = [word for word in self._long_opt + if word.startswith(opt)] + raise NoSuchOption(opt, possibilities=possibilities) + + option = self._long_opt[opt] + if option.takes_value: + # At this point it's safe to modify rargs by injecting the + # explicit value, because no exception is raised in this + # branch. This means that the inserted value will be fully + # consumed. + if explicit_value is not None: + state.rargs.insert(0, explicit_value) + + nargs = option.nargs + if len(state.rargs) < nargs: + _error_opt_args(nargs, opt) + elif nargs == 1: + value = state.rargs.pop(0) + else: + value = tuple(state.rargs[:nargs]) + del state.rargs[:nargs] + + elif explicit_value is not None: + raise BadOptionUsage('%s option does not take a value' % opt) + + else: + value = None + + option.process(value, state) + + def _match_short_opt(self, arg, state): + stop = False + i = 1 + prefix = arg[0] + unknown_options = [] + + for ch in arg[1:]: + opt = normalize_opt(prefix + ch, self.ctx) + option = self._short_opt.get(opt) + i += 1 + + if not option: + if self.ignore_unknown_options: + unknown_options.append(ch) + continue + raise NoSuchOption(opt) + if option.takes_value: + # Any characters left in arg? Pretend they're the + # next arg, and stop consuming characters of arg. + if i < len(arg): + state.rargs.insert(0, arg[i:]) + stop = True + + nargs = option.nargs + if len(state.rargs) < nargs: + _error_opt_args(nargs, opt) + elif nargs == 1: + value = state.rargs.pop(0) + else: + value = tuple(state.rargs[:nargs]) + del state.rargs[:nargs] + + else: + value = None + + option.process(value, state) + + if stop: + break + + # If we got any unknown options we re-combinate the string of the + # remaining options and re-attach the prefix, then report that + # to the state as new larg. This way there is basic combinatorics + # that can be achieved while still ignoring unknown arguments. + if self.ignore_unknown_options and unknown_options: + state.largs.append(prefix + ''.join(unknown_options)) + + def _process_opts(self, arg, state): + explicit_value = None + # Long option handling happens in two parts. The first part is + # supporting explicitly attached values. In any case, we will try + # to long match the option first. + if '=' in arg: + long_opt, explicit_value = arg.split('=', 1) + else: + long_opt = arg + norm_long_opt = normalize_opt(long_opt, self.ctx) + + # At this point we will match the (assumed) long option through + # the long option matching code. Note that this allows options + # like "-foo" to be matched as long options. + try: + self._match_long_opt(norm_long_opt, explicit_value, state) + except NoSuchOption: + # At this point the long option matching failed, and we need + # to try with short options. However there is a special rule + # which says, that if we have a two character options prefix + # (applies to "--foo" for instance), we do not dispatch to the + # short option code and will instead raise the no option + # error. + if arg[:2] not in self._opt_prefixes: + return self._match_short_opt(arg, state) + if not self.ignore_unknown_options: + raise + state.largs.append(arg) diff --git a/website/web/Lib/site-packages/click/termui.py b/website/web/Lib/site-packages/click/termui.py new file mode 100644 index 000000000..d9fba5232 --- /dev/null +++ b/website/web/Lib/site-packages/click/termui.py @@ -0,0 +1,539 @@ +import os +import sys +import struct + +from ._compat import raw_input, text_type, string_types, \ + isatty, strip_ansi, get_winterm_size, DEFAULT_COLUMNS, WIN +from .utils import echo +from .exceptions import Abort, UsageError +from .types import convert_type +from .globals import resolve_color_default + + +# The prompt functions to use. The doc tools currently override these +# functions to customize how they work. +visible_prompt_func = raw_input + +_ansi_colors = ('black', 'red', 'green', 'yellow', 'blue', 'magenta', + 'cyan', 'white', 'reset') +_ansi_reset_all = '\033[0m' + + +def hidden_prompt_func(prompt): + import getpass + return getpass.getpass(prompt) + + +def _build_prompt(text, suffix, show_default=False, default=None): + prompt = text + if default is not None and show_default: + prompt = '%s [%s]' % (prompt, default) + return prompt + suffix + + +def prompt(text, default=None, hide_input=False, + confirmation_prompt=False, type=None, + value_proc=None, prompt_suffix=': ', + show_default=True, err=False): + """Prompts a user for input. This is a convenience function that can + be used to prompt a user for input later. + + If the user aborts the input by sending a interrupt signal, this + function will catch it and raise a :exc:`Abort` exception. + + .. versionadded:: 6.0 + Added unicode support for cmd.exe on Windows. + + .. versionadded:: 4.0 + Added the `err` parameter. + + :param text: the text to show for the prompt. + :param default: the default value to use if no input happens. If this + is not given it will prompt until it's aborted. + :param hide_input: if this is set to true then the input value will + be hidden. + :param confirmation_prompt: asks for confirmation for the value. + :param type: the type to use to check the value against. + :param value_proc: if this parameter is provided it's a function that + is invoked instead of the type conversion to + convert a value. + :param prompt_suffix: a suffix that should be added to the prompt. + :param show_default: shows or hides the default value in the prompt. + :param err: if set to true the file defaults to ``stderr`` instead of + ``stdout``, the same as with echo. + """ + result = None + + def prompt_func(text): + f = hide_input and hidden_prompt_func or visible_prompt_func + try: + # Write the prompt separately so that we get nice + # coloring through colorama on Windows + echo(text, nl=False, err=err) + return f('') + except (KeyboardInterrupt, EOFError): + # getpass doesn't print a newline if the user aborts input with ^C. + # Allegedly this behavior is inherited from getpass(3). + # A doc bug has been filed at https://bugs.python.org/issue24711 + if hide_input: + echo(None, err=err) + raise Abort() + + if value_proc is None: + value_proc = convert_type(type, default) + + prompt = _build_prompt(text, prompt_suffix, show_default, default) + + while 1: + while 1: + value = prompt_func(prompt) + if value: + break + # If a default is set and used, then the confirmation + # prompt is always skipped because that's the only thing + # that really makes sense. + elif default is not None: + return default + try: + result = value_proc(value) + except UsageError as e: + echo('Error: %s' % e.message, err=err) + continue + if not confirmation_prompt: + return result + while 1: + value2 = prompt_func('Repeat for confirmation: ') + if value2: + break + if value == value2: + return result + echo('Error: the two entered values do not match', err=err) + + +def confirm(text, default=False, abort=False, prompt_suffix=': ', + show_default=True, err=False): + """Prompts for confirmation (yes/no question). + + If the user aborts the input by sending a interrupt signal this + function will catch it and raise a :exc:`Abort` exception. + + .. versionadded:: 4.0 + Added the `err` parameter. + + :param text: the question to ask. + :param default: the default for the prompt. + :param abort: if this is set to `True` a negative answer aborts the + exception by raising :exc:`Abort`. + :param prompt_suffix: a suffix that should be added to the prompt. + :param show_default: shows or hides the default value in the prompt. + :param err: if set to true the file defaults to ``stderr`` instead of + ``stdout``, the same as with echo. + """ + prompt = _build_prompt(text, prompt_suffix, show_default, + default and 'Y/n' or 'y/N') + while 1: + try: + # Write the prompt separately so that we get nice + # coloring through colorama on Windows + echo(prompt, nl=False, err=err) + value = visible_prompt_func('').lower().strip() + except (KeyboardInterrupt, EOFError): + raise Abort() + if value in ('y', 'yes'): + rv = True + elif value in ('n', 'no'): + rv = False + elif value == '': + rv = default + else: + echo('Error: invalid input', err=err) + continue + break + if abort and not rv: + raise Abort() + return rv + + +def get_terminal_size(): + """Returns the current size of the terminal as tuple in the form + ``(width, height)`` in columns and rows. + """ + # If shutil has get_terminal_size() (Python 3.3 and later) use that + if sys.version_info >= (3, 3): + import shutil + shutil_get_terminal_size = getattr(shutil, 'get_terminal_size', None) + if shutil_get_terminal_size: + sz = shutil_get_terminal_size() + return sz.columns, sz.lines + + if get_winterm_size is not None: + return get_winterm_size() + + def ioctl_gwinsz(fd): + try: + import fcntl + import termios + cr = struct.unpack( + 'hh', fcntl.ioctl(fd, termios.TIOCGWINSZ, '1234')) + except Exception: + return + return cr + + cr = ioctl_gwinsz(0) or ioctl_gwinsz(1) or ioctl_gwinsz(2) + if not cr: + try: + fd = os.open(os.ctermid(), os.O_RDONLY) + try: + cr = ioctl_gwinsz(fd) + finally: + os.close(fd) + except Exception: + pass + if not cr or not cr[0] or not cr[1]: + cr = (os.environ.get('LINES', 25), + os.environ.get('COLUMNS', DEFAULT_COLUMNS)) + return int(cr[1]), int(cr[0]) + + +def echo_via_pager(text, color=None): + """This function takes a text and shows it via an environment specific + pager on stdout. + + .. versionchanged:: 3.0 + Added the `color` flag. + + :param text: the text to page. + :param color: controls if the pager supports ANSI colors or not. The + default is autodetection. + """ + color = resolve_color_default(color) + if not isinstance(text, string_types): + text = text_type(text) + from ._termui_impl import pager + return pager(text + '\n', color) + + +def progressbar(iterable=None, length=None, label=None, show_eta=True, + show_percent=None, show_pos=False, + item_show_func=None, fill_char='#', empty_char='-', + bar_template='%(label)s [%(bar)s] %(info)s', + info_sep=' ', width=36, file=None, color=None): + """This function creates an iterable context manager that can be used + to iterate over something while showing a progress bar. It will + either iterate over the `iterable` or `length` items (that are counted + up). While iteration happens, this function will print a rendered + progress bar to the given `file` (defaults to stdout) and will attempt + to calculate remaining time and more. By default, this progress bar + will not be rendered if the file is not a terminal. + + The context manager creates the progress bar. When the context + manager is entered the progress bar is already displayed. With every + iteration over the progress bar, the iterable passed to the bar is + advanced and the bar is updated. When the context manager exits, + a newline is printed and the progress bar is finalized on screen. + + No printing must happen or the progress bar will be unintentionally + destroyed. + + Example usage:: + + with progressbar(items) as bar: + for item in bar: + do_something_with(item) + + Alternatively, if no iterable is specified, one can manually update the + progress bar through the `update()` method instead of directly + iterating over the progress bar. The update method accepts the number + of steps to increment the bar with:: + + with progressbar(length=chunks.total_bytes) as bar: + for chunk in chunks: + process_chunk(chunk) + bar.update(chunks.bytes) + + .. versionadded:: 2.0 + + .. versionadded:: 4.0 + Added the `color` parameter. Added a `update` method to the + progressbar object. + + :param iterable: an iterable to iterate over. If not provided the length + is required. + :param length: the number of items to iterate over. By default the + progressbar will attempt to ask the iterator about its + length, which might or might not work. If an iterable is + also provided this parameter can be used to override the + length. If an iterable is not provided the progress bar + will iterate over a range of that length. + :param label: the label to show next to the progress bar. + :param show_eta: enables or disables the estimated time display. This is + automatically disabled if the length cannot be + determined. + :param show_percent: enables or disables the percentage display. The + default is `True` if the iterable has a length or + `False` if not. + :param show_pos: enables or disables the absolute position display. The + default is `False`. + :param item_show_func: a function called with the current item which + can return a string to show the current item + next to the progress bar. Note that the current + item can be `None`! + :param fill_char: the character to use to show the filled part of the + progress bar. + :param empty_char: the character to use to show the non-filled part of + the progress bar. + :param bar_template: the format string to use as template for the bar. + The parameters in it are ``label`` for the label, + ``bar`` for the progress bar and ``info`` for the + info section. + :param info_sep: the separator between multiple info items (eta etc.) + :param width: the width of the progress bar in characters, 0 means full + terminal width + :param file: the file to write to. If this is not a terminal then + only the label is printed. + :param color: controls if the terminal supports ANSI colors or not. The + default is autodetection. This is only needed if ANSI + codes are included anywhere in the progress bar output + which is not the case by default. + """ + from ._termui_impl import ProgressBar + color = resolve_color_default(color) + return ProgressBar(iterable=iterable, length=length, show_eta=show_eta, + show_percent=show_percent, show_pos=show_pos, + item_show_func=item_show_func, fill_char=fill_char, + empty_char=empty_char, bar_template=bar_template, + info_sep=info_sep, file=file, label=label, + width=width, color=color) + + +def clear(): + """Clears the terminal screen. This will have the effect of clearing + the whole visible space of the terminal and moving the cursor to the + top left. This does not do anything if not connected to a terminal. + + .. versionadded:: 2.0 + """ + if not isatty(sys.stdout): + return + # If we're on Windows and we don't have colorama available, then we + # clear the screen by shelling out. Otherwise we can use an escape + # sequence. + if WIN: + os.system('cls') + else: + sys.stdout.write('\033[2J\033[1;1H') + + +def style(text, fg=None, bg=None, bold=None, dim=None, underline=None, + blink=None, reverse=None, reset=True): + """Styles a text with ANSI styles and returns the new string. By + default the styling is self contained which means that at the end + of the string a reset code is issued. This can be prevented by + passing ``reset=False``. + + Examples:: + + click.echo(click.style('Hello World!', fg='green')) + click.echo(click.style('ATTENTION!', blink=True)) + click.echo(click.style('Some things', reverse=True, fg='cyan')) + + Supported color names: + + * ``black`` (might be a gray) + * ``red`` + * ``green`` + * ``yellow`` (might be an orange) + * ``blue`` + * ``magenta`` + * ``cyan`` + * ``white`` (might be light gray) + * ``reset`` (reset the color code only) + + .. versionadded:: 2.0 + + :param text: the string to style with ansi codes. + :param fg: if provided this will become the foreground color. + :param bg: if provided this will become the background color. + :param bold: if provided this will enable or disable bold mode. + :param dim: if provided this will enable or disable dim mode. This is + badly supported. + :param underline: if provided this will enable or disable underline. + :param blink: if provided this will enable or disable blinking. + :param reverse: if provided this will enable or disable inverse + rendering (foreground becomes background and the + other way round). + :param reset: by default a reset-all code is added at the end of the + string which means that styles do not carry over. This + can be disabled to compose styles. + """ + bits = [] + if fg: + try: + bits.append('\033[%dm' % (_ansi_colors.index(fg) + 30)) + except ValueError: + raise TypeError('Unknown color %r' % fg) + if bg: + try: + bits.append('\033[%dm' % (_ansi_colors.index(bg) + 40)) + except ValueError: + raise TypeError('Unknown color %r' % bg) + if bold is not None: + bits.append('\033[%dm' % (1 if bold else 22)) + if dim is not None: + bits.append('\033[%dm' % (2 if dim else 22)) + if underline is not None: + bits.append('\033[%dm' % (4 if underline else 24)) + if blink is not None: + bits.append('\033[%dm' % (5 if blink else 25)) + if reverse is not None: + bits.append('\033[%dm' % (7 if reverse else 27)) + bits.append(text) + if reset: + bits.append(_ansi_reset_all) + return ''.join(bits) + + +def unstyle(text): + """Removes ANSI styling information from a string. Usually it's not + necessary to use this function as Click's echo function will + automatically remove styling if necessary. + + .. versionadded:: 2.0 + + :param text: the text to remove style information from. + """ + return strip_ansi(text) + + +def secho(text, file=None, nl=True, err=False, color=None, **styles): + """This function combines :func:`echo` and :func:`style` into one + call. As such the following two calls are the same:: + + click.secho('Hello World!', fg='green') + click.echo(click.style('Hello World!', fg='green')) + + All keyword arguments are forwarded to the underlying functions + depending on which one they go with. + + .. versionadded:: 2.0 + """ + return echo(style(text, **styles), file=file, nl=nl, err=err, color=color) + + +def edit(text=None, editor=None, env=None, require_save=True, + extension='.txt', filename=None): + r"""Edits the given text in the defined editor. If an editor is given + (should be the full path to the executable but the regular operating + system search path is used for finding the executable) it overrides + the detected editor. Optionally, some environment variables can be + used. If the editor is closed without changes, `None` is returned. In + case a file is edited directly the return value is always `None` and + `require_save` and `extension` are ignored. + + If the editor cannot be opened a :exc:`UsageError` is raised. + + Note for Windows: to simplify cross-platform usage, the newlines are + automatically converted from POSIX to Windows and vice versa. As such, + the message here will have ``\n`` as newline markers. + + :param text: the text to edit. + :param editor: optionally the editor to use. Defaults to automatic + detection. + :param env: environment variables to forward to the editor. + :param require_save: if this is true, then not saving in the editor + will make the return value become `None`. + :param extension: the extension to tell the editor about. This defaults + to `.txt` but changing this might change syntax + highlighting. + :param filename: if provided it will edit this file instead of the + provided text contents. It will not use a temporary + file as an indirection in that case. + """ + from ._termui_impl import Editor + editor = Editor(editor=editor, env=env, require_save=require_save, + extension=extension) + if filename is None: + return editor.edit(text) + editor.edit_file(filename) + + +def launch(url, wait=False, locate=False): + """This function launches the given URL (or filename) in the default + viewer application for this file type. If this is an executable, it + might launch the executable in a new session. The return value is + the exit code of the launched application. Usually, ``0`` indicates + success. + + Examples:: + + click.launch('http://click.pocoo.org/') + click.launch('/my/downloaded/file', locate=True) + + .. versionadded:: 2.0 + + :param url: URL or filename of the thing to launch. + :param wait: waits for the program to stop. + :param locate: if this is set to `True` then instead of launching the + application associated with the URL it will attempt to + launch a file manager with the file located. This + might have weird effects if the URL does not point to + the filesystem. + """ + from ._termui_impl import open_url + return open_url(url, wait=wait, locate=locate) + + +# If this is provided, getchar() calls into this instead. This is used +# for unittesting purposes. +_getchar = None + + +def getchar(echo=False): + """Fetches a single character from the terminal and returns it. This + will always return a unicode character and under certain rare + circumstances this might return more than one character. The + situations which more than one character is returned is when for + whatever reason multiple characters end up in the terminal buffer or + standard input was not actually a terminal. + + Note that this will always read from the terminal, even if something + is piped into the standard input. + + .. versionadded:: 2.0 + + :param echo: if set to `True`, the character read will also show up on + the terminal. The default is to not show it. + """ + f = _getchar + if f is None: + from ._termui_impl import getchar as f + return f(echo) + + +def pause(info='Press any key to continue ...', err=False): + """This command stops execution and waits for the user to press any + key to continue. This is similar to the Windows batch "pause" + command. If the program is not run through a terminal, this command + will instead do nothing. + + .. versionadded:: 2.0 + + .. versionadded:: 4.0 + Added the `err` parameter. + + :param info: the info string to print before pausing. + :param err: if set to message goes to ``stderr`` instead of + ``stdout``, the same as with echo. + """ + if not isatty(sys.stdin) or not isatty(sys.stdout): + return + try: + if info: + echo(info, nl=False, err=err) + try: + getchar() + except (KeyboardInterrupt, EOFError): + pass + finally: + if info: + echo(err=err) diff --git a/website/web/Lib/site-packages/click/testing.py b/website/web/Lib/site-packages/click/testing.py new file mode 100644 index 000000000..4416c7741 --- /dev/null +++ b/website/web/Lib/site-packages/click/testing.py @@ -0,0 +1,322 @@ +import os +import sys +import shutil +import tempfile +import contextlib + +from ._compat import iteritems, PY2 + + +# If someone wants to vendor click, we want to ensure the +# correct package is discovered. Ideally we could use a +# relative import here but unfortunately Python does not +# support that. +clickpkg = sys.modules[__name__.rsplit('.', 1)[0]] + + +if PY2: + from cStringIO import StringIO +else: + import io + from ._compat import _find_binary_reader + + +class EchoingStdin(object): + + def __init__(self, input, output): + self._input = input + self._output = output + + def __getattr__(self, x): + return getattr(self._input, x) + + def _echo(self, rv): + self._output.write(rv) + return rv + + def read(self, n=-1): + return self._echo(self._input.read(n)) + + def readline(self, n=-1): + return self._echo(self._input.readline(n)) + + def readlines(self): + return [self._echo(x) for x in self._input.readlines()] + + def __iter__(self): + return iter(self._echo(x) for x in self._input) + + def __repr__(self): + return repr(self._input) + + +def make_input_stream(input, charset): + # Is already an input stream. + if hasattr(input, 'read'): + if PY2: + return input + rv = _find_binary_reader(input) + if rv is not None: + return rv + raise TypeError('Could not find binary reader for input stream.') + + if input is None: + input = b'' + elif not isinstance(input, bytes): + input = input.encode(charset) + if PY2: + return StringIO(input) + return io.BytesIO(input) + + +class Result(object): + """Holds the captured result of an invoked CLI script.""" + + def __init__(self, runner, output_bytes, exit_code, exception, + exc_info=None): + #: The runner that created the result + self.runner = runner + #: The output as bytes. + self.output_bytes = output_bytes + #: The exit code as integer. + self.exit_code = exit_code + #: The exception that happend if one did. + self.exception = exception + #: The traceback + self.exc_info = exc_info + + @property + def output(self): + """The output as unicode string.""" + return self.output_bytes.decode(self.runner.charset, 'replace') \ + .replace('\r\n', '\n') + + def __repr__(self): + return '' % ( + self.exception and repr(self.exception) or 'okay', + ) + + +class CliRunner(object): + """The CLI runner provides functionality to invoke a Click command line + script for unittesting purposes in a isolated environment. This only + works in single-threaded systems without any concurrency as it changes the + global interpreter state. + + :param charset: the character set for the input and output data. This is + UTF-8 by default and should not be changed currently as + the reporting to Click only works in Python 2 properly. + :param env: a dictionary with environment variables for overriding. + :param echo_stdin: if this is set to `True`, then reading from stdin writes + to stdout. This is useful for showing examples in + some circumstances. Note that regular prompts + will automatically echo the input. + """ + + def __init__(self, charset=None, env=None, echo_stdin=False): + if charset is None: + charset = 'utf-8' + self.charset = charset + self.env = env or {} + self.echo_stdin = echo_stdin + + def get_default_prog_name(self, cli): + """Given a command object it will return the default program name + for it. The default is the `name` attribute or ``"root"`` if not + set. + """ + return cli.name or 'root' + + def make_env(self, overrides=None): + """Returns the environment overrides for invoking a script.""" + rv = dict(self.env) + if overrides: + rv.update(overrides) + return rv + + @contextlib.contextmanager + def isolation(self, input=None, env=None, color=False): + """A context manager that sets up the isolation for invoking of a + command line tool. This sets up stdin with the given input data + and `os.environ` with the overrides from the given dictionary. + This also rebinds some internals in Click to be mocked (like the + prompt functionality). + + This is automatically done in the :meth:`invoke` method. + + .. versionadded:: 4.0 + The ``color`` parameter was added. + + :param input: the input stream to put into sys.stdin. + :param env: the environment overrides as dictionary. + :param color: whether the output should contain color codes. The + application can still override this explicitly. + """ + input = make_input_stream(input, self.charset) + + old_stdin = sys.stdin + old_stdout = sys.stdout + old_stderr = sys.stderr + old_forced_width = clickpkg.formatting.FORCED_WIDTH + clickpkg.formatting.FORCED_WIDTH = 80 + + env = self.make_env(env) + + if PY2: + sys.stdout = sys.stderr = bytes_output = StringIO() + if self.echo_stdin: + input = EchoingStdin(input, bytes_output) + else: + bytes_output = io.BytesIO() + if self.echo_stdin: + input = EchoingStdin(input, bytes_output) + input = io.TextIOWrapper(input, encoding=self.charset) + sys.stdout = sys.stderr = io.TextIOWrapper( + bytes_output, encoding=self.charset) + + sys.stdin = input + + def visible_input(prompt=None): + sys.stdout.write(prompt or '') + val = input.readline().rstrip('\r\n') + sys.stdout.write(val + '\n') + sys.stdout.flush() + return val + + def hidden_input(prompt=None): + sys.stdout.write((prompt or '') + '\n') + sys.stdout.flush() + return input.readline().rstrip('\r\n') + + def _getchar(echo): + char = sys.stdin.read(1) + if echo: + sys.stdout.write(char) + sys.stdout.flush() + return char + + default_color = color + def should_strip_ansi(stream=None, color=None): + if color is None: + return not default_color + return not color + + old_visible_prompt_func = clickpkg.termui.visible_prompt_func + old_hidden_prompt_func = clickpkg.termui.hidden_prompt_func + old__getchar_func = clickpkg.termui._getchar + old_should_strip_ansi = clickpkg.utils.should_strip_ansi + clickpkg.termui.visible_prompt_func = visible_input + clickpkg.termui.hidden_prompt_func = hidden_input + clickpkg.termui._getchar = _getchar + clickpkg.utils.should_strip_ansi = should_strip_ansi + + old_env = {} + try: + for key, value in iteritems(env): + old_env[key] = os.environ.get(key) + if value is None: + try: + del os.environ[key] + except Exception: + pass + else: + os.environ[key] = value + yield bytes_output + finally: + for key, value in iteritems(old_env): + if value is None: + try: + del os.environ[key] + except Exception: + pass + else: + os.environ[key] = value + sys.stdout = old_stdout + sys.stderr = old_stderr + sys.stdin = old_stdin + clickpkg.termui.visible_prompt_func = old_visible_prompt_func + clickpkg.termui.hidden_prompt_func = old_hidden_prompt_func + clickpkg.termui._getchar = old__getchar_func + clickpkg.utils.should_strip_ansi = old_should_strip_ansi + clickpkg.formatting.FORCED_WIDTH = old_forced_width + + def invoke(self, cli, args=None, input=None, env=None, + catch_exceptions=True, color=False, **extra): + """Invokes a command in an isolated environment. The arguments are + forwarded directly to the command line script, the `extra` keyword + arguments are passed to the :meth:`~clickpkg.Command.main` function of + the command. + + This returns a :class:`Result` object. + + .. versionadded:: 3.0 + The ``catch_exceptions`` parameter was added. + + .. versionchanged:: 3.0 + The result object now has an `exc_info` attribute with the + traceback if available. + + .. versionadded:: 4.0 + The ``color`` parameter was added. + + :param cli: the command to invoke + :param args: the arguments to invoke + :param input: the input data for `sys.stdin`. + :param env: the environment overrides. + :param catch_exceptions: Whether to catch any other exceptions than + ``SystemExit``. + :param extra: the keyword arguments to pass to :meth:`main`. + :param color: whether the output should contain color codes. The + application can still override this explicitly. + """ + exc_info = None + with self.isolation(input=input, env=env, color=color) as out: + exception = None + exit_code = 0 + + try: + cli.main(args=args or (), + prog_name=self.get_default_prog_name(cli), **extra) + except SystemExit as e: + if e.code != 0: + exception = e + + exc_info = sys.exc_info() + + exit_code = e.code + if not isinstance(exit_code, int): + sys.stdout.write(str(exit_code)) + sys.stdout.write('\n') + exit_code = 1 + except Exception as e: + if not catch_exceptions: + raise + exception = e + exit_code = -1 + exc_info = sys.exc_info() + finally: + sys.stdout.flush() + output = out.getvalue() + + return Result(runner=self, + output_bytes=output, + exit_code=exit_code, + exception=exception, + exc_info=exc_info) + + @contextlib.contextmanager + def isolated_filesystem(self): + """A context manager that creates a temporary folder and changes + the current working directory to it for isolated filesystem tests. + """ + cwd = os.getcwd() + t = tempfile.mkdtemp() + os.chdir(t) + try: + yield t + finally: + os.chdir(cwd) + try: + shutil.rmtree(t) + except (OSError, IOError): + pass diff --git a/website/web/Lib/site-packages/click/types.py b/website/web/Lib/site-packages/click/types.py new file mode 100644 index 000000000..36390026d --- /dev/null +++ b/website/web/Lib/site-packages/click/types.py @@ -0,0 +1,550 @@ +import os +import stat + +from ._compat import open_stream, text_type, filename_to_ui, \ + get_filesystem_encoding, get_streerror, _get_argv_encoding, PY2 +from .exceptions import BadParameter +from .utils import safecall, LazyFile + + +class ParamType(object): + """Helper for converting values through types. The following is + necessary for a valid type: + + * it needs a name + * it needs to pass through None unchanged + * it needs to convert from a string + * it needs to convert its result type through unchanged + (eg: needs to be idempotent) + * it needs to be able to deal with param and context being `None`. + This can be the case when the object is used with prompt + inputs. + """ + is_composite = False + + #: the descriptive name of this type + name = None + + #: if a list of this type is expected and the value is pulled from a + #: string environment variable, this is what splits it up. `None` + #: means any whitespace. For all parameters the general rule is that + #: whitespace splits them up. The exception are paths and files which + #: are split by ``os.path.pathsep`` by default (":" on Unix and ";" on + #: Windows). + envvar_list_splitter = None + + def __call__(self, value, param=None, ctx=None): + if value is not None: + return self.convert(value, param, ctx) + + def get_metavar(self, param): + """Returns the metavar default for this param if it provides one.""" + + def get_missing_message(self, param): + """Optionally might return extra information about a missing + parameter. + + .. versionadded:: 2.0 + """ + + def convert(self, value, param, ctx): + """Converts the value. This is not invoked for values that are + `None` (the missing value). + """ + return value + + def split_envvar_value(self, rv): + """Given a value from an environment variable this splits it up + into small chunks depending on the defined envvar list splitter. + + If the splitter is set to `None`, which means that whitespace splits, + then leading and trailing whitespace is ignored. Otherwise, leading + and trailing splitters usually lead to empty items being included. + """ + return (rv or '').split(self.envvar_list_splitter) + + def fail(self, message, param=None, ctx=None): + """Helper method to fail with an invalid value message.""" + raise BadParameter(message, ctx=ctx, param=param) + + +class CompositeParamType(ParamType): + is_composite = True + + @property + def arity(self): + raise NotImplementedError() + + +class FuncParamType(ParamType): + + def __init__(self, func): + self.name = func.__name__ + self.func = func + + def convert(self, value, param, ctx): + try: + return self.func(value) + except ValueError: + try: + value = text_type(value) + except UnicodeError: + value = str(value).decode('utf-8', 'replace') + self.fail(value, param, ctx) + + +class UnprocessedParamType(ParamType): + name = 'text' + + def convert(self, value, param, ctx): + return value + + def __repr__(self): + return 'UNPROCESSED' + + +class StringParamType(ParamType): + name = 'text' + + def convert(self, value, param, ctx): + if isinstance(value, bytes): + enc = _get_argv_encoding() + try: + value = value.decode(enc) + except UnicodeError: + fs_enc = get_filesystem_encoding() + if fs_enc != enc: + try: + value = value.decode(fs_enc) + except UnicodeError: + value = value.decode('utf-8', 'replace') + return value + return value + + def __repr__(self): + return 'STRING' + + +class Choice(ParamType): + """The choice type allows a value to be checked against a fixed set of + supported values. All of these values have to be strings. + + See :ref:`choice-opts` for an example. + """ + name = 'choice' + + def __init__(self, choices): + self.choices = choices + + def get_metavar(self, param): + return '[%s]' % '|'.join(self.choices) + + def get_missing_message(self, param): + return 'Choose from %s.' % ', '.join(self.choices) + + def convert(self, value, param, ctx): + # Exact match + if value in self.choices: + return value + + # Match through normalization + if ctx is not None and \ + ctx.token_normalize_func is not None: + value = ctx.token_normalize_func(value) + for choice in self.choices: + if ctx.token_normalize_func(choice) == value: + return choice + + self.fail('invalid choice: %s. (choose from %s)' % + (value, ', '.join(self.choices)), param, ctx) + + def __repr__(self): + return 'Choice(%r)' % list(self.choices) + + +class IntParamType(ParamType): + name = 'integer' + + def convert(self, value, param, ctx): + try: + return int(value) + except (ValueError, UnicodeError): + self.fail('%s is not a valid integer' % value, param, ctx) + + def __repr__(self): + return 'INT' + + +class IntRange(IntParamType): + """A parameter that works similar to :data:`click.INT` but restricts + the value to fit into a range. The default behavior is to fail if the + value falls outside the range, but it can also be silently clamped + between the two edges. + + See :ref:`ranges` for an example. + """ + name = 'integer range' + + def __init__(self, min=None, max=None, clamp=False): + self.min = min + self.max = max + self.clamp = clamp + + def convert(self, value, param, ctx): + rv = IntParamType.convert(self, value, param, ctx) + if self.clamp: + if self.min is not None and rv < self.min: + return self.min + if self.max is not None and rv > self.max: + return self.max + if self.min is not None and rv < self.min or \ + self.max is not None and rv > self.max: + if self.min is None: + self.fail('%s is bigger than the maximum valid value ' + '%s.' % (rv, self.max), param, ctx) + elif self.max is None: + self.fail('%s is smaller than the minimum valid value ' + '%s.' % (rv, self.min), param, ctx) + else: + self.fail('%s is not in the valid range of %s to %s.' + % (rv, self.min, self.max), param, ctx) + return rv + + def __repr__(self): + return 'IntRange(%r, %r)' % (self.min, self.max) + + +class BoolParamType(ParamType): + name = 'boolean' + + def convert(self, value, param, ctx): + if isinstance(value, bool): + return bool(value) + value = value.lower() + if value in ('true', '1', 'yes', 'y'): + return True + elif value in ('false', '0', 'no', 'n'): + return False + self.fail('%s is not a valid boolean' % value, param, ctx) + + def __repr__(self): + return 'BOOL' + + +class FloatParamType(ParamType): + name = 'float' + + def convert(self, value, param, ctx): + try: + return float(value) + except (UnicodeError, ValueError): + self.fail('%s is not a valid floating point value' % + value, param, ctx) + + def __repr__(self): + return 'FLOAT' + + +class UUIDParameterType(ParamType): + name = 'uuid' + + def convert(self, value, param, ctx): + import uuid + try: + if PY2 and isinstance(value, text_type): + value = value.encode('ascii') + return uuid.UUID(value) + except (UnicodeError, ValueError): + self.fail('%s is not a valid UUID value' % value, param, ctx) + + def __repr__(self): + return 'UUID' + + +class File(ParamType): + """Declares a parameter to be a file for reading or writing. The file + is automatically closed once the context tears down (after the command + finished working). + + Files can be opened for reading or writing. The special value ``-`` + indicates stdin or stdout depending on the mode. + + By default, the file is opened for reading text data, but it can also be + opened in binary mode or for writing. The encoding parameter can be used + to force a specific encoding. + + The `lazy` flag controls if the file should be opened immediately or + upon first IO. The default is to be non lazy for standard input and + output streams as well as files opened for reading, lazy otherwise. + + Starting with Click 2.0, files can also be opened atomically in which + case all writes go into a separate file in the same folder and upon + completion the file will be moved over to the original location. This + is useful if a file regularly read by other users is modified. + + See :ref:`file-args` for more information. + """ + name = 'filename' + envvar_list_splitter = os.path.pathsep + + def __init__(self, mode='r', encoding=None, errors='strict', lazy=None, + atomic=False): + self.mode = mode + self.encoding = encoding + self.errors = errors + self.lazy = lazy + self.atomic = atomic + + def resolve_lazy_flag(self, value): + if self.lazy is not None: + return self.lazy + if value == '-': + return False + elif 'w' in self.mode: + return True + return False + + def convert(self, value, param, ctx): + try: + if hasattr(value, 'read') or hasattr(value, 'write'): + return value + + lazy = self.resolve_lazy_flag(value) + + if lazy: + f = LazyFile(value, self.mode, self.encoding, self.errors, + atomic=self.atomic) + if ctx is not None: + ctx.call_on_close(f.close_intelligently) + return f + + f, should_close = open_stream(value, self.mode, + self.encoding, self.errors, + atomic=self.atomic) + # If a context is provided, we automatically close the file + # at the end of the context execution (or flush out). If a + # context does not exist, it's the caller's responsibility to + # properly close the file. This for instance happens when the + # type is used with prompts. + if ctx is not None: + if should_close: + ctx.call_on_close(safecall(f.close)) + else: + ctx.call_on_close(safecall(f.flush)) + return f + except (IOError, OSError) as e: + self.fail('Could not open file: %s: %s' % ( + filename_to_ui(value), + get_streerror(e), + ), param, ctx) + + +class Path(ParamType): + """The path type is similar to the :class:`File` type but it performs + different checks. First of all, instead of returning an open file + handle it returns just the filename. Secondly, it can perform various + basic checks about what the file or directory should be. + + .. versionchanged:: 6.0 + `allow_dash` was added. + + :param exists: if set to true, the file or directory needs to exist for + this value to be valid. If this is not required and a + file does indeed not exist, then all further checks are + silently skipped. + :param file_okay: controls if a file is a possible value. + :param dir_okay: controls if a directory is a possible value. + :param writable: if true, a writable check is performed. + :param readable: if true, a readable check is performed. + :param resolve_path: if this is true, then the path is fully resolved + before the value is passed onwards. This means + that it's absolute and symlinks are resolved. + :param allow_dash: If this is set to `True`, a single dash to indicate + standard streams is permitted. + :param type: optionally a string type that should be used to + represent the path. The default is `None` which + means the return value will be either bytes or + unicode depending on what makes most sense given the + input data Click deals with. + """ + envvar_list_splitter = os.path.pathsep + + def __init__(self, exists=False, file_okay=True, dir_okay=True, + writable=False, readable=True, resolve_path=False, + allow_dash=False, path_type=None): + self.exists = exists + self.file_okay = file_okay + self.dir_okay = dir_okay + self.writable = writable + self.readable = readable + self.resolve_path = resolve_path + self.allow_dash = allow_dash + self.type = path_type + + if self.file_okay and not self.dir_okay: + self.name = 'file' + self.path_type = 'File' + if self.dir_okay and not self.file_okay: + self.name = 'directory' + self.path_type = 'Directory' + else: + self.name = 'path' + self.path_type = 'Path' + + def coerce_path_result(self, rv): + if self.type is not None and not isinstance(rv, self.type): + if self.type is text_type: + rv = rv.decode(get_filesystem_encoding()) + else: + rv = rv.encode(get_filesystem_encoding()) + return rv + + def convert(self, value, param, ctx): + rv = value + + is_dash = self.file_okay and self.allow_dash and rv in (b'-', '-') + + if not is_dash: + if self.resolve_path: + rv = os.path.realpath(rv) + + try: + st = os.stat(rv) + except OSError: + if not self.exists: + return self.coerce_path_result(rv) + self.fail('%s "%s" does not exist.' % ( + self.path_type, + filename_to_ui(value) + ), param, ctx) + + if not self.file_okay and stat.S_ISREG(st.st_mode): + self.fail('%s "%s" is a file.' % ( + self.path_type, + filename_to_ui(value) + ), param, ctx) + if not self.dir_okay and stat.S_ISDIR(st.st_mode): + self.fail('%s "%s" is a directory.' % ( + self.path_type, + filename_to_ui(value) + ), param, ctx) + if self.writable and not os.access(value, os.W_OK): + self.fail('%s "%s" is not writable.' % ( + self.path_type, + filename_to_ui(value) + ), param, ctx) + if self.readable and not os.access(value, os.R_OK): + self.fail('%s "%s" is not readable.' % ( + self.path_type, + filename_to_ui(value) + ), param, ctx) + + return self.coerce_path_result(rv) + + +class Tuple(CompositeParamType): + """The default behavior of Click is to apply a type on a value directly. + This works well in most cases, except for when `nargs` is set to a fixed + count and different types should be used for different items. In this + case the :class:`Tuple` type can be used. This type can only be used + if `nargs` is set to a fixed number. + + For more information see :ref:`tuple-type`. + + This can be selected by using a Python tuple literal as a type. + + :param types: a list of types that should be used for the tuple items. + """ + + def __init__(self, types): + self.types = [convert_type(ty) for ty in types] + + @property + def name(self): + return "<" + " ".join(ty.name for ty in self.types) + ">" + + @property + def arity(self): + return len(self.types) + + def convert(self, value, param, ctx): + if len(value) != len(self.types): + raise TypeError('It would appear that nargs is set to conflict ' + 'with the composite type arity.') + return tuple(ty(x, param, ctx) for ty, x in zip(self.types, value)) + + +def convert_type(ty, default=None): + """Converts a callable or python ty into the most appropriate param + ty. + """ + guessed_type = False + if ty is None and default is not None: + if isinstance(default, tuple): + ty = tuple(map(type, default)) + else: + ty = type(default) + guessed_type = True + + if isinstance(ty, tuple): + return Tuple(ty) + if isinstance(ty, ParamType): + return ty + if ty is text_type or ty is str or ty is None: + return STRING + if ty is int: + return INT + # Booleans are only okay if not guessed. This is done because for + # flags the default value is actually a bit of a lie in that it + # indicates which of the flags is the one we want. See get_default() + # for more information. + if ty is bool and not guessed_type: + return BOOL + if ty is float: + return FLOAT + if guessed_type: + return STRING + + # Catch a common mistake + if __debug__: + try: + if issubclass(ty, ParamType): + raise AssertionError('Attempted to use an uninstantiated ' + 'parameter type (%s).' % ty) + except TypeError: + pass + return FuncParamType(ty) + + +#: A dummy parameter type that just does nothing. From a user's +#: perspective this appears to just be the same as `STRING` but internally +#: no string conversion takes place. This is necessary to achieve the +#: same bytes/unicode behavior on Python 2/3 in situations where you want +#: to not convert argument types. This is usually useful when working +#: with file paths as they can appear in bytes and unicode. +#: +#: For path related uses the :class:`Path` type is a better choice but +#: there are situations where an unprocessed type is useful which is why +#: it is is provided. +#: +#: .. versionadded:: 4.0 +UNPROCESSED = UnprocessedParamType() + +#: A unicode string parameter type which is the implicit default. This +#: can also be selected by using ``str`` as type. +STRING = StringParamType() + +#: An integer parameter. This can also be selected by using ``int`` as +#: type. +INT = IntParamType() + +#: A floating point value parameter. This can also be selected by using +#: ``float`` as type. +FLOAT = FloatParamType() + +#: A boolean parameter. This is the default for boolean flags. This can +#: also be selected by using ``bool`` as a type. +BOOL = BoolParamType() + +#: A UUID parameter. +UUID = UUIDParameterType() diff --git a/website/web/Lib/site-packages/click/utils.py b/website/web/Lib/site-packages/click/utils.py new file mode 100644 index 000000000..eee626d3f --- /dev/null +++ b/website/web/Lib/site-packages/click/utils.py @@ -0,0 +1,415 @@ +import os +import sys + +from .globals import resolve_color_default + +from ._compat import text_type, open_stream, get_filesystem_encoding, \ + get_streerror, string_types, PY2, binary_streams, text_streams, \ + filename_to_ui, auto_wrap_for_ansi, strip_ansi, should_strip_ansi, \ + _default_text_stdout, _default_text_stderr, is_bytes, WIN + +if not PY2: + from ._compat import _find_binary_writer +elif WIN: + from ._winconsole import _get_windows_argv, \ + _hash_py_argv, _initial_argv_hash + + +echo_native_types = string_types + (bytes, bytearray) + + +def _posixify(name): + return '-'.join(name.split()).lower() + + +def safecall(func): + """Wraps a function so that it swallows exceptions.""" + def wrapper(*args, **kwargs): + try: + return func(*args, **kwargs) + except Exception: + pass + return wrapper + + +def make_str(value): + """Converts a value into a valid string.""" + if isinstance(value, bytes): + try: + return value.decode(get_filesystem_encoding()) + except UnicodeError: + return value.decode('utf-8', 'replace') + return text_type(value) + + +def make_default_short_help(help, max_length=45): + words = help.split() + total_length = 0 + result = [] + done = False + + for word in words: + if word[-1:] == '.': + done = True + new_length = result and 1 + len(word) or len(word) + if total_length + new_length > max_length: + result.append('...') + done = True + else: + if result: + result.append(' ') + result.append(word) + if done: + break + total_length += new_length + + return ''.join(result) + + +class LazyFile(object): + """A lazy file works like a regular file but it does not fully open + the file but it does perform some basic checks early to see if the + filename parameter does make sense. This is useful for safely opening + files for writing. + """ + + def __init__(self, filename, mode='r', encoding=None, errors='strict', + atomic=False): + self.name = filename + self.mode = mode + self.encoding = encoding + self.errors = errors + self.atomic = atomic + + if filename == '-': + self._f, self.should_close = open_stream(filename, mode, + encoding, errors) + else: + if 'r' in mode: + # Open and close the file in case we're opening it for + # reading so that we can catch at least some errors in + # some cases early. + open(filename, mode).close() + self._f = None + self.should_close = True + + def __getattr__(self, name): + return getattr(self.open(), name) + + def __repr__(self): + if self._f is not None: + return repr(self._f) + return '' % (self.name, self.mode) + + def open(self): + """Opens the file if it's not yet open. This call might fail with + a :exc:`FileError`. Not handling this error will produce an error + that Click shows. + """ + if self._f is not None: + return self._f + try: + rv, self.should_close = open_stream(self.name, self.mode, + self.encoding, + self.errors, + atomic=self.atomic) + except (IOError, OSError) as e: + from .exceptions import FileError + raise FileError(self.name, hint=get_streerror(e)) + self._f = rv + return rv + + def close(self): + """Closes the underlying file, no matter what.""" + if self._f is not None: + self._f.close() + + def close_intelligently(self): + """This function only closes the file if it was opened by the lazy + file wrapper. For instance this will never close stdin. + """ + if self.should_close: + self.close() + + def __enter__(self): + return self + + def __exit__(self, exc_type, exc_value, tb): + self.close_intelligently() + + def __iter__(self): + self.open() + return iter(self._f) + + +class KeepOpenFile(object): + + def __init__(self, file): + self._file = file + + def __getattr__(self, name): + return getattr(self._file, name) + + def __enter__(self): + return self + + def __exit__(self, exc_type, exc_value, tb): + pass + + def __repr__(self): + return repr(self._file) + + def __iter__(self): + return iter(self._file) + + +def echo(message=None, file=None, nl=True, err=False, color=None): + """Prints a message plus a newline to the given file or stdout. On + first sight, this looks like the print function, but it has improved + support for handling Unicode and binary data that does not fail no + matter how badly configured the system is. + + Primarily it means that you can print binary data as well as Unicode + data on both 2.x and 3.x to the given file in the most appropriate way + possible. This is a very carefree function as in that it will try its + best to not fail. As of Click 6.0 this includes support for unicode + output on the Windows console. + + In addition to that, if `colorama`_ is installed, the echo function will + also support clever handling of ANSI codes. Essentially it will then + do the following: + + - add transparent handling of ANSI color codes on Windows. + - hide ANSI codes automatically if the destination file is not a + terminal. + + .. _colorama: http://pypi.python.org/pypi/colorama + + .. versionchanged:: 6.0 + As of Click 6.0 the echo function will properly support unicode + output on the windows console. Not that click does not modify + the interpreter in any way which means that `sys.stdout` or the + print statement or function will still not provide unicode support. + + .. versionchanged:: 2.0 + Starting with version 2.0 of Click, the echo function will work + with colorama if it's installed. + + .. versionadded:: 3.0 + The `err` parameter was added. + + .. versionchanged:: 4.0 + Added the `color` flag. + + :param message: the message to print + :param file: the file to write to (defaults to ``stdout``) + :param err: if set to true the file defaults to ``stderr`` instead of + ``stdout``. This is faster and easier than calling + :func:`get_text_stderr` yourself. + :param nl: if set to `True` (the default) a newline is printed afterwards. + :param color: controls if the terminal supports ANSI colors or not. The + default is autodetection. + """ + if file is None: + if err: + file = _default_text_stderr() + else: + file = _default_text_stdout() + + # Convert non bytes/text into the native string type. + if message is not None and not isinstance(message, echo_native_types): + message = text_type(message) + + if nl: + message = message or u'' + if isinstance(message, text_type): + message += u'\n' + else: + message += b'\n' + + # If there is a message, and we're in Python 3, and the value looks + # like bytes, we manually need to find the binary stream and write the + # message in there. This is done separately so that most stream + # types will work as you would expect. Eg: you can write to StringIO + # for other cases. + if message and not PY2 and is_bytes(message): + binary_file = _find_binary_writer(file) + if binary_file is not None: + file.flush() + binary_file.write(message) + binary_file.flush() + return + + # ANSI-style support. If there is no message or we are dealing with + # bytes nothing is happening. If we are connected to a file we want + # to strip colors. If we are on windows we either wrap the stream + # to strip the color or we use the colorama support to translate the + # ansi codes to API calls. + if message and not is_bytes(message): + color = resolve_color_default(color) + if should_strip_ansi(file, color): + message = strip_ansi(message) + elif WIN: + if auto_wrap_for_ansi is not None: + file = auto_wrap_for_ansi(file) + elif not color: + message = strip_ansi(message) + + if message: + file.write(message) + file.flush() + + +def get_binary_stream(name): + """Returns a system stream for byte processing. This essentially + returns the stream from the sys module with the given name but it + solves some compatibility issues between different Python versions. + Primarily this function is necessary for getting binary streams on + Python 3. + + :param name: the name of the stream to open. Valid names are ``'stdin'``, + ``'stdout'`` and ``'stderr'`` + """ + opener = binary_streams.get(name) + if opener is None: + raise TypeError('Unknown standard stream %r' % name) + return opener() + + +def get_text_stream(name, encoding=None, errors='strict'): + """Returns a system stream for text processing. This usually returns + a wrapped stream around a binary stream returned from + :func:`get_binary_stream` but it also can take shortcuts on Python 3 + for already correctly configured streams. + + :param name: the name of the stream to open. Valid names are ``'stdin'``, + ``'stdout'`` and ``'stderr'`` + :param encoding: overrides the detected default encoding. + :param errors: overrides the default error mode. + """ + opener = text_streams.get(name) + if opener is None: + raise TypeError('Unknown standard stream %r' % name) + return opener(encoding, errors) + + +def open_file(filename, mode='r', encoding=None, errors='strict', + lazy=False, atomic=False): + """This is similar to how the :class:`File` works but for manual + usage. Files are opened non lazy by default. This can open regular + files as well as stdin/stdout if ``'-'`` is passed. + + If stdin/stdout is returned the stream is wrapped so that the context + manager will not close the stream accidentally. This makes it possible + to always use the function like this without having to worry to + accidentally close a standard stream:: + + with open_file(filename) as f: + ... + + .. versionadded:: 3.0 + + :param filename: the name of the file to open (or ``'-'`` for stdin/stdout). + :param mode: the mode in which to open the file. + :param encoding: the encoding to use. + :param errors: the error handling for this file. + :param lazy: can be flipped to true to open the file lazily. + :param atomic: in atomic mode writes go into a temporary file and it's + moved on close. + """ + if lazy: + return LazyFile(filename, mode, encoding, errors, atomic=atomic) + f, should_close = open_stream(filename, mode, encoding, errors, + atomic=atomic) + if not should_close: + f = KeepOpenFile(f) + return f + + +def get_os_args(): + """This returns the argument part of sys.argv in the most appropriate + form for processing. What this means is that this return value is in + a format that works for Click to process but does not necessarily + correspond well to what's actually standard for the interpreter. + + On most environments the return value is ``sys.argv[:1]`` unchanged. + However if you are on Windows and running Python 2 the return value + will actually be a list of unicode strings instead because the + default behavior on that platform otherwise will not be able to + carry all possible values that sys.argv can have. + + .. versionadded:: 6.0 + """ + # We can only extract the unicode argv if sys.argv has not been + # changed since the startup of the application. + if PY2 and WIN and _initial_argv_hash == _hash_py_argv(): + return _get_windows_argv() + return sys.argv[1:] + + +def format_filename(filename, shorten=False): + """Formats a filename for user display. The main purpose of this + function is to ensure that the filename can be displayed at all. This + will decode the filename to unicode if necessary in a way that it will + not fail. Optionally, it can shorten the filename to not include the + full path to the filename. + + :param filename: formats a filename for UI display. This will also convert + the filename into unicode without failing. + :param shorten: this optionally shortens the filename to strip of the + path that leads up to it. + """ + if shorten: + filename = os.path.basename(filename) + return filename_to_ui(filename) + + +def get_app_dir(app_name, roaming=True, force_posix=False): + r"""Returns the config folder for the application. The default behavior + is to return whatever is most appropriate for the operating system. + + To give you an idea, for an app called ``"Foo Bar"``, something like + the following folders could be returned: + + Mac OS X: + ``~/Library/Application Support/Foo Bar`` + Mac OS X (POSIX): + ``~/.foo-bar`` + Unix: + ``~/.config/foo-bar`` + Unix (POSIX): + ``~/.foo-bar`` + Win XP (roaming): + ``C:\Documents and Settings\\Local Settings\Application Data\Foo Bar`` + Win XP (not roaming): + ``C:\Documents and Settings\\Application Data\Foo Bar`` + Win 7 (roaming): + ``C:\Users\\AppData\Roaming\Foo Bar`` + Win 7 (not roaming): + ``C:\Users\\AppData\Local\Foo Bar`` + + .. versionadded:: 2.0 + + :param app_name: the application name. This should be properly capitalized + and can contain whitespace. + :param roaming: controls if the folder should be roaming or not on Windows. + Has no affect otherwise. + :param force_posix: if this is set to `True` then on any POSIX system the + folder will be stored in the home folder with a leading + dot instead of the XDG config home or darwin's + application support folder. + """ + if WIN: + key = roaming and 'APPDATA' or 'LOCALAPPDATA' + folder = os.environ.get(key) + if folder is None: + folder = os.path.expanduser('~') + return os.path.join(folder, app_name) + if force_posix: + return os.path.join(os.path.expanduser('~/.' + _posixify(app_name))) + if sys.platform == 'darwin': + return os.path.join(os.path.expanduser( + '~/Library/Application Support'), app_name) + return os.path.join( + os.environ.get('XDG_CONFIG_HOME', os.path.expanduser('~/.config')), + _posixify(app_name)) diff --git a/website/web/Lib/site-packages/easy_install.py b/website/web/Lib/site-packages/easy_install.py new file mode 100644 index 000000000..d87e98403 --- /dev/null +++ b/website/web/Lib/site-packages/easy_install.py @@ -0,0 +1,5 @@ +"""Run the EasyInstall command""" + +if __name__ == '__main__': + from setuptools.command.easy_install import main + main() diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/PKG-INFO b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/PKG-INFO new file mode 100644 index 000000000..3fa645523 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/PKG-INFO @@ -0,0 +1,102 @@ +Metadata-Version: 1.1 +Name: emoji +Version: 0.4.5 +Summary: Emoji for Python +Home-page: https://github.com/carpedm20/emoji/ +Author: Taehoon Kim and Kevin Wurster +Author-email: carpedm20@gmail.com and wursterk@gmail.com +License: New BSD +Description: Emoji + ===== + + Emoji for Python. This project was inspired by `kyokomi `__. + + + Example + ------- + + The entire set of Emoji codes as defined by the `unicode consortium `__ + is supported in addition to a bunch of `aliases `__. By + default only the official list is enabled but doing ``emoji.emojize(use_aliases=True)`` enables + both the full list and aliases. + + .. code-block:: python + + >> import emoji + >> print(emoji.emojize('Python is :thumbs_up_sign:')) + Python is 👍 + >> print(emoji.emojize('Python is :thumbsup:', use_aliases=True)) + Python is 👍 + + + Installation + ------------ + + Via pip: + + .. code-block:: console + + $ pip install emoji --upgrade + + From master branch: + + .. code-block:: console + + $ git clone https://github.com/carpedm20/emoji.git + $ cd emoji + $ python setup.py install + + + Developing + ---------- + + .. code-block:: console + + $ git clone https://github.com/carpedm20/emoji.git + $ cd emoji + $ pip install -e .\[dev\] + $ nosetests + + The ``utils/get-codes-from-unicode-consortium.py`` may help when updating + ``unicode_codes.py`` but is not guaranteed to work. Generally speaking it + scrapes a table on the Unicode Consortium's website with + `BeautifulSoup `_ and prints the + contents to ``stdout`` in a more useful format. + + + Link + ---- + + `Emoji Cheat Sheet `__ + + `Official unicode list `__ + + + Authors + ------- + + Taehoon Kim / `@carpedm20 `__ + + Kevin Wurster / `@geowurster `__ +Keywords: emoji +Platform: UNKNOWN +Classifier: Development Status :: 4 - Beta +Classifier: Intended Audience :: Developers +Classifier: Intended Audience :: Information Technology +Classifier: License :: OSI Approved :: BSD License +Classifier: Operating System :: OS Independent +Classifier: Programming Language :: Python :: 2 +Classifier: Programming Language :: Python :: 2.6 +Classifier: Programming Language :: Python :: 2.7 +Classifier: Programming Language :: Python :: 3 +Classifier: Programming Language :: Python :: 3.2 +Classifier: Programming Language :: Python :: 3.3 +Classifier: Programming Language :: Python :: 3.4 +Classifier: Programming Language :: Python :: 3.5 +Classifier: Programming Language :: Python :: 3.6 +Classifier: Programming Language :: Python :: Implementation :: CPython +Classifier: Programming Language :: Python :: Implementation :: PyPy +Classifier: Programming Language :: Python +Classifier: Topic :: Internet :: WWW/HTTP :: Dynamic Content +Classifier: Topic :: Multimedia :: Graphics :: Presentation +Classifier: Topic :: Software Development :: Libraries :: Python Modules diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/SOURCES.txt b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/SOURCES.txt new file mode 100644 index 000000000..75c89c4a2 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/SOURCES.txt @@ -0,0 +1,18 @@ +CHANGES.md +LICENSE.txt +MANIFEST.in +README.rst +setup.cfg +setup.py +emoji/__init__.py +emoji/core.py +emoji/unicode_codes.py +emoji.egg-info/PKG-INFO +emoji.egg-info/SOURCES.txt +emoji.egg-info/dependency_links.txt +emoji.egg-info/requires.txt +emoji.egg-info/top_level.txt +emoji.egg-info/zip-safe +tests/__init__.py +tests/test_core.py +tests/test_unicode_codes.py \ No newline at end of file diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/dependency_links.txt b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/dependency_links.txt new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/dependency_links.txt @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/installed-files.txt b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/installed-files.txt new file mode 100644 index 000000000..57da17a55 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/installed-files.txt @@ -0,0 +1,12 @@ +..\emoji\core.py +..\emoji\unicode_codes.py +..\emoji\__init__.py +..\emoji\__pycache__\core.cpython-36.pyc +..\emoji\__pycache__\unicode_codes.cpython-36.pyc +..\emoji\__pycache__\__init__.cpython-36.pyc +dependency_links.txt +PKG-INFO +requires.txt +SOURCES.txt +top_level.txt +zip-safe diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/requires.txt b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/requires.txt new file mode 100644 index 000000000..93e2a63b9 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/requires.txt @@ -0,0 +1,5 @@ + +[dev] +nose +coverage +coveralls diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/top_level.txt b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/top_level.txt new file mode 100644 index 000000000..3a917a9c5 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/top_level.txt @@ -0,0 +1 @@ +emoji diff --git a/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/zip-safe b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/zip-safe new file mode 100644 index 000000000..8b1378917 --- /dev/null +++ b/website/web/Lib/site-packages/emoji-0.4.5-py3.6.egg-info/zip-safe @@ -0,0 +1 @@ + diff --git a/website/web/Lib/site-packages/emoji/__init__.py b/website/web/Lib/site-packages/emoji/__init__.py new file mode 100644 index 000000000..1bf6a8c3f --- /dev/null +++ b/website/web/Lib/site-packages/emoji/__init__.py @@ -0,0 +1,60 @@ +# -*- coding: UTF-8 -*- + + +""" +emoji for Python +~~~~~~~~~~~~~~~~ + +emoji terminal output for Python. + + >>> import emoji + >>> print(emoji.emojize('Python is :thumbsup:', use_aliases=True)) + Python is 👍 + >> print(emoji.emojize('Python is :thumbs_up_sign:')) + Python is 👍 +""" + + +from emoji.core import emojize +from emoji.core import demojize +from emoji.core import get_emoji_regexp +from emoji.unicode_codes import EMOJI_ALIAS_UNICODE +from emoji.unicode_codes import EMOJI_UNICODE +from emoji.unicode_codes import UNICODE_EMOJI +from emoji.unicode_codes import UNICODE_EMOJI_ALIAS + + +__version__ = '0.4.5' +__author__ = 'Taehoon Kim and Kevin Wurster' +__email__ = 'carpedm20@gmail.com and wursterk@gmail.com' +__source__ = 'https://github.com/carpedm20/emoji/' +__license__ = ''' +New BSD License + +Copyright (c) 2014-2015, Taehoon Kim and Kevin Wurster +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +* The names of its contributors may not be used to endorse or promote products + derived from this software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" +AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE +IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. +''' diff --git a/website/web/Lib/site-packages/emoji/core.py b/website/web/Lib/site-packages/emoji/core.py new file mode 100644 index 000000000..28cd12058 --- /dev/null +++ b/website/web/Lib/site-packages/emoji/core.py @@ -0,0 +1,94 @@ +# -*- coding: UTF-8 -*- + + +""" +emoji.core +~~~~~~~~~~ + +Core components for emoji. + +""" + + +import re +import sys + +from emoji import unicode_codes + + +__all__ = ['emojize', 'demojize', 'get_emoji_regexp'] + + +PY2 = sys.version_info[0] is 2 + +_EMOJI_REGEXP = None +_DEFAULT_DELIMITER = ":" + +def emojize(string, use_aliases=False, delimiters=(_DEFAULT_DELIMITER,_DEFAULT_DELIMITER)): + + """Replace emoji names in a string with unicode codes. + + :param string: String contains emoji names. + :param use_aliases: (optional) Enable emoji aliases. See ``emoji.UNICODE_EMOJI_ALIAS``. + :param delimiters: (optional) Use delimiters other than _DEFAULT_DELIMITER + >>> import emoji + >>> print(emoji.emojize("Python is fun :thumbsup:", use_aliases=True)) + Python is fun 👍 + >>> print(emoji.emojize("Python is fun :thumbs_up_sign:")) + Python is fun 👍 + >>> print(emoji.emojize("Python is fun __thumbs_up_sign__", delimiters = ("__", "__"))) + Python is fun 👍 + """ + + pattern = re.compile(u'(%s[a-zA-Z0-9\+\-_&.ô’Åéãíç()!#*]+%s)' % delimiters) + + def replace(match): + mg = match.group(1).replace(delimiters[0], _DEFAULT_DELIMITER).replace(delimiters[1], _DEFAULT_DELIMITER) + if use_aliases: + return unicode_codes.EMOJI_ALIAS_UNICODE.get(mg, mg) + else: + return unicode_codes.EMOJI_UNICODE.get(mg, mg) + + return pattern.sub(replace, string) + + +def demojize(string, delimiters=(_DEFAULT_DELIMITER,_DEFAULT_DELIMITER)): + + """Replace unicode emoji in a string with emoji shortcodes. Useful for storage. + + :param string: String contains unicode characters. MUST BE UNICODE. + :param delimiters: (optional) User delimiters other than _DEFAULT_DELIMITER + >>> import emoji + >>> print(emoji.emojize("Python is fun :thumbs_up_sign:")) + Python is fun 👍 + >>> print(emoji.demojize(u"Python is fun 👍")) + Python is fun :thumbs_up_sign: + >>> print(emoji.demojize("Unicode is tricky 😯".decode('utf-8'))) + Unicode is tricky :hushed_face: + >>> print(emoji.demojize("Unicode is tricky 😯".decode('utf-8'), delimiters=(" __", "__ "))) + Unicode is tricky :hushed_face: + """ + + def replace(match): + val = unicode_codes.UNICODE_EMOJI.get(match.group(0), match.group(0)) + return delimiters[0] + val[1:-1] + delimiters[1] + + return get_emoji_regexp().sub(replace, string) + + +def get_emoji_regexp(): + + """Returns compiled regular expression that matches emojis defined in + ``emoji.UNICODE_EMOJI_ALIAS``. The regular expression is only compiled once. + """ + + global _EMOJI_REGEXP + # Build emoji regexp once + if _EMOJI_REGEXP is None: + # Sort emojis by length to make sure mulit-character emojis are + # matched first + emojis = sorted(unicode_codes.EMOJI_UNICODE.values(), key=len, + reverse=True) + pattern = u'(' + u'|'.join(re.escape(u) for u in emojis) + u')' + _EMOJI_REGEXP = re.compile(pattern) + return _EMOJI_REGEXP diff --git a/website/web/Lib/site-packages/emoji/unicode_codes.py b/website/web/Lib/site-packages/emoji/unicode_codes.py new file mode 100644 index 000000000..37c941d26 --- /dev/null +++ b/website/web/Lib/site-packages/emoji/unicode_codes.py @@ -0,0 +1,3711 @@ +# -*- coding: UTF-8 -*- + + +""" +Data literal storing emoji names and unicode codes +""" + + +__all__ = ['EMOJI_UNICODE', 'UNICODE_EMOJI', 'EMOJI_ALIAS_UNICODE', 'UNICODE_EMOJI_ALIAS'] + + +EMOJI_UNICODE = { + u':1st_place_medal:': u'\U0001F947', + u':2nd_place_medal:': u'\U0001F948', + u':3rd_place_medal:': u'\U0001F949', + u':AB_button_(blood_type):': u'\U0001F18E', + u':ATM_sign:': u'\U0001F3E7', + u':A_button_(blood_type):': u'\U0001F170', + u':Afghanistan:': u'\U0001F1E6 \U0001F1EB', + u':Albania:': u'\U0001F1E6 \U0001F1F1', + u':Algeria:': u'\U0001F1E9 \U0001F1FF', + u':American_Samoa:': u'\U0001F1E6 \U0001F1F8', + u':Andorra:': u'\U0001F1E6 \U0001F1E9', + u':Angola:': u'\U0001F1E6 \U0001F1F4', + u':Anguilla:': u'\U0001F1E6 \U0001F1EE', + u':Antarctica:': u'\U0001F1E6 \U0001F1F6', + u':Antigua_&_Barbuda:': u'\U0001F1E6 \U0001F1EC', + u':Aquarius:': u'\U00002652', + u':Argentina:': u'\U0001F1E6 \U0001F1F7', + u':Aries:': u'\U00002648', + u':Armenia:': u'\U0001F1E6 \U0001F1F2', + u':Aruba:': u'\U0001F1E6 \U0001F1FC', + u':Ascension_Island:': u'\U0001F1E6 \U0001F1E8', + u':Australia:': u'\U0001F1E6 \U0001F1FA', + u':Austria:': u'\U0001F1E6 \U0001F1F9', + u':Azerbaijan:': u'\U0001F1E6 \U0001F1FF', + u':BACK_arrow:': u'\U0001F519', + u':B_button_(blood_type):': u'\U0001F171', + u':Bahamas:': u'\U0001F1E7 \U0001F1F8', + u':Bahrain:': u'\U0001F1E7 \U0001F1ED', + u':Bangladesh:': u'\U0001F1E7 \U0001F1E9', + u':Barbados:': u'\U0001F1E7 \U0001F1E7', + u':Belarus:': u'\U0001F1E7 \U0001F1FE', + u':Belgium:': u'\U0001F1E7 \U0001F1EA', + u':Belize:': u'\U0001F1E7 \U0001F1FF', + u':Benin:': u'\U0001F1E7 \U0001F1EF', + u':Bermuda:': u'\U0001F1E7 \U0001F1F2', + u':Bhutan:': u'\U0001F1E7 \U0001F1F9', + u':Bolivia:': u'\U0001F1E7 \U0001F1F4', + u':Bosnia_&_Herzegovina:': u'\U0001F1E7 \U0001F1E6', + u':Botswana:': u'\U0001F1E7 \U0001F1FC', + u':Bouvet_Island:': u'\U0001F1E7 \U0001F1FB', + u':Brazil:': u'\U0001F1E7 \U0001F1F7', + u':British_Indian_Ocean_Territory:': u'\U0001F1EE \U0001F1F4', + u':British_Virgin_Islands:': u'\U0001F1FB \U0001F1EC', + u':Brunei:': u'\U0001F1E7 \U0001F1F3', + u':Bulgaria:': u'\U0001F1E7 \U0001F1EC', + u':Burkina_Faso:': u'\U0001F1E7 \U0001F1EB', + u':Burundi:': u'\U0001F1E7 \U0001F1EE', + u':CL_button:': u'\U0001F191', + u':COOL_button:': u'\U0001F192', + u':Cambodia:': u'\U0001F1F0 \U0001F1ED', + u':Cameroon:': u'\U0001F1E8 \U0001F1F2', + u':Canada:': u'\U0001F1E8 \U0001F1E6', + u':Canary_Islands:': u'\U0001F1EE \U0001F1E8', + u':Cancer:': u'\U0000264B', + u':Cape_Verde:': u'\U0001F1E8 \U0001F1FB', + u':Capricorn:': u'\U00002651', + u':Caribbean_Netherlands:': u'\U0001F1E7 \U0001F1F6', + u':Cayman_Islands:': u'\U0001F1F0 \U0001F1FE', + u':Central_African_Republic:': u'\U0001F1E8 \U0001F1EB', + u':Ceuta_&_Melilla:': u'\U0001F1EA \U0001F1E6', + u':Chad:': u'\U0001F1F9 \U0001F1E9', + u':Chile:': u'\U0001F1E8 \U0001F1F1', + u':China:': u'\U0001F1E8 \U0001F1F3', + u':Christmas_Island:': u'\U0001F1E8 \U0001F1FD', + u':Christmas_tree:': u'\U0001F384', + u':Clipperton_Island:': u'\U0001F1E8 \U0001F1F5', + u':Cocos_(Keeling)_Islands:': u'\U0001F1E8 \U0001F1E8', + u':Colombia:': u'\U0001F1E8 \U0001F1F4', + u':Comoros:': u'\U0001F1F0 \U0001F1F2', + u':Congo_-_Brazzaville:': u'\U0001F1E8 \U0001F1EC', + u':Congo_-_Kinshasa:': u'\U0001F1E8 \U0001F1E9', + u':Cook_Islands:': u'\U0001F1E8 \U0001F1F0', + u':Costa_Rica:': u'\U0001F1E8 \U0001F1F7', + u':Croatia:': u'\U0001F1ED \U0001F1F7', + u':Cuba:': u'\U0001F1E8 \U0001F1FA', + u':Curaçao:': u'\U0001F1E8 \U0001F1FC', + u':Cyprus:': u'\U0001F1E8 \U0001F1FE', + u':Czech_Republic:': u'\U0001F1E8 \U0001F1FF', + u':Côte_d’Ivoire:': u'\U0001F1E8 \U0001F1EE', + u':Denmark:': u'\U0001F1E9 \U0001F1F0', + u':Diego_Garcia:': u'\U0001F1E9 \U0001F1EC', + u':Djibouti:': u'\U0001F1E9 \U0001F1EF', + u':Dominica:': u'\U0001F1E9 \U0001F1F2', + u':Dominican_Republic:': u'\U0001F1E9 \U0001F1F4', + u':END_arrow:': u'\U0001F51A', + u':Ecuador:': u'\U0001F1EA \U0001F1E8', + u':Egypt:': u'\U0001F1EA \U0001F1EC', + u':El_Salvador:': u'\U0001F1F8 \U0001F1FB', + u':Equatorial_Guinea:': u'\U0001F1EC \U0001F1F6', + u':Eritrea:': u'\U0001F1EA \U0001F1F7', + u':Estonia:': u'\U0001F1EA \U0001F1EA', + u':Ethiopia:': u'\U0001F1EA \U0001F1F9', + u':European_Union:': u'\U0001F1EA \U0001F1FA', + u':FREE_button:': u'\U0001F193', + u':Falkland_Islands:': u'\U0001F1EB \U0001F1F0', + u':Faroe_Islands:': u'\U0001F1EB \U0001F1F4', + u':Fiji:': u'\U0001F1EB \U0001F1EF', + u':Finland:': u'\U0001F1EB \U0001F1EE', + u':France:': u'\U0001F1EB \U0001F1F7', + u':French_Guiana:': u'\U0001F1EC \U0001F1EB', + u':French_Polynesia:': u'\U0001F1F5 \U0001F1EB', + u':French_Southern_Territories:': u'\U0001F1F9 \U0001F1EB', + u':Gabon:': u'\U0001F1EC \U0001F1E6', + u':Gambia:': u'\U0001F1EC \U0001F1F2', + u':Gemini:': u'\U0000264A', + u':Georgia:': u'\U0001F1EC \U0001F1EA', + u':Germany:': u'\U0001F1E9 \U0001F1EA', + u':Ghana:': u'\U0001F1EC \U0001F1ED', + u':Gibraltar:': u'\U0001F1EC \U0001F1EE', + u':Greece:': u'\U0001F1EC \U0001F1F7', + u':Greenland:': u'\U0001F1EC \U0001F1F1', + u':Grenada:': u'\U0001F1EC \U0001F1E9', + u':Guadeloupe:': u'\U0001F1EC \U0001F1F5', + u':Guam:': u'\U0001F1EC \U0001F1FA', + u':Guatemala:': u'\U0001F1EC \U0001F1F9', + u':Guernsey:': u'\U0001F1EC \U0001F1EC', + u':Guinea:': u'\U0001F1EC \U0001F1F3', + u':Guinea-Bissau:': u'\U0001F1EC \U0001F1FC', + u':Guyana:': u'\U0001F1EC \U0001F1FE', + u':Haiti:': u'\U0001F1ED \U0001F1F9', + u':Heard_&_McDonald_Islands:': u'\U0001F1ED \U0001F1F2', + u':Honduras:': u'\U0001F1ED \U0001F1F3', + u':Hong_Kong_SAR_China:': u'\U0001F1ED \U0001F1F0', + u':Hungary:': u'\U0001F1ED \U0001F1FA', + u':ID_button:': u'\U0001F194', + u':Iceland:': u'\U0001F1EE \U0001F1F8', + u':India:': u'\U0001F1EE \U0001F1F3', + u':Indonesia:': u'\U0001F1EE \U0001F1E9', + u':Iran:': u'\U0001F1EE \U0001F1F7', + u':Iraq:': u'\U0001F1EE \U0001F1F6', + u':Ireland:': u'\U0001F1EE \U0001F1EA', + u':Isle_of_Man:': u'\U0001F1EE \U0001F1F2', + u':Israel:': u'\U0001F1EE \U0001F1F1', + u':Italy:': u'\U0001F1EE \U0001F1F9', + u':Jamaica:': u'\U0001F1EF \U0001F1F2', + u':Japan:': u'\U0001F1EF \U0001F1F5', + u':Japanese_acceptable_button:': u'\U0001F251', + u':Japanese_application_button:': u'\U0001F238', + u':Japanese_bargain_button:': u'\U0001F250', + u':Japanese_castle:': u'\U0001F3EF', + u':Japanese_congratulations_button:': u'\U00003297', + u':Japanese_discount_button:': u'\U0001F239', + u':Japanese_dolls:': u'\U0001F38E', + u':Japanese_free_of_charge_button:': u'\U0001F21A', + u':Japanese_here_button:': u'\U0001F201', + u':Japanese_monthly_amount_button:': u'\U0001F237', + u':Japanese_no_vacancy_button:': u'\U0001F235', + u':Japanese_not_free_of_charge_button:': u'\U0001F236', + u':Japanese_open_for_business_button:': u'\U0001F23A', + u':Japanese_passing_grade_button:': u'\U0001F234', + u':Japanese_post_office:': u'\U0001F3E3', + u':Japanese_prohibited_button:': u'\U0001F232', + u':Japanese_reserved_button:': u'\U0001F22F', + u':Japanese_secret_button:': u'\U00003299', + u':Japanese_service_charge_button:': u'\U0001F202', + u':Japanese_symbol_for_beginner:': u'\U0001F530', + u':Japanese_vacancy_button:': u'\U0001F233', + u':Jersey:': u'\U0001F1EF \U0001F1EA', + u':Jordan:': u'\U0001F1EF \U0001F1F4', + u':Kazakhstan:': u'\U0001F1F0 \U0001F1FF', + u':Kenya:': u'\U0001F1F0 \U0001F1EA', + u':Kiribati:': u'\U0001F1F0 \U0001F1EE', + u':Kosovo:': u'\U0001F1FD \U0001F1F0', + u':Kuwait:': u'\U0001F1F0 \U0001F1FC', + u':Kyrgyzstan:': u'\U0001F1F0 \U0001F1EC', + u':Laos:': u'\U0001F1F1 \U0001F1E6', + u':Latvia:': u'\U0001F1F1 \U0001F1FB', + u':Lebanon:': u'\U0001F1F1 \U0001F1E7', + u':Leo:': u'\U0000264C', + u':Lesotho:': u'\U0001F1F1 \U0001F1F8', + u':Liberia:': u'\U0001F1F1 \U0001F1F7', + u':Libra:': u'\U0000264E', + u':Libya:': u'\U0001F1F1 \U0001F1FE', + u':Liechtenstein:': u'\U0001F1F1 \U0001F1EE', + u':Lithuania:': u'\U0001F1F1 \U0001F1F9', + u':Luxembourg:': u'\U0001F1F1 \U0001F1FA', + u':Macau_SAR_China:': u'\U0001F1F2 \U0001F1F4', + u':Macedonia:': u'\U0001F1F2 \U0001F1F0', + u':Madagascar:': u'\U0001F1F2 \U0001F1EC', + u':Malawi:': u'\U0001F1F2 \U0001F1FC', + u':Malaysia:': u'\U0001F1F2 \U0001F1FE', + u':Maldives:': u'\U0001F1F2 \U0001F1FB', + u':Mali:': u'\U0001F1F2 \U0001F1F1', + u':Malta:': u'\U0001F1F2 \U0001F1F9', + u':Marshall_Islands:': u'\U0001F1F2 \U0001F1ED', + u':Martinique:': u'\U0001F1F2 \U0001F1F6', + u':Mauritania:': u'\U0001F1F2 \U0001F1F7', + u':Mauritius:': u'\U0001F1F2 \U0001F1FA', + u':Mayotte:': u'\U0001F1FE \U0001F1F9', + u':Mexico:': u'\U0001F1F2 \U0001F1FD', + u':Micronesia:': u'\U0001F1EB \U0001F1F2', + u':Moldova:': u'\U0001F1F2 \U0001F1E9', + u':Monaco:': u'\U0001F1F2 \U0001F1E8', + u':Mongolia:': u'\U0001F1F2 \U0001F1F3', + u':Montenegro:': u'\U0001F1F2 \U0001F1EA', + u':Montserrat:': u'\U0001F1F2 \U0001F1F8', + u':Morocco:': u'\U0001F1F2 \U0001F1E6', + u':Mozambique:': u'\U0001F1F2 \U0001F1FF', + u':Mrs._Claus:': u'\U0001F936', + u':Mrs._Claus_dark_skin_tone:': u'\U0001F936 \U0001F3FF', + u':Mrs._Claus_light_skin_tone:': u'\U0001F936 \U0001F3FB', + u':Mrs._Claus_medium-dark_skin_tone:': u'\U0001F936 \U0001F3FE', + u':Mrs._Claus_medium-light_skin_tone:': u'\U0001F936 \U0001F3FC', + u':Mrs._Claus_medium_skin_tone:': u'\U0001F936 \U0001F3FD', + u':Myanmar_(Burma):': u'\U0001F1F2 \U0001F1F2', + u':NEW_button:': u'\U0001F195', + u':NG_button:': u'\U0001F196', + u':Namibia:': u'\U0001F1F3 \U0001F1E6', + u':Nauru:': u'\U0001F1F3 \U0001F1F7', + u':Nepal:': u'\U0001F1F3 \U0001F1F5', + u':Netherlands:': u'\U0001F1F3 \U0001F1F1', + u':New_Caledonia:': u'\U0001F1F3 \U0001F1E8', + u':New_Zealand:': u'\U0001F1F3 \U0001F1FF', + u':Nicaragua:': u'\U0001F1F3 \U0001F1EE', + u':Niger:': u'\U0001F1F3 \U0001F1EA', + u':Nigeria:': u'\U0001F1F3 \U0001F1EC', + u':Niue:': u'\U0001F1F3 \U0001F1FA', + u':Norfolk_Island:': u'\U0001F1F3 \U0001F1EB', + u':North_Korea:': u'\U0001F1F0 \U0001F1F5', + u':Northern_Mariana_Islands:': u'\U0001F1F2 \U0001F1F5', + u':Norway:': u'\U0001F1F3 \U0001F1F4', + u':OK_button:': u'\U0001F197', + u':OK_hand:': u'\U0001F44C', + u':OK_hand_dark_skin_tone:': u'\U0001F44C \U0001F3FF', + u':OK_hand_light_skin_tone:': u'\U0001F44C \U0001F3FB', + u':OK_hand_medium-dark_skin_tone:': u'\U0001F44C \U0001F3FE', + u':OK_hand_medium-light_skin_tone:': u'\U0001F44C \U0001F3FC', + u':OK_hand_medium_skin_tone:': u'\U0001F44C \U0001F3FD', + u':ON!_arrow:': u'\U0001F51B', + u':O_button_(blood_type):': u'\U0001F17E', + u':Oman:': u'\U0001F1F4 \U0001F1F2', + u':Ophiuchus:': u'\U000026CE', + u':P_button:': u'\U0001F17F', + u':Pakistan:': u'\U0001F1F5 \U0001F1F0', + u':Palau:': u'\U0001F1F5 \U0001F1FC', + u':Palestinian_Territories:': u'\U0001F1F5 \U0001F1F8', + u':Panama:': u'\U0001F1F5 \U0001F1E6', + u':Papua_New_Guinea:': u'\U0001F1F5 \U0001F1EC', + u':Paraguay:': u'\U0001F1F5 \U0001F1FE', + u':Peru:': u'\U0001F1F5 \U0001F1EA', + u':Philippines:': u'\U0001F1F5 \U0001F1ED', + u':Pisces:': u'\U00002653', + u':Pitcairn_Islands:': u'\U0001F1F5 \U0001F1F3', + u':Poland:': u'\U0001F1F5 \U0001F1F1', + u':Portugal:': u'\U0001F1F5 \U0001F1F9', + u':Puerto_Rico:': u'\U0001F1F5 \U0001F1F7', + u':Qatar:': u'\U0001F1F6 \U0001F1E6', + u':Romania:': u'\U0001F1F7 \U0001F1F4', + u':Russia:': u'\U0001F1F7 \U0001F1FA', + u':Rwanda:': u'\U0001F1F7 \U0001F1FC', + u':Réunion:': u'\U0001F1F7 \U0001F1EA', + u':SOON_arrow:': u'\U0001F51C', + u':SOS_button:': u'\U0001F198', + u':Sagittarius:': u'\U00002650', + u':Samoa:': u'\U0001F1FC \U0001F1F8', + u':San_Marino:': u'\U0001F1F8 \U0001F1F2', + u':Santa_Claus:': u'\U0001F385', + u':Santa_Claus_dark_skin_tone:': u'\U0001F385 \U0001F3FF', + u':Santa_Claus_light_skin_tone:': u'\U0001F385 \U0001F3FB', + u':Santa_Claus_medium-dark_skin_tone:': u'\U0001F385 \U0001F3FE', + u':Santa_Claus_medium-light_skin_tone:': u'\U0001F385 \U0001F3FC', + u':Santa_Claus_medium_skin_tone:': u'\U0001F385 \U0001F3FD', + u':Saudi_Arabia:': u'\U0001F1F8 \U0001F1E6', + u':Scorpius:': u'\U0000264F', + u':Senegal:': u'\U0001F1F8 \U0001F1F3', + u':Serbia:': u'\U0001F1F7 \U0001F1F8', + u':Seychelles:': u'\U0001F1F8 \U0001F1E8', + u':Sierra_Leone:': u'\U0001F1F8 \U0001F1F1', + u':Singapore:': u'\U0001F1F8 \U0001F1EC', + u':Sint_Maarten:': u'\U0001F1F8 \U0001F1FD', + u':Slovakia:': u'\U0001F1F8 \U0001F1F0', + u':Slovenia:': u'\U0001F1F8 \U0001F1EE', + u':Solomon_Islands:': u'\U0001F1F8 \U0001F1E7', + u':Somalia:': u'\U0001F1F8 \U0001F1F4', + u':South_Africa:': u'\U0001F1FF \U0001F1E6', + u':South_Georgia_&_South_Sandwich_Islands:': u'\U0001F1EC \U0001F1F8', + u':South_Korea:': u'\U0001F1F0 \U0001F1F7', + u':South_Sudan:': u'\U0001F1F8 \U0001F1F8', + u':Spain:': u'\U0001F1EA \U0001F1F8', + u':Sri_Lanka:': u'\U0001F1F1 \U0001F1F0', + u':St._Barthélemy:': u'\U0001F1E7 \U0001F1F1', + u':St._Helena:': u'\U0001F1F8 \U0001F1ED', + u':St._Kitts_&_Nevis:': u'\U0001F1F0 \U0001F1F3', + u':St._Lucia:': u'\U0001F1F1 \U0001F1E8', + u':St._Martin:': u'\U0001F1F2 \U0001F1EB', + u':St._Pierre_&_Miquelon:': u'\U0001F1F5 \U0001F1F2', + u':St._Vincent_&_Grenadines:': u'\U0001F1FB \U0001F1E8', + u':Statue_of_Liberty:': u'\U0001F5FD', + u':Sudan:': u'\U0001F1F8 \U0001F1E9', + u':Suriname:': u'\U0001F1F8 \U0001F1F7', + u':Svalbard_&_Jan_Mayen:': u'\U0001F1F8 \U0001F1EF', + u':Swaziland:': u'\U0001F1F8 \U0001F1FF', + u':Sweden:': u'\U0001F1F8 \U0001F1EA', + u':Switzerland:': u'\U0001F1E8 \U0001F1ED', + u':Syria:': u'\U0001F1F8 \U0001F1FE', + u':São_Tomé_&_Príncipe:': u'\U0001F1F8 \U0001F1F9', + u':TOP_arrow:': u'\U0001F51D', + u':Taiwan:': u'\U0001F1F9 \U0001F1FC', + u':Tajikistan:': u'\U0001F1F9 \U0001F1EF', + u':Tanzania:': u'\U0001F1F9 \U0001F1FF', + u':Taurus:': u'\U00002649', + u':Thailand:': u'\U0001F1F9 \U0001F1ED', + u':Timor-Leste:': u'\U0001F1F9 \U0001F1F1', + u':Togo:': u'\U0001F1F9 \U0001F1EC', + u':Tokelau:': u'\U0001F1F9 \U0001F1F0', + u':Tokyo_tower:': u'\U0001F5FC', + u':Tonga:': u'\U0001F1F9 \U0001F1F4', + u':Trinidad_&_Tobago:': u'\U0001F1F9 \U0001F1F9', + u':Tristan_da_Cunha:': u'\U0001F1F9 \U0001F1E6', + u':Tunisia:': u'\U0001F1F9 \U0001F1F3', + u':Turkey:': u'\U0001F1F9 \U0001F1F7', + u':Turkmenistan:': u'\U0001F1F9 \U0001F1F2', + u':Turks_&_Caicos_Islands:': u'\U0001F1F9 \U0001F1E8', + u':Tuvalu:': u'\U0001F1F9 \U0001F1FB', + u':U.S._Outlying_Islands:': u'\U0001F1FA \U0001F1F2', + u':U.S._Virgin_Islands:': u'\U0001F1FB \U0001F1EE', + u':UP!_button:': u'\U0001F199', + u':Uganda:': u'\U0001F1FA \U0001F1EC', + u':Ukraine:': u'\U0001F1FA \U0001F1E6', + u':United_Arab_Emirates:': u'\U0001F1E6 \U0001F1EA', + u':United_Kingdom:': u'\U0001F1EC \U0001F1E7', + u':United_Nations:': u'\U0001F1FA \U0001F1F3', + u':United_States:': u'\U0001F1FA \U0001F1F8', + u':Uruguay:': u'\U0001F1FA \U0001F1FE', + u':Uzbekistan:': u'\U0001F1FA \U0001F1FF', + u':VS_button:': u'\U0001F19A', + u':Vanuatu:': u'\U0001F1FB \U0001F1FA', + u':Vatican_City:': u'\U0001F1FB \U0001F1E6', + u':Venezuela:': u'\U0001F1FB \U0001F1EA', + u':Vietnam:': u'\U0001F1FB \U0001F1F3', + u':Virgo:': u'\U0000264D', + u':Wallis_&_Futuna:': u'\U0001F1FC \U0001F1EB', + u':Western_Sahara:': u'\U0001F1EA \U0001F1ED', + u':Yemen:': u'\U0001F1FE \U0001F1EA', + u':Zambia:': u'\U0001F1FF \U0001F1F2', + u':Zimbabwe:': u'\U0001F1FF \U0001F1FC', + u':admission_tickets:': u'\U0001F39F', + u':aerial_tramway:': u'\U0001F6A1', + u':airplane:': u'\U00002708', + u':airplane_arrival:': u'\U0001F6EC', + u':airplane_departure:': u'\U0001F6EB', + u':alarm_clock:': u'\U000023F0', + u':alembic:': u'\U00002697', + u':alien:': u'\U0001F47D', + u':alien_monster:': u'\U0001F47E', + u':ambulance:': u'\U0001F691', + u':american_football:': u'\U0001F3C8', + u':amphora:': u'\U0001F3FA', + u':anchor:': u'\U00002693', + u':anger_symbol:': u'\U0001F4A2', + u':angry_face:': u'\U0001F620', + u':angry_face_with_horns:': u'\U0001F47F', + u':anguished_face:': u'\U0001F627', + u':ant:': u'\U0001F41C', + u':antenna_bars:': u'\U0001F4F6', + u':anticlockwise_arrows_button:': u'\U0001F504', + u':articulated_lorry:': u'\U0001F69B', + u':artist_palette:': u'\U0001F3A8', + u':astonished_face:': u'\U0001F632', + u':atom_symbol:': u'\U0000269B', + u':automobile:': u'\U0001F697', + u':avocado:': u'\U0001F951', + u':baby:': u'\U0001F476', + u':baby_angel:': u'\U0001F47C', + u':baby_angel_dark_skin_tone:': u'\U0001F47C \U0001F3FF', + u':baby_angel_light_skin_tone:': u'\U0001F47C \U0001F3FB', + u':baby_angel_medium-dark_skin_tone:': u'\U0001F47C \U0001F3FE', + u':baby_angel_medium-light_skin_tone:': u'\U0001F47C \U0001F3FC', + u':baby_angel_medium_skin_tone:': u'\U0001F47C \U0001F3FD', + u':baby_bottle:': u'\U0001F37C', + u':baby_chick:': u'\U0001F424', + u':baby_dark_skin_tone:': u'\U0001F476 \U0001F3FF', + u':baby_light_skin_tone:': u'\U0001F476 \U0001F3FB', + u':baby_medium-dark_skin_tone:': u'\U0001F476 \U0001F3FE', + u':baby_medium-light_skin_tone:': u'\U0001F476 \U0001F3FC', + u':baby_medium_skin_tone:': u'\U0001F476 \U0001F3FD', + u':baby_symbol:': u'\U0001F6BC', + u':backhand_index_pointing_down:': u'\U0001F447', + u':backhand_index_pointing_down_dark_skin_tone:': u'\U0001F447 \U0001F3FF', + u':backhand_index_pointing_down_light_skin_tone:': u'\U0001F447 \U0001F3FB', + u':backhand_index_pointing_down_medium-dark_skin_tone:': u'\U0001F447 \U0001F3FE', + u':backhand_index_pointing_down_medium-light_skin_tone:': u'\U0001F447 \U0001F3FC', + u':backhand_index_pointing_down_medium_skin_tone:': u'\U0001F447 \U0001F3FD', + u':backhand_index_pointing_left:': u'\U0001F448', + u':backhand_index_pointing_left_dark_skin_tone:': u'\U0001F448 \U0001F3FF', + u':backhand_index_pointing_left_light_skin_tone:': u'\U0001F448 \U0001F3FB', + u':backhand_index_pointing_left_medium-dark_skin_tone:': u'\U0001F448 \U0001F3FE', + u':backhand_index_pointing_left_medium-light_skin_tone:': u'\U0001F448 \U0001F3FC', + u':backhand_index_pointing_left_medium_skin_tone:': u'\U0001F448 \U0001F3FD', + u':backhand_index_pointing_right:': u'\U0001F449', + u':backhand_index_pointing_right_dark_skin_tone:': u'\U0001F449 \U0001F3FF', + u':backhand_index_pointing_right_light_skin_tone:': u'\U0001F449 \U0001F3FB', + u':backhand_index_pointing_right_medium-dark_skin_tone:': u'\U0001F449 \U0001F3FE', + u':backhand_index_pointing_right_medium-light_skin_tone:': u'\U0001F449 \U0001F3FC', + u':backhand_index_pointing_right_medium_skin_tone:': u'\U0001F449 \U0001F3FD', + u':backhand_index_pointing_up:': u'\U0001F446', + u':backhand_index_pointing_up_dark_skin_tone:': u'\U0001F446 \U0001F3FF', + u':backhand_index_pointing_up_light_skin_tone:': u'\U0001F446 \U0001F3FB', + u':backhand_index_pointing_up_medium-dark_skin_tone:': u'\U0001F446 \U0001F3FE', + u':backhand_index_pointing_up_medium-light_skin_tone:': u'\U0001F446 \U0001F3FC', + u':backhand_index_pointing_up_medium_skin_tone:': u'\U0001F446 \U0001F3FD', + u':bacon:': u'\U0001F953', + u':badminton:': u'\U0001F3F8', + u':baggage_claim:': u'\U0001F6C4', + u':baguette_bread:': u'\U0001F956', + u':balance_scale:': u'\U00002696', + u':balloon:': u'\U0001F388', + u':ballot_box_with_ballot:': u'\U0001F5F3', + u':ballot_box_with_check:': u'\U00002611', + u':banana:': u'\U0001F34C', + u':bank:': u'\U0001F3E6', + u':bar_chart:': u'\U0001F4CA', + u':barber_pole:': u'\U0001F488', + u':baseball:': u'\U000026BE', + u':basketball:': u'\U0001F3C0', + u':bat:': u'\U0001F987', + u':bathtub:': u'\U0001F6C1', + u':battery:': u'\U0001F50B', + u':beach_with_umbrella:': u'\U0001F3D6', + u':bear_face:': u'\U0001F43B', + u':beating_heart:': u'\U0001F493', + u':bed:': u'\U0001F6CF', + u':beer_mug:': u'\U0001F37A', + u':bell:': u'\U0001F514', + u':bell_with_slash:': u'\U0001F515', + u':bellhop_bell:': u'\U0001F6CE', + u':bento_box:': u'\U0001F371', + u':bicycle:': u'\U0001F6B2', + u':bikini:': u'\U0001F459', + u':biohazard:': u'\U00002623', + u':bird:': u'\U0001F426', + u':birthday_cake:': u'\U0001F382', + u':black_circle:': u'\U000026AB', + u':black_flag:': u'\U0001F3F4', + u':black_heart:': u'\U0001F5A4', + u':black_large_square:': u'\U00002B1B', + u':black_medium-small_square:': u'\U000025FE', + u':black_medium_square:': u'\U000025FC', + u':black_nib:': u'\U00002712', + u':black_small_square:': u'\U000025AA', + u':black_square_button:': u'\U0001F532', + u':blond-haired_man:': u'\U0001F471 \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_man_dark_skin_tone:': u'\U0001F471 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_man_light_skin_tone:': u'\U0001F471 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_man_medium-dark_skin_tone:': u'\U0001F471 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_man_medium-light_skin_tone:': u'\U0001F471 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_man_medium_skin_tone:': u'\U0001F471 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':blond-haired_person:': u'\U0001F471', + u':blond-haired_person_dark_skin_tone:': u'\U0001F471 \U0001F3FF', + u':blond-haired_person_light_skin_tone:': u'\U0001F471 \U0001F3FB', + u':blond-haired_person_medium-dark_skin_tone:': u'\U0001F471 \U0001F3FE', + u':blond-haired_person_medium-light_skin_tone:': u'\U0001F471 \U0001F3FC', + u':blond-haired_person_medium_skin_tone:': u'\U0001F471 \U0001F3FD', + u':blond-haired_woman:': u'\U0001F471 \U0000200D \U00002640 \U0000FE0F', + u':blond-haired_woman_dark_skin_tone:': u'\U0001F471 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':blond-haired_woman_light_skin_tone:': u'\U0001F471 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':blond-haired_woman_medium-dark_skin_tone:': u'\U0001F471 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':blond-haired_woman_medium-light_skin_tone:': u'\U0001F471 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':blond-haired_woman_medium_skin_tone:': u'\U0001F471 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':blossom:': u'\U0001F33C', + u':blowfish:': u'\U0001F421', + u':blue_book:': u'\U0001F4D8', + u':blue_circle:': u'\U0001F535', + u':blue_heart:': u'\U0001F499', + u':boar:': u'\U0001F417', + u':bomb:': u'\U0001F4A3', + u':bookmark:': u'\U0001F516', + u':bookmark_tabs:': u'\U0001F4D1', + u':books:': u'\U0001F4DA', + u':bottle_with_popping_cork:': u'\U0001F37E', + u':bouquet:': u'\U0001F490', + u':bow_and_arrow:': u'\U0001F3F9', + u':bowling:': u'\U0001F3B3', + u':boxing_glove:': u'\U0001F94A', + u':boy:': u'\U0001F466', + u':boy_dark_skin_tone:': u'\U0001F466 \U0001F3FF', + u':boy_light_skin_tone:': u'\U0001F466 \U0001F3FB', + u':boy_medium-dark_skin_tone:': u'\U0001F466 \U0001F3FE', + u':boy_medium-light_skin_tone:': u'\U0001F466 \U0001F3FC', + u':boy_medium_skin_tone:': u'\U0001F466 \U0001F3FD', + u':bread:': u'\U0001F35E', + u':bride_with_veil:': u'\U0001F470', + u':bride_with_veil_dark_skin_tone:': u'\U0001F470 \U0001F3FF', + u':bride_with_veil_light_skin_tone:': u'\U0001F470 \U0001F3FB', + u':bride_with_veil_medium-dark_skin_tone:': u'\U0001F470 \U0001F3FE', + u':bride_with_veil_medium-light_skin_tone:': u'\U0001F470 \U0001F3FC', + u':bride_with_veil_medium_skin_tone:': u'\U0001F470 \U0001F3FD', + u':bridge_at_night:': u'\U0001F309', + u':briefcase:': u'\U0001F4BC', + u':bright_button:': u'\U0001F506', + u':broken_heart:': u'\U0001F494', + u':bug:': u'\U0001F41B', + u':building_construction:': u'\U0001F3D7', + u':burrito:': u'\U0001F32F', + u':bus:': u'\U0001F68C', + u':bus_stop:': u'\U0001F68F', + u':bust_in_silhouette:': u'\U0001F464', + u':busts_in_silhouette:': u'\U0001F465', + u':butterfly:': u'\U0001F98B', + u':cactus:': u'\U0001F335', + u':calendar:': u'\U0001F4C5', + u':call_me_hand:': u'\U0001F919', + u':call_me_hand_dark_skin_tone:': u'\U0001F919 \U0001F3FF', + u':call_me_hand_light_skin_tone:': u'\U0001F919 \U0001F3FB', + u':call_me_hand_medium-dark_skin_tone:': u'\U0001F919 \U0001F3FE', + u':call_me_hand_medium-light_skin_tone:': u'\U0001F919 \U0001F3FC', + u':call_me_hand_medium_skin_tone:': u'\U0001F919 \U0001F3FD', + u':camel:': u'\U0001F42A', + u':camera:': u'\U0001F4F7', + u':camera_with_flash:': u'\U0001F4F8', + u':camping:': u'\U0001F3D5', + u':candle:': u'\U0001F56F', + u':candy:': u'\U0001F36C', + u':canoe:': u'\U0001F6F6', + u':card_file_box:': u'\U0001F5C3', + u':card_index:': u'\U0001F4C7', + u':card_index_dividers:': u'\U0001F5C2', + u':carousel_horse:': u'\U0001F3A0', + u':carp_streamer:': u'\U0001F38F', + u':carrot:': u'\U0001F955', + u':castle:': u'\U0001F3F0', + u':cat:': u'\U0001F408', + u':cat_face:': u'\U0001F431', + u':cat_face_with_tears_of_joy:': u'\U0001F639', + u':cat_face_with_wry_smile:': u'\U0001F63C', + u':chains:': u'\U000026D3', + u':chart_decreasing:': u'\U0001F4C9', + u':chart_increasing:': u'\U0001F4C8', + u':chart_increasing_with_yen:': u'\U0001F4B9', + u':cheese_wedge:': u'\U0001F9C0', + u':chequered_flag:': u'\U0001F3C1', + u':cherries:': u'\U0001F352', + u':cherry_blossom:': u'\U0001F338', + u':chestnut:': u'\U0001F330', + u':chicken:': u'\U0001F414', + u':children_crossing:': u'\U0001F6B8', + u':chipmunk:': u'\U0001F43F', + u':chocolate_bar:': u'\U0001F36B', + u':church:': u'\U000026EA', + u':cigarette:': u'\U0001F6AC', + u':cinema:': u'\U0001F3A6', + u':circled_M:': u'\U000024C2', + u':circus_tent:': u'\U0001F3AA', + u':cityscape:': u'\U0001F3D9', + u':cityscape_at_dusk:': u'\U0001F306', + u':clamp:': u'\U0001F5DC', + u':clapper_board:': u'\U0001F3AC', + u':clapping_hands:': u'\U0001F44F', + u':clapping_hands_dark_skin_tone:': u'\U0001F44F \U0001F3FF', + u':clapping_hands_light_skin_tone:': u'\U0001F44F \U0001F3FB', + u':clapping_hands_medium-dark_skin_tone:': u'\U0001F44F \U0001F3FE', + u':clapping_hands_medium-light_skin_tone:': u'\U0001F44F \U0001F3FC', + u':clapping_hands_medium_skin_tone:': u'\U0001F44F \U0001F3FD', + u':classical_building:': u'\U0001F3DB', + u':clinking_beer_mugs:': u'\U0001F37B', + u':clinking_glasses:': u'\U0001F942', + u':clipboard:': u'\U0001F4CB', + u':clockwise_vertical_arrows:': u'\U0001F503', + u':closed_book:': u'\U0001F4D5', + u':closed_mailbox_with_lowered_flag:': u'\U0001F4EA', + u':closed_mailbox_with_raised_flag:': u'\U0001F4EB', + u':closed_umbrella:': u'\U0001F302', + u':cloud:': u'\U00002601', + u':cloud_with_lightning:': u'\U0001F329', + u':cloud_with_lightning_and_rain:': u'\U000026C8', + u':cloud_with_rain:': u'\U0001F327', + u':cloud_with_snow:': u'\U0001F328', + u':clown_face:': u'\U0001F921', + u':club_suit:': u'\U00002663', + u':clutch_bag:': u'\U0001F45D', + u':cocktail_glass:': u'\U0001F378', + u':coffin:': u'\U000026B0', + u':collision:': u'\U0001F4A5', + u':comet:': u'\U00002604', + u':computer_disk:': u'\U0001F4BD', + u':computer_mouse:': u'\U0001F5B1', + u':confetti_ball:': u'\U0001F38A', + u':confounded_face:': u'\U0001F616', + u':confused_face:': u'\U0001F615', + u':construction:': u'\U0001F6A7', + u':construction_worker:': u'\U0001F477', + u':construction_worker_dark_skin_tone:': u'\U0001F477 \U0001F3FF', + u':construction_worker_light_skin_tone:': u'\U0001F477 \U0001F3FB', + u':construction_worker_medium-dark_skin_tone:': u'\U0001F477 \U0001F3FE', + u':construction_worker_medium-light_skin_tone:': u'\U0001F477 \U0001F3FC', + u':construction_worker_medium_skin_tone:': u'\U0001F477 \U0001F3FD', + u':control_knobs:': u'\U0001F39B', + u':convenience_store:': u'\U0001F3EA', + u':cooked_rice:': u'\U0001F35A', + u':cookie:': u'\U0001F36A', + u':cooking:': u'\U0001F373', + u':copyright:': u'\U000000A9', + u':couch_and_lamp:': u'\U0001F6CB', + u':couple_with_heart:': u'\U0001F491', + u':couple_with_heart_man_man:': u'\U0001F468 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F468', + u':couple_with_heart_woman_man:': u'\U0001F469 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F468', + u':couple_with_heart_woman_woman:': u'\U0001F469 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F469', + u':cow:': u'\U0001F404', + u':cow_face:': u'\U0001F42E', + u':cowboy_hat_face:': u'\U0001F920', + u':crab:': u'\U0001F980', + u':crayon:': u'\U0001F58D', + u':credit_card:': u'\U0001F4B3', + u':crescent_moon:': u'\U0001F319', + u':cricket:': u'\U0001F3CF', + u':crocodile:': u'\U0001F40A', + u':croissant:': u'\U0001F950', + u':cross_mark:': u'\U0000274C', + u':cross_mark_button:': u'\U0000274E', + u':crossed_fingers:': u'\U0001F91E', + u':crossed_fingers_dark_skin_tone:': u'\U0001F91E \U0001F3FF', + u':crossed_fingers_light_skin_tone:': u'\U0001F91E \U0001F3FB', + u':crossed_fingers_medium-dark_skin_tone:': u'\U0001F91E \U0001F3FE', + u':crossed_fingers_medium-light_skin_tone:': u'\U0001F91E \U0001F3FC', + u':crossed_fingers_medium_skin_tone:': u'\U0001F91E \U0001F3FD', + u':crossed_flags:': u'\U0001F38C', + u':crossed_swords:': u'\U00002694', + u':crown:': u'\U0001F451', + u':crying_cat_face:': u'\U0001F63F', + u':crying_face:': u'\U0001F622', + u':crystal_ball:': u'\U0001F52E', + u':cucumber:': u'\U0001F952', + u':curly_loop:': u'\U000027B0', + u':currency_exchange:': u'\U0001F4B1', + u':curry_rice:': u'\U0001F35B', + u':custard:': u'\U0001F36E', + u':customs:': u'\U0001F6C3', + u':cyclone:': u'\U0001F300', + u':dagger:': u'\U0001F5E1', + u':dango:': u'\U0001F361', + u':dark_skin_tone:': u'\U0001F3FF', + u':dashing_away:': u'\U0001F4A8', + u':deciduous_tree:': u'\U0001F333', + u':deer:': u'\U0001F98C', + u':delivery_truck:': u'\U0001F69A', + u':department_store:': u'\U0001F3EC', + u':derelict_house:': u'\U0001F3DA', + u':desert:': u'\U0001F3DC', + u':desert_island:': u'\U0001F3DD', + u':desktop_computer:': u'\U0001F5A5', + u':detective:': u'\U0001F575', + u':detective_dark_skin_tone:': u'\U0001F575 \U0001F3FF', + u':detective_light_skin_tone:': u'\U0001F575 \U0001F3FB', + u':detective_medium-dark_skin_tone:': u'\U0001F575 \U0001F3FE', + u':detective_medium-light_skin_tone:': u'\U0001F575 \U0001F3FC', + u':detective_medium_skin_tone:': u'\U0001F575 \U0001F3FD', + u':diamond_suit:': u'\U00002666', + u':diamond_with_a_dot:': u'\U0001F4A0', + u':dim_button:': u'\U0001F505', + u':direct_hit:': u'\U0001F3AF', + u':disappointed_but_relieved_face:': u'\U0001F625', + u':disappointed_face:': u'\U0001F61E', + u':dizzy:': u'\U0001F4AB', + u':dizzy_face:': u'\U0001F635', + u':dog:': u'\U0001F415', + u':dog_face:': u'\U0001F436', + u':dollar_banknote:': u'\U0001F4B5', + u':dolphin:': u'\U0001F42C', + u':door:': u'\U0001F6AA', + u':dotted_six-pointed_star:': u'\U0001F52F', + u':double_curly_loop:': u'\U000027BF', + u':double_exclamation_mark:': u'\U0000203C', + u':doughnut:': u'\U0001F369', + u':dove:': u'\U0001F54A', + u':down-left_arrow:': u'\U00002199', + u':down-right_arrow:': u'\U00002198', + u':down_arrow:': u'\U00002B07', + u':down_button:': u'\U0001F53D', + u':dragon:': u'\U0001F409', + u':dragon_face:': u'\U0001F432', + u':dress:': u'\U0001F457', + u':drooling_face:': u'\U0001F924', + u':droplet:': u'\U0001F4A7', + u':drum:': u'\U0001F941', + u':duck:': u'\U0001F986', + u':dvd:': u'\U0001F4C0', + u':e-mail:': u'\U0001F4E7', + u':eagle:': u'\U0001F985', + u':ear:': u'\U0001F442', + u':ear_dark_skin_tone:': u'\U0001F442 \U0001F3FF', + u':ear_light_skin_tone:': u'\U0001F442 \U0001F3FB', + u':ear_medium-dark_skin_tone:': u'\U0001F442 \U0001F3FE', + u':ear_medium-light_skin_tone:': u'\U0001F442 \U0001F3FC', + u':ear_medium_skin_tone:': u'\U0001F442 \U0001F3FD', + u':ear_of_corn:': u'\U0001F33D', + u':egg:': u'\U0001F95A', + u':eggplant:': u'\U0001F346', + u':eight-pointed_star:': u'\U00002734', + u':eight-spoked_asterisk:': u'\U00002733', + u':eight-thirty:': u'\U0001F563', + u':eight_o’clock:': u'\U0001F557', + u':eject_button:': u'\U000023CF', + u':electric_plug:': u'\U0001F50C', + u':elephant:': u'\U0001F418', + u':eleven-thirty:': u'\U0001F566', + u':eleven_o’clock:': u'\U0001F55A', + u':envelope:': u'\U00002709', + u':envelope_with_arrow:': u'\U0001F4E9', + u':euro_banknote:': u'\U0001F4B6', + u':evergreen_tree:': u'\U0001F332', + u':exclamation_mark:': u'\U00002757', + u':exclamation_question_mark:': u'\U00002049', + u':expressionless_face:': u'\U0001F611', + u':eye:': u'\U0001F441', + u':eye_in_speech_bubble:': u'\U0001F441 \U0000FE0F \U0000200D \U0001F5E8 \U0000FE0F', + u':eyes:': u'\U0001F440', + u':face_blowing_a_kiss:': u'\U0001F618', + u':face_savouring_delicious_food:': u'\U0001F60B', + u':face_screaming_in_fear:': u'\U0001F631', + u':face_with_cold_sweat:': u'\U0001F613', + u':face_with_head-bandage:': u'\U0001F915', + u':face_with_medical_mask:': u'\U0001F637', + u':face_with_open_mouth:': u'\U0001F62E', + u':face_with_open_mouth_&_cold_sweat:': u'\U0001F630', + u':face_with_rolling_eyes:': u'\U0001F644', + u':face_with_steam_from_nose:': u'\U0001F624', + u':face_with_stuck-out_tongue:': u'\U0001F61B', + u':face_with_stuck-out_tongue_&_closed_eyes:': u'\U0001F61D', + u':face_with_stuck-out_tongue_&_winking_eye:': u'\U0001F61C', + u':face_with_tears_of_joy:': u'\U0001F602', + u':face_with_thermometer:': u'\U0001F912', + u':face_without_mouth:': u'\U0001F636', + u':factory:': u'\U0001F3ED', + u':fallen_leaf:': u'\U0001F342', + u':family:': u'\U0001F46A', + u':family_man_boy:': u'\U0001F468 \U0000200D \U0001F466', + u':family_man_boy_boy:': u'\U0001F468 \U0000200D \U0001F466 \U0000200D \U0001F466', + u':family_man_girl:': u'\U0001F468 \U0000200D \U0001F467', + u':family_man_girl_boy:': u'\U0001F468 \U0000200D \U0001F467 \U0000200D \U0001F466', + u':family_man_girl_girl:': u'\U0001F468 \U0000200D \U0001F467 \U0000200D \U0001F467', + u':family_man_man_boy:': u'\U0001F468 \U0000200D \U0001F468 \U0000200D \U0001F466', + u':family_man_man_boy_boy:': u'\U0001F468 \U0000200D \U0001F468 \U0000200D \U0001F466 \U0000200D \U0001F466', + u':family_man_man_girl:': u'\U0001F468 \U0000200D \U0001F468 \U0000200D \U0001F467', + u':family_man_man_girl_boy:': u'\U0001F468 \U0000200D \U0001F468 \U0000200D \U0001F467 \U0000200D \U0001F466', + u':family_man_man_girl_girl:': u'\U0001F468 \U0000200D \U0001F468 \U0000200D \U0001F467 \U0000200D \U0001F467', + u':family_man_woman_boy:': u'\U0001F468 \U0000200D \U0001F469 \U0000200D \U0001F466', + u':family_man_woman_boy_boy:': u'\U0001F468 \U0000200D \U0001F469 \U0000200D \U0001F466 \U0000200D \U0001F466', + u':family_man_woman_girl:': u'\U0001F468 \U0000200D \U0001F469 \U0000200D \U0001F467', + u':family_man_woman_girl_boy:': u'\U0001F468 \U0000200D \U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F466', + u':family_man_woman_girl_girl:': u'\U0001F468 \U0000200D \U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F467', + u':family_woman_boy:': u'\U0001F469 \U0000200D \U0001F466', + u':family_woman_boy_boy:': u'\U0001F469 \U0000200D \U0001F466 \U0000200D \U0001F466', + u':family_woman_girl:': u'\U0001F469 \U0000200D \U0001F467', + u':family_woman_girl_boy:': u'\U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F466', + u':family_woman_girl_girl:': u'\U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F467', + u':family_woman_woman_boy:': u'\U0001F469 \U0000200D \U0001F469 \U0000200D \U0001F466', + u':family_woman_woman_boy_boy:': u'\U0001F469 \U0000200D \U0001F469 \U0000200D \U0001F466 \U0000200D \U0001F466', + u':family_woman_woman_girl:': u'\U0001F469 \U0000200D \U0001F469 \U0000200D \U0001F467', + u':family_woman_woman_girl_boy:': u'\U0001F469 \U0000200D \U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F466', + u':family_woman_woman_girl_girl:': u'\U0001F469 \U0000200D \U0001F469 \U0000200D \U0001F467 \U0000200D \U0001F467', + u':fast-forward_button:': u'\U000023E9', + u':fast_down_button:': u'\U000023EC', + u':fast_reverse_button:': u'\U000023EA', + u':fast_up_button:': u'\U000023EB', + u':fax_machine:': u'\U0001F4E0', + u':fearful_face:': u'\U0001F628', + u':female_sign:': u'\U00002640', + u':ferris_wheel:': u'\U0001F3A1', + u':ferry:': u'\U000026F4', + u':field_hockey:': u'\U0001F3D1', + u':file_cabinet:': u'\U0001F5C4', + u':file_folder:': u'\U0001F4C1', + u':film_frames:': u'\U0001F39E', + u':film_projector:': u'\U0001F4FD', + u':fire:': u'\U0001F525', + u':fire_engine:': u'\U0001F692', + u':fireworks:': u'\U0001F386', + u':first_quarter_moon:': u'\U0001F313', + u':first_quarter_moon_with_face:': u'\U0001F31B', + u':fish:': u'\U0001F41F', + u':fish_cake_with_swirl:': u'\U0001F365', + u':fishing_pole:': u'\U0001F3A3', + u':five-thirty:': u'\U0001F560', + u':five_o’clock:': u'\U0001F554', + u':flag_in_hole:': u'\U000026F3', + u':flashlight:': u'\U0001F526', + u':fleur-de-lis:': u'\U0000269C', + u':flexed_biceps:': u'\U0001F4AA', + u':flexed_biceps_dark_skin_tone:': u'\U0001F4AA \U0001F3FF', + u':flexed_biceps_light_skin_tone:': u'\U0001F4AA \U0001F3FB', + u':flexed_biceps_medium-dark_skin_tone:': u'\U0001F4AA \U0001F3FE', + u':flexed_biceps_medium-light_skin_tone:': u'\U0001F4AA \U0001F3FC', + u':flexed_biceps_medium_skin_tone:': u'\U0001F4AA \U0001F3FD', + u':floppy_disk:': u'\U0001F4BE', + u':flower_playing_cards:': u'\U0001F3B4', + u':flushed_face:': u'\U0001F633', + u':fog:': u'\U0001F32B', + u':foggy:': u'\U0001F301', + u':folded_hands:': u'\U0001F64F', + u':folded_hands_dark_skin_tone:': u'\U0001F64F \U0001F3FF', + u':folded_hands_light_skin_tone:': u'\U0001F64F \U0001F3FB', + u':folded_hands_medium-dark_skin_tone:': u'\U0001F64F \U0001F3FE', + u':folded_hands_medium-light_skin_tone:': u'\U0001F64F \U0001F3FC', + u':folded_hands_medium_skin_tone:': u'\U0001F64F \U0001F3FD', + u':footprints:': u'\U0001F463', + u':fork_and_knife:': u'\U0001F374', + u':fork_and_knife_with_plate:': u'\U0001F37D', + u':fountain:': u'\U000026F2', + u':fountain_pen:': u'\U0001F58B', + u':four-thirty:': u'\U0001F55F', + u':four_leaf_clover:': u'\U0001F340', + u':four_o’clock:': u'\U0001F553', + u':fox_face:': u'\U0001F98A', + u':framed_picture:': u'\U0001F5BC', + u':french_fries:': u'\U0001F35F', + u':fried_shrimp:': u'\U0001F364', + u':frog_face:': u'\U0001F438', + u':front-facing_baby_chick:': u'\U0001F425', + u':frowning_face:': u'\U00002639', + u':frowning_face_with_open_mouth:': u'\U0001F626', + u':fuel_pump:': u'\U000026FD', + u':full_moon:': u'\U0001F315', + u':full_moon_with_face:': u'\U0001F31D', + u':funeral_urn:': u'\U000026B1', + u':game_die:': u'\U0001F3B2', + u':gear:': u'\U00002699', + u':gem_stone:': u'\U0001F48E', + u':ghost:': u'\U0001F47B', + u':girl:': u'\U0001F467', + u':girl_dark_skin_tone:': u'\U0001F467 \U0001F3FF', + u':girl_light_skin_tone:': u'\U0001F467 \U0001F3FB', + u':girl_medium-dark_skin_tone:': u'\U0001F467 \U0001F3FE', + u':girl_medium-light_skin_tone:': u'\U0001F467 \U0001F3FC', + u':girl_medium_skin_tone:': u'\U0001F467 \U0001F3FD', + u':glass_of_milk:': u'\U0001F95B', + u':glasses:': u'\U0001F453', + u':globe_showing_Americas:': u'\U0001F30E', + u':globe_showing_Asia-Australia:': u'\U0001F30F', + u':globe_showing_Europe-Africa:': u'\U0001F30D', + u':globe_with_meridians:': u'\U0001F310', + u':glowing_star:': u'\U0001F31F', + u':goal_net:': u'\U0001F945', + u':goat:': u'\U0001F410', + u':goblin:': u'\U0001F47A', + u':gorilla:': u'\U0001F98D', + u':graduation_cap:': u'\U0001F393', + u':grapes:': u'\U0001F347', + u':green_apple:': u'\U0001F34F', + u':green_book:': u'\U0001F4D7', + u':green_heart:': u'\U0001F49A', + u':green_salad:': u'\U0001F957', + u':grimacing_face:': u'\U0001F62C', + u':grinning_cat_face_with_smiling_eyes:': u'\U0001F638', + u':grinning_face:': u'\U0001F600', + u':grinning_face_with_smiling_eyes:': u'\U0001F601', + u':growing_heart:': u'\U0001F497', + u':guard:': u'\U0001F482', + u':guard_dark_skin_tone:': u'\U0001F482 \U0001F3FF', + u':guard_light_skin_tone:': u'\U0001F482 \U0001F3FB', + u':guard_medium-dark_skin_tone:': u'\U0001F482 \U0001F3FE', + u':guard_medium-light_skin_tone:': u'\U0001F482 \U0001F3FC', + u':guard_medium_skin_tone:': u'\U0001F482 \U0001F3FD', + u':guitar:': u'\U0001F3B8', + u':hamburger:': u'\U0001F354', + u':hammer:': u'\U0001F528', + u':hammer_and_pick:': u'\U00002692', + u':hammer_and_wrench:': u'\U0001F6E0', + u':hamster_face:': u'\U0001F439', + u':handbag:': u'\U0001F45C', + u':handshake:': u'\U0001F91D', + u':hatching_chick:': u'\U0001F423', + u':headphone:': u'\U0001F3A7', + u':hear-no-evil_monkey:': u'\U0001F649', + u':heart_decoration:': u'\U0001F49F', + u':heart_suit:': u'\U00002665', + u':heart_with_arrow:': u'\U0001F498', + u':heart_with_ribbon:': u'\U0001F49D', + u':heavy_check_mark:': u'\U00002714', + u':heavy_division_sign:': u'\U00002797', + u':heavy_dollar_sign:': u'\U0001F4B2', + u':heavy_heart_exclamation:': u'\U00002763', + u':heavy_large_circle:': u'\U00002B55', + u':heavy_minus_sign:': u'\U00002796', + u':heavy_multiplication_x:': u'\U00002716', + u':heavy_plus_sign:': u'\U00002795', + u':helicopter:': u'\U0001F681', + u':herb:': u'\U0001F33F', + u':hibiscus:': u'\U0001F33A', + u':high-heeled_shoe:': u'\U0001F460', + u':high-speed_train:': u'\U0001F684', + u':high-speed_train_with_bullet_nose:': u'\U0001F685', + u':high_voltage:': u'\U000026A1', + u':hole:': u'\U0001F573', + u':honey_pot:': u'\U0001F36F', + u':honeybee:': u'\U0001F41D', + u':horizontal_traffic_light:': u'\U0001F6A5', + u':horse:': u'\U0001F40E', + u':horse_face:': u'\U0001F434', + u':horse_racing:': u'\U0001F3C7', + u':horse_racing_dark_skin_tone:': u'\U0001F3C7 \U0001F3FF', + u':horse_racing_light_skin_tone:': u'\U0001F3C7 \U0001F3FB', + u':horse_racing_medium-dark_skin_tone:': u'\U0001F3C7 \U0001F3FE', + u':horse_racing_medium-light_skin_tone:': u'\U0001F3C7 \U0001F3FC', + u':horse_racing_medium_skin_tone:': u'\U0001F3C7 \U0001F3FD', + u':hospital:': u'\U0001F3E5', + u':hot_beverage:': u'\U00002615', + u':hot_dog:': u'\U0001F32D', + u':hot_pepper:': u'\U0001F336', + u':hot_springs:': u'\U00002668', + u':hotel:': u'\U0001F3E8', + u':hourglass:': u'\U0000231B', + u':hourglass_with_flowing_sand:': u'\U000023F3', + u':house:': u'\U0001F3E0', + u':house_with_garden:': u'\U0001F3E1', + u':hugging_face:': u'\U0001F917', + u':hundred_points:': u'\U0001F4AF', + u':hushed_face:': u'\U0001F62F', + u':ice_cream:': u'\U0001F368', + u':ice_hockey:': u'\U0001F3D2', + u':ice_skate:': u'\U000026F8', + u':inbox_tray:': u'\U0001F4E5', + u':incoming_envelope:': u'\U0001F4E8', + u':index_pointing_up:': u'\U0000261D', + u':index_pointing_up_dark_skin_tone:': u'\U0000261D \U0001F3FF', + u':index_pointing_up_light_skin_tone:': u'\U0000261D \U0001F3FB', + u':index_pointing_up_medium-dark_skin_tone:': u'\U0000261D \U0001F3FE', + u':index_pointing_up_medium-light_skin_tone:': u'\U0000261D \U0001F3FC', + u':index_pointing_up_medium_skin_tone:': u'\U0000261D \U0001F3FD', + u':information:': u'\U00002139', + u':input_latin_letters:': u'\U0001F524', + u':input_latin_lowercase:': u'\U0001F521', + u':input_latin_uppercase:': u'\U0001F520', + u':input_numbers:': u'\U0001F522', + u':input_symbols:': u'\U0001F523', + u':jack-o-lantern:': u'\U0001F383', + u':jeans:': u'\U0001F456', + u':joker:': u'\U0001F0CF', + u':joystick:': u'\U0001F579', + u':kaaba:': u'\U0001F54B', + u':key:': u'\U0001F511', + u':keyboard:': u'\U00002328', + u':keycap_#:': u'\U00000023 \U0000FE0F \U000020E3', + u':keycap_*:': u'\U0000002A \U0000FE0F \U000020E3', + u':keycap_0:': u'\U00000030 \U0000FE0F \U000020E3', + u':keycap_1:': u'\U00000031 \U0000FE0F \U000020E3', + u':keycap_10:': u'\U0001F51F', + u':keycap_2:': u'\U00000032 \U0000FE0F \U000020E3', + u':keycap_3:': u'\U00000033 \U0000FE0F \U000020E3', + u':keycap_4:': u'\U00000034 \U0000FE0F \U000020E3', + u':keycap_5:': u'\U00000035 \U0000FE0F \U000020E3', + u':keycap_6:': u'\U00000036 \U0000FE0F \U000020E3', + u':keycap_7:': u'\U00000037 \U0000FE0F \U000020E3', + u':keycap_8:': u'\U00000038 \U0000FE0F \U000020E3', + u':keycap_9:': u'\U00000039 \U0000FE0F \U000020E3', + u':kick_scooter:': u'\U0001F6F4', + u':kimono:': u'\U0001F458', + u':kiss:': u'\U0001F48F', + u':kiss_man_man:': u'\U0001F468 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F48B \U0000200D \U0001F468', + u':kiss_mark:': u'\U0001F48B', + u':kiss_woman_man:': u'\U0001F469 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F48B \U0000200D \U0001F468', + u':kiss_woman_woman:': u'\U0001F469 \U0000200D \U00002764 \U0000FE0F \U0000200D \U0001F48B \U0000200D \U0001F469', + u':kissing_cat_face_with_closed_eyes:': u'\U0001F63D', + u':kissing_face:': u'\U0001F617', + u':kissing_face_with_closed_eyes:': u'\U0001F61A', + u':kissing_face_with_smiling_eyes:': u'\U0001F619', + u':kitchen_knife:': u'\U0001F52A', + u':kiwi_fruit:': u'\U0001F95D', + u':koala:': u'\U0001F428', + u':label:': u'\U0001F3F7', + u':lady_beetle:': u'\U0001F41E', + u':laptop_computer:': u'\U0001F4BB', + u':large_blue_diamond:': u'\U0001F537', + u':large_orange_diamond:': u'\U0001F536', + u':last_quarter_moon:': u'\U0001F317', + u':last_quarter_moon_with_face:': u'\U0001F31C', + u':last_track_button:': u'\U000023EE', + u':latin_cross:': u'\U0000271D', + u':leaf_fluttering_in_wind:': u'\U0001F343', + u':ledger:': u'\U0001F4D2', + u':left-facing_fist:': u'\U0001F91B', + u':left-facing_fist_dark_skin_tone:': u'\U0001F91B \U0001F3FF', + u':left-facing_fist_light_skin_tone:': u'\U0001F91B \U0001F3FB', + u':left-facing_fist_medium-dark_skin_tone:': u'\U0001F91B \U0001F3FE', + u':left-facing_fist_medium-light_skin_tone:': u'\U0001F91B \U0001F3FC', + u':left-facing_fist_medium_skin_tone:': u'\U0001F91B \U0001F3FD', + u':left-pointing_magnifying_glass:': u'\U0001F50D', + u':left-right_arrow:': u'\U00002194', + u':left_arrow:': u'\U00002B05', + u':left_arrow_curving_right:': u'\U000021AA', + u':left_luggage:': u'\U0001F6C5', + u':left_speech_bubble:': u'\U0001F5E8', + u':lemon:': u'\U0001F34B', + u':leopard:': u'\U0001F406', + u':level_slider:': u'\U0001F39A', + u':light_bulb:': u'\U0001F4A1', + u':light_rail:': u'\U0001F688', + u':light_skin_tone:': u'\U0001F3FB', + u':link:': u'\U0001F517', + u':linked_paperclips:': u'\U0001F587', + u':lion_face:': u'\U0001F981', + u':lipstick:': u'\U0001F484', + u':litter_in_bin_sign:': u'\U0001F6AE', + u':lizard:': u'\U0001F98E', + u':locked:': u'\U0001F512', + u':locked_with_key:': u'\U0001F510', + u':locked_with_pen:': u'\U0001F50F', + u':locomotive:': u'\U0001F682', + u':lollipop:': u'\U0001F36D', + u':loudly_crying_face:': u'\U0001F62D', + u':loudspeaker:': u'\U0001F4E2', + u':love_hotel:': u'\U0001F3E9', + u':love_letter:': u'\U0001F48C', + u':lying_face:': u'\U0001F925', + u':mahjong_red_dragon:': u'\U0001F004', + u':male_sign:': u'\U00002642', + u':man:': u'\U0001F468', + u':man_and_woman_holding_hands:': u'\U0001F46B', + u':man_artist:': u'\U0001F468 \U0000200D \U0001F3A8', + u':man_artist_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F3A8', + u':man_artist_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F3A8', + u':man_artist_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F3A8', + u':man_artist_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F3A8', + u':man_artist_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F3A8', + u':man_astronaut:': u'\U0001F468 \U0000200D \U0001F680', + u':man_astronaut_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F680', + u':man_astronaut_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F680', + u':man_astronaut_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F680', + u':man_astronaut_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F680', + u':man_astronaut_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F680', + u':man_biking:': u'\U0001F6B4 \U0000200D \U00002642 \U0000FE0F', + u':man_biking_dark_skin_tone:': u'\U0001F6B4 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_biking_light_skin_tone:': u'\U0001F6B4 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_biking_medium-dark_skin_tone:': u'\U0001F6B4 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_biking_medium-light_skin_tone:': u'\U0001F6B4 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_biking_medium_skin_tone:': u'\U0001F6B4 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball:': u'\U000026F9 \U0000FE0F \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball_dark_skin_tone:': u'\U000026F9 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball_light_skin_tone:': u'\U000026F9 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball_medium-dark_skin_tone:': u'\U000026F9 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball_medium-light_skin_tone:': u'\U000026F9 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_bouncing_ball_medium_skin_tone:': u'\U000026F9 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_bowing:': u'\U0001F647 \U0000200D \U00002642 \U0000FE0F', + u':man_bowing_dark_skin_tone:': u'\U0001F647 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_bowing_light_skin_tone:': u'\U0001F647 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_bowing_medium-dark_skin_tone:': u'\U0001F647 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_bowing_medium-light_skin_tone:': u'\U0001F647 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_bowing_medium_skin_tone:': u'\U0001F647 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling:': u'\U0001F938 \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling_dark_skin_tone:': u'\U0001F938 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling_light_skin_tone:': u'\U0001F938 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling_medium-dark_skin_tone:': u'\U0001F938 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling_medium-light_skin_tone:': u'\U0001F938 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_cartwheeling_medium_skin_tone:': u'\U0001F938 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker:': u'\U0001F477 \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker_dark_skin_tone:': u'\U0001F477 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker_light_skin_tone:': u'\U0001F477 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker_medium-dark_skin_tone:': u'\U0001F477 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker_medium-light_skin_tone:': u'\U0001F477 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_construction_worker_medium_skin_tone:': u'\U0001F477 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_cook:': u'\U0001F468 \U0000200D \U0001F373', + u':man_cook_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F373', + u':man_cook_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F373', + u':man_cook_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F373', + u':man_cook_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F373', + u':man_cook_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F373', + u':man_dancing:': u'\U0001F57A', + u':man_dancing_dark_skin_tone:': u'\U0001F57A \U0001F3FF', + u':man_dancing_light_skin_tone:': u'\U0001F57A \U0001F3FB', + u':man_dancing_medium-dark_skin_tone:': u'\U0001F57A \U0001F3FE', + u':man_dancing_medium-light_skin_tone:': u'\U0001F57A \U0001F3FC', + u':man_dancing_medium_skin_tone:': u'\U0001F57A \U0001F3FD', + u':man_dark_skin_tone:': u'\U0001F468 \U0001F3FF', + u':man_detective:': u'\U0001F575 \U0000FE0F \U0000200D \U00002642 \U0000FE0F', + u':man_detective_dark_skin_tone:': u'\U0001F575 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_detective_light_skin_tone:': u'\U0001F575 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_detective_medium-dark_skin_tone:': u'\U0001F575 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_detective_medium-light_skin_tone:': u'\U0001F575 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_detective_medium_skin_tone:': u'\U0001F575 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming:': u'\U0001F926 \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming_dark_skin_tone:': u'\U0001F926 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming_light_skin_tone:': u'\U0001F926 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming_medium-dark_skin_tone:': u'\U0001F926 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming_medium-light_skin_tone:': u'\U0001F926 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_facepalming_medium_skin_tone:': u'\U0001F926 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_factory_worker:': u'\U0001F468 \U0000200D \U0001F3ED', + u':man_factory_worker_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F3ED', + u':man_factory_worker_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F3ED', + u':man_factory_worker_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F3ED', + u':man_factory_worker_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F3ED', + u':man_factory_worker_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F3ED', + u':man_farmer:': u'\U0001F468 \U0000200D \U0001F33E', + u':man_farmer_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F33E', + u':man_farmer_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F33E', + u':man_farmer_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F33E', + u':man_farmer_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F33E', + u':man_farmer_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F33E', + u':man_firefighter:': u'\U0001F468 \U0000200D \U0001F692', + u':man_firefighter_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F692', + u':man_firefighter_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F692', + u':man_firefighter_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F692', + u':man_firefighter_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F692', + u':man_firefighter_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F692', + u':man_frowning:': u'\U0001F64D \U0000200D \U00002642 \U0000FE0F', + u':man_frowning_dark_skin_tone:': u'\U0001F64D \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_frowning_light_skin_tone:': u'\U0001F64D \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_frowning_medium-dark_skin_tone:': u'\U0001F64D \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_frowning_medium-light_skin_tone:': u'\U0001F64D \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_frowning_medium_skin_tone:': u'\U0001F64D \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO:': u'\U0001F645 \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO_dark_skin_tone:': u'\U0001F645 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO_light_skin_tone:': u'\U0001F645 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO_medium-dark_skin_tone:': u'\U0001F645 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO_medium-light_skin_tone:': u'\U0001F645 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_NO_medium_skin_tone:': u'\U0001F645 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK:': u'\U0001F646 \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK_dark_skin_tone:': u'\U0001F646 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK_light_skin_tone:': u'\U0001F646 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK_medium-dark_skin_tone:': u'\U0001F646 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK_medium-light_skin_tone:': u'\U0001F646 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_gesturing_OK_medium_skin_tone:': u'\U0001F646 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut:': u'\U0001F487 \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut_dark_skin_tone:': u'\U0001F487 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut_light_skin_tone:': u'\U0001F487 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut_medium-dark_skin_tone:': u'\U0001F487 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut_medium-light_skin_tone:': u'\U0001F487 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_getting_haircut_medium_skin_tone:': u'\U0001F487 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage:': u'\U0001F486 \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage_dark_skin_tone:': u'\U0001F486 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage_light_skin_tone:': u'\U0001F486 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage_medium-dark_skin_tone:': u'\U0001F486 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage_medium-light_skin_tone:': u'\U0001F486 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_getting_massage_medium_skin_tone:': u'\U0001F486 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_golfing:': u'\U0001F3CC \U0000FE0F \U0000200D \U00002642 \U0000FE0F', + u':man_golfing_dark_skin_tone:': u'\U0001F3CC \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_golfing_light_skin_tone:': u'\U0001F3CC \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_golfing_medium-dark_skin_tone:': u'\U0001F3CC \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_golfing_medium-light_skin_tone:': u'\U0001F3CC \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_golfing_medium_skin_tone:': u'\U0001F3CC \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_guard:': u'\U0001F482 \U0000200D \U00002642 \U0000FE0F', + u':man_guard_dark_skin_tone:': u'\U0001F482 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_guard_light_skin_tone:': u'\U0001F482 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_guard_medium-dark_skin_tone:': u'\U0001F482 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_guard_medium-light_skin_tone:': u'\U0001F482 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_guard_medium_skin_tone:': u'\U0001F482 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_health_worker:': u'\U0001F468 \U0000200D \U00002695 \U0000FE0F', + u':man_health_worker_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U00002695 \U0000FE0F', + u':man_health_worker_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U00002695 \U0000FE0F', + u':man_health_worker_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U00002695 \U0000FE0F', + u':man_health_worker_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U00002695 \U0000FE0F', + u':man_health_worker_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U00002695 \U0000FE0F', + u':man_in_business_suit_levitating:': u'\U0001F574', + u':man_in_business_suit_levitating_dark_skin_tone:': u'\U0001F574 \U0001F3FF', + u':man_in_business_suit_levitating_light_skin_tone:': u'\U0001F574 \U0001F3FB', + u':man_in_business_suit_levitating_medium-dark_skin_tone:': u'\U0001F574 \U0001F3FE', + u':man_in_business_suit_levitating_medium-light_skin_tone:': u'\U0001F574 \U0001F3FC', + u':man_in_business_suit_levitating_medium_skin_tone:': u'\U0001F574 \U0001F3FD', + u':man_in_tuxedo:': u'\U0001F935', + u':man_in_tuxedo_dark_skin_tone:': u'\U0001F935 \U0001F3FF', + u':man_in_tuxedo_light_skin_tone:': u'\U0001F935 \U0001F3FB', + u':man_in_tuxedo_medium-dark_skin_tone:': u'\U0001F935 \U0001F3FE', + u':man_in_tuxedo_medium-light_skin_tone:': u'\U0001F935 \U0001F3FC', + u':man_in_tuxedo_medium_skin_tone:': u'\U0001F935 \U0001F3FD', + u':man_judge:': u'\U0001F468 \U0000200D \U00002696 \U0000FE0F', + u':man_judge_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U00002696 \U0000FE0F', + u':man_judge_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U00002696 \U0000FE0F', + u':man_judge_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U00002696 \U0000FE0F', + u':man_judge_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U00002696 \U0000FE0F', + u':man_judge_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U00002696 \U0000FE0F', + u':man_juggling:': u'\U0001F939 \U0000200D \U00002642 \U0000FE0F', + u':man_juggling_dark_skin_tone:': u'\U0001F939 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_juggling_light_skin_tone:': u'\U0001F939 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_juggling_medium-dark_skin_tone:': u'\U0001F939 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_juggling_medium-light_skin_tone:': u'\U0001F939 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_juggling_medium_skin_tone:': u'\U0001F939 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights:': u'\U0001F3CB \U0000FE0F \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights_dark_skin_tone:': u'\U0001F3CB \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights_light_skin_tone:': u'\U0001F3CB \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights_medium-dark_skin_tone:': u'\U0001F3CB \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights_medium-light_skin_tone:': u'\U0001F3CB \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_lifting_weights_medium_skin_tone:': u'\U0001F3CB \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_light_skin_tone:': u'\U0001F468 \U0001F3FB', + u':man_mechanic:': u'\U0001F468 \U0000200D \U0001F527', + u':man_mechanic_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F527', + u':man_mechanic_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F527', + u':man_mechanic_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F527', + u':man_mechanic_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F527', + u':man_mechanic_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F527', + u':man_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE', + u':man_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC', + u':man_medium_skin_tone:': u'\U0001F468 \U0001F3FD', + u':man_mountain_biking:': u'\U0001F6B5 \U0000200D \U00002642 \U0000FE0F', + u':man_mountain_biking_dark_skin_tone:': u'\U0001F6B5 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_mountain_biking_light_skin_tone:': u'\U0001F6B5 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_mountain_biking_medium-dark_skin_tone:': u'\U0001F6B5 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_mountain_biking_medium-light_skin_tone:': u'\U0001F6B5 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_mountain_biking_medium_skin_tone:': u'\U0001F6B5 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_office_worker:': u'\U0001F468 \U0000200D \U0001F4BC', + u':man_office_worker_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F4BC', + u':man_office_worker_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F4BC', + u':man_office_worker_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F4BC', + u':man_office_worker_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F4BC', + u':man_office_worker_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F4BC', + u':man_pilot:': u'\U0001F468 \U0000200D \U00002708 \U0000FE0F', + u':man_pilot_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U00002708 \U0000FE0F', + u':man_pilot_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U00002708 \U0000FE0F', + u':man_pilot_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U00002708 \U0000FE0F', + u':man_pilot_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U00002708 \U0000FE0F', + u':man_pilot_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U00002708 \U0000FE0F', + u':man_playing_handball:': u'\U0001F93E \U0000200D \U00002642 \U0000FE0F', + u':man_playing_handball_dark_skin_tone:': u'\U0001F93E \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_playing_handball_light_skin_tone:': u'\U0001F93E \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_playing_handball_medium-dark_skin_tone:': u'\U0001F93E \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_playing_handball_medium-light_skin_tone:': u'\U0001F93E \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_playing_handball_medium_skin_tone:': u'\U0001F93E \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo:': u'\U0001F93D \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo_dark_skin_tone:': u'\U0001F93D \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo_light_skin_tone:': u'\U0001F93D \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo_medium-dark_skin_tone:': u'\U0001F93D \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo_medium-light_skin_tone:': u'\U0001F93D \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_playing_water_polo_medium_skin_tone:': u'\U0001F93D \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer:': u'\U0001F46E \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer_dark_skin_tone:': u'\U0001F46E \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer_light_skin_tone:': u'\U0001F46E \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer_medium-dark_skin_tone:': u'\U0001F46E \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer_medium-light_skin_tone:': u'\U0001F46E \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_police_officer_medium_skin_tone:': u'\U0001F46E \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_pouting:': u'\U0001F64E \U0000200D \U00002642 \U0000FE0F', + u':man_pouting_dark_skin_tone:': u'\U0001F64E \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_pouting_light_skin_tone:': u'\U0001F64E \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_pouting_medium-dark_skin_tone:': u'\U0001F64E \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_pouting_medium-light_skin_tone:': u'\U0001F64E \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_pouting_medium_skin_tone:': u'\U0001F64E \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand:': u'\U0001F64B \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand_dark_skin_tone:': u'\U0001F64B \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand_light_skin_tone:': u'\U0001F64B \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand_medium-dark_skin_tone:': u'\U0001F64B \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand_medium-light_skin_tone:': u'\U0001F64B \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_raising_hand_medium_skin_tone:': u'\U0001F64B \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat:': u'\U0001F6A3 \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat_dark_skin_tone:': u'\U0001F6A3 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat_light_skin_tone:': u'\U0001F6A3 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat_medium-dark_skin_tone:': u'\U0001F6A3 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat_medium-light_skin_tone:': u'\U0001F6A3 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_rowing_boat_medium_skin_tone:': u'\U0001F6A3 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_running:': u'\U0001F3C3 \U0000200D \U00002642 \U0000FE0F', + u':man_running_dark_skin_tone:': u'\U0001F3C3 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_running_light_skin_tone:': u'\U0001F3C3 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_running_medium-dark_skin_tone:': u'\U0001F3C3 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_running_medium-light_skin_tone:': u'\U0001F3C3 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_running_medium_skin_tone:': u'\U0001F3C3 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_scientist:': u'\U0001F468 \U0000200D \U0001F52C', + u':man_scientist_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F52C', + u':man_scientist_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F52C', + u':man_scientist_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F52C', + u':man_scientist_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F52C', + u':man_scientist_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F52C', + u':man_shrugging:': u'\U0001F937 \U0000200D \U00002642 \U0000FE0F', + u':man_shrugging_dark_skin_tone:': u'\U0001F937 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_shrugging_light_skin_tone:': u'\U0001F937 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_shrugging_medium-dark_skin_tone:': u'\U0001F937 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_shrugging_medium-light_skin_tone:': u'\U0001F937 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_shrugging_medium_skin_tone:': u'\U0001F937 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_singer:': u'\U0001F468 \U0000200D \U0001F3A4', + u':man_singer_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F3A4', + u':man_singer_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F3A4', + u':man_singer_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F3A4', + u':man_singer_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F3A4', + u':man_singer_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F3A4', + u':man_student:': u'\U0001F468 \U0000200D \U0001F393', + u':man_student_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F393', + u':man_student_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F393', + u':man_student_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F393', + u':man_student_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F393', + u':man_student_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F393', + u':man_surfing:': u'\U0001F3C4 \U0000200D \U00002642 \U0000FE0F', + u':man_surfing_dark_skin_tone:': u'\U0001F3C4 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_surfing_light_skin_tone:': u'\U0001F3C4 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_surfing_medium-dark_skin_tone:': u'\U0001F3C4 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_surfing_medium-light_skin_tone:': u'\U0001F3C4 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_surfing_medium_skin_tone:': u'\U0001F3C4 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_swimming:': u'\U0001F3CA \U0000200D \U00002642 \U0000FE0F', + u':man_swimming_dark_skin_tone:': u'\U0001F3CA \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_swimming_light_skin_tone:': u'\U0001F3CA \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_swimming_medium-dark_skin_tone:': u'\U0001F3CA \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_swimming_medium-light_skin_tone:': u'\U0001F3CA \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_swimming_medium_skin_tone:': u'\U0001F3CA \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_teacher:': u'\U0001F468 \U0000200D \U0001F3EB', + u':man_teacher_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F3EB', + u':man_teacher_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F3EB', + u':man_teacher_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F3EB', + u':man_teacher_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F3EB', + u':man_teacher_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F3EB', + u':man_technologist:': u'\U0001F468 \U0000200D \U0001F4BB', + u':man_technologist_dark_skin_tone:': u'\U0001F468 \U0001F3FF \U0000200D \U0001F4BB', + u':man_technologist_light_skin_tone:': u'\U0001F468 \U0001F3FB \U0000200D \U0001F4BB', + u':man_technologist_medium-dark_skin_tone:': u'\U0001F468 \U0001F3FE \U0000200D \U0001F4BB', + u':man_technologist_medium-light_skin_tone:': u'\U0001F468 \U0001F3FC \U0000200D \U0001F4BB', + u':man_technologist_medium_skin_tone:': u'\U0001F468 \U0001F3FD \U0000200D \U0001F4BB', + u':man_tipping_hand:': u'\U0001F481 \U0000200D \U00002642 \U0000FE0F', + u':man_tipping_hand_dark_skin_tone:': u'\U0001F481 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_tipping_hand_light_skin_tone:': u'\U0001F481 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_tipping_hand_medium-dark_skin_tone:': u'\U0001F481 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_tipping_hand_medium-light_skin_tone:': u'\U0001F481 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_tipping_hand_medium_skin_tone:': u'\U0001F481 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_walking:': u'\U0001F6B6 \U0000200D \U00002642 \U0000FE0F', + u':man_walking_dark_skin_tone:': u'\U0001F6B6 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_walking_light_skin_tone:': u'\U0001F6B6 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_walking_medium-dark_skin_tone:': u'\U0001F6B6 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_walking_medium-light_skin_tone:': u'\U0001F6B6 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_walking_medium_skin_tone:': u'\U0001F6B6 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban:': u'\U0001F473 \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban_dark_skin_tone:': u'\U0001F473 \U0001F3FF \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban_light_skin_tone:': u'\U0001F473 \U0001F3FB \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban_medium-dark_skin_tone:': u'\U0001F473 \U0001F3FE \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban_medium-light_skin_tone:': u'\U0001F473 \U0001F3FC \U0000200D \U00002642 \U0000FE0F', + u':man_wearing_turban_medium_skin_tone:': u'\U0001F473 \U0001F3FD \U0000200D \U00002642 \U0000FE0F', + u':man_with_Chinese_cap:': u'\U0001F472', + u':man_with_Chinese_cap_dark_skin_tone:': u'\U0001F472 \U0001F3FF', + u':man_with_Chinese_cap_light_skin_tone:': u'\U0001F472 \U0001F3FB', + u':man_with_Chinese_cap_medium-dark_skin_tone:': u'\U0001F472 \U0001F3FE', + u':man_with_Chinese_cap_medium-light_skin_tone:': u'\U0001F472 \U0001F3FC', + u':man_with_Chinese_cap_medium_skin_tone:': u'\U0001F472 \U0001F3FD', + u':mantelpiece_clock:': u'\U0001F570', + u':man’s_shoe:': u'\U0001F45E', + u':map_of_Japan:': u'\U0001F5FE', + u':maple_leaf:': u'\U0001F341', + u':martial_arts_uniform:': u'\U0001F94B', + u':meat_on_bone:': u'\U0001F356', + u':medical_symbol:': u'\U00002695', + u':medium-dark_skin_tone:': u'\U0001F3FE', + u':medium-light_skin_tone:': u'\U0001F3FC', + u':medium_skin_tone:': u'\U0001F3FD', + u':megaphone:': u'\U0001F4E3', + u':melon:': u'\U0001F348', + u':memo:': u'\U0001F4DD', + u':men_with_bunny_ears_partying:': u'\U0001F46F \U0000200D \U00002642 \U0000FE0F', + u':men_wrestling:': u'\U0001F93C \U0000200D \U00002642 \U0000FE0F', + u':menorah:': u'\U0001F54E', + u':men’s_room:': u'\U0001F6B9', + u':metro:': u'\U0001F687', + u':microphone:': u'\U0001F3A4', + u':microscope:': u'\U0001F52C', + u':middle_finger:': u'\U0001F595', + u':middle_finger_dark_skin_tone:': u'\U0001F595 \U0001F3FF', + u':middle_finger_light_skin_tone:': u'\U0001F595 \U0001F3FB', + u':middle_finger_medium-dark_skin_tone:': u'\U0001F595 \U0001F3FE', + u':middle_finger_medium-light_skin_tone:': u'\U0001F595 \U0001F3FC', + u':middle_finger_medium_skin_tone:': u'\U0001F595 \U0001F3FD', + u':military_medal:': u'\U0001F396', + u':milky_way:': u'\U0001F30C', + u':minibus:': u'\U0001F690', + u':moai:': u'\U0001F5FF', + u':mobile_phone:': u'\U0001F4F1', + u':mobile_phone_off:': u'\U0001F4F4', + u':mobile_phone_with_arrow:': u'\U0001F4F2', + u':money-mouth_face:': u'\U0001F911', + u':money_bag:': u'\U0001F4B0', + u':money_with_wings:': u'\U0001F4B8', + u':monkey:': u'\U0001F412', + u':monkey_face:': u'\U0001F435', + u':monorail:': u'\U0001F69D', + u':moon_viewing_ceremony:': u'\U0001F391', + u':mosque:': u'\U0001F54C', + u':motor_boat:': u'\U0001F6E5', + u':motor_scooter:': u'\U0001F6F5', + u':motorcycle:': u'\U0001F3CD', + u':motorway:': u'\U0001F6E3', + u':mount_fuji:': u'\U0001F5FB', + u':mountain:': u'\U000026F0', + u':mountain_cableway:': u'\U0001F6A0', + u':mountain_railway:': u'\U0001F69E', + u':mouse:': u'\U0001F401', + u':mouse_face:': u'\U0001F42D', + u':mouth:': u'\U0001F444', + u':movie_camera:': u'\U0001F3A5', + u':mushroom:': u'\U0001F344', + u':musical_keyboard:': u'\U0001F3B9', + u':musical_note:': u'\U0001F3B5', + u':musical_notes:': u'\U0001F3B6', + u':musical_score:': u'\U0001F3BC', + u':muted_speaker:': u'\U0001F507', + u':nail_polish:': u'\U0001F485', + u':nail_polish_dark_skin_tone:': u'\U0001F485 \U0001F3FF', + u':nail_polish_light_skin_tone:': u'\U0001F485 \U0001F3FB', + u':nail_polish_medium-dark_skin_tone:': u'\U0001F485 \U0001F3FE', + u':nail_polish_medium-light_skin_tone:': u'\U0001F485 \U0001F3FC', + u':nail_polish_medium_skin_tone:': u'\U0001F485 \U0001F3FD', + u':name_badge:': u'\U0001F4DB', + u':national_park:': u'\U0001F3DE', + u':nauseated_face:': u'\U0001F922', + u':necktie:': u'\U0001F454', + u':nerd_face:': u'\U0001F913', + u':neutral_face:': u'\U0001F610', + u':new_moon:': u'\U0001F311', + u':new_moon_face:': u'\U0001F31A', + u':newspaper:': u'\U0001F4F0', + u':next_track_button:': u'\U000023ED', + u':night_with_stars:': u'\U0001F303', + u':nine-thirty:': u'\U0001F564', + u':nine_o’clock:': u'\U0001F558', + u':no_bicycles:': u'\U0001F6B3', + u':no_entry:': u'\U000026D4', + u':no_littering:': u'\U0001F6AF', + u':no_mobile_phones:': u'\U0001F4F5', + u':no_one_under_eighteen:': u'\U0001F51E', + u':no_pedestrians:': u'\U0001F6B7', + u':no_smoking:': u'\U0001F6AD', + u':non-potable_water:': u'\U0001F6B1', + u':nose:': u'\U0001F443', + u':nose_dark_skin_tone:': u'\U0001F443 \U0001F3FF', + u':nose_light_skin_tone:': u'\U0001F443 \U0001F3FB', + u':nose_medium-dark_skin_tone:': u'\U0001F443 \U0001F3FE', + u':nose_medium-light_skin_tone:': u'\U0001F443 \U0001F3FC', + u':nose_medium_skin_tone:': u'\U0001F443 \U0001F3FD', + u':notebook:': u'\U0001F4D3', + u':notebook_with_decorative_cover:': u'\U0001F4D4', + u':nut_and_bolt:': u'\U0001F529', + u':octopus:': u'\U0001F419', + u':oden:': u'\U0001F362', + u':office_building:': u'\U0001F3E2', + u':ogre:': u'\U0001F479', + u':oil_drum:': u'\U0001F6E2', + u':old_key:': u'\U0001F5DD', + u':old_man:': u'\U0001F474', + u':old_man_dark_skin_tone:': u'\U0001F474 \U0001F3FF', + u':old_man_light_skin_tone:': u'\U0001F474 \U0001F3FB', + u':old_man_medium-dark_skin_tone:': u'\U0001F474 \U0001F3FE', + u':old_man_medium-light_skin_tone:': u'\U0001F474 \U0001F3FC', + u':old_man_medium_skin_tone:': u'\U0001F474 \U0001F3FD', + u':old_woman:': u'\U0001F475', + u':old_woman_dark_skin_tone:': u'\U0001F475 \U0001F3FF', + u':old_woman_light_skin_tone:': u'\U0001F475 \U0001F3FB', + u':old_woman_medium-dark_skin_tone:': u'\U0001F475 \U0001F3FE', + u':old_woman_medium-light_skin_tone:': u'\U0001F475 \U0001F3FC', + u':old_woman_medium_skin_tone:': u'\U0001F475 \U0001F3FD', + u':om:': u'\U0001F549', + u':oncoming_automobile:': u'\U0001F698', + u':oncoming_bus:': u'\U0001F68D', + u':oncoming_fist:': u'\U0001F44A', + u':oncoming_fist_dark_skin_tone:': u'\U0001F44A \U0001F3FF', + u':oncoming_fist_light_skin_tone:': u'\U0001F44A \U0001F3FB', + u':oncoming_fist_medium-dark_skin_tone:': u'\U0001F44A \U0001F3FE', + u':oncoming_fist_medium-light_skin_tone:': u'\U0001F44A \U0001F3FC', + u':oncoming_fist_medium_skin_tone:': u'\U0001F44A \U0001F3FD', + u':oncoming_police_car:': u'\U0001F694', + u':oncoming_taxi:': u'\U0001F696', + u':one-thirty:': u'\U0001F55C', + u':one_o’clock:': u'\U0001F550', + u':open_book:': u'\U0001F4D6', + u':open_file_folder:': u'\U0001F4C2', + u':open_hands:': u'\U0001F450', + u':open_hands_dark_skin_tone:': u'\U0001F450 \U0001F3FF', + u':open_hands_light_skin_tone:': u'\U0001F450 \U0001F3FB', + u':open_hands_medium-dark_skin_tone:': u'\U0001F450 \U0001F3FE', + u':open_hands_medium-light_skin_tone:': u'\U0001F450 \U0001F3FC', + u':open_hands_medium_skin_tone:': u'\U0001F450 \U0001F3FD', + u':open_mailbox_with_lowered_flag:': u'\U0001F4ED', + u':open_mailbox_with_raised_flag:': u'\U0001F4EC', + u':optical_disk:': u'\U0001F4BF', + u':orange_book:': u'\U0001F4D9', + u':orthodox_cross:': u'\U00002626', + u':outbox_tray:': u'\U0001F4E4', + u':owl:': u'\U0001F989', + u':ox:': u'\U0001F402', + u':package:': u'\U0001F4E6', + u':page_facing_up:': u'\U0001F4C4', + u':page_with_curl:': u'\U0001F4C3', + u':pager:': u'\U0001F4DF', + u':paintbrush:': u'\U0001F58C', + u':palm_tree:': u'\U0001F334', + u':pancakes:': u'\U0001F95E', + u':panda_face:': u'\U0001F43C', + u':paperclip:': u'\U0001F4CE', + u':part_alternation_mark:': u'\U0000303D', + u':party_popper:': u'\U0001F389', + u':passenger_ship:': u'\U0001F6F3', + u':passport_control:': u'\U0001F6C2', + u':pause_button:': u'\U000023F8', + u':paw_prints:': u'\U0001F43E', + u':peace_symbol:': u'\U0000262E', + u':peach:': u'\U0001F351', + u':peanuts:': u'\U0001F95C', + u':pear:': u'\U0001F350', + u':pen:': u'\U0001F58A', + u':pencil:': u'\U0000270F', + u':penguin:': u'\U0001F427', + u':pensive_face:': u'\U0001F614', + u':people_with_bunny_ears_partying:': u'\U0001F46F', + u':people_wrestling:': u'\U0001F93C', + u':performing_arts:': u'\U0001F3AD', + u':persevering_face:': u'\U0001F623', + u':person_biking:': u'\U0001F6B4', + u':person_biking_dark_skin_tone:': u'\U0001F6B4 \U0001F3FF', + u':person_biking_light_skin_tone:': u'\U0001F6B4 \U0001F3FB', + u':person_biking_medium-dark_skin_tone:': u'\U0001F6B4 \U0001F3FE', + u':person_biking_medium-light_skin_tone:': u'\U0001F6B4 \U0001F3FC', + u':person_biking_medium_skin_tone:': u'\U0001F6B4 \U0001F3FD', + u':person_bouncing_ball:': u'\U000026F9', + u':person_bouncing_ball_dark_skin_tone:': u'\U000026F9 \U0001F3FF', + u':person_bouncing_ball_light_skin_tone:': u'\U000026F9 \U0001F3FB', + u':person_bouncing_ball_medium-dark_skin_tone:': u'\U000026F9 \U0001F3FE', + u':person_bouncing_ball_medium-light_skin_tone:': u'\U000026F9 \U0001F3FC', + u':person_bouncing_ball_medium_skin_tone:': u'\U000026F9 \U0001F3FD', + u':person_bowing:': u'\U0001F647', + u':person_bowing_dark_skin_tone:': u'\U0001F647 \U0001F3FF', + u':person_bowing_light_skin_tone:': u'\U0001F647 \U0001F3FB', + u':person_bowing_medium-dark_skin_tone:': u'\U0001F647 \U0001F3FE', + u':person_bowing_medium-light_skin_tone:': u'\U0001F647 \U0001F3FC', + u':person_bowing_medium_skin_tone:': u'\U0001F647 \U0001F3FD', + u':person_cartwheeling:': u'\U0001F938', + u':person_cartwheeling_dark_skin_tone:': u'\U0001F938 \U0001F3FF', + u':person_cartwheeling_light_skin_tone:': u'\U0001F938 \U0001F3FB', + u':person_cartwheeling_medium-dark_skin_tone:': u'\U0001F938 \U0001F3FE', + u':person_cartwheeling_medium-light_skin_tone:': u'\U0001F938 \U0001F3FC', + u':person_cartwheeling_medium_skin_tone:': u'\U0001F938 \U0001F3FD', + u':person_facepalming:': u'\U0001F926', + u':person_facepalming_dark_skin_tone:': u'\U0001F926 \U0001F3FF', + u':person_facepalming_light_skin_tone:': u'\U0001F926 \U0001F3FB', + u':person_facepalming_medium-dark_skin_tone:': u'\U0001F926 \U0001F3FE', + u':person_facepalming_medium-light_skin_tone:': u'\U0001F926 \U0001F3FC', + u':person_facepalming_medium_skin_tone:': u'\U0001F926 \U0001F3FD', + u':person_fencing:': u'\U0001F93A', + u':person_frowning:': u'\U0001F64D', + u':person_frowning_dark_skin_tone:': u'\U0001F64D \U0001F3FF', + u':person_frowning_light_skin_tone:': u'\U0001F64D \U0001F3FB', + u':person_frowning_medium-dark_skin_tone:': u'\U0001F64D \U0001F3FE', + u':person_frowning_medium-light_skin_tone:': u'\U0001F64D \U0001F3FC', + u':person_frowning_medium_skin_tone:': u'\U0001F64D \U0001F3FD', + u':person_gesturing_NO:': u'\U0001F645', + u':person_gesturing_NO_dark_skin_tone:': u'\U0001F645 \U0001F3FF', + u':person_gesturing_NO_light_skin_tone:': u'\U0001F645 \U0001F3FB', + u':person_gesturing_NO_medium-dark_skin_tone:': u'\U0001F645 \U0001F3FE', + u':person_gesturing_NO_medium-light_skin_tone:': u'\U0001F645 \U0001F3FC', + u':person_gesturing_NO_medium_skin_tone:': u'\U0001F645 \U0001F3FD', + u':person_gesturing_OK:': u'\U0001F646', + u':person_gesturing_OK_dark_skin_tone:': u'\U0001F646 \U0001F3FF', + u':person_gesturing_OK_light_skin_tone:': u'\U0001F646 \U0001F3FB', + u':person_gesturing_OK_medium-dark_skin_tone:': u'\U0001F646 \U0001F3FE', + u':person_gesturing_OK_medium-light_skin_tone:': u'\U0001F646 \U0001F3FC', + u':person_gesturing_OK_medium_skin_tone:': u'\U0001F646 \U0001F3FD', + u':person_getting_haircut:': u'\U0001F487', + u':person_getting_haircut_dark_skin_tone:': u'\U0001F487 \U0001F3FF', + u':person_getting_haircut_light_skin_tone:': u'\U0001F487 \U0001F3FB', + u':person_getting_haircut_medium-dark_skin_tone:': u'\U0001F487 \U0001F3FE', + u':person_getting_haircut_medium-light_skin_tone:': u'\U0001F487 \U0001F3FC', + u':person_getting_haircut_medium_skin_tone:': u'\U0001F487 \U0001F3FD', + u':person_getting_massage:': u'\U0001F486', + u':person_getting_massage_dark_skin_tone:': u'\U0001F486 \U0001F3FF', + u':person_getting_massage_light_skin_tone:': u'\U0001F486 \U0001F3FB', + u':person_getting_massage_medium-dark_skin_tone:': u'\U0001F486 \U0001F3FE', + u':person_getting_massage_medium-light_skin_tone:': u'\U0001F486 \U0001F3FC', + u':person_getting_massage_medium_skin_tone:': u'\U0001F486 \U0001F3FD', + u':person_golfing:': u'\U0001F3CC', + u':person_golfing_dark_skin_tone:': u'\U0001F3CC \U0001F3FF', + u':person_golfing_light_skin_tone:': u'\U0001F3CC \U0001F3FB', + u':person_golfing_medium-dark_skin_tone:': u'\U0001F3CC \U0001F3FE', + u':person_golfing_medium-light_skin_tone:': u'\U0001F3CC \U0001F3FC', + u':person_golfing_medium_skin_tone:': u'\U0001F3CC \U0001F3FD', + u':person_in_bed:': u'\U0001F6CC', + u':person_in_bed_dark_skin_tone:': u'\U0001F6CC \U0001F3FF', + u':person_in_bed_light_skin_tone:': u'\U0001F6CC \U0001F3FB', + u':person_in_bed_medium-dark_skin_tone:': u'\U0001F6CC \U0001F3FE', + u':person_in_bed_medium-light_skin_tone:': u'\U0001F6CC \U0001F3FC', + u':person_in_bed_medium_skin_tone:': u'\U0001F6CC \U0001F3FD', + u':person_juggling:': u'\U0001F939', + u':person_juggling_dark_skin_tone:': u'\U0001F939 \U0001F3FF', + u':person_juggling_light_skin_tone:': u'\U0001F939 \U0001F3FB', + u':person_juggling_medium-dark_skin_tone:': u'\U0001F939 \U0001F3FE', + u':person_juggling_medium-light_skin_tone:': u'\U0001F939 \U0001F3FC', + u':person_juggling_medium_skin_tone:': u'\U0001F939 \U0001F3FD', + u':person_lifting_weights:': u'\U0001F3CB', + u':person_lifting_weights_dark_skin_tone:': u'\U0001F3CB \U0001F3FF', + u':person_lifting_weights_light_skin_tone:': u'\U0001F3CB \U0001F3FB', + u':person_lifting_weights_medium-dark_skin_tone:': u'\U0001F3CB \U0001F3FE', + u':person_lifting_weights_medium-light_skin_tone:': u'\U0001F3CB \U0001F3FC', + u':person_lifting_weights_medium_skin_tone:': u'\U0001F3CB \U0001F3FD', + u':person_mountain_biking:': u'\U0001F6B5', + u':person_mountain_biking_dark_skin_tone:': u'\U0001F6B5 \U0001F3FF', + u':person_mountain_biking_light_skin_tone:': u'\U0001F6B5 \U0001F3FB', + u':person_mountain_biking_medium-dark_skin_tone:': u'\U0001F6B5 \U0001F3FE', + u':person_mountain_biking_medium-light_skin_tone:': u'\U0001F6B5 \U0001F3FC', + u':person_mountain_biking_medium_skin_tone:': u'\U0001F6B5 \U0001F3FD', + u':person_playing_handball:': u'\U0001F93E', + u':person_playing_handball_dark_skin_tone:': u'\U0001F93E \U0001F3FF', + u':person_playing_handball_light_skin_tone:': u'\U0001F93E \U0001F3FB', + u':person_playing_handball_medium-dark_skin_tone:': u'\U0001F93E \U0001F3FE', + u':person_playing_handball_medium-light_skin_tone:': u'\U0001F93E \U0001F3FC', + u':person_playing_handball_medium_skin_tone:': u'\U0001F93E \U0001F3FD', + u':person_playing_water_polo:': u'\U0001F93D', + u':person_playing_water_polo_dark_skin_tone:': u'\U0001F93D \U0001F3FF', + u':person_playing_water_polo_light_skin_tone:': u'\U0001F93D \U0001F3FB', + u':person_playing_water_polo_medium-dark_skin_tone:': u'\U0001F93D \U0001F3FE', + u':person_playing_water_polo_medium-light_skin_tone:': u'\U0001F93D \U0001F3FC', + u':person_playing_water_polo_medium_skin_tone:': u'\U0001F93D \U0001F3FD', + u':person_pouting:': u'\U0001F64E', + u':person_pouting_dark_skin_tone:': u'\U0001F64E \U0001F3FF', + u':person_pouting_light_skin_tone:': u'\U0001F64E \U0001F3FB', + u':person_pouting_medium-dark_skin_tone:': u'\U0001F64E \U0001F3FE', + u':person_pouting_medium-light_skin_tone:': u'\U0001F64E \U0001F3FC', + u':person_pouting_medium_skin_tone:': u'\U0001F64E \U0001F3FD', + u':person_raising_hand:': u'\U0001F64B', + u':person_raising_hand_dark_skin_tone:': u'\U0001F64B \U0001F3FF', + u':person_raising_hand_light_skin_tone:': u'\U0001F64B \U0001F3FB', + u':person_raising_hand_medium-dark_skin_tone:': u'\U0001F64B \U0001F3FE', + u':person_raising_hand_medium-light_skin_tone:': u'\U0001F64B \U0001F3FC', + u':person_raising_hand_medium_skin_tone:': u'\U0001F64B \U0001F3FD', + u':person_rowing_boat:': u'\U0001F6A3', + u':person_rowing_boat_dark_skin_tone:': u'\U0001F6A3 \U0001F3FF', + u':person_rowing_boat_light_skin_tone:': u'\U0001F6A3 \U0001F3FB', + u':person_rowing_boat_medium-dark_skin_tone:': u'\U0001F6A3 \U0001F3FE', + u':person_rowing_boat_medium-light_skin_tone:': u'\U0001F6A3 \U0001F3FC', + u':person_rowing_boat_medium_skin_tone:': u'\U0001F6A3 \U0001F3FD', + u':person_running:': u'\U0001F3C3', + u':person_running_dark_skin_tone:': u'\U0001F3C3 \U0001F3FF', + u':person_running_light_skin_tone:': u'\U0001F3C3 \U0001F3FB', + u':person_running_medium-dark_skin_tone:': u'\U0001F3C3 \U0001F3FE', + u':person_running_medium-light_skin_tone:': u'\U0001F3C3 \U0001F3FC', + u':person_running_medium_skin_tone:': u'\U0001F3C3 \U0001F3FD', + u':person_shrugging:': u'\U0001F937', + u':person_shrugging_dark_skin_tone:': u'\U0001F937 \U0001F3FF', + u':person_shrugging_light_skin_tone:': u'\U0001F937 \U0001F3FB', + u':person_shrugging_medium-dark_skin_tone:': u'\U0001F937 \U0001F3FE', + u':person_shrugging_medium-light_skin_tone:': u'\U0001F937 \U0001F3FC', + u':person_shrugging_medium_skin_tone:': u'\U0001F937 \U0001F3FD', + u':person_surfing:': u'\U0001F3C4', + u':person_surfing_dark_skin_tone:': u'\U0001F3C4 \U0001F3FF', + u':person_surfing_light_skin_tone:': u'\U0001F3C4 \U0001F3FB', + u':person_surfing_medium-dark_skin_tone:': u'\U0001F3C4 \U0001F3FE', + u':person_surfing_medium-light_skin_tone:': u'\U0001F3C4 \U0001F3FC', + u':person_surfing_medium_skin_tone:': u'\U0001F3C4 \U0001F3FD', + u':person_swimming:': u'\U0001F3CA', + u':person_swimming_dark_skin_tone:': u'\U0001F3CA \U0001F3FF', + u':person_swimming_light_skin_tone:': u'\U0001F3CA \U0001F3FB', + u':person_swimming_medium-dark_skin_tone:': u'\U0001F3CA \U0001F3FE', + u':person_swimming_medium-light_skin_tone:': u'\U0001F3CA \U0001F3FC', + u':person_swimming_medium_skin_tone:': u'\U0001F3CA \U0001F3FD', + u':person_taking_bath:': u'\U0001F6C0', + u':person_taking_bath_dark_skin_tone:': u'\U0001F6C0 \U0001F3FF', + u':person_taking_bath_light_skin_tone:': u'\U0001F6C0 \U0001F3FB', + u':person_taking_bath_medium-dark_skin_tone:': u'\U0001F6C0 \U0001F3FE', + u':person_taking_bath_medium-light_skin_tone:': u'\U0001F6C0 \U0001F3FC', + u':person_taking_bath_medium_skin_tone:': u'\U0001F6C0 \U0001F3FD', + u':person_tipping_hand:': u'\U0001F481', + u':person_tipping_hand_dark_skin_tone:': u'\U0001F481 \U0001F3FF', + u':person_tipping_hand_light_skin_tone:': u'\U0001F481 \U0001F3FB', + u':person_tipping_hand_medium-dark_skin_tone:': u'\U0001F481 \U0001F3FE', + u':person_tipping_hand_medium-light_skin_tone:': u'\U0001F481 \U0001F3FC', + u':person_tipping_hand_medium_skin_tone:': u'\U0001F481 \U0001F3FD', + u':person_walking:': u'\U0001F6B6', + u':person_walking_dark_skin_tone:': u'\U0001F6B6 \U0001F3FF', + u':person_walking_light_skin_tone:': u'\U0001F6B6 \U0001F3FB', + u':person_walking_medium-dark_skin_tone:': u'\U0001F6B6 \U0001F3FE', + u':person_walking_medium-light_skin_tone:': u'\U0001F6B6 \U0001F3FC', + u':person_walking_medium_skin_tone:': u'\U0001F6B6 \U0001F3FD', + u':person_wearing_turban:': u'\U0001F473', + u':person_wearing_turban_dark_skin_tone:': u'\U0001F473 \U0001F3FF', + u':person_wearing_turban_light_skin_tone:': u'\U0001F473 \U0001F3FB', + u':person_wearing_turban_medium-dark_skin_tone:': u'\U0001F473 \U0001F3FE', + u':person_wearing_turban_medium-light_skin_tone:': u'\U0001F473 \U0001F3FC', + u':person_wearing_turban_medium_skin_tone:': u'\U0001F473 \U0001F3FD', + u':pick:': u'\U000026CF', + u':pig:': u'\U0001F416', + u':pig_face:': u'\U0001F437', + u':pig_nose:': u'\U0001F43D', + u':pile_of_poo:': u'\U0001F4A9', + u':pill:': u'\U0001F48A', + u':pine_decoration:': u'\U0001F38D', + u':pineapple:': u'\U0001F34D', + u':ping_pong:': u'\U0001F3D3', + u':pistol:': u'\U0001F52B', + u':pizza:': u'\U0001F355', + u':place_of_worship:': u'\U0001F6D0', + u':play_button:': u'\U000025B6', + u':play_or_pause_button:': u'\U000023EF', + u':police_car:': u'\U0001F693', + u':police_car_light:': u'\U0001F6A8', + u':police_officer:': u'\U0001F46E', + u':police_officer_dark_skin_tone:': u'\U0001F46E \U0001F3FF', + u':police_officer_light_skin_tone:': u'\U0001F46E \U0001F3FB', + u':police_officer_medium-dark_skin_tone:': u'\U0001F46E \U0001F3FE', + u':police_officer_medium-light_skin_tone:': u'\U0001F46E \U0001F3FC', + u':police_officer_medium_skin_tone:': u'\U0001F46E \U0001F3FD', + u':poodle:': u'\U0001F429', + u':pool_8_ball:': u'\U0001F3B1', + u':popcorn:': u'\U0001F37F', + u':post_office:': u'\U0001F3E4', + u':postal_horn:': u'\U0001F4EF', + u':postbox:': u'\U0001F4EE', + u':pot_of_food:': u'\U0001F372', + u':potable_water:': u'\U0001F6B0', + u':potato:': u'\U0001F954', + u':poultry_leg:': u'\U0001F357', + u':pound_banknote:': u'\U0001F4B7', + u':pouting_cat_face:': u'\U0001F63E', + u':pouting_face:': u'\U0001F621', + u':prayer_beads:': u'\U0001F4FF', + u':pregnant_woman:': u'\U0001F930', + u':pregnant_woman_dark_skin_tone:': u'\U0001F930 \U0001F3FF', + u':pregnant_woman_light_skin_tone:': u'\U0001F930 \U0001F3FB', + u':pregnant_woman_medium-dark_skin_tone:': u'\U0001F930 \U0001F3FE', + u':pregnant_woman_medium-light_skin_tone:': u'\U0001F930 \U0001F3FC', + u':pregnant_woman_medium_skin_tone:': u'\U0001F930 \U0001F3FD', + u':prince:': u'\U0001F934', + u':prince_dark_skin_tone:': u'\U0001F934 \U0001F3FF', + u':prince_light_skin_tone:': u'\U0001F934 \U0001F3FB', + u':prince_medium-dark_skin_tone:': u'\U0001F934 \U0001F3FE', + u':prince_medium-light_skin_tone:': u'\U0001F934 \U0001F3FC', + u':prince_medium_skin_tone:': u'\U0001F934 \U0001F3FD', + u':princess:': u'\U0001F478', + u':princess_dark_skin_tone:': u'\U0001F478 \U0001F3FF', + u':princess_light_skin_tone:': u'\U0001F478 \U0001F3FB', + u':princess_medium-dark_skin_tone:': u'\U0001F478 \U0001F3FE', + u':princess_medium-light_skin_tone:': u'\U0001F478 \U0001F3FC', + u':princess_medium_skin_tone:': u'\U0001F478 \U0001F3FD', + u':printer:': u'\U0001F5A8', + u':prohibited:': u'\U0001F6AB', + u':purple_heart:': u'\U0001F49C', + u':purse:': u'\U0001F45B', + u':pushpin:': u'\U0001F4CC', + u':question_mark:': u'\U00002753', + u':rabbit:': u'\U0001F407', + u':rabbit_face:': u'\U0001F430', + u':racing_car:': u'\U0001F3CE', + u':radio:': u'\U0001F4FB', + u':radio_button:': u'\U0001F518', + u':radioactive:': u'\U00002622', + u':railway_car:': u'\U0001F683', + u':railway_track:': u'\U0001F6E4', + u':rainbow:': u'\U0001F308', + u':rainbow_flag:': u'\U0001F3F3 \U0000FE0F \U0000200D \U0001F308', + u':raised_back_of_hand:': u'\U0001F91A', + u':raised_back_of_hand_dark_skin_tone:': u'\U0001F91A \U0001F3FF', + u':raised_back_of_hand_light_skin_tone:': u'\U0001F91A \U0001F3FB', + u':raised_back_of_hand_medium-dark_skin_tone:': u'\U0001F91A \U0001F3FE', + u':raised_back_of_hand_medium-light_skin_tone:': u'\U0001F91A \U0001F3FC', + u':raised_back_of_hand_medium_skin_tone:': u'\U0001F91A \U0001F3FD', + u':raised_fist:': u'\U0000270A', + u':raised_fist_dark_skin_tone:': u'\U0000270A \U0001F3FF', + u':raised_fist_light_skin_tone:': u'\U0000270A \U0001F3FB', + u':raised_fist_medium-dark_skin_tone:': u'\U0000270A \U0001F3FE', + u':raised_fist_medium-light_skin_tone:': u'\U0000270A \U0001F3FC', + u':raised_fist_medium_skin_tone:': u'\U0000270A \U0001F3FD', + u':raised_hand:': u'\U0000270B', + u':raised_hand_dark_skin_tone:': u'\U0000270B \U0001F3FF', + u':raised_hand_light_skin_tone:': u'\U0000270B \U0001F3FB', + u':raised_hand_medium-dark_skin_tone:': u'\U0000270B \U0001F3FE', + u':raised_hand_medium-light_skin_tone:': u'\U0000270B \U0001F3FC', + u':raised_hand_medium_skin_tone:': u'\U0000270B \U0001F3FD', + u':raised_hand_with_fingers_splayed:': u'\U0001F590', + u':raised_hand_with_fingers_splayed_dark_skin_tone:': u'\U0001F590 \U0001F3FF', + u':raised_hand_with_fingers_splayed_light_skin_tone:': u'\U0001F590 \U0001F3FB', + u':raised_hand_with_fingers_splayed_medium-dark_skin_tone:': u'\U0001F590 \U0001F3FE', + u':raised_hand_with_fingers_splayed_medium-light_skin_tone:': u'\U0001F590 \U0001F3FC', + u':raised_hand_with_fingers_splayed_medium_skin_tone:': u'\U0001F590 \U0001F3FD', + u':raising_hands:': u'\U0001F64C', + u':raising_hands_dark_skin_tone:': u'\U0001F64C \U0001F3FF', + u':raising_hands_light_skin_tone:': u'\U0001F64C \U0001F3FB', + u':raising_hands_medium-dark_skin_tone:': u'\U0001F64C \U0001F3FE', + u':raising_hands_medium-light_skin_tone:': u'\U0001F64C \U0001F3FC', + u':raising_hands_medium_skin_tone:': u'\U0001F64C \U0001F3FD', + u':ram:': u'\U0001F40F', + u':rat:': u'\U0001F400', + u':record_button:': u'\U000023FA', + u':recycling_symbol:': u'\U0000267B', + u':red_apple:': u'\U0001F34E', + u':red_circle:': u'\U0001F534', + u':red_heart:': u'\U00002764', + u':red_paper_lantern:': u'\U0001F3EE', + u':red_triangle_pointed_down:': u'\U0001F53B', + u':red_triangle_pointed_up:': u'\U0001F53A', + u':registered:': u'\U000000AE', + u':relieved_face:': u'\U0001F60C', + u':reminder_ribbon:': u'\U0001F397', + u':repeat_button:': u'\U0001F501', + u':repeat_single_button:': u'\U0001F502', + u':rescue_worker’s_helmet:': u'\U000026D1', + u':restroom:': u'\U0001F6BB', + u':reverse_button:': u'\U000025C0', + u':revolving_hearts:': u'\U0001F49E', + u':rhinoceros:': u'\U0001F98F', + u':ribbon:': u'\U0001F380', + u':rice_ball:': u'\U0001F359', + u':rice_cracker:': u'\U0001F358', + u':right-facing_fist:': u'\U0001F91C', + u':right-facing_fist_dark_skin_tone:': u'\U0001F91C \U0001F3FF', + u':right-facing_fist_light_skin_tone:': u'\U0001F91C \U0001F3FB', + u':right-facing_fist_medium-dark_skin_tone:': u'\U0001F91C \U0001F3FE', + u':right-facing_fist_medium-light_skin_tone:': u'\U0001F91C \U0001F3FC', + u':right-facing_fist_medium_skin_tone:': u'\U0001F91C \U0001F3FD', + u':right-pointing_magnifying_glass:': u'\U0001F50E', + u':right_anger_bubble:': u'\U0001F5EF', + u':right_arrow:': u'\U000027A1', + u':right_arrow_curving_down:': u'\U00002935', + u':right_arrow_curving_left:': u'\U000021A9', + u':right_arrow_curving_up:': u'\U00002934', + u':ring:': u'\U0001F48D', + u':roasted_sweet_potato:': u'\U0001F360', + u':robot_face:': u'\U0001F916', + u':rocket:': u'\U0001F680', + u':rolled-up_newspaper:': u'\U0001F5DE', + u':roller_coaster:': u'\U0001F3A2', + u':rolling_on_the_floor_laughing:': u'\U0001F923', + u':rooster:': u'\U0001F413', + u':rose:': u'\U0001F339', + u':rosette:': u'\U0001F3F5', + u':round_pushpin:': u'\U0001F4CD', + u':rugby_football:': u'\U0001F3C9', + u':running_shirt:': u'\U0001F3BD', + u':running_shoe:': u'\U0001F45F', + u':sailboat:': u'\U000026F5', + u':sake:': u'\U0001F376', + u':satellite:': u'\U0001F6F0', + u':satellite_antenna:': u'\U0001F4E1', + u':saxophone:': u'\U0001F3B7', + u':school:': u'\U0001F3EB', + u':school_backpack:': u'\U0001F392', + u':scissors:': u'\U00002702', + u':scorpion:': u'\U0001F982', + u':scroll:': u'\U0001F4DC', + u':seat:': u'\U0001F4BA', + u':see-no-evil_monkey:': u'\U0001F648', + u':seedling:': u'\U0001F331', + u':selfie:': u'\U0001F933', + u':selfie_dark_skin_tone:': u'\U0001F933 \U0001F3FF', + u':selfie_light_skin_tone:': u'\U0001F933 \U0001F3FB', + u':selfie_medium-dark_skin_tone:': u'\U0001F933 \U0001F3FE', + u':selfie_medium-light_skin_tone:': u'\U0001F933 \U0001F3FC', + u':selfie_medium_skin_tone:': u'\U0001F933 \U0001F3FD', + u':seven-thirty:': u'\U0001F562', + u':seven_o’clock:': u'\U0001F556', + u':shallow_pan_of_food:': u'\U0001F958', + u':shamrock:': u'\U00002618', + u':shark:': u'\U0001F988', + u':shaved_ice:': u'\U0001F367', + u':sheaf_of_rice:': u'\U0001F33E', + u':sheep:': u'\U0001F411', + u':shield:': u'\U0001F6E1', + u':shinto_shrine:': u'\U000026E9', + u':ship:': u'\U0001F6A2', + u':shooting_star:': u'\U0001F320', + u':shopping_bags:': u'\U0001F6CD', + u':shopping_cart:': u'\U0001F6D2', + u':shortcake:': u'\U0001F370', + u':shower:': u'\U0001F6BF', + u':shrimp:': u'\U0001F990', + u':shuffle_tracks_button:': u'\U0001F500', + u':sign_of_the_horns:': u'\U0001F918', + u':sign_of_the_horns_dark_skin_tone:': u'\U0001F918 \U0001F3FF', + u':sign_of_the_horns_light_skin_tone:': u'\U0001F918 \U0001F3FB', + u':sign_of_the_horns_medium-dark_skin_tone:': u'\U0001F918 \U0001F3FE', + u':sign_of_the_horns_medium-light_skin_tone:': u'\U0001F918 \U0001F3FC', + u':sign_of_the_horns_medium_skin_tone:': u'\U0001F918 \U0001F3FD', + u':six-thirty:': u'\U0001F561', + u':six_o’clock:': u'\U0001F555', + u':skier:': u'\U000026F7', + u':skis:': u'\U0001F3BF', + u':skull:': u'\U0001F480', + u':skull_and_crossbones:': u'\U00002620', + u':sleeping_face:': u'\U0001F634', + u':sleepy_face:': u'\U0001F62A', + u':slightly_frowning_face:': u'\U0001F641', + u':slightly_smiling_face:': u'\U0001F642', + u':slot_machine:': u'\U0001F3B0', + u':small_airplane:': u'\U0001F6E9', + u':small_blue_diamond:': u'\U0001F539', + u':small_orange_diamond:': u'\U0001F538', + u':smiling_cat_face_with_heart-eyes:': u'\U0001F63B', + u':smiling_cat_face_with_open_mouth:': u'\U0001F63A', + u':smiling_face:': u'\U0000263A', + u':smiling_face_with_halo:': u'\U0001F607', + u':smiling_face_with_heart-eyes:': u'\U0001F60D', + u':smiling_face_with_horns:': u'\U0001F608', + u':smiling_face_with_open_mouth:': u'\U0001F603', + u':smiling_face_with_open_mouth_&_closed_eyes:': u'\U0001F606', + u':smiling_face_with_open_mouth_&_cold_sweat:': u'\U0001F605', + u':smiling_face_with_open_mouth_&_smiling_eyes:': u'\U0001F604', + u':smiling_face_with_smiling_eyes:': u'\U0001F60A', + u':smiling_face_with_sunglasses:': u'\U0001F60E', + u':smirking_face:': u'\U0001F60F', + u':snail:': u'\U0001F40C', + u':snake:': u'\U0001F40D', + u':sneezing_face:': u'\U0001F927', + u':snow-capped_mountain:': u'\U0001F3D4', + u':snowboarder:': u'\U0001F3C2', + u':snowboarder_dark_skin_tone:': u'\U0001F3C2 \U0001F3FF', + u':snowboarder_light_skin_tone:': u'\U0001F3C2 \U0001F3FB', + u':snowboarder_medium-dark_skin_tone:': u'\U0001F3C2 \U0001F3FE', + u':snowboarder_medium-light_skin_tone:': u'\U0001F3C2 \U0001F3FC', + u':snowboarder_medium_skin_tone:': u'\U0001F3C2 \U0001F3FD', + u':snowflake:': u'\U00002744', + u':snowman:': u'\U00002603', + u':snowman_without_snow:': u'\U000026C4', + u':soccer_ball:': u'\U000026BD', + u':soft_ice_cream:': u'\U0001F366', + u':spade_suit:': u'\U00002660', + u':spaghetti:': u'\U0001F35D', + u':sparkle:': u'\U00002747', + u':sparkler:': u'\U0001F387', + u':sparkles:': u'\U00002728', + u':sparkling_heart:': u'\U0001F496', + u':speak-no-evil_monkey:': u'\U0001F64A', + u':speaker_high_volume:': u'\U0001F50A', + u':speaker_low_volume:': u'\U0001F508', + u':speaker_medium_volume:': u'\U0001F509', + u':speaking_head:': u'\U0001F5E3', + u':speech_balloon:': u'\U0001F4AC', + u':speedboat:': u'\U0001F6A4', + u':spider:': u'\U0001F577', + u':spider_web:': u'\U0001F578', + u':spiral_calendar:': u'\U0001F5D3', + u':spiral_notepad:': u'\U0001F5D2', + u':spiral_shell:': u'\U0001F41A', + u':spoon:': u'\U0001F944', + u':sport_utility_vehicle:': u'\U0001F699', + u':sports_medal:': u'\U0001F3C5', + u':spouting_whale:': u'\U0001F433', + u':squid:': u'\U0001F991', + u':stadium:': u'\U0001F3DF', + u':star_and_crescent:': u'\U0000262A', + u':star_of_David:': u'\U00002721', + u':station:': u'\U0001F689', + u':steaming_bowl:': u'\U0001F35C', + u':stop_button:': u'\U000023F9', + u':stop_sign:': u'\U0001F6D1', + u':stopwatch:': u'\U000023F1', + u':straight_ruler:': u'\U0001F4CF', + u':strawberry:': u'\U0001F353', + u':studio_microphone:': u'\U0001F399', + u':stuffed_flatbread:': u'\U0001F959', + u':sun:': u'\U00002600', + u':sun_behind_cloud:': u'\U000026C5', + u':sun_behind_large_cloud:': u'\U0001F325', + u':sun_behind_rain_cloud:': u'\U0001F326', + u':sun_behind_small_cloud:': u'\U0001F324', + u':sun_with_face:': u'\U0001F31E', + u':sunflower:': u'\U0001F33B', + u':sunglasses:': u'\U0001F576', + u':sunrise:': u'\U0001F305', + u':sunrise_over_mountains:': u'\U0001F304', + u':sunset:': u'\U0001F307', + u':sushi:': u'\U0001F363', + u':suspension_railway:': u'\U0001F69F', + u':sweat_droplets:': u'\U0001F4A6', + u':synagogue:': u'\U0001F54D', + u':syringe:': u'\U0001F489', + u':t-shirt:': u'\U0001F455', + u':taco:': u'\U0001F32E', + u':tanabata_tree:': u'\U0001F38B', + u':tangerine:': u'\U0001F34A', + u':taxi:': u'\U0001F695', + u':teacup_without_handle:': u'\U0001F375', + u':tear-off_calendar:': u'\U0001F4C6', + u':telephone:': u'\U0000260E', + u':telephone_receiver:': u'\U0001F4DE', + u':telescope:': u'\U0001F52D', + u':television:': u'\U0001F4FA', + u':ten-thirty:': u'\U0001F565', + u':ten_o’clock:': u'\U0001F559', + u':tennis:': u'\U0001F3BE', + u':tent:': u'\U000026FA', + u':thermometer:': u'\U0001F321', + u':thinking_face:': u'\U0001F914', + u':thought_balloon:': u'\U0001F4AD', + u':three-thirty:': u'\U0001F55E', + u':three_o’clock:': u'\U0001F552', + u':thumbs_down:': u'\U0001F44E', + u':thumbs_down_dark_skin_tone:': u'\U0001F44E \U0001F3FF', + u':thumbs_down_light_skin_tone:': u'\U0001F44E \U0001F3FB', + u':thumbs_down_medium-dark_skin_tone:': u'\U0001F44E \U0001F3FE', + u':thumbs_down_medium-light_skin_tone:': u'\U0001F44E \U0001F3FC', + u':thumbs_down_medium_skin_tone:': u'\U0001F44E \U0001F3FD', + u':thumbs_up:': u'\U0001F44D', + u':thumbs_up_dark_skin_tone:': u'\U0001F44D \U0001F3FF', + u':thumbs_up_light_skin_tone:': u'\U0001F44D \U0001F3FB', + u':thumbs_up_medium-dark_skin_tone:': u'\U0001F44D \U0001F3FE', + u':thumbs_up_medium-light_skin_tone:': u'\U0001F44D \U0001F3FC', + u':thumbs_up_medium_skin_tone:': u'\U0001F44D \U0001F3FD', + u':ticket:': u'\U0001F3AB', + u':tiger:': u'\U0001F405', + u':tiger_face:': u'\U0001F42F', + u':timer_clock:': u'\U000023F2', + u':tired_face:': u'\U0001F62B', + u':toilet:': u'\U0001F6BD', + u':tomato:': u'\U0001F345', + u':tongue:': u'\U0001F445', + u':top_hat:': u'\U0001F3A9', + u':tornado:': u'\U0001F32A', + u':trackball:': u'\U0001F5B2', + u':tractor:': u'\U0001F69C', + u':trade_mark:': u'\U00002122', + u':train:': u'\U0001F686', + u':tram:': u'\U0001F68A', + u':tram_car:': u'\U0001F68B', + u':triangular_flag:': u'\U0001F6A9', + u':triangular_ruler:': u'\U0001F4D0', + u':trident_emblem:': u'\U0001F531', + u':trolleybus:': u'\U0001F68E', + u':trophy:': u'\U0001F3C6', + u':tropical_drink:': u'\U0001F379', + u':tropical_fish:': u'\U0001F420', + u':trumpet:': u'\U0001F3BA', + u':tulip:': u'\U0001F337', + u':tumbler_glass:': u'\U0001F943', + u':turkey:': u'\U0001F983', + u':turtle:': u'\U0001F422', + u':twelve-thirty:': u'\U0001F567', + u':twelve_o’clock:': u'\U0001F55B', + u':two-hump_camel:': u'\U0001F42B', + u':two-thirty:': u'\U0001F55D', + u':two_hearts:': u'\U0001F495', + u':two_men_holding_hands:': u'\U0001F46C', + u':two_o’clock:': u'\U0001F551', + u':two_women_holding_hands:': u'\U0001F46D', + u':umbrella:': u'\U00002602', + u':umbrella_on_ground:': u'\U000026F1', + u':umbrella_with_rain_drops:': u'\U00002614', + u':unamused_face:': u'\U0001F612', + u':unicorn_face:': u'\U0001F984', + u':unlocked:': u'\U0001F513', + u':up-down_arrow:': u'\U00002195', + u':up-left_arrow:': u'\U00002196', + u':up-right_arrow:': u'\U00002197', + u':up_arrow:': u'\U00002B06', + u':up_button:': u'\U0001F53C', + u':upside-down_face:': u'\U0001F643', + u':vertical_traffic_light:': u'\U0001F6A6', + u':vibration_mode:': u'\U0001F4F3', + u':victory_hand:': u'\U0000270C', + u':victory_hand_dark_skin_tone:': u'\U0000270C \U0001F3FF', + u':victory_hand_light_skin_tone:': u'\U0000270C \U0001F3FB', + u':victory_hand_medium-dark_skin_tone:': u'\U0000270C \U0001F3FE', + u':victory_hand_medium-light_skin_tone:': u'\U0000270C \U0001F3FC', + u':victory_hand_medium_skin_tone:': u'\U0000270C \U0001F3FD', + u':video_camera:': u'\U0001F4F9', + u':video_game:': u'\U0001F3AE', + u':videocassette:': u'\U0001F4FC', + u':violin:': u'\U0001F3BB', + u':volcano:': u'\U0001F30B', + u':volleyball:': u'\U0001F3D0', + u':vulcan_salute:': u'\U0001F596', + u':vulcan_salute_dark_skin_tone:': u'\U0001F596 \U0001F3FF', + u':vulcan_salute_light_skin_tone:': u'\U0001F596 \U0001F3FB', + u':vulcan_salute_medium-dark_skin_tone:': u'\U0001F596 \U0001F3FE', + u':vulcan_salute_medium-light_skin_tone:': u'\U0001F596 \U0001F3FC', + u':vulcan_salute_medium_skin_tone:': u'\U0001F596 \U0001F3FD', + u':waning_crescent_moon:': u'\U0001F318', + u':waning_gibbous_moon:': u'\U0001F316', + u':warning:': u'\U000026A0', + u':wastebasket:': u'\U0001F5D1', + u':watch:': u'\U0000231A', + u':water_buffalo:': u'\U0001F403', + u':water_closet:': u'\U0001F6BE', + u':water_wave:': u'\U0001F30A', + u':watermelon:': u'\U0001F349', + u':waving_hand:': u'\U0001F44B', + u':waving_hand_dark_skin_tone:': u'\U0001F44B \U0001F3FF', + u':waving_hand_light_skin_tone:': u'\U0001F44B \U0001F3FB', + u':waving_hand_medium-dark_skin_tone:': u'\U0001F44B \U0001F3FE', + u':waving_hand_medium-light_skin_tone:': u'\U0001F44B \U0001F3FC', + u':waving_hand_medium_skin_tone:': u'\U0001F44B \U0001F3FD', + u':wavy_dash:': u'\U00003030', + u':waxing_crescent_moon:': u'\U0001F312', + u':waxing_gibbous_moon:': u'\U0001F314', + u':weary_cat_face:': u'\U0001F640', + u':weary_face:': u'\U0001F629', + u':wedding:': u'\U0001F492', + u':whale:': u'\U0001F40B', + u':wheel_of_dharma:': u'\U00002638', + u':wheelchair_symbol:': u'\U0000267F', + u':white_circle:': u'\U000026AA', + u':white_exclamation_mark:': u'\U00002755', + u':white_flag:': u'\U0001F3F3', + u':white_flower:': u'\U0001F4AE', + u':white_heavy_check_mark:': u'\U00002705', + u':white_large_square:': u'\U00002B1C', + u':white_medium-small_square:': u'\U000025FD', + u':white_medium_square:': u'\U000025FB', + u':white_medium_star:': u'\U00002B50', + u':white_question_mark:': u'\U00002754', + u':white_small_square:': u'\U000025AB', + u':white_square_button:': u'\U0001F533', + u':wilted_flower:': u'\U0001F940', + u':wind_chime:': u'\U0001F390', + u':wind_face:': u'\U0001F32C', + u':wine_glass:': u'\U0001F377', + u':winking_face:': u'\U0001F609', + u':wolf_face:': u'\U0001F43A', + u':woman:': u'\U0001F469', + u':woman_artist:': u'\U0001F469 \U0000200D \U0001F3A8', + u':woman_artist_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F3A8', + u':woman_artist_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F3A8', + u':woman_artist_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F3A8', + u':woman_artist_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F3A8', + u':woman_artist_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F3A8', + u':woman_astronaut:': u'\U0001F469 \U0000200D \U0001F680', + u':woman_astronaut_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F680', + u':woman_astronaut_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F680', + u':woman_astronaut_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F680', + u':woman_astronaut_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F680', + u':woman_astronaut_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F680', + u':woman_biking:': u'\U0001F6B4 \U0000200D \U00002640 \U0000FE0F', + u':woman_biking_dark_skin_tone:': u'\U0001F6B4 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_biking_light_skin_tone:': u'\U0001F6B4 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_biking_medium-dark_skin_tone:': u'\U0001F6B4 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_biking_medium-light_skin_tone:': u'\U0001F6B4 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_biking_medium_skin_tone:': u'\U0001F6B4 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball:': u'\U000026F9 \U0000FE0F \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball_dark_skin_tone:': u'\U000026F9 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball_light_skin_tone:': u'\U000026F9 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball_medium-dark_skin_tone:': u'\U000026F9 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball_medium-light_skin_tone:': u'\U000026F9 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_bouncing_ball_medium_skin_tone:': u'\U000026F9 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing:': u'\U0001F647 \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing_dark_skin_tone:': u'\U0001F647 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing_light_skin_tone:': u'\U0001F647 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing_medium-dark_skin_tone:': u'\U0001F647 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing_medium-light_skin_tone:': u'\U0001F647 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_bowing_medium_skin_tone:': u'\U0001F647 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling:': u'\U0001F938 \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling_dark_skin_tone:': u'\U0001F938 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling_light_skin_tone:': u'\U0001F938 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling_medium-dark_skin_tone:': u'\U0001F938 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling_medium-light_skin_tone:': u'\U0001F938 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_cartwheeling_medium_skin_tone:': u'\U0001F938 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker:': u'\U0001F477 \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker_dark_skin_tone:': u'\U0001F477 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker_light_skin_tone:': u'\U0001F477 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker_medium-dark_skin_tone:': u'\U0001F477 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker_medium-light_skin_tone:': u'\U0001F477 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_construction_worker_medium_skin_tone:': u'\U0001F477 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_cook:': u'\U0001F469 \U0000200D \U0001F373', + u':woman_cook_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F373', + u':woman_cook_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F373', + u':woman_cook_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F373', + u':woman_cook_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F373', + u':woman_cook_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F373', + u':woman_dancing:': u'\U0001F483', + u':woman_dancing_dark_skin_tone:': u'\U0001F483 \U0001F3FF', + u':woman_dancing_light_skin_tone:': u'\U0001F483 \U0001F3FB', + u':woman_dancing_medium-dark_skin_tone:': u'\U0001F483 \U0001F3FE', + u':woman_dancing_medium-light_skin_tone:': u'\U0001F483 \U0001F3FC', + u':woman_dancing_medium_skin_tone:': u'\U0001F483 \U0001F3FD', + u':woman_dark_skin_tone:': u'\U0001F469 \U0001F3FF', + u':woman_detective:': u'\U0001F575 \U0000FE0F \U0000200D \U00002640 \U0000FE0F', + u':woman_detective_dark_skin_tone:': u'\U0001F575 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_detective_light_skin_tone:': u'\U0001F575 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_detective_medium-dark_skin_tone:': u'\U0001F575 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_detective_medium-light_skin_tone:': u'\U0001F575 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_detective_medium_skin_tone:': u'\U0001F575 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming:': u'\U0001F926 \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming_dark_skin_tone:': u'\U0001F926 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming_light_skin_tone:': u'\U0001F926 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming_medium-dark_skin_tone:': u'\U0001F926 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming_medium-light_skin_tone:': u'\U0001F926 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_facepalming_medium_skin_tone:': u'\U0001F926 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_factory_worker:': u'\U0001F469 \U0000200D \U0001F3ED', + u':woman_factory_worker_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F3ED', + u':woman_factory_worker_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F3ED', + u':woman_factory_worker_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F3ED', + u':woman_factory_worker_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F3ED', + u':woman_factory_worker_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F3ED', + u':woman_farmer:': u'\U0001F469 \U0000200D \U0001F33E', + u':woman_farmer_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F33E', + u':woman_farmer_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F33E', + u':woman_farmer_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F33E', + u':woman_farmer_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F33E', + u':woman_farmer_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F33E', + u':woman_firefighter:': u'\U0001F469 \U0000200D \U0001F692', + u':woman_firefighter_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F692', + u':woman_firefighter_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F692', + u':woman_firefighter_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F692', + u':woman_firefighter_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F692', + u':woman_firefighter_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F692', + u':woman_frowning:': u'\U0001F64D \U0000200D \U00002640 \U0000FE0F', + u':woman_frowning_dark_skin_tone:': u'\U0001F64D \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_frowning_light_skin_tone:': u'\U0001F64D \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_frowning_medium-dark_skin_tone:': u'\U0001F64D \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_frowning_medium-light_skin_tone:': u'\U0001F64D \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_frowning_medium_skin_tone:': u'\U0001F64D \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO:': u'\U0001F645 \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO_dark_skin_tone:': u'\U0001F645 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO_light_skin_tone:': u'\U0001F645 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO_medium-dark_skin_tone:': u'\U0001F645 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO_medium-light_skin_tone:': u'\U0001F645 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_NO_medium_skin_tone:': u'\U0001F645 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK:': u'\U0001F646 \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK_dark_skin_tone:': u'\U0001F646 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK_light_skin_tone:': u'\U0001F646 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK_medium-dark_skin_tone:': u'\U0001F646 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK_medium-light_skin_tone:': u'\U0001F646 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_gesturing_OK_medium_skin_tone:': u'\U0001F646 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut:': u'\U0001F487 \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut_dark_skin_tone:': u'\U0001F487 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut_light_skin_tone:': u'\U0001F487 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut_medium-dark_skin_tone:': u'\U0001F487 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut_medium-light_skin_tone:': u'\U0001F487 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_haircut_medium_skin_tone:': u'\U0001F487 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage:': u'\U0001F486 \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage_dark_skin_tone:': u'\U0001F486 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage_light_skin_tone:': u'\U0001F486 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage_medium-dark_skin_tone:': u'\U0001F486 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage_medium-light_skin_tone:': u'\U0001F486 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_getting_massage_medium_skin_tone:': u'\U0001F486 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing:': u'\U0001F3CC \U0000FE0F \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing_dark_skin_tone:': u'\U0001F3CC \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing_light_skin_tone:': u'\U0001F3CC \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing_medium-dark_skin_tone:': u'\U0001F3CC \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing_medium-light_skin_tone:': u'\U0001F3CC \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_golfing_medium_skin_tone:': u'\U0001F3CC \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_guard:': u'\U0001F482 \U0000200D \U00002640 \U0000FE0F', + u':woman_guard_dark_skin_tone:': u'\U0001F482 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_guard_light_skin_tone:': u'\U0001F482 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_guard_medium-dark_skin_tone:': u'\U0001F482 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_guard_medium-light_skin_tone:': u'\U0001F482 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_guard_medium_skin_tone:': u'\U0001F482 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_health_worker:': u'\U0001F469 \U0000200D \U00002695 \U0000FE0F', + u':woman_health_worker_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U00002695 \U0000FE0F', + u':woman_health_worker_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U00002695 \U0000FE0F', + u':woman_health_worker_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U00002695 \U0000FE0F', + u':woman_health_worker_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U00002695 \U0000FE0F', + u':woman_health_worker_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U00002695 \U0000FE0F', + u':woman_judge:': u'\U0001F469 \U0000200D \U00002696 \U0000FE0F', + u':woman_judge_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U00002696 \U0000FE0F', + u':woman_judge_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U00002696 \U0000FE0F', + u':woman_judge_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U00002696 \U0000FE0F', + u':woman_judge_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U00002696 \U0000FE0F', + u':woman_judge_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U00002696 \U0000FE0F', + u':woman_juggling:': u'\U0001F939 \U0000200D \U00002640 \U0000FE0F', + u':woman_juggling_dark_skin_tone:': u'\U0001F939 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_juggling_light_skin_tone:': u'\U0001F939 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_juggling_medium-dark_skin_tone:': u'\U0001F939 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_juggling_medium-light_skin_tone:': u'\U0001F939 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_juggling_medium_skin_tone:': u'\U0001F939 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights:': u'\U0001F3CB \U0000FE0F \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights_dark_skin_tone:': u'\U0001F3CB \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights_light_skin_tone:': u'\U0001F3CB \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights_medium-dark_skin_tone:': u'\U0001F3CB \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights_medium-light_skin_tone:': u'\U0001F3CB \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_lifting_weights_medium_skin_tone:': u'\U0001F3CB \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_light_skin_tone:': u'\U0001F469 \U0001F3FB', + u':woman_mechanic:': u'\U0001F469 \U0000200D \U0001F527', + u':woman_mechanic_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F527', + u':woman_mechanic_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F527', + u':woman_mechanic_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F527', + u':woman_mechanic_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F527', + u':woman_mechanic_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F527', + u':woman_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE', + u':woman_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC', + u':woman_medium_skin_tone:': u'\U0001F469 \U0001F3FD', + u':woman_mountain_biking:': u'\U0001F6B5 \U0000200D \U00002640 \U0000FE0F', + u':woman_mountain_biking_dark_skin_tone:': u'\U0001F6B5 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_mountain_biking_light_skin_tone:': u'\U0001F6B5 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_mountain_biking_medium-dark_skin_tone:': u'\U0001F6B5 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_mountain_biking_medium-light_skin_tone:': u'\U0001F6B5 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_mountain_biking_medium_skin_tone:': u'\U0001F6B5 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_office_worker:': u'\U0001F469 \U0000200D \U0001F4BC', + u':woman_office_worker_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F4BC', + u':woman_office_worker_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F4BC', + u':woman_office_worker_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F4BC', + u':woman_office_worker_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F4BC', + u':woman_office_worker_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F4BC', + u':woman_pilot:': u'\U0001F469 \U0000200D \U00002708 \U0000FE0F', + u':woman_pilot_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U00002708 \U0000FE0F', + u':woman_pilot_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U00002708 \U0000FE0F', + u':woman_pilot_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U00002708 \U0000FE0F', + u':woman_pilot_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U00002708 \U0000FE0F', + u':woman_pilot_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U00002708 \U0000FE0F', + u':woman_playing_handball:': u'\U0001F93E \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_handball_dark_skin_tone:': u'\U0001F93E \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_handball_light_skin_tone:': u'\U0001F93E \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_handball_medium-dark_skin_tone:': u'\U0001F93E \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_handball_medium-light_skin_tone:': u'\U0001F93E \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_handball_medium_skin_tone:': u'\U0001F93E \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo:': u'\U0001F93D \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo_dark_skin_tone:': u'\U0001F93D \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo_light_skin_tone:': u'\U0001F93D \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo_medium-dark_skin_tone:': u'\U0001F93D \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo_medium-light_skin_tone:': u'\U0001F93D \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_playing_water_polo_medium_skin_tone:': u'\U0001F93D \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer:': u'\U0001F46E \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer_dark_skin_tone:': u'\U0001F46E \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer_light_skin_tone:': u'\U0001F46E \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer_medium-dark_skin_tone:': u'\U0001F46E \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer_medium-light_skin_tone:': u'\U0001F46E \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_police_officer_medium_skin_tone:': u'\U0001F46E \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting:': u'\U0001F64E \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting_dark_skin_tone:': u'\U0001F64E \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting_light_skin_tone:': u'\U0001F64E \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting_medium-dark_skin_tone:': u'\U0001F64E \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting_medium-light_skin_tone:': u'\U0001F64E \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_pouting_medium_skin_tone:': u'\U0001F64E \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand:': u'\U0001F64B \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand_dark_skin_tone:': u'\U0001F64B \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand_light_skin_tone:': u'\U0001F64B \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand_medium-dark_skin_tone:': u'\U0001F64B \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand_medium-light_skin_tone:': u'\U0001F64B \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_raising_hand_medium_skin_tone:': u'\U0001F64B \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat:': u'\U0001F6A3 \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat_dark_skin_tone:': u'\U0001F6A3 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat_light_skin_tone:': u'\U0001F6A3 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat_medium-dark_skin_tone:': u'\U0001F6A3 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat_medium-light_skin_tone:': u'\U0001F6A3 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_rowing_boat_medium_skin_tone:': u'\U0001F6A3 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_running:': u'\U0001F3C3 \U0000200D \U00002640 \U0000FE0F', + u':woman_running_dark_skin_tone:': u'\U0001F3C3 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_running_light_skin_tone:': u'\U0001F3C3 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_running_medium-dark_skin_tone:': u'\U0001F3C3 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_running_medium-light_skin_tone:': u'\U0001F3C3 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_running_medium_skin_tone:': u'\U0001F3C3 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_scientist:': u'\U0001F469 \U0000200D \U0001F52C', + u':woman_scientist_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F52C', + u':woman_scientist_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F52C', + u':woman_scientist_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F52C', + u':woman_scientist_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F52C', + u':woman_scientist_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F52C', + u':woman_shrugging:': u'\U0001F937 \U0000200D \U00002640 \U0000FE0F', + u':woman_shrugging_dark_skin_tone:': u'\U0001F937 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_shrugging_light_skin_tone:': u'\U0001F937 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_shrugging_medium-dark_skin_tone:': u'\U0001F937 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_shrugging_medium-light_skin_tone:': u'\U0001F937 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_shrugging_medium_skin_tone:': u'\U0001F937 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_singer:': u'\U0001F469 \U0000200D \U0001F3A4', + u':woman_singer_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F3A4', + u':woman_singer_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F3A4', + u':woman_singer_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F3A4', + u':woman_singer_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F3A4', + u':woman_singer_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F3A4', + u':woman_student:': u'\U0001F469 \U0000200D \U0001F393', + u':woman_student_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F393', + u':woman_student_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F393', + u':woman_student_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F393', + u':woman_student_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F393', + u':woman_student_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F393', + u':woman_surfing:': u'\U0001F3C4 \U0000200D \U00002640 \U0000FE0F', + u':woman_surfing_dark_skin_tone:': u'\U0001F3C4 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_surfing_light_skin_tone:': u'\U0001F3C4 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_surfing_medium-dark_skin_tone:': u'\U0001F3C4 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_surfing_medium-light_skin_tone:': u'\U0001F3C4 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_surfing_medium_skin_tone:': u'\U0001F3C4 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming:': u'\U0001F3CA \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming_dark_skin_tone:': u'\U0001F3CA \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming_light_skin_tone:': u'\U0001F3CA \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming_medium-dark_skin_tone:': u'\U0001F3CA \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming_medium-light_skin_tone:': u'\U0001F3CA \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_swimming_medium_skin_tone:': u'\U0001F3CA \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_teacher:': u'\U0001F469 \U0000200D \U0001F3EB', + u':woman_teacher_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F3EB', + u':woman_teacher_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F3EB', + u':woman_teacher_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F3EB', + u':woman_teacher_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F3EB', + u':woman_teacher_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F3EB', + u':woman_technologist:': u'\U0001F469 \U0000200D \U0001F4BB', + u':woman_technologist_dark_skin_tone:': u'\U0001F469 \U0001F3FF \U0000200D \U0001F4BB', + u':woman_technologist_light_skin_tone:': u'\U0001F469 \U0001F3FB \U0000200D \U0001F4BB', + u':woman_technologist_medium-dark_skin_tone:': u'\U0001F469 \U0001F3FE \U0000200D \U0001F4BB', + u':woman_technologist_medium-light_skin_tone:': u'\U0001F469 \U0001F3FC \U0000200D \U0001F4BB', + u':woman_technologist_medium_skin_tone:': u'\U0001F469 \U0001F3FD \U0000200D \U0001F4BB', + u':woman_tipping_hand:': u'\U0001F481 \U0000200D \U00002640 \U0000FE0F', + u':woman_tipping_hand_dark_skin_tone:': u'\U0001F481 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_tipping_hand_light_skin_tone:': u'\U0001F481 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_tipping_hand_medium-dark_skin_tone:': u'\U0001F481 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_tipping_hand_medium-light_skin_tone:': u'\U0001F481 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_tipping_hand_medium_skin_tone:': u'\U0001F481 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_walking:': u'\U0001F6B6 \U0000200D \U00002640 \U0000FE0F', + u':woman_walking_dark_skin_tone:': u'\U0001F6B6 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_walking_light_skin_tone:': u'\U0001F6B6 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_walking_medium-dark_skin_tone:': u'\U0001F6B6 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_walking_medium-light_skin_tone:': u'\U0001F6B6 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_walking_medium_skin_tone:': u'\U0001F6B6 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban:': u'\U0001F473 \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban_dark_skin_tone:': u'\U0001F473 \U0001F3FF \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban_light_skin_tone:': u'\U0001F473 \U0001F3FB \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban_medium-dark_skin_tone:': u'\U0001F473 \U0001F3FE \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban_medium-light_skin_tone:': u'\U0001F473 \U0001F3FC \U0000200D \U00002640 \U0000FE0F', + u':woman_wearing_turban_medium_skin_tone:': u'\U0001F473 \U0001F3FD \U0000200D \U00002640 \U0000FE0F', + u':woman’s_boot:': u'\U0001F462', + u':woman’s_clothes:': u'\U0001F45A', + u':woman’s_hat:': u'\U0001F452', + u':woman’s_sandal:': u'\U0001F461', + u':women_with_bunny_ears_partying:': u'\U0001F46F \U0000200D \U00002640 \U0000FE0F', + u':women_wrestling:': u'\U0001F93C \U0000200D \U00002640 \U0000FE0F', + u':women’s_room:': u'\U0001F6BA', + u':world_map:': u'\U0001F5FA', + u':worried_face:': u'\U0001F61F', + u':wrapped_gift:': u'\U0001F381', + u':wrench:': u'\U0001F527', + u':writing_hand:': u'\U0000270D', + u':writing_hand_dark_skin_tone:': u'\U0000270D \U0001F3FF', + u':writing_hand_light_skin_tone:': u'\U0000270D \U0001F3FB', + u':writing_hand_medium-dark_skin_tone:': u'\U0000270D \U0001F3FE', + u':writing_hand_medium-light_skin_tone:': u'\U0000270D \U0001F3FC', + u':writing_hand_medium_skin_tone:': u'\U0000270D \U0001F3FD', + u':yellow_heart:': u'\U0001F49B', + u':yen_banknote:': u'\U0001F4B4', + u':yin_yang:': u'\U0000262F', + u':zipper-mouth_face:': u'\U0001F910', + u':zzz:': u'\U0001F4A4', + u':Åland_Islands:': u'\U0001F1E6 \U0001F1FD', +} + +EMOJI_ALIAS_UNICODE = dict(EMOJI_UNICODE.items(), **{ + u':admission_tickets:': u'\U0001F39F', + u':aerial_tramway:': u'\U0001F6A1', + u':airplane:': u'\U00002708', + u':airplane_arriving:': u'\U0001F6EC', + u':airplane_departure:': u'\U0001F6EB', + u':alarm_clock:': u'\U000023F0', + u':alembic:': u'\U00002697', + u':space_invader:': u'\U0001F47E', + u':ambulance:': u'\U0001F691', + u':football:': u'\U0001F3C8', + u':amphora:': u'\U0001F3FA', + u':anchor:': u'\U00002693', + u':anger:': u'\U0001F4A2', + u':angry:': u'\U0001F620', + u':anguished:': u'\U0001F627', + u':ant:': u'\U0001F41C', + u':signal_strength:': u'\U0001F4F6', + u':arrows_counterclockwise:': u'\U0001F504', + u':aquarius:': u'\U00002652', + u':aries:': u'\U00002648', + u':arrow_heading_down:': u'\U00002935', + u':arrow_heading_up:': u'\U00002934', + u':articulated_lorry:': u'\U0001F69B', + u':art:': u'\U0001F3A8', + u':astonished:': u'\U0001F632', + u':athletic_shoe:': u'\U0001F45F', + u':atom_symbol:': u'\U0000269B', + u':eggplant:': u'\U0001F346', + u':atm:': u'\U0001F3E7', + u':car:': u'\U0001F697', + u':red_car:': u'\U0001F697', + u':baby:': u'\U0001F476', + u':angel:': u'\U0001F47C', + u':baby_bottle:': u'\U0001F37C', + u':baby_chick:': u'\U0001F424', + u':baby_symbol:': u'\U0001F6BC', + u':back:': u'\U0001F519', + u':camel:': u'\U0001F42B', + u':badminton_racquet_and_shuttlecock:': u'\U0001F3F8', + u':baggage_claim:': u'\U0001F6C4', + u':balloon:': u'\U0001F388', + u':ballot_box_with_ballot:': u'\U0001F5F3', + u':ballot_box_with_check:': u'\U00002611', + u':banana:': u'\U0001F34C', + u':bank:': u'\U0001F3E6', + u':dollar:': u'\U0001F4B5', + u':euro:': u'\U0001F4B6', + u':pound:': u'\U0001F4B7', + u':yen:': u'\U0001F4B4', + u':bar_chart:': u'\U0001F4CA', + u':barber:': u'\U0001F488', + u':baseball:': u'\U000026BE', + u':basketball:': u'\U0001F3C0', + u':bath:': u'\U0001F6C0', + u':bathtub:': u'\U0001F6C1', + u':battery:': u'\U0001F50B', + u':beach_with_umbrella:': u'\U0001F3D6', + u':bear:': u'\U0001F43B', + u':heartbeat:': u'\U0001F493', + u':bed:': u'\U0001F6CF', + u':beer:': u'\U0001F37A', + u':bell:': u'\U0001F514', + u':no_bell:': u'\U0001F515', + u':bellhop_bell:': u'\U0001F6CE', + u':bento:': u'\U0001F371', + u':bike:': u'\U0001F6B2', + u':bicyclist:': u'\U0001F6B4', + u':bikini:': u'\U0001F459', + u':8ball:': u'\U0001F3B1', + u':biohazard_sign:': u'\U00002623', + u':bird:': u'\U0001F426', + u':birthday:': u'\U0001F382', + u':black_circle_for_record:': u'\U000023FA', + u':clubs:': u'\U00002663', + u':diamonds:': u'\U00002666', + u':arrow_double_down:': u'\U000023EC', + u':hearts:': u'\U00002665', + u':black_large_square:': u'\U00002B1B', + u':rewind:': u'\U000023EA', + u':black_left__pointing_double_triangle_with_vertical_bar:': u'\U000023EE', + u':arrow_backward:': u'\U000025C0', + u':black_medium_small_square:': u'\U000025FE', + u':black_medium_square:': u'\U000025FC', + u':black_nib:': u'\U00002712', + u':question:': u'\U00002753', + u':fast_forward:': u'\U000023E9', + u':black_right__pointing_double_triangle_with_vertical_bar:': u'\U000023ED', + u':arrow_forward:': u'\U000025B6', + u':black_right__pointing_triangle_with_double_vertical_bar:': u'\U000023EF', + u':arrow_right:': u'\U000027A1', + u':scissors:': u'\U00002702', + u':black_small_square:': u'\U000025AA', + u':spades:': u'\U00002660', + u':black_square_button:': u'\U0001F532', + u':black_square_for_stop:': u'\U000023F9', + u':sunny:': u'\U00002600', + u':phone:': u'\U0000260E', + u':telephone:': u'\U0000260E', + u':recycle:': u'\U0000267B', + u':arrow_double_up:': u'\U000023EB', + u':blossom:': u'\U0001F33C', + u':blowfish:': u'\U0001F421', + u':blue_book:': u'\U0001F4D8', + u':blue_heart:': u'\U0001F499', + u':boar:': u'\U0001F417', + u':bomb:': u'\U0001F4A3', + u':bookmark:': u'\U0001F516', + u':bookmark_tabs:': u'\U0001F4D1', + u':books:': u'\U0001F4DA', + u':bottle_with_popping_cork:': u'\U0001F37E', + u':bouquet:': u'\U0001F490', + u':bow_and_arrow:': u'\U0001F3F9', + u':bowling:': u'\U0001F3B3', + u':boy:': u'\U0001F466', + u':bread:': u'\U0001F35E', + u':bride_with_veil:': u'\U0001F470', + u':bridge_at_night:': u'\U0001F309', + u':briefcase:': u'\U0001F4BC', + u':broken_heart:': u'\U0001F494', + u':bug:': u'\U0001F41B', + u':building_construction:': u'\U0001F3D7', + u':burrito:': u'\U0001F32F', + u':bus:': u'\U0001F68C', + u':busstop:': u'\U0001F68F', + u':bust_in_silhouette:': u'\U0001F464', + u':busts_in_silhouette:': u'\U0001F465', + u':cactus:': u'\U0001F335', + u':date:': u'\U0001F4C5', + u':camera:': u'\U0001F4F7', + u':camera_with_flash:': u'\U0001F4F8', + u':camping:': u'\U0001F3D5', + u':cancer:': u'\U0000264B', + u':candle:': u'\U0001F56F', + u':candy:': u'\U0001F36C', + u':capricorn:': u'\U00002651', + u':card_file_box:': u'\U0001F5C3', + u':card_index:': u'\U0001F4C7', + u':card_index_dividers:': u'\U0001F5C2', + u':carousel_horse:': u'\U0001F3A0', + u':flags:': u'\U0001F38F', + u':cat2:': u'\U0001F408', + u':cat:': u'\U0001F431', + u':joy_cat:': u'\U0001F639', + u':smirk_cat:': u'\U0001F63C', + u':chains:': u'\U000026D3', + u':chart_with_downwards_trend:': u'\U0001F4C9', + u':chart_with_upwards_trend:': u'\U0001F4C8', + u':chart:': u'\U0001F4B9', + u':mega:': u'\U0001F4E3', + u':cheese_wedge:': u'\U0001F9C0', + u':checkered_flag:': u'\U0001F3C1', + u':cherries:': u'\U0001F352', + u':cherry_blossom:': u'\U0001F338', + u':chestnut:': u'\U0001F330', + u':chicken:': u'\U0001F414', + u':children_crossing:': u'\U0001F6B8', + u':chipmunk:': u'\U0001F43F', + u':chocolate_bar:': u'\U0001F36B', + u':christmas_tree:': u'\U0001F384', + u':church:': u'\U000026EA', + u':cinema:': u'\U0001F3A6', + u':accept:': u'\U0001F251', + u':ideograph_advantage:': u'\U0001F250', + u':congratulations:': u'\U00003297', + u':secret:': u'\U00003299', + u':m:': u'\U000024C2', + u':circus_tent:': u'\U0001F3AA', + u':cityscape:': u'\U0001F3D9', + u':city_sunset:': u'\U0001F306', + u':clapper:': u'\U0001F3AC', + u':clap:': u'\U0001F44F', + u':classical_building:': u'\U0001F3DB', + u':beers:': u'\U0001F37B', + u':clipboard:': u'\U0001F4CB', + u':clock830:': u'\U0001F563', + u':clock8:': u'\U0001F557', + u':clock1130:': u'\U0001F566', + u':clock11:': u'\U0001F55A', + u':clock530:': u'\U0001F560', + u':clock5:': u'\U0001F554', + u':clock430:': u'\U0001F55F', + u':clock4:': u'\U0001F553', + u':clock930:': u'\U0001F564', + u':clock9:': u'\U0001F558', + u':clock130:': u'\U0001F55C', + u':clock1:': u'\U0001F550', + u':clock730:': u'\U0001F562', + u':clock7:': u'\U0001F556', + u':clock630:': u'\U0001F561', + u':clock6:': u'\U0001F555', + u':clock1030:': u'\U0001F565', + u':clock10:': u'\U0001F559', + u':clock330:': u'\U0001F55E', + u':clock3:': u'\U0001F552', + u':clock1230:': u'\U0001F567', + u':clock12:': u'\U0001F55B', + u':clock230:': u'\U0001F55D', + u':clock2:': u'\U0001F551', + u':arrows_clockwise:': u'\U0001F503', + u':repeat:': u'\U0001F501', + u':repeat_one:': u'\U0001F502', + u':closed_book:': u'\U0001F4D5', + u':closed_lock_with_key:': u'\U0001F510', + u':mailbox_closed:': u'\U0001F4EA', + u':mailbox:': u'\U0001F4EB', + u':closed_umbrella:': u'\U0001F302', + u':cloud:': u'\U00002601', + u':cloud_with_lightning:': u'\U0001F329', + u':cloud_with_rain:': u'\U0001F327', + u':cloud_with_snow:': u'\U0001F328', + u':cloud_with_tornado:': u'\U0001F32A', + u':cocktail:': u'\U0001F378', + u':coffin:': u'\U000026B0', + u':boom:': u'\U0001F4A5', + u':collision:': u'\U0001F4A5', + u':comet:': u'\U00002604', + u':compression:': u'\U0001F5DC', + u':confetti_ball:': u'\U0001F38A', + u':confounded:': u'\U0001F616', + u':confused:': u'\U0001F615', + u':construction:': u'\U0001F6A7', + u':construction_worker:': u'\U0001F477', + u':control_knobs:': u'\U0001F39B', + u':convenience_store:': u'\U0001F3EA', + u':rice:': u'\U0001F35A', + u':cookie:': u'\U0001F36A', + u':egg:': u'\U0001F373', + u':copyright:': u'\U000000A9', + u':couch_and_lamp:': u'\U0001F6CB', + u':couple_with_heart:': u'\U0001F491', + u':cow2:': u'\U0001F404', + u':cow:': u'\U0001F42E', + u':crab:': u'\U0001F980', + u':credit_card:': u'\U0001F4B3', + u':crescent_moon:': u'\U0001F319', + u':cricket_bat_and_ball:': u'\U0001F3CF', + u':crocodile:': u'\U0001F40A', + u':x:': u'\U0000274C', + u':crossed_flags:': u'\U0001F38C', + u':crossed_swords:': u'\U00002694', + u':crown:': u'\U0001F451', + u':crying_cat_face:': u'\U0001F63F', + u':cry:': u'\U0001F622', + u':crystal_ball:': u'\U0001F52E', + u':curly_loop:': u'\U000027B0', + u':currency_exchange:': u'\U0001F4B1', + u':curry:': u'\U0001F35B', + u':custard:': u'\U0001F36E', + u':customs:': u'\U0001F6C3', + u':cyclone:': u'\U0001F300', + u':dagger_knife:': u'\U0001F5E1', + u':dancer:': u'\U0001F483', + u':dango:': u'\U0001F361', + u':dark_sunglasses:': u'\U0001F576', + u':dash:': u'\U0001F4A8', + u':deciduous_tree:': u'\U0001F333', + u':truck:': u'\U0001F69A', + u':department_store:': u'\U0001F3EC', + u':derelict_house_building:': u'\U0001F3DA', + u':desert:': u'\U0001F3DC', + u':desert_island:': u'\U0001F3DD', + u':desktop_computer:': u'\U0001F5A5', + u':diamond_shape_with_a_dot_inside:': u'\U0001F4A0', + u':dart:': u'\U0001F3AF', + u':disappointed_relieved:': u'\U0001F625', + u':disappointed:': u'\U0001F61E', + u':dizzy_face:': u'\U0001F635', + u':dizzy:': u'\U0001F4AB', + u':do_not_litter:': u'\U0001F6AF', + u':dog2:': u'\U0001F415', + u':dog:': u'\U0001F436', + u':dolphin:': u'\U0001F42C', + u':flipper:': u'\U0001F42C', + u':door:': u'\U0001F6AA', + u':loop:': u'\U000027BF', + u':bangbang:': u'\U0000203C', + u':double_vertical_bar:': u'\U000023F8', + u':doughnut:': u'\U0001F369', + u':dove_of_peace:': u'\U0001F54A', + u':small_red_triangle_down:': u'\U0001F53B', + u':arrow_down_small:': u'\U0001F53D', + u':arrow_down:': u'\U00002B07', + u':dragon:': u'\U0001F409', + u':dragon_face:': u'\U0001F432', + u':dress:': u'\U0001F457', + u':dromedary_camel:': u'\U0001F42A', + u':droplet:': u'\U0001F4A7', + u':dvd:': u'\U0001F4C0', + u':e__mail:': u'\U0001F4E7', + u':ear:': u'\U0001F442', + u':corn:': u'\U0001F33D', + u':ear_of_rice:': u'\U0001F33E', + u':earth_americas:': u'\U0001F30E', + u':earth_asia:': u'\U0001F30F', + u':earth_africa:': u'\U0001F30D', + u':eight_pointed_black_star:': u'\U00002734', + u':eight_spoked_asterisk:': u'\U00002733', + u':eject_symbol:': u'\U000023CF', + u':bulb:': u'\U0001F4A1', + u':electric_plug:': u'\U0001F50C', + u':flashlight:': u'\U0001F526', + u':elephant:': u'\U0001F418', + u':emoji_modifier_fitzpatrick_type__1__2:': u'\U0001F3FB', + u':emoji_modifier_fitzpatrick_type__3:': u'\U0001F3FC', + u':emoji_modifier_fitzpatrick_type__4:': u'\U0001F3FD', + u':emoji_modifier_fitzpatrick_type__5:': u'\U0001F3FE', + u':emoji_modifier_fitzpatrick_type__6:': u'\U0001F3FF', + u':end:': u'\U0001F51A', + u':email:': u'\U00002709', + u':envelope:': u'\U00002709', + u':envelope_with_arrow:': u'\U0001F4E9', + u':european_castle:': u'\U0001F3F0', + u':european_post_office:': u'\U0001F3E4', + u':evergreen_tree:': u'\U0001F332', + u':interrobang:': u'\U00002049', + u':expressionless:': u'\U0001F611', + u':alien:': u'\U0001F47D', + u':eye:': u'\U0001F441', + u':eyeglasses:': u'\U0001F453', + u':eyes:': u'\U0001F440', + u':massage:': u'\U0001F486', + u':yum:': u'\U0001F60B', + u':scream:': u'\U0001F631', + u':kissing_heart:': u'\U0001F618', + u':sweat:': u'\U0001F613', + u':face_with_head__bandage:': u'\U0001F915', + u':triumph:': u'\U0001F624', + u':mask:': u'\U0001F637', + u':no_good:': u'\U0001F645', + u':ok_woman:': u'\U0001F646', + u':open_mouth:': u'\U0001F62E', + u':cold_sweat:': u'\U0001F630', + u':face_with_rolling_eyes:': u'\U0001F644', + u':stuck_out_tongue:': u'\U0001F61B', + u':stuck_out_tongue_closed_eyes:': u'\U0001F61D', + u':stuck_out_tongue_winking_eye:': u'\U0001F61C', + u':joy:': u'\U0001F602', + u':face_with_thermometer:': u'\U0001F912', + u':no_mouth:': u'\U0001F636', + u':factory:': u'\U0001F3ED', + u':fallen_leaf:': u'\U0001F342', + u':family:': u'\U0001F46A', + u':santa:': u'\U0001F385', + u':fax:': u'\U0001F4E0', + u':fearful:': u'\U0001F628', + u':ferris_wheel:': u'\U0001F3A1', + u':ferry:': u'\U000026F4', + u':field_hockey_stick_and_ball:': u'\U0001F3D1', + u':file_cabinet:': u'\U0001F5C4', + u':file_folder:': u'\U0001F4C1', + u':film_frames:': u'\U0001F39E', + u':film_projector:': u'\U0001F4FD', + u':fire:': u'\U0001F525', + u':fire_engine:': u'\U0001F692', + u':sparkler:': u'\U0001F387', + u':fireworks:': u'\U0001F386', + u':first_quarter_moon:': u'\U0001F313', + u':first_quarter_moon_with_face:': u'\U0001F31B', + u':fish:': u'\U0001F41F', + u':fish_cake:': u'\U0001F365', + u':fishing_pole_and_fish:': u'\U0001F3A3', + u':facepunch:': u'\U0001F44A', + u':punch:': u'\U0001F44A', + u':flag_for_Afghanistan:': u'\U0001F1E6 \U0001F1EB', + u':flag_for_Albania:': u'\U0001F1E6 \U0001F1F1', + u':flag_for_Algeria:': u'\U0001F1E9 \U0001F1FF', + u':flag_for_American_Samoa:': u'\U0001F1E6 \U0001F1F8', + u':flag_for_Andorra:': u'\U0001F1E6 \U0001F1E9', + u':flag_for_Angola:': u'\U0001F1E6 \U0001F1F4', + u':flag_for_Anguilla:': u'\U0001F1E6 \U0001F1EE', + u':flag_for_Antarctica:': u'\U0001F1E6 \U0001F1F6', + u':flag_for_Antigua_&_Barbuda:': u'\U0001F1E6 \U0001F1EC', + u':flag_for_Argentina:': u'\U0001F1E6 \U0001F1F7', + u':flag_for_Armenia:': u'\U0001F1E6 \U0001F1F2', + u':flag_for_Aruba:': u'\U0001F1E6 \U0001F1FC', + u':flag_for_Ascension_Island:': u'\U0001F1E6 \U0001F1E8', + u':flag_for_Australia:': u'\U0001F1E6 \U0001F1FA', + u':flag_for_Austria:': u'\U0001F1E6 \U0001F1F9', + u':flag_for_Azerbaijan:': u'\U0001F1E6 \U0001F1FF', + u':flag_for_Bahamas:': u'\U0001F1E7 \U0001F1F8', + u':flag_for_Bahrain:': u'\U0001F1E7 \U0001F1ED', + u':flag_for_Bangladesh:': u'\U0001F1E7 \U0001F1E9', + u':flag_for_Barbados:': u'\U0001F1E7 \U0001F1E7', + u':flag_for_Belarus:': u'\U0001F1E7 \U0001F1FE', + u':flag_for_Belgium:': u'\U0001F1E7 \U0001F1EA', + u':flag_for_Belize:': u'\U0001F1E7 \U0001F1FF', + u':flag_for_Benin:': u'\U0001F1E7 \U0001F1EF', + u':flag_for_Bermuda:': u'\U0001F1E7 \U0001F1F2', + u':flag_for_Bhutan:': u'\U0001F1E7 \U0001F1F9', + u':flag_for_Bolivia:': u'\U0001F1E7 \U0001F1F4', + u':flag_for_Bosnia_&_Herzegovina:': u'\U0001F1E7 \U0001F1E6', + u':flag_for_Botswana:': u'\U0001F1E7 \U0001F1FC', + u':flag_for_Bouvet_Island:': u'\U0001F1E7 \U0001F1FB', + u':flag_for_Brazil:': u'\U0001F1E7 \U0001F1F7', + u':flag_for_British_Indian_Ocean_Territory:': u'\U0001F1EE \U0001F1F4', + u':flag_for_British_Virgin_Islands:': u'\U0001F1FB \U0001F1EC', + u':flag_for_Brunei:': u'\U0001F1E7 \U0001F1F3', + u':flag_for_Bulgaria:': u'\U0001F1E7 \U0001F1EC', + u':flag_for_Burkina_Faso:': u'\U0001F1E7 \U0001F1EB', + u':flag_for_Burundi:': u'\U0001F1E7 \U0001F1EE', + u':flag_for_Cambodia:': u'\U0001F1F0 \U0001F1ED', + u':flag_for_Cameroon:': u'\U0001F1E8 \U0001F1F2', + u':flag_for_Canada:': u'\U0001F1E8 \U0001F1E6', + u':flag_for_Canary_Islands:': u'\U0001F1EE \U0001F1E8', + u':flag_for_Cape_Verde:': u'\U0001F1E8 \U0001F1FB', + u':flag_for_Caribbean_Netherlands:': u'\U0001F1E7 \U0001F1F6', + u':flag_for_Cayman_Islands:': u'\U0001F1F0 \U0001F1FE', + u':flag_for_Central_African_Republic:': u'\U0001F1E8 \U0001F1EB', + u':flag_for_Ceuta_&_Melilla:': u'\U0001F1EA \U0001F1E6', + u':flag_for_Chad:': u'\U0001F1F9 \U0001F1E9', + u':flag_for_Chile:': u'\U0001F1E8 \U0001F1F1', + u':flag_for_China:': u'\U0001F1E8 \U0001F1F3', + u':flag_for_Christmas_Island:': u'\U0001F1E8 \U0001F1FD', + u':flag_for_Clipperton_Island:': u'\U0001F1E8 \U0001F1F5', + u':flag_for_Cocos__Islands:': u'\U0001F1E8 \U0001F1E8', + u':flag_for_Colombia:': u'\U0001F1E8 \U0001F1F4', + u':flag_for_Comoros:': u'\U0001F1F0 \U0001F1F2', + u':flag_for_Congo____Brazzaville:': u'\U0001F1E8 \U0001F1EC', + u':flag_for_Congo____Kinshasa:': u'\U0001F1E8 \U0001F1E9', + u':flag_for_Cook_Islands:': u'\U0001F1E8 \U0001F1F0', + u':flag_for_Costa_Rica:': u'\U0001F1E8 \U0001F1F7', + u':flag_for_Croatia:': u'\U0001F1ED \U0001F1F7', + u':flag_for_Cuba:': u'\U0001F1E8 \U0001F1FA', + u':flag_for_Curaçao:': u'\U0001F1E8 \U0001F1FC', + u':flag_for_Cyprus:': u'\U0001F1E8 \U0001F1FE', + u':flag_for_Czech_Republic:': u'\U0001F1E8 \U0001F1FF', + u':flag_for_Côte_d’Ivoire:': u'\U0001F1E8 \U0001F1EE', + u':flag_for_Denmark:': u'\U0001F1E9 \U0001F1F0', + u':flag_for_Diego_Garcia:': u'\U0001F1E9 \U0001F1EC', + u':flag_for_Djibouti:': u'\U0001F1E9 \U0001F1EF', + u':flag_for_Dominica:': u'\U0001F1E9 \U0001F1F2', + u':flag_for_Dominican_Republic:': u'\U0001F1E9 \U0001F1F4', + u':flag_for_Ecuador:': u'\U0001F1EA \U0001F1E8', + u':flag_for_Egypt:': u'\U0001F1EA \U0001F1EC', + u':flag_for_El_Salvador:': u'\U0001F1F8 \U0001F1FB', + u':flag_for_Equatorial_Guinea:': u'\U0001F1EC \U0001F1F6', + u':flag_for_Eritrea:': u'\U0001F1EA \U0001F1F7', + u':flag_for_Estonia:': u'\U0001F1EA \U0001F1EA', + u':flag_for_Ethiopia:': u'\U0001F1EA \U0001F1F9', + u':flag_for_European_Union:': u'\U0001F1EA \U0001F1FA', + u':flag_for_Falkland_Islands:': u'\U0001F1EB \U0001F1F0', + u':flag_for_Faroe_Islands:': u'\U0001F1EB \U0001F1F4', + u':flag_for_Fiji:': u'\U0001F1EB \U0001F1EF', + u':flag_for_Finland:': u'\U0001F1EB \U0001F1EE', + u':flag_for_France:': u'\U0001F1EB \U0001F1F7', + u':flag_for_French_Guiana:': u'\U0001F1EC \U0001F1EB', + u':flag_for_French_Polynesia:': u'\U0001F1F5 \U0001F1EB', + u':flag_for_French_Southern_Territories:': u'\U0001F1F9 \U0001F1EB', + u':flag_for_Gabon:': u'\U0001F1EC \U0001F1E6', + u':flag_for_Gambia:': u'\U0001F1EC \U0001F1F2', + u':flag_for_Georgia:': u'\U0001F1EC \U0001F1EA', + u':flag_for_Germany:': u'\U0001F1E9 \U0001F1EA', + u':flag_for_Ghana:': u'\U0001F1EC \U0001F1ED', + u':flag_for_Gibraltar:': u'\U0001F1EC \U0001F1EE', + u':flag_for_Greece:': u'\U0001F1EC \U0001F1F7', + u':flag_for_Greenland:': u'\U0001F1EC \U0001F1F1', + u':flag_for_Grenada:': u'\U0001F1EC \U0001F1E9', + u':flag_for_Guadeloupe:': u'\U0001F1EC \U0001F1F5', + u':flag_for_Guam:': u'\U0001F1EC \U0001F1FA', + u':flag_for_Guatemala:': u'\U0001F1EC \U0001F1F9', + u':flag_for_Guernsey:': u'\U0001F1EC \U0001F1EC', + u':flag_for_Guinea:': u'\U0001F1EC \U0001F1F3', + u':flag_for_Guinea__Bissau:': u'\U0001F1EC \U0001F1FC', + u':flag_for_Guyana:': u'\U0001F1EC \U0001F1FE', + u':flag_for_Haiti:': u'\U0001F1ED \U0001F1F9', + u':flag_for_Heard_&_McDonald_Islands:': u'\U0001F1ED \U0001F1F2', + u':flag_for_Honduras:': u'\U0001F1ED \U0001F1F3', + u':flag_for_Hong_Kong:': u'\U0001F1ED \U0001F1F0', + u':flag_for_Hungary:': u'\U0001F1ED \U0001F1FA', + u':flag_for_Iceland:': u'\U0001F1EE \U0001F1F8', + u':flag_for_India:': u'\U0001F1EE \U0001F1F3', + u':flag_for_Indonesia:': u'\U0001F1EE \U0001F1E9', + u':flag_for_Iran:': u'\U0001F1EE \U0001F1F7', + u':flag_for_Iraq:': u'\U0001F1EE \U0001F1F6', + u':flag_for_Ireland:': u'\U0001F1EE \U0001F1EA', + u':flag_for_Isle_of_Man:': u'\U0001F1EE \U0001F1F2', + u':flag_for_Israel:': u'\U0001F1EE \U0001F1F1', + u':flag_for_Italy:': u'\U0001F1EE \U0001F1F9', + u':flag_for_Jamaica:': u'\U0001F1EF \U0001F1F2', + u':flag_for_Japan:': u'\U0001F1EF \U0001F1F5', + u':flag_for_Jersey:': u'\U0001F1EF \U0001F1EA', + u':flag_for_Jordan:': u'\U0001F1EF \U0001F1F4', + u':flag_for_Kazakhstan:': u'\U0001F1F0 \U0001F1FF', + u':flag_for_Kenya:': u'\U0001F1F0 \U0001F1EA', + u':flag_for_Kiribati:': u'\U0001F1F0 \U0001F1EE', + u':flag_for_Kosovo:': u'\U0001F1FD \U0001F1F0', + u':flag_for_Kuwait:': u'\U0001F1F0 \U0001F1FC', + u':flag_for_Kyrgyzstan:': u'\U0001F1F0 \U0001F1EC', + u':flag_for_Laos:': u'\U0001F1F1 \U0001F1E6', + u':flag_for_Latvia:': u'\U0001F1F1 \U0001F1FB', + u':flag_for_Lebanon:': u'\U0001F1F1 \U0001F1E7', + u':flag_for_Lesotho:': u'\U0001F1F1 \U0001F1F8', + u':flag_for_Liberia:': u'\U0001F1F1 \U0001F1F7', + u':flag_for_Libya:': u'\U0001F1F1 \U0001F1FE', + u':flag_for_Liechtenstein:': u'\U0001F1F1 \U0001F1EE', + u':flag_for_Lithuania:': u'\U0001F1F1 \U0001F1F9', + u':flag_for_Luxembourg:': u'\U0001F1F1 \U0001F1FA', + u':flag_for_Macau:': u'\U0001F1F2 \U0001F1F4', + u':flag_for_Macedonia:': u'\U0001F1F2 \U0001F1F0', + u':flag_for_Madagascar:': u'\U0001F1F2 \U0001F1EC', + u':flag_for_Malawi:': u'\U0001F1F2 \U0001F1FC', + u':flag_for_Malaysia:': u'\U0001F1F2 \U0001F1FE', + u':flag_for_Maldives:': u'\U0001F1F2 \U0001F1FB', + u':flag_for_Mali:': u'\U0001F1F2 \U0001F1F1', + u':flag_for_Malta:': u'\U0001F1F2 \U0001F1F9', + u':flag_for_Marshall_Islands:': u'\U0001F1F2 \U0001F1ED', + u':flag_for_Martinique:': u'\U0001F1F2 \U0001F1F6', + u':flag_for_Mauritania:': u'\U0001F1F2 \U0001F1F7', + u':flag_for_Mauritius:': u'\U0001F1F2 \U0001F1FA', + u':flag_for_Mayotte:': u'\U0001F1FE \U0001F1F9', + u':flag_for_Mexico:': u'\U0001F1F2 \U0001F1FD', + u':flag_for_Micronesia:': u'\U0001F1EB \U0001F1F2', + u':flag_for_Moldova:': u'\U0001F1F2 \U0001F1E9', + u':flag_for_Monaco:': u'\U0001F1F2 \U0001F1E8', + u':flag_for_Mongolia:': u'\U0001F1F2 \U0001F1F3', + u':flag_for_Montenegro:': u'\U0001F1F2 \U0001F1EA', + u':flag_for_Montserrat:': u'\U0001F1F2 \U0001F1F8', + u':flag_for_Morocco:': u'\U0001F1F2 \U0001F1E6', + u':flag_for_Mozambique:': u'\U0001F1F2 \U0001F1FF', + u':flag_for_Myanmar:': u'\U0001F1F2 \U0001F1F2', + u':flag_for_Namibia:': u'\U0001F1F3 \U0001F1E6', + u':flag_for_Nauru:': u'\U0001F1F3 \U0001F1F7', + u':flag_for_Nepal:': u'\U0001F1F3 \U0001F1F5', + u':flag_for_Netherlands:': u'\U0001F1F3 \U0001F1F1', + u':flag_for_New_Caledonia:': u'\U0001F1F3 \U0001F1E8', + u':flag_for_New_Zealand:': u'\U0001F1F3 \U0001F1FF', + u':flag_for_Nicaragua:': u'\U0001F1F3 \U0001F1EE', + u':flag_for_Niger:': u'\U0001F1F3 \U0001F1EA', + u':flag_for_Nigeria:': u'\U0001F1F3 \U0001F1EC', + u':flag_for_Niue:': u'\U0001F1F3 \U0001F1FA', + u':flag_for_Norfolk_Island:': u'\U0001F1F3 \U0001F1EB', + u':flag_for_North_Korea:': u'\U0001F1F0 \U0001F1F5', + u':flag_for_Northern_Mariana_Islands:': u'\U0001F1F2 \U0001F1F5', + u':flag_for_Norway:': u'\U0001F1F3 \U0001F1F4', + u':flag_for_Oman:': u'\U0001F1F4 \U0001F1F2', + u':flag_for_Pakistan:': u'\U0001F1F5 \U0001F1F0', + u':flag_for_Palau:': u'\U0001F1F5 \U0001F1FC', + u':flag_for_Palestinian_Territories:': u'\U0001F1F5 \U0001F1F8', + u':flag_for_Panama:': u'\U0001F1F5 \U0001F1E6', + u':flag_for_Papua_New_Guinea:': u'\U0001F1F5 \U0001F1EC', + u':flag_for_Paraguay:': u'\U0001F1F5 \U0001F1FE', + u':flag_for_Peru:': u'\U0001F1F5 \U0001F1EA', + u':flag_for_Philippines:': u'\U0001F1F5 \U0001F1ED', + u':flag_for_Pitcairn_Islands:': u'\U0001F1F5 \U0001F1F3', + u':flag_for_Poland:': u'\U0001F1F5 \U0001F1F1', + u':flag_for_Portugal:': u'\U0001F1F5 \U0001F1F9', + u':flag_for_Puerto_Rico:': u'\U0001F1F5 \U0001F1F7', + u':flag_for_Qatar:': u'\U0001F1F6 \U0001F1E6', + u':flag_for_Romania:': u'\U0001F1F7 \U0001F1F4', + u':flag_for_Russia:': u'\U0001F1F7 \U0001F1FA', + u':flag_for_Rwanda:': u'\U0001F1F7 \U0001F1FC', + u':flag_for_Réunion:': u'\U0001F1F7 \U0001F1EA', + u':flag_for_Samoa:': u'\U0001F1FC \U0001F1F8', + u':flag_for_San_Marino:': u'\U0001F1F8 \U0001F1F2', + u':flag_for_Saudi_Arabia:': u'\U0001F1F8 \U0001F1E6', + u':flag_for_Senegal:': u'\U0001F1F8 \U0001F1F3', + u':flag_for_Serbia:': u'\U0001F1F7 \U0001F1F8', + u':flag_for_Seychelles:': u'\U0001F1F8 \U0001F1E8', + u':flag_for_Sierra_Leone:': u'\U0001F1F8 \U0001F1F1', + u':flag_for_Singapore:': u'\U0001F1F8 \U0001F1EC', + u':flag_for_Sint_Maarten:': u'\U0001F1F8 \U0001F1FD', + u':flag_for_Slovakia:': u'\U0001F1F8 \U0001F1F0', + u':flag_for_Slovenia:': u'\U0001F1F8 \U0001F1EE', + u':flag_for_Solomon_Islands:': u'\U0001F1F8 \U0001F1E7', + u':flag_for_Somalia:': u'\U0001F1F8 \U0001F1F4', + u':flag_for_South_Africa:': u'\U0001F1FF \U0001F1E6', + u':flag_for_South_Georgia_&_South_Sandwich_Islands:': u'\U0001F1EC \U0001F1F8', + u':flag_for_South_Korea:': u'\U0001F1F0 \U0001F1F7', + u':flag_for_South_Sudan:': u'\U0001F1F8 \U0001F1F8', + u':flag_for_Spain:': u'\U0001F1EA \U0001F1F8', + u':flag_for_Sri_Lanka:': u'\U0001F1F1 \U0001F1F0', + u':flag_for_St._Barthélemy:': u'\U0001F1E7 \U0001F1F1', + u':flag_for_St._Helena:': u'\U0001F1F8 \U0001F1ED', + u':flag_for_St._Kitts_&_Nevis:': u'\U0001F1F0 \U0001F1F3', + u':flag_for_St._Lucia:': u'\U0001F1F1 \U0001F1E8', + u':flag_for_St._Martin:': u'\U0001F1F2 \U0001F1EB', + u':flag_for_St._Pierre_&_Miquelon:': u'\U0001F1F5 \U0001F1F2', + u':flag_for_St._Vincent_&_Grenadines:': u'\U0001F1FB \U0001F1E8', + u':flag_for_Sudan:': u'\U0001F1F8 \U0001F1E9', + u':flag_for_Suriname:': u'\U0001F1F8 \U0001F1F7', + u':flag_for_Svalbard_&_Jan_Mayen:': u'\U0001F1F8 \U0001F1EF', + u':flag_for_Swaziland:': u'\U0001F1F8 \U0001F1FF', + u':flag_for_Sweden:': u'\U0001F1F8 \U0001F1EA', + u':flag_for_Switzerland:': u'\U0001F1E8 \U0001F1ED', + u':flag_for_Syria:': u'\U0001F1F8 \U0001F1FE', + u':flag_for_São_Tomé_&_Príncipe:': u'\U0001F1F8 \U0001F1F9', + u':flag_for_Taiwan:': u'\U0001F1F9 \U0001F1FC', + u':flag_for_Tajikistan:': u'\U0001F1F9 \U0001F1EF', + u':flag_for_Tanzania:': u'\U0001F1F9 \U0001F1FF', + u':flag_for_Thailand:': u'\U0001F1F9 \U0001F1ED', + u':flag_for_Timor__Leste:': u'\U0001F1F9 \U0001F1F1', + u':flag_for_Togo:': u'\U0001F1F9 \U0001F1EC', + u':flag_for_Tokelau:': u'\U0001F1F9 \U0001F1F0', + u':flag_for_Tonga:': u'\U0001F1F9 \U0001F1F4', + u':flag_for_Trinidad_&_Tobago:': u'\U0001F1F9 \U0001F1F9', + u':flag_for_Tristan_da_Cunha:': u'\U0001F1F9 \U0001F1E6', + u':flag_for_Tunisia:': u'\U0001F1F9 \U0001F1F3', + u':flag_for_Turkey:': u'\U0001F1F9 \U0001F1F7', + u':flag_for_Turkmenistan:': u'\U0001F1F9 \U0001F1F2', + u':flag_for_Turks_&_Caicos_Islands:': u'\U0001F1F9 \U0001F1E8', + u':flag_for_Tuvalu:': u'\U0001F1F9 \U0001F1FB', + u':flag_for_U.S._Outlying_Islands:': u'\U0001F1FA \U0001F1F2', + u':flag_for_U.S._Virgin_Islands:': u'\U0001F1FB \U0001F1EE', + u':flag_for_Uganda:': u'\U0001F1FA \U0001F1EC', + u':flag_for_Ukraine:': u'\U0001F1FA \U0001F1E6', + u':flag_for_United_Arab_Emirates:': u'\U0001F1E6 \U0001F1EA', + u':flag_for_United_Kingdom:': u'\U0001F1EC \U0001F1E7', + u':flag_for_United_States:': u'\U0001F1FA \U0001F1F8', + u':flag_for_Uruguay:': u'\U0001F1FA \U0001F1FE', + u':flag_for_Uzbekistan:': u'\U0001F1FA \U0001F1FF', + u':flag_for_Vanuatu:': u'\U0001F1FB \U0001F1FA', + u':flag_for_Vatican_City:': u'\U0001F1FB \U0001F1E6', + u':flag_for_Venezuela:': u'\U0001F1FB \U0001F1EA', + u':flag_for_Vietnam:': u'\U0001F1FB \U0001F1F3', + u':flag_for_Wallis_&_Futuna:': u'\U0001F1FC \U0001F1EB', + u':flag_for_Western_Sahara:': u'\U0001F1EA \U0001F1ED', + u':flag_for_Yemen:': u'\U0001F1FE \U0001F1EA', + u':flag_for_Zambia:': u'\U0001F1FF \U0001F1F2', + u':flag_for_Zimbabwe:': u'\U0001F1FF \U0001F1FC', + u':flag_for_Åland_Islands:': u'\U0001F1E6 \U0001F1FD', + u':golf:': u'\U000026F3', + u':fleur__de__lis:': u'\U0000269C', + u':muscle:': u'\U0001F4AA', + u':floppy_disk:': u'\U0001F4BE', + u':flower_playing_cards:': u'\U0001F3B4', + u':flushed:': u'\U0001F633', + u':fog:': u'\U0001F32B', + u':foggy:': u'\U0001F301', + u':footprints:': u'\U0001F463', + u':fork_and_knife:': u'\U0001F374', + u':fork_and_knife_with_plate:': u'\U0001F37D', + u':fountain:': u'\U000026F2', + u':four_leaf_clover:': u'\U0001F340', + u':frame_with_picture:': u'\U0001F5BC', + u':fries:': u'\U0001F35F', + u':fried_shrimp:': u'\U0001F364', + u':frog:': u'\U0001F438', + u':hatched_chick:': u'\U0001F425', + u':frowning:': u'\U0001F626', + u':fuelpump:': u'\U000026FD', + u':full_moon:': u'\U0001F315', + u':full_moon_with_face:': u'\U0001F31D', + u':funeral_urn:': u'\U000026B1', + u':game_die:': u'\U0001F3B2', + u':gear:': u'\U00002699', + u':gem:': u'\U0001F48E', + u':gemini:': u'\U0000264A', + u':ghost:': u'\U0001F47B', + u':girl:': u'\U0001F467', + u':globe_with_meridians:': u'\U0001F310', + u':star2:': u'\U0001F31F', + u':goat:': u'\U0001F410', + u':golfer:': u'\U0001F3CC', + u':mortar_board:': u'\U0001F393', + u':grapes:': u'\U0001F347', + u':green_apple:': u'\U0001F34F', + u':green_book:': u'\U0001F4D7', + u':green_heart:': u'\U0001F49A', + u':grimacing:': u'\U0001F62C', + u':smile_cat:': u'\U0001F638', + u':grinning:': u'\U0001F600', + u':grin:': u'\U0001F601', + u':heartpulse:': u'\U0001F497', + u':guardsman:': u'\U0001F482', + u':guitar:': u'\U0001F3B8', + u':haircut:': u'\U0001F487', + u':hamburger:': u'\U0001F354', + u':hammer:': u'\U0001F528', + u':hammer_and_pick:': u'\U00002692', + u':hammer_and_wrench:': u'\U0001F6E0', + u':hamster:': u'\U0001F439', + u':handbag:': u'\U0001F45C', + u':raising_hand:': u'\U0001F64B', + u':hatching_chick:': u'\U0001F423', + u':headphones:': u'\U0001F3A7', + u':hear_no_evil:': u'\U0001F649', + u':heart_decoration:': u'\U0001F49F', + u':cupid:': u'\U0001F498', + u':gift_heart:': u'\U0001F49D', + u':heart:': u'\U00002764', + u':heavy_check_mark:': u'\U00002714', + u':heavy_division_sign:': u'\U00002797', + u':heavy_dollar_sign:': u'\U0001F4B2', + u':exclamation:': u'\U00002757', + u':heavy_exclamation_mark:': u'\U00002757', + u':heavy_heart_exclamation_mark_ornament:': u'\U00002763', + u':o:': u'\U00002B55', + u':heavy_minus_sign:': u'\U00002796', + u':heavy_multiplication_x:': u'\U00002716', + u':heavy_plus_sign:': u'\U00002795', + u':helicopter:': u'\U0001F681', + u':helm_symbol:': u'\U00002388', + u':helmet_with_white_cross:': u'\U000026D1', + u':herb:': u'\U0001F33F', + u':hibiscus:': u'\U0001F33A', + u':high_heel:': u'\U0001F460', + u':bullettrain_side:': u'\U0001F684', + u':bullettrain_front:': u'\U0001F685', + u':high_brightness:': u'\U0001F506', + u':zap:': u'\U000026A1', + u':hocho:': u'\U0001F52A', + u':knife:': u'\U0001F52A', + u':hole:': u'\U0001F573', + u':honey_pot:': u'\U0001F36F', + u':bee:': u'\U0001F41D', + u':traffic_light:': u'\U0001F6A5', + u':racehorse:': u'\U0001F40E', + u':horse:': u'\U0001F434', + u':horse_racing:': u'\U0001F3C7', + u':hospital:': u'\U0001F3E5', + u':coffee:': u'\U00002615', + u':hot_dog:': u'\U0001F32D', + u':hot_pepper:': u'\U0001F336', + u':hotsprings:': u'\U00002668', + u':hotel:': u'\U0001F3E8', + u':hourglass:': u'\U0000231B', + u':hourglass_flowing_sand:': u'\U000023F3', + u':house:': u'\U0001F3E0', + u':house_buildings:': u'\U0001F3D8', + u':house_with_garden:': u'\U0001F3E1', + u':hugging_face:': u'\U0001F917', + u':100:': u'\U0001F4AF', + u':hushed:': u'\U0001F62F', + u':ice_cream:': u'\U0001F368', + u':ice_hockey_stick_and_puck:': u'\U0001F3D2', + u':ice_skate:': u'\U000026F8', + u':imp:': u'\U0001F47F', + u':inbox_tray:': u'\U0001F4E5', + u':incoming_envelope:': u'\U0001F4E8', + u':information_desk_person:': u'\U0001F481', + u':information_source:': u'\U00002139', + u':capital_abcd:': u'\U0001F520', + u':abc:': u'\U0001F524', + u':abcd:': u'\U0001F521', + u':1234:': u'\U0001F522', + u':symbols:': u'\U0001F523', + u':izakaya_lantern:': u'\U0001F3EE', + u':lantern:': u'\U0001F3EE', + u':jack_o_lantern:': u'\U0001F383', + u':japanese_castle:': u'\U0001F3EF', + u':dolls:': u'\U0001F38E', + u':japanese_goblin:': u'\U0001F47A', + u':japanese_ogre:': u'\U0001F479', + u':post_office:': u'\U0001F3E3', + u':beginner:': u'\U0001F530', + u':jeans:': u'\U0001F456', + u':joystick:': u'\U0001F579', + u':kaaba:': u'\U0001F54B', + u':key:': u'\U0001F511', + u':keyboard:': u'\U00002328', + u':keycap_asterisk:': u'\U0000002A \U000020E3', + u':keycap_digit_eight:': u'\U00000038 \U000020E3', + u':keycap_digit_five:': u'\U00000035 \U000020E3', + u':keycap_digit_four:': u'\U00000034 \U000020E3', + u':keycap_digit_nine:': u'\U00000039 \U000020E3', + u':keycap_digit_one:': u'\U00000031 \U000020E3', + u':keycap_digit_seven:': u'\U00000037 \U000020E3', + u':keycap_digit_six:': u'\U00000036 \U000020E3', + u':keycap_digit_three:': u'\U00000033 \U000020E3', + u':keycap_digit_two:': u'\U00000032 \U000020E3', + u':keycap_digit_zero:': u'\U00000030 \U000020E3', + u':keycap_number_sign:': u'\U00000023 \U000020E3', + u':keycap_ten:': u'\U0001F51F', + u':kimono:': u'\U0001F458', + u':couplekiss:': u'\U0001F48F', + u':kiss:': u'\U0001F48B', + u':kissing_cat:': u'\U0001F63D', + u':kissing:': u'\U0001F617', + u':kissing_closed_eyes:': u'\U0001F61A', + u':kissing_smiling_eyes:': u'\U0001F619', + u':koala:': u'\U0001F428', + u':label:': u'\U0001F3F7', + u':beetle:': u'\U0001F41E', + u':large_blue_circle:': u'\U0001F535', + u':large_blue_diamond:': u'\U0001F537', + u':large_orange_diamond:': u'\U0001F536', + u':red_circle:': u'\U0001F534', + u':last_quarter_moon:': u'\U0001F317', + u':last_quarter_moon_with_face:': u'\U0001F31C', + u':latin_cross:': u'\U0000271D', + u':leaves:': u'\U0001F343', + u':ledger:': u'\U0001F4D2', + u':mag:': u'\U0001F50D', + u':left_luggage:': u'\U0001F6C5', + u':left_right_arrow:': u'\U00002194', + u':leftwards_arrow_with_hook:': u'\U000021A9', + u':arrow_left:': u'\U00002B05', + u':lemon:': u'\U0001F34B', + u':leo:': u'\U0000264C', + u':leopard:': u'\U0001F406', + u':level_slider:': u'\U0001F39A', + u':libra:': u'\U0000264E', + u':light_rail:': u'\U0001F688', + u':link:': u'\U0001F517', + u':linked_paperclips:': u'\U0001F587', + u':lion_face:': u'\U0001F981', + u':lipstick:': u'\U0001F484', + u':lock:': u'\U0001F512', + u':lock_with_ink_pen:': u'\U0001F50F', + u':lollipop:': u'\U0001F36D', + u':sob:': u'\U0001F62D', + u':love_hotel:': u'\U0001F3E9', + u':love_letter:': u'\U0001F48C', + u':low_brightness:': u'\U0001F505', + u':lower_left_ballpoint_pen:': u'\U0001F58A', + u':lower_left_crayon:': u'\U0001F58D', + u':lower_left_fountain_pen:': u'\U0001F58B', + u':lower_left_paintbrush:': u'\U0001F58C', + u':mahjong:': u'\U0001F004', + u':man:': u'\U0001F468', + u':couple:': u'\U0001F46B', + u':man_in_business_suit_levitating:': u'\U0001F574', + u':man_with_gua_pi_mao:': u'\U0001F472', + u':man_with_turban:': u'\U0001F473', + u':mans_shoe:': u'\U0001F45E', + u':shoe:': u'\U0001F45E', + u':mantelpiece_clock:': u'\U0001F570', + u':maple_leaf:': u'\U0001F341', + u':meat_on_bone:': u'\U0001F356', + u':black_circle:': u'\U000026AB', + u':white_circle:': u'\U000026AA', + u':melon:': u'\U0001F348', + u':memo:': u'\U0001F4DD', + u':pencil:': u'\U0001F4DD', + u':menorah_with_nine_branches:': u'\U0001F54E', + u':mens:': u'\U0001F6B9', + u':metro:': u'\U0001F687', + u':microphone:': u'\U0001F3A4', + u':microscope:': u'\U0001F52C', + u':military_medal:': u'\U0001F396', + u':milky_way:': u'\U0001F30C', + u':minibus:': u'\U0001F690', + u':minidisc:': u'\U0001F4BD', + u':iphone:': u'\U0001F4F1', + u':mobile_phone_off:': u'\U0001F4F4', + u':calling:': u'\U0001F4F2', + u':money__mouth_face:': u'\U0001F911', + u':moneybag:': u'\U0001F4B0', + u':money_with_wings:': u'\U0001F4B8', + u':monkey:': u'\U0001F412', + u':monkey_face:': u'\U0001F435', + u':monorail:': u'\U0001F69D', + u':rice_scene:': u'\U0001F391', + u':mosque:': u'\U0001F54C', + u':motor_boat:': u'\U0001F6E5', + u':motorway:': u'\U0001F6E3', + u':mount_fuji:': u'\U0001F5FB', + u':mountain:': u'\U000026F0', + u':mountain_bicyclist:': u'\U0001F6B5', + u':mountain_cableway:': u'\U0001F6A0', + u':mountain_railway:': u'\U0001F69E', + u':mouse2:': u'\U0001F401', + u':mouse:': u'\U0001F42D', + u':lips:': u'\U0001F444', + u':movie_camera:': u'\U0001F3A5', + u':moyai:': u'\U0001F5FF', + u':notes:': u'\U0001F3B6', + u':mushroom:': u'\U0001F344', + u':musical_keyboard:': u'\U0001F3B9', + u':musical_note:': u'\U0001F3B5', + u':musical_score:': u'\U0001F3BC', + u':nail_care:': u'\U0001F485', + u':name_badge:': u'\U0001F4DB', + u':national_park:': u'\U0001F3DE', + u':necktie:': u'\U0001F454', + u':ab:': u'\U0001F18E', + u':negative_squared_cross_mark:': u'\U0000274E', + u':a:': u'\U0001F170', + u':b:': u'\U0001F171', + u':o2:': u'\U0001F17E', + u':parking:': u'\U0001F17F', + u':nerd_face:': u'\U0001F913', + u':neutral_face:': u'\U0001F610', + u':new_moon:': u'\U0001F311', + u':honeybee:': u'\U0001F41D', + u':new_moon_with_face:': u'\U0001F31A', + u':newspaper:': u'\U0001F4F0', + u':night_with_stars:': u'\U0001F303', + u':no_bicycles:': u'\U0001F6B3', + u':no_entry:': u'\U000026D4', + u':no_entry_sign:': u'\U0001F6AB', + u':no_mobile_phones:': u'\U0001F4F5', + u':underage:': u'\U0001F51E', + u':no_pedestrians:': u'\U0001F6B7', + u':no_smoking:': u'\U0001F6AD', + u':non__potable_water:': u'\U0001F6B1', + u':arrow_upper_right:': u'\U00002197', + u':arrow_upper_left:': u'\U00002196', + u':nose:': u'\U0001F443', + u':notebook:': u'\U0001F4D3', + u':notebook_with_decorative_cover:': u'\U0001F4D4', + u':nut_and_bolt:': u'\U0001F529', + u':octopus:': u'\U0001F419', + u':oden:': u'\U0001F362', + u':office:': u'\U0001F3E2', + u':oil_drum:': u'\U0001F6E2', + u':ok_hand:': u'\U0001F44C', + u':old_key:': u'\U0001F5DD', + u':older_man:': u'\U0001F474', + u':older_woman:': u'\U0001F475', + u':om_symbol:': u'\U0001F549', + u':on:': u'\U0001F51B', + u':oncoming_automobile:': u'\U0001F698', + u':oncoming_bus:': u'\U0001F68D', + u':oncoming_police_car:': u'\U0001F694', + u':oncoming_taxi:': u'\U0001F696', + u':book:': u'\U0001F4D6', + u':open_book:': u'\U0001F4D6', + u':open_file_folder:': u'\U0001F4C2', + u':open_hands:': u'\U0001F450', + u':unlock:': u'\U0001F513', + u':mailbox_with_no_mail:': u'\U0001F4ED', + u':mailbox_with_mail:': u'\U0001F4EC', + u':ophiuchus:': u'\U000026CE', + u':cd:': u'\U0001F4BF', + u':orange_book:': u'\U0001F4D9', + u':orthodox_cross:': u'\U00002626', + u':outbox_tray:': u'\U0001F4E4', + u':ox:': u'\U0001F402', + u':package:': u'\U0001F4E6', + u':page_facing_up:': u'\U0001F4C4', + u':page_with_curl:': u'\U0001F4C3', + u':pager:': u'\U0001F4DF', + u':palm_tree:': u'\U0001F334', + u':panda_face:': u'\U0001F43C', + u':paperclip:': u'\U0001F4CE', + u':part_alternation_mark:': u'\U0000303D', + u':tada:': u'\U0001F389', + u':passenger_ship:': u'\U0001F6F3', + u':passport_control:': u'\U0001F6C2', + u':feet:': u'\U0001F43E', + u':paw_prints:': u'\U0001F43E', + u':peace_symbol:': u'\U0000262E', + u':peach:': u'\U0001F351', + u':pear:': u'\U0001F350', + u':walking:': u'\U0001F6B6', + u':pencil2:': u'\U0000270F', + u':penguin:': u'\U0001F427', + u':pensive:': u'\U0001F614', + u':performing_arts:': u'\U0001F3AD', + u':persevere:': u'\U0001F623', + u':bow:': u'\U0001F647', + u':person_frowning:': u'\U0001F64D', + u':raised_hands:': u'\U0001F64C', + u':person_with_ball:': u'\U000026F9', + u':person_with_blond_hair:': u'\U0001F471', + u':pray:': u'\U0001F64F', + u':person_with_pouting_face:': u'\U0001F64E', + u':computer:': u'\U0001F4BB', + u':pick:': u'\U000026CF', + u':pig2:': u'\U0001F416', + u':pig:': u'\U0001F437', + u':pig_nose:': u'\U0001F43D', + u':hankey:': u'\U0001F4A9', + u':poop:': u'\U0001F4A9', + u':shit:': u'\U0001F4A9', + u':pill:': u'\U0001F48A', + u':bamboo:': u'\U0001F38D', + u':pineapple:': u'\U0001F34D', + u':pisces:': u'\U00002653', + u':gun:': u'\U0001F52B', + u':place_of_worship:': u'\U0001F6D0', + u':black_joker:': u'\U0001F0CF', + u':police_car:': u'\U0001F693', + u':rotating_light:': u'\U0001F6A8', + u':cop:': u'\U0001F46E', + u':poodle:': u'\U0001F429', + u':popcorn:': u'\U0001F37F', + u':postal_horn:': u'\U0001F4EF', + u':postbox:': u'\U0001F4EE', + u':stew:': u'\U0001F372', + u':potable_water:': u'\U0001F6B0', + u':pouch:': u'\U0001F45D', + u':poultry_leg:': u'\U0001F357', + u':pouting_cat:': u'\U0001F63E', + u':rage:': u'\U0001F621', + u':prayer_beads:': u'\U0001F4FF', + u':princess:': u'\U0001F478', + u':printer:': u'\U0001F5A8', + u':loudspeaker:': u'\U0001F4E2', + u':purple_heart:': u'\U0001F49C', + u':purse:': u'\U0001F45B', + u':pushpin:': u'\U0001F4CC', + u':put_litter_in_its_place:': u'\U0001F6AE', + u':rabbit2:': u'\U0001F407', + u':rabbit:': u'\U0001F430', + u':racing_car:': u'\U0001F3CE', + u':racing_motorcycle:': u'\U0001F3CD', + u':radio:': u'\U0001F4FB', + u':radio_button:': u'\U0001F518', + u':radioactive_sign:': u'\U00002622', + u':railway_car:': u'\U0001F683', + u':railway_track:': u'\U0001F6E4', + u':rainbow:': u'\U0001F308', + u':fist:': u'\U0000270A', + u':hand:': u'\U0000270B', + u':raised_hand:': u'\U0000270B', + u':raised_hand_with_fingers_splayed:': u'\U0001F590', + u':raised_hand_with_part_between_middle_and_ring_fingers:': u'\U0001F596', + u':ram:': u'\U0001F40F', + u':rat:': u'\U0001F400', + u':blue_car:': u'\U0001F699', + u':apple:': u'\U0001F34E', + u':registered:': u'\U000000AE', + u':relieved:': u'\U0001F60C', + u':reminder_ribbon:': u'\U0001F397', + u':restroom:': u'\U0001F6BB', + u':reversed_hand_with_middle_finger_extended:': u'\U0001F595', + u':revolving_hearts:': u'\U0001F49E', + u':ribbon:': u'\U0001F380', + u':rice_ball:': u'\U0001F359', + u':rice_cracker:': u'\U0001F358', + u':mag_right:': u'\U0001F50E', + u':right_anger_bubble:': u'\U0001F5EF', + u':arrow_right_hook:': u'\U000021AA', + u':ring:': u'\U0001F48D', + u':sweet_potato:': u'\U0001F360', + u':robot_face:': u'\U0001F916', + u':rocket:': u'\U0001F680', + u':rolled__up_newspaper:': u'\U0001F5DE', + u':roller_coaster:': u'\U0001F3A2', + u':rooster:': u'\U0001F413', + u':rose:': u'\U0001F339', + u':rosette:': u'\U0001F3F5', + u':round_pushpin:': u'\U0001F4CD', + u':rowboat:': u'\U0001F6A3', + u':rugby_football:': u'\U0001F3C9', + u':runner:': u'\U0001F3C3', + u':running:': u'\U0001F3C3', + u':running_shirt_with_sash:': u'\U0001F3BD', + u':sagittarius:': u'\U00002650', + u':boat:': u'\U000026F5', + u':sailboat:': u'\U000026F5', + u':sake:': u'\U0001F376', + u':satellite:': u'\U0001F4E1', + u':saxophone:': u'\U0001F3B7', + u':scales:': u'\U00002696', + u':school:': u'\U0001F3EB', + u':school_satchel:': u'\U0001F392', + u':scorpion:': u'\U0001F982', + u':scorpius:': u'\U0000264F', + u':scroll:': u'\U0001F4DC', + u':seat:': u'\U0001F4BA', + u':see_no_evil:': u'\U0001F648', + u':seedling:': u'\U0001F331', + u':shamrock:': u'\U00002618', + u':shaved_ice:': u'\U0001F367', + u':sheep:': u'\U0001F411', + u':shield:': u'\U0001F6E1', + u':shinto_shrine:': u'\U000026E9', + u':ship:': u'\U0001F6A2', + u':stars:': u'\U0001F320', + u':shopping_bags:': u'\U0001F6CD', + u':cake:': u'\U0001F370', + u':shower:': u'\U0001F6BF', + u':sign_of_the_horns:': u'\U0001F918', + u':japan:': u'\U0001F5FE', + u':six_pointed_star:': u'\U0001F52F', + u':ski:': u'\U0001F3BF', + u':skier:': u'\U000026F7', + u':skull:': u'\U0001F480', + u':skull_and_crossbones:': u'\U00002620', + u':sleeping_accommodation:': u'\U0001F6CC', + u':sleeping:': u'\U0001F634', + u':zzz:': u'\U0001F4A4', + u':sleepy:': u'\U0001F62A', + u':sleuth_or_spy:': u'\U0001F575', + u':pizza:': u'\U0001F355', + u':slightly_frowning_face:': u'\U0001F641', + u':slightly_smiling_face:': u'\U0001F642', + u':slot_machine:': u'\U0001F3B0', + u':small_airplane:': u'\U0001F6E9', + u':small_blue_diamond:': u'\U0001F539', + u':small_orange_diamond:': u'\U0001F538', + u':heart_eyes_cat:': u'\U0001F63B', + u':smiley_cat:': u'\U0001F63A', + u':innocent:': u'\U0001F607', + u':heart_eyes:': u'\U0001F60D', + u':smiling_imp:': u'\U0001F608', + u':smiley:': u'\U0001F603', + u':sweat_smile:': u'\U0001F605', + u':smile:': u'\U0001F604', + u':laughing:': u'\U0001F606', + u':satisfied:': u'\U0001F606', + u':blush:': u'\U0001F60A', + u':sunglasses:': u'\U0001F60E', + u':smirk:': u'\U0001F60F', + u':smoking:': u'\U0001F6AC', + u':snail:': u'\U0001F40C', + u':snake:': u'\U0001F40D', + u':snow_capped_mountain:': u'\U0001F3D4', + u':snowboarder:': u'\U0001F3C2', + u':snowflake:': u'\U00002744', + u':snowman:': u'\U00002603', + u':soccer:': u'\U000026BD', + u':icecream:': u'\U0001F366', + u':soon:': u'\U0001F51C', + u':arrow_lower_right:': u'\U00002198', + u':arrow_lower_left:': u'\U00002199', + u':spaghetti:': u'\U0001F35D', + u':sparkle:': u'\U00002747', + u':sparkles:': u'\U00002728', + u':sparkling_heart:': u'\U0001F496', + u':speak_no_evil:': u'\U0001F64A', + u':speaker:': u'\U0001F508', + u':mute:': u'\U0001F507', + u':sound:': u'\U0001F509', + u':loud_sound:': u'\U0001F50A', + u':speaking_head_in_silhouette:': u'\U0001F5E3', + u':speech_balloon:': u'\U0001F4AC', + u':speedboat:': u'\U0001F6A4', + u':spider:': u'\U0001F577', + u':spider_web:': u'\U0001F578', + u':spiral_calendar_pad:': u'\U0001F5D3', + u':spiral_note_pad:': u'\U0001F5D2', + u':shell:': u'\U0001F41A', + u':sweat_drops:': u'\U0001F4A6', + u':sports_medal:': u'\U0001F3C5', + u':whale:': u'\U0001F433', + u':u5272:': u'\U0001F239', + u':u5408:': u'\U0001F234', + u':u55b6:': u'\U0001F23A', + u':u6307:': u'\U0001F22F', + u':u6708:': u'\U0001F237', + u':u6709:': u'\U0001F236', + u':u6e80:': u'\U0001F235', + u':u7121:': u'\U0001F21A', + u':u7533:': u'\U0001F238', + u':u7981:': u'\U0001F232', + u':u7a7a:': u'\U0001F233', + u':cl:': u'\U0001F191', + u':cool:': u'\U0001F192', + u':free:': u'\U0001F193', + u':id:': u'\U0001F194', + u':koko:': u'\U0001F201', + u':sa:': u'\U0001F202', + u':new:': u'\U0001F195', + u':ng:': u'\U0001F196', + u':ok:': u'\U0001F197', + u':sos:': u'\U0001F198', + u':up:': u'\U0001F199', + u':vs:': u'\U0001F19A', + u':stadium:': u'\U0001F3DF', + u':star_and_crescent:': u'\U0000262A', + u':star_of_david:': u'\U00002721', + u':station:': u'\U0001F689', + u':statue_of_liberty:': u'\U0001F5FD', + u':steam_locomotive:': u'\U0001F682', + u':ramen:': u'\U0001F35C', + u':stopwatch:': u'\U000023F1', + u':straight_ruler:': u'\U0001F4CF', + u':strawberry:': u'\U0001F353', + u':studio_microphone:': u'\U0001F399', + u':partly_sunny:': u'\U000026C5', + u':sun_with_face:': u'\U0001F31E', + u':sunflower:': u'\U0001F33B', + u':sunrise:': u'\U0001F305', + u':sunrise_over_mountains:': u'\U0001F304', + u':city_sunrise:': u'\U0001F307', + u':surfer:': u'\U0001F3C4', + u':sushi:': u'\U0001F363', + u':suspension_railway:': u'\U0001F69F', + u':swimmer:': u'\U0001F3CA', + u':synagogue:': u'\U0001F54D', + u':syringe:': u'\U0001F489', + u':shirt:': u'\U0001F455', + u':tshirt:': u'\U0001F455', + u':table_tennis_paddle_and_ball:': u'\U0001F3D3', + u':taco:': u'\U0001F32E', + u':tanabata_tree:': u'\U0001F38B', + u':tangerine:': u'\U0001F34A', + u':taurus:': u'\U00002649', + u':taxi:': u'\U0001F695', + u':tea:': u'\U0001F375', + u':calendar:': u'\U0001F4C6', + u':telephone_receiver:': u'\U0001F4DE', + u':telescope:': u'\U0001F52D', + u':tv:': u'\U0001F4FA', + u':tennis:': u'\U0001F3BE', + u':tent:': u'\U000026FA', + u':thermometer:': u'\U0001F321', + u':thinking_face:': u'\U0001F914', + u':thought_balloon:': u'\U0001F4AD', + u':three_button_mouse:': u'\U0001F5B1', + u':+1:': u'\U0001F44D', + u':thumbsup:': u'\U0001F44D', + u':__1:': u'\U0001F44E', + u':thumbsdown:': u'\U0001F44E', + u':thunder_cloud_and_rain:': u'\U000026C8', + u':ticket:': u'\U0001F3AB', + u':tiger2:': u'\U0001F405', + u':tiger:': u'\U0001F42F', + u':timer_clock:': u'\U000023F2', + u':tired_face:': u'\U0001F62B', + u':toilet:': u'\U0001F6BD', + u':tokyo_tower:': u'\U0001F5FC', + u':tomato:': u'\U0001F345', + u':tongue:': u'\U0001F445', + u':tophat:': u'\U0001F3A9', + u':top:': u'\U0001F51D', + u':trackball:': u'\U0001F5B2', + u':tractor:': u'\U0001F69C', + u':tm:': u'\U00002122', + u':train2:': u'\U0001F686', + u':tram:': u'\U0001F68A', + u':train:': u'\U0001F68B', + u':triangular_flag_on_post:': u'\U0001F6A9', + u':triangular_ruler:': u'\U0001F4D0', + u':trident:': u'\U0001F531', + u':trolleybus:': u'\U0001F68E', + u':trophy:': u'\U0001F3C6', + u':tropical_drink:': u'\U0001F379', + u':tropical_fish:': u'\U0001F420', + u':trumpet:': u'\U0001F3BA', + u':tulip:': u'\U0001F337', + u':turkey:': u'\U0001F983', + u':turtle:': u'\U0001F422', + u':twisted_rightwards_arrows:': u'\U0001F500', + u':two_hearts:': u'\U0001F495', + u':two_men_holding_hands:': u'\U0001F46C', + u':two_women_holding_hands:': u'\U0001F46D', + u':umbrella:': u'\U00002602', + u':umbrella_on_ground:': u'\U000026F1', + u':unamused:': u'\U0001F612', + u':unicorn_face:': u'\U0001F984', + u':small_red_triangle:': u'\U0001F53A', + u':arrow_up_small:': u'\U0001F53C', + u':arrow_up_down:': u'\U00002195', + u':upside__down_face:': u'\U0001F643', + u':arrow_up:': u'\U00002B06', + u':vertical_traffic_light:': u'\U0001F6A6', + u':vibration_mode:': u'\U0001F4F3', + u':v:': u'\U0000270C', + u':video_camera:': u'\U0001F4F9', + u':video_game:': u'\U0001F3AE', + u':vhs:': u'\U0001F4FC', + u':violin:': u'\U0001F3BB', + u':virgo:': u'\U0000264D', + u':volcano:': u'\U0001F30B', + u':volleyball:': u'\U0001F3D0', + u':waning_crescent_moon:': u'\U0001F318', + u':waning_gibbous_moon:': u'\U0001F316', + u':warning:': u'\U000026A0', + u':wastebasket:': u'\U0001F5D1', + u':watch:': u'\U0000231A', + u':water_buffalo:': u'\U0001F403', + u':wc:': u'\U0001F6BE', + u':ocean:': u'\U0001F30A', + u':watermelon:': u'\U0001F349', + u':waving_black_flag:': u'\U0001F3F4', + u':wave:': u'\U0001F44B', + u':waving_white_flag:': u'\U0001F3F3', + u':wavy_dash:': u'\U00003030', + u':waxing_crescent_moon:': u'\U0001F312', + u':moon:': u'\U0001F314', + u':waxing_gibbous_moon:': u'\U0001F314', + u':scream_cat:': u'\U0001F640', + u':weary:': u'\U0001F629', + u':wedding:': u'\U0001F492', + u':weight_lifter:': u'\U0001F3CB', + u':whale2:': u'\U0001F40B', + u':wheel_of_dharma:': u'\U00002638', + u':wheelchair:': u'\U0000267F', + u':point_down:': u'\U0001F447', + u':grey_exclamation:': u'\U00002755', + u':white_flower:': u'\U0001F4AE', + u':white_frowning_face:': u'\U00002639', + u':white_check_mark:': u'\U00002705', + u':white_large_square:': u'\U00002B1C', + u':point_left:': u'\U0001F448', + u':white_medium_small_square:': u'\U000025FD', + u':white_medium_square:': u'\U000025FB', + u':star:': u'\U00002B50', + u':grey_question:': u'\U00002754', + u':point_right:': u'\U0001F449', + u':white_small_square:': u'\U000025AB', + u':relaxed:': u'\U0000263A', + u':white_square_button:': u'\U0001F533', + u':white_sun_behind_cloud:': u'\U0001F325', + u':white_sun_behind_cloud_with_rain:': u'\U0001F326', + u':white_sun_with_small_cloud:': u'\U0001F324', + u':point_up_2:': u'\U0001F446', + u':point_up:': u'\U0000261D', + u':wind_blowing_face:': u'\U0001F32C', + u':wind_chime:': u'\U0001F390', + u':wine_glass:': u'\U0001F377', + u':wink:': u'\U0001F609', + u':wolf:': u'\U0001F43A', + u':woman:': u'\U0001F469', + u':dancers:': u'\U0001F46F', + u':boot:': u'\U0001F462', + u':womans_clothes:': u'\U0001F45A', + u':womans_hat:': u'\U0001F452', + u':sandal:': u'\U0001F461', + u':womens:': u'\U0001F6BA', + u':world_map:': u'\U0001F5FA', + u':worried:': u'\U0001F61F', + u':gift:': u'\U0001F381', + u':wrench:': u'\U0001F527', + u':writing_hand:': u'\U0000270D', + u':yellow_heart:': u'\U0001F49B', + u':yin_yang:': u'\U0000262F', + u':zipper__mouth_face:': u'\U0001F910' +}) + + +UNICODE_EMOJI = {v: k for k, v in EMOJI_UNICODE.items()} +UNICODE_EMOJI_ALIAS = {v: k for k, v in EMOJI_ALIAS_UNICODE.items()} diff --git a/website/web/Lib/site-packages/flask/__init__.py b/website/web/Lib/site-packages/flask/__init__.py new file mode 100644 index 000000000..a9a873fac --- /dev/null +++ b/website/web/Lib/site-packages/flask/__init__.py @@ -0,0 +1,49 @@ +# -*- coding: utf-8 -*- +""" + flask + ~~~~~ + + A microframework based on Werkzeug. It's extensively documented + and follows best practice patterns. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +__version__ = '0.12.2' + +# utilities we import from Werkzeug and Jinja2 that are unused +# in the module but are exported as public interface. +from werkzeug.exceptions import abort +from werkzeug.utils import redirect +from jinja2 import Markup, escape + +from .app import Flask, Request, Response +from .config import Config +from .helpers import url_for, flash, send_file, send_from_directory, \ + get_flashed_messages, get_template_attribute, make_response, safe_join, \ + stream_with_context +from .globals import current_app, g, request, session, _request_ctx_stack, \ + _app_ctx_stack +from .ctx import has_request_context, has_app_context, \ + after_this_request, copy_current_request_context +from .blueprints import Blueprint +from .templating import render_template, render_template_string + +# the signals +from .signals import signals_available, template_rendered, request_started, \ + request_finished, got_request_exception, request_tearing_down, \ + appcontext_tearing_down, appcontext_pushed, \ + appcontext_popped, message_flashed, before_render_template + +# We're not exposing the actual json module but a convenient wrapper around +# it. +from . import json + +# This was the only thing that Flask used to export at one point and it had +# a more generic name. +jsonify = json.jsonify + +# backwards compat, goes away in 1.0 +from .sessions import SecureCookieSession as Session +json_available = True diff --git a/website/web/Lib/site-packages/flask/__main__.py b/website/web/Lib/site-packages/flask/__main__.py new file mode 100644 index 000000000..cbefccd27 --- /dev/null +++ b/website/web/Lib/site-packages/flask/__main__.py @@ -0,0 +1,15 @@ +# -*- coding: utf-8 -*- +""" + flask.__main__ + ~~~~~~~~~~~~~~ + + Alias for flask.run for the command line. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + + +if __name__ == '__main__': + from .cli import main + main(as_module=True) diff --git a/website/web/Lib/site-packages/flask/_compat.py b/website/web/Lib/site-packages/flask/_compat.py new file mode 100644 index 000000000..071628fc1 --- /dev/null +++ b/website/web/Lib/site-packages/flask/_compat.py @@ -0,0 +1,96 @@ +# -*- coding: utf-8 -*- +""" + flask._compat + ~~~~~~~~~~~~~ + + Some py2/py3 compatibility support based on a stripped down + version of six so we don't have to depend on a specific version + of it. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +import sys + +PY2 = sys.version_info[0] == 2 +_identity = lambda x: x + + +if not PY2: + text_type = str + string_types = (str,) + integer_types = (int,) + + iterkeys = lambda d: iter(d.keys()) + itervalues = lambda d: iter(d.values()) + iteritems = lambda d: iter(d.items()) + + from io import StringIO + + def reraise(tp, value, tb=None): + if value.__traceback__ is not tb: + raise value.with_traceback(tb) + raise value + + implements_to_string = _identity + +else: + text_type = unicode + string_types = (str, unicode) + integer_types = (int, long) + + iterkeys = lambda d: d.iterkeys() + itervalues = lambda d: d.itervalues() + iteritems = lambda d: d.iteritems() + + from cStringIO import StringIO + + exec('def reraise(tp, value, tb=None):\n raise tp, value, tb') + + def implements_to_string(cls): + cls.__unicode__ = cls.__str__ + cls.__str__ = lambda x: x.__unicode__().encode('utf-8') + return cls + + +def with_metaclass(meta, *bases): + """Create a base class with a metaclass.""" + # This requires a bit of explanation: the basic idea is to make a + # dummy metaclass for one level of class instantiation that replaces + # itself with the actual metaclass. + class metaclass(type): + def __new__(cls, name, this_bases, d): + return meta(name, bases, d) + return type.__new__(metaclass, 'temporary_class', (), {}) + + +# Certain versions of pypy have a bug where clearing the exception stack +# breaks the __exit__ function in a very peculiar way. The second level of +# exception blocks is necessary because pypy seems to forget to check if an +# exception happened until the next bytecode instruction? +# +# Relevant PyPy bugfix commit: +# https://bitbucket.org/pypy/pypy/commits/77ecf91c635a287e88e60d8ddb0f4e9df4003301 +# According to ronan on #pypy IRC, it is released in PyPy2 2.3 and later +# versions. +# +# Ubuntu 14.04 has PyPy 2.2.1, which does exhibit this bug. +BROKEN_PYPY_CTXMGR_EXIT = False +if hasattr(sys, 'pypy_version_info'): + class _Mgr(object): + def __enter__(self): + return self + def __exit__(self, *args): + if hasattr(sys, 'exc_clear'): + # Python 3 (PyPy3) doesn't have exc_clear + sys.exc_clear() + try: + try: + with _Mgr(): + raise AssertionError() + except: + raise + except TypeError: + BROKEN_PYPY_CTXMGR_EXIT = True + except AssertionError: + pass diff --git a/website/web/Lib/site-packages/flask/app.py b/website/web/Lib/site-packages/flask/app.py new file mode 100644 index 000000000..1404e17e7 --- /dev/null +++ b/website/web/Lib/site-packages/flask/app.py @@ -0,0 +1,2003 @@ +# -*- coding: utf-8 -*- +""" + flask.app + ~~~~~~~~~ + + This module implements the central WSGI application object. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +import os +import sys +from threading import Lock +from datetime import timedelta +from itertools import chain +from functools import update_wrapper + +from werkzeug.datastructures import ImmutableDict +from werkzeug.routing import Map, Rule, RequestRedirect, BuildError +from werkzeug.exceptions import HTTPException, InternalServerError, \ + MethodNotAllowed, BadRequest, default_exceptions + +from .helpers import _PackageBoundObject, url_for, get_flashed_messages, \ + locked_cached_property, _endpoint_from_view_func, find_package, \ + get_debug_flag +from . import json, cli +from .wrappers import Request, Response +from .config import ConfigAttribute, Config +from .ctx import RequestContext, AppContext, _AppCtxGlobals +from .globals import _request_ctx_stack, request, session, g +from .sessions import SecureCookieSessionInterface +from .templating import DispatchingJinjaLoader, Environment, \ + _default_template_ctx_processor +from .signals import request_started, request_finished, got_request_exception, \ + request_tearing_down, appcontext_tearing_down +from ._compat import reraise, string_types, text_type, integer_types + +# a lock used for logger initialization +_logger_lock = Lock() + +# a singleton sentinel value for parameter defaults +_sentinel = object() + + +def _make_timedelta(value): + if not isinstance(value, timedelta): + return timedelta(seconds=value) + return value + + +def setupmethod(f): + """Wraps a method so that it performs a check in debug mode if the + first request was already handled. + """ + def wrapper_func(self, *args, **kwargs): + if self.debug and self._got_first_request: + raise AssertionError('A setup function was called after the ' + 'first request was handled. This usually indicates a bug ' + 'in the application where a module was not imported ' + 'and decorators or other functionality was called too late.\n' + 'To fix this make sure to import all your view modules, ' + 'database models and everything related at a central place ' + 'before the application starts serving requests.') + return f(self, *args, **kwargs) + return update_wrapper(wrapper_func, f) + + +class Flask(_PackageBoundObject): + """The flask object implements a WSGI application and acts as the central + object. It is passed the name of the module or package of the + application. Once it is created it will act as a central registry for + the view functions, the URL rules, template configuration and much more. + + The name of the package is used to resolve resources from inside the + package or the folder the module is contained in depending on if the + package parameter resolves to an actual python package (a folder with + an :file:`__init__.py` file inside) or a standard module (just a ``.py`` file). + + For more information about resource loading, see :func:`open_resource`. + + Usually you create a :class:`Flask` instance in your main module or + in the :file:`__init__.py` file of your package like this:: + + from flask import Flask + app = Flask(__name__) + + .. admonition:: About the First Parameter + + The idea of the first parameter is to give Flask an idea of what + belongs to your application. This name is used to find resources + on the filesystem, can be used by extensions to improve debugging + information and a lot more. + + So it's important what you provide there. If you are using a single + module, `__name__` is always the correct value. If you however are + using a package, it's usually recommended to hardcode the name of + your package there. + + For example if your application is defined in :file:`yourapplication/app.py` + you should create it with one of the two versions below:: + + app = Flask('yourapplication') + app = Flask(__name__.split('.')[0]) + + Why is that? The application will work even with `__name__`, thanks + to how resources are looked up. However it will make debugging more + painful. Certain extensions can make assumptions based on the + import name of your application. For example the Flask-SQLAlchemy + extension will look for the code in your application that triggered + an SQL query in debug mode. If the import name is not properly set + up, that debugging information is lost. (For example it would only + pick up SQL queries in `yourapplication.app` and not + `yourapplication.views.frontend`) + + .. versionadded:: 0.7 + The `static_url_path`, `static_folder`, and `template_folder` + parameters were added. + + .. versionadded:: 0.8 + The `instance_path` and `instance_relative_config` parameters were + added. + + .. versionadded:: 0.11 + The `root_path` parameter was added. + + :param import_name: the name of the application package + :param static_url_path: can be used to specify a different path for the + static files on the web. Defaults to the name + of the `static_folder` folder. + :param static_folder: the folder with static files that should be served + at `static_url_path`. Defaults to the ``'static'`` + folder in the root path of the application. + :param template_folder: the folder that contains the templates that should + be used by the application. Defaults to + ``'templates'`` folder in the root path of the + application. + :param instance_path: An alternative instance path for the application. + By default the folder ``'instance'`` next to the + package or module is assumed to be the instance + path. + :param instance_relative_config: if set to ``True`` relative filenames + for loading the config are assumed to + be relative to the instance path instead + of the application root. + :param root_path: Flask by default will automatically calculate the path + to the root of the application. In certain situations + this cannot be achieved (for instance if the package + is a Python 3 namespace package) and needs to be + manually defined. + """ + + #: The class that is used for request objects. See :class:`~flask.Request` + #: for more information. + request_class = Request + + #: The class that is used for response objects. See + #: :class:`~flask.Response` for more information. + response_class = Response + + #: The class that is used for the Jinja environment. + #: + #: .. versionadded:: 0.11 + jinja_environment = Environment + + #: The class that is used for the :data:`~flask.g` instance. + #: + #: Example use cases for a custom class: + #: + #: 1. Store arbitrary attributes on flask.g. + #: 2. Add a property for lazy per-request database connectors. + #: 3. Return None instead of AttributeError on unexpected attributes. + #: 4. Raise exception if an unexpected attr is set, a "controlled" flask.g. + #: + #: In Flask 0.9 this property was called `request_globals_class` but it + #: was changed in 0.10 to :attr:`app_ctx_globals_class` because the + #: flask.g object is now application context scoped. + #: + #: .. versionadded:: 0.10 + app_ctx_globals_class = _AppCtxGlobals + + # Backwards compatibility support + def _get_request_globals_class(self): + return self.app_ctx_globals_class + def _set_request_globals_class(self, value): + from warnings import warn + warn(DeprecationWarning('request_globals_class attribute is now ' + 'called app_ctx_globals_class')) + self.app_ctx_globals_class = value + request_globals_class = property(_get_request_globals_class, + _set_request_globals_class) + del _get_request_globals_class, _set_request_globals_class + + #: The class that is used for the ``config`` attribute of this app. + #: Defaults to :class:`~flask.Config`. + #: + #: Example use cases for a custom class: + #: + #: 1. Default values for certain config options. + #: 2. Access to config values through attributes in addition to keys. + #: + #: .. versionadded:: 0.11 + config_class = Config + + #: The debug flag. Set this to ``True`` to enable debugging of the + #: application. In debug mode the debugger will kick in when an unhandled + #: exception occurs and the integrated server will automatically reload + #: the application if changes in the code are detected. + #: + #: This attribute can also be configured from the config with the ``DEBUG`` + #: configuration key. Defaults to ``False``. + debug = ConfigAttribute('DEBUG') + + #: The testing flag. Set this to ``True`` to enable the test mode of + #: Flask extensions (and in the future probably also Flask itself). + #: For example this might activate unittest helpers that have an + #: additional runtime cost which should not be enabled by default. + #: + #: If this is enabled and PROPAGATE_EXCEPTIONS is not changed from the + #: default it's implicitly enabled. + #: + #: This attribute can also be configured from the config with the + #: ``TESTING`` configuration key. Defaults to ``False``. + testing = ConfigAttribute('TESTING') + + #: If a secret key is set, cryptographic components can use this to + #: sign cookies and other things. Set this to a complex random value + #: when you want to use the secure cookie for instance. + #: + #: This attribute can also be configured from the config with the + #: ``SECRET_KEY`` configuration key. Defaults to ``None``. + secret_key = ConfigAttribute('SECRET_KEY') + + #: The secure cookie uses this for the name of the session cookie. + #: + #: This attribute can also be configured from the config with the + #: ``SESSION_COOKIE_NAME`` configuration key. Defaults to ``'session'`` + session_cookie_name = ConfigAttribute('SESSION_COOKIE_NAME') + + #: A :class:`~datetime.timedelta` which is used to set the expiration + #: date of a permanent session. The default is 31 days which makes a + #: permanent session survive for roughly one month. + #: + #: This attribute can also be configured from the config with the + #: ``PERMANENT_SESSION_LIFETIME`` configuration key. Defaults to + #: ``timedelta(days=31)`` + permanent_session_lifetime = ConfigAttribute('PERMANENT_SESSION_LIFETIME', + get_converter=_make_timedelta) + + #: A :class:`~datetime.timedelta` which is used as default cache_timeout + #: for the :func:`send_file` functions. The default is 12 hours. + #: + #: This attribute can also be configured from the config with the + #: ``SEND_FILE_MAX_AGE_DEFAULT`` configuration key. This configuration + #: variable can also be set with an integer value used as seconds. + #: Defaults to ``timedelta(hours=12)`` + send_file_max_age_default = ConfigAttribute('SEND_FILE_MAX_AGE_DEFAULT', + get_converter=_make_timedelta) + + #: Enable this if you want to use the X-Sendfile feature. Keep in + #: mind that the server has to support this. This only affects files + #: sent with the :func:`send_file` method. + #: + #: .. versionadded:: 0.2 + #: + #: This attribute can also be configured from the config with the + #: ``USE_X_SENDFILE`` configuration key. Defaults to ``False``. + use_x_sendfile = ConfigAttribute('USE_X_SENDFILE') + + #: The name of the logger to use. By default the logger name is the + #: package name passed to the constructor. + #: + #: .. versionadded:: 0.4 + logger_name = ConfigAttribute('LOGGER_NAME') + + #: The JSON encoder class to use. Defaults to :class:`~flask.json.JSONEncoder`. + #: + #: .. versionadded:: 0.10 + json_encoder = json.JSONEncoder + + #: The JSON decoder class to use. Defaults to :class:`~flask.json.JSONDecoder`. + #: + #: .. versionadded:: 0.10 + json_decoder = json.JSONDecoder + + #: Options that are passed directly to the Jinja2 environment. + jinja_options = ImmutableDict( + extensions=['jinja2.ext.autoescape', 'jinja2.ext.with_'] + ) + + #: Default configuration parameters. + default_config = ImmutableDict({ + 'DEBUG': get_debug_flag(default=False), + 'TESTING': False, + 'PROPAGATE_EXCEPTIONS': None, + 'PRESERVE_CONTEXT_ON_EXCEPTION': None, + 'SECRET_KEY': None, + 'PERMANENT_SESSION_LIFETIME': timedelta(days=31), + 'USE_X_SENDFILE': False, + 'LOGGER_NAME': None, + 'LOGGER_HANDLER_POLICY': 'always', + 'SERVER_NAME': None, + 'APPLICATION_ROOT': None, + 'SESSION_COOKIE_NAME': 'session', + 'SESSION_COOKIE_DOMAIN': None, + 'SESSION_COOKIE_PATH': None, + 'SESSION_COOKIE_HTTPONLY': True, + 'SESSION_COOKIE_SECURE': False, + 'SESSION_REFRESH_EACH_REQUEST': True, + 'MAX_CONTENT_LENGTH': None, + 'SEND_FILE_MAX_AGE_DEFAULT': timedelta(hours=12), + 'TRAP_BAD_REQUEST_ERRORS': False, + 'TRAP_HTTP_EXCEPTIONS': False, + 'EXPLAIN_TEMPLATE_LOADING': False, + 'PREFERRED_URL_SCHEME': 'http', + 'JSON_AS_ASCII': True, + 'JSON_SORT_KEYS': True, + 'JSONIFY_PRETTYPRINT_REGULAR': True, + 'JSONIFY_MIMETYPE': 'application/json', + 'TEMPLATES_AUTO_RELOAD': None, + }) + + #: The rule object to use for URL rules created. This is used by + #: :meth:`add_url_rule`. Defaults to :class:`werkzeug.routing.Rule`. + #: + #: .. versionadded:: 0.7 + url_rule_class = Rule + + #: the test client that is used with when `test_client` is used. + #: + #: .. versionadded:: 0.7 + test_client_class = None + + #: the session interface to use. By default an instance of + #: :class:`~flask.sessions.SecureCookieSessionInterface` is used here. + #: + #: .. versionadded:: 0.8 + session_interface = SecureCookieSessionInterface() + + def __init__(self, import_name, static_path=None, static_url_path=None, + static_folder='static', template_folder='templates', + instance_path=None, instance_relative_config=False, + root_path=None): + _PackageBoundObject.__init__(self, import_name, + template_folder=template_folder, + root_path=root_path) + if static_path is not None: + from warnings import warn + warn(DeprecationWarning('static_path is now called ' + 'static_url_path'), stacklevel=2) + static_url_path = static_path + + if static_url_path is not None: + self.static_url_path = static_url_path + if static_folder is not None: + self.static_folder = static_folder + if instance_path is None: + instance_path = self.auto_find_instance_path() + elif not os.path.isabs(instance_path): + raise ValueError('If an instance path is provided it must be ' + 'absolute. A relative path was given instead.') + + #: Holds the path to the instance folder. + #: + #: .. versionadded:: 0.8 + self.instance_path = instance_path + + #: The configuration dictionary as :class:`Config`. This behaves + #: exactly like a regular dictionary but supports additional methods + #: to load a config from files. + self.config = self.make_config(instance_relative_config) + + # Prepare the deferred setup of the logger. + self._logger = None + self.logger_name = self.import_name + + #: A dictionary of all view functions registered. The keys will + #: be function names which are also used to generate URLs and + #: the values are the function objects themselves. + #: To register a view function, use the :meth:`route` decorator. + self.view_functions = {} + + # support for the now deprecated `error_handlers` attribute. The + # :attr:`error_handler_spec` shall be used now. + self._error_handlers = {} + + #: A dictionary of all registered error handlers. The key is ``None`` + #: for error handlers active on the application, otherwise the key is + #: the name of the blueprint. Each key points to another dictionary + #: where the key is the status code of the http exception. The + #: special key ``None`` points to a list of tuples where the first item + #: is the class for the instance check and the second the error handler + #: function. + #: + #: To register a error handler, use the :meth:`errorhandler` + #: decorator. + self.error_handler_spec = {None: self._error_handlers} + + #: A list of functions that are called when :meth:`url_for` raises a + #: :exc:`~werkzeug.routing.BuildError`. Each function registered here + #: is called with `error`, `endpoint` and `values`. If a function + #: returns ``None`` or raises a :exc:`BuildError` the next function is + #: tried. + #: + #: .. versionadded:: 0.9 + self.url_build_error_handlers = [] + + #: A dictionary with lists of functions that should be called at the + #: beginning of the request. The key of the dictionary is the name of + #: the blueprint this function is active for, ``None`` for all requests. + #: This can for example be used to open database connections or + #: getting hold of the currently logged in user. To register a + #: function here, use the :meth:`before_request` decorator. + self.before_request_funcs = {} + + #: A lists of functions that should be called at the beginning of the + #: first request to this instance. To register a function here, use + #: the :meth:`before_first_request` decorator. + #: + #: .. versionadded:: 0.8 + self.before_first_request_funcs = [] + + #: A dictionary with lists of functions that should be called after + #: each request. The key of the dictionary is the name of the blueprint + #: this function is active for, ``None`` for all requests. This can for + #: example be used to close database connections. To register a function + #: here, use the :meth:`after_request` decorator. + self.after_request_funcs = {} + + #: A dictionary with lists of functions that are called after + #: each request, even if an exception has occurred. The key of the + #: dictionary is the name of the blueprint this function is active for, + #: ``None`` for all requests. These functions are not allowed to modify + #: the request, and their return values are ignored. If an exception + #: occurred while processing the request, it gets passed to each + #: teardown_request function. To register a function here, use the + #: :meth:`teardown_request` decorator. + #: + #: .. versionadded:: 0.7 + self.teardown_request_funcs = {} + + #: A list of functions that are called when the application context + #: is destroyed. Since the application context is also torn down + #: if the request ends this is the place to store code that disconnects + #: from databases. + #: + #: .. versionadded:: 0.9 + self.teardown_appcontext_funcs = [] + + #: A dictionary with lists of functions that can be used as URL + #: value processor functions. Whenever a URL is built these functions + #: are called to modify the dictionary of values in place. The key + #: ``None`` here is used for application wide + #: callbacks, otherwise the key is the name of the blueprint. + #: Each of these functions has the chance to modify the dictionary + #: + #: .. versionadded:: 0.7 + self.url_value_preprocessors = {} + + #: A dictionary with lists of functions that can be used as URL value + #: preprocessors. The key ``None`` here is used for application wide + #: callbacks, otherwise the key is the name of the blueprint. + #: Each of these functions has the chance to modify the dictionary + #: of URL values before they are used as the keyword arguments of the + #: view function. For each function registered this one should also + #: provide a :meth:`url_defaults` function that adds the parameters + #: automatically again that were removed that way. + #: + #: .. versionadded:: 0.7 + self.url_default_functions = {} + + #: A dictionary with list of functions that are called without argument + #: to populate the template context. The key of the dictionary is the + #: name of the blueprint this function is active for, ``None`` for all + #: requests. Each returns a dictionary that the template context is + #: updated with. To register a function here, use the + #: :meth:`context_processor` decorator. + self.template_context_processors = { + None: [_default_template_ctx_processor] + } + + #: A list of shell context processor functions that should be run + #: when a shell context is created. + #: + #: .. versionadded:: 0.11 + self.shell_context_processors = [] + + #: all the attached blueprints in a dictionary by name. Blueprints + #: can be attached multiple times so this dictionary does not tell + #: you how often they got attached. + #: + #: .. versionadded:: 0.7 + self.blueprints = {} + self._blueprint_order = [] + + #: a place where extensions can store application specific state. For + #: example this is where an extension could store database engines and + #: similar things. For backwards compatibility extensions should register + #: themselves like this:: + #: + #: if not hasattr(app, 'extensions'): + #: app.extensions = {} + #: app.extensions['extensionname'] = SomeObject() + #: + #: The key must match the name of the extension module. For example in + #: case of a "Flask-Foo" extension in `flask_foo`, the key would be + #: ``'foo'``. + #: + #: .. versionadded:: 0.7 + self.extensions = {} + + #: The :class:`~werkzeug.routing.Map` for this instance. You can use + #: this to change the routing converters after the class was created + #: but before any routes are connected. Example:: + #: + #: from werkzeug.routing import BaseConverter + #: + #: class ListConverter(BaseConverter): + #: def to_python(self, value): + #: return value.split(',') + #: def to_url(self, values): + #: return ','.join(super(ListConverter, self).to_url(value) + #: for value in values) + #: + #: app = Flask(__name__) + #: app.url_map.converters['list'] = ListConverter + self.url_map = Map() + + # tracks internally if the application already handled at least one + # request. + self._got_first_request = False + self._before_request_lock = Lock() + + # register the static folder for the application. Do that even + # if the folder does not exist. First of all it might be created + # while the server is running (usually happens during development) + # but also because google appengine stores static files somewhere + # else when mapped with the .yml file. + if self.has_static_folder: + self.add_url_rule(self.static_url_path + '/', + endpoint='static', + view_func=self.send_static_file) + + #: The click command line context for this application. Commands + #: registered here show up in the :command:`flask` command once the + #: application has been discovered. The default commands are + #: provided by Flask itself and can be overridden. + #: + #: This is an instance of a :class:`click.Group` object. + self.cli = cli.AppGroup(self.name) + + def _get_error_handlers(self): + from warnings import warn + warn(DeprecationWarning('error_handlers is deprecated, use the ' + 'new error_handler_spec attribute instead.'), stacklevel=1) + return self._error_handlers + def _set_error_handlers(self, value): + self._error_handlers = value + self.error_handler_spec[None] = value + error_handlers = property(_get_error_handlers, _set_error_handlers) + del _get_error_handlers, _set_error_handlers + + @locked_cached_property + def name(self): + """The name of the application. This is usually the import name + with the difference that it's guessed from the run file if the + import name is main. This name is used as a display name when + Flask needs the name of the application. It can be set and overridden + to change the value. + + .. versionadded:: 0.8 + """ + if self.import_name == '__main__': + fn = getattr(sys.modules['__main__'], '__file__', None) + if fn is None: + return '__main__' + return os.path.splitext(os.path.basename(fn))[0] + return self.import_name + + @property + def propagate_exceptions(self): + """Returns the value of the ``PROPAGATE_EXCEPTIONS`` configuration + value in case it's set, otherwise a sensible default is returned. + + .. versionadded:: 0.7 + """ + rv = self.config['PROPAGATE_EXCEPTIONS'] + if rv is not None: + return rv + return self.testing or self.debug + + @property + def preserve_context_on_exception(self): + """Returns the value of the ``PRESERVE_CONTEXT_ON_EXCEPTION`` + configuration value in case it's set, otherwise a sensible default + is returned. + + .. versionadded:: 0.7 + """ + rv = self.config['PRESERVE_CONTEXT_ON_EXCEPTION'] + if rv is not None: + return rv + return self.debug + + @property + def logger(self): + """A :class:`logging.Logger` object for this application. The + default configuration is to log to stderr if the application is + in debug mode. This logger can be used to (surprise) log messages. + Here some examples:: + + app.logger.debug('A value for debugging') + app.logger.warning('A warning occurred (%d apples)', 42) + app.logger.error('An error occurred') + + .. versionadded:: 0.3 + """ + if self._logger and self._logger.name == self.logger_name: + return self._logger + with _logger_lock: + if self._logger and self._logger.name == self.logger_name: + return self._logger + from flask.logging import create_logger + self._logger = rv = create_logger(self) + return rv + + @locked_cached_property + def jinja_env(self): + """The Jinja2 environment used to load templates.""" + return self.create_jinja_environment() + + @property + def got_first_request(self): + """This attribute is set to ``True`` if the application started + handling the first request. + + .. versionadded:: 0.8 + """ + return self._got_first_request + + def make_config(self, instance_relative=False): + """Used to create the config attribute by the Flask constructor. + The `instance_relative` parameter is passed in from the constructor + of Flask (there named `instance_relative_config`) and indicates if + the config should be relative to the instance path or the root path + of the application. + + .. versionadded:: 0.8 + """ + root_path = self.root_path + if instance_relative: + root_path = self.instance_path + return self.config_class(root_path, self.default_config) + + def auto_find_instance_path(self): + """Tries to locate the instance path if it was not provided to the + constructor of the application class. It will basically calculate + the path to a folder named ``instance`` next to your main file or + the package. + + .. versionadded:: 0.8 + """ + prefix, package_path = find_package(self.import_name) + if prefix is None: + return os.path.join(package_path, 'instance') + return os.path.join(prefix, 'var', self.name + '-instance') + + def open_instance_resource(self, resource, mode='rb'): + """Opens a resource from the application's instance folder + (:attr:`instance_path`). Otherwise works like + :meth:`open_resource`. Instance resources can also be opened for + writing. + + :param resource: the name of the resource. To access resources within + subfolders use forward slashes as separator. + :param mode: resource file opening mode, default is 'rb'. + """ + return open(os.path.join(self.instance_path, resource), mode) + + def create_jinja_environment(self): + """Creates the Jinja2 environment based on :attr:`jinja_options` + and :meth:`select_jinja_autoescape`. Since 0.7 this also adds + the Jinja2 globals and filters after initialization. Override + this function to customize the behavior. + + .. versionadded:: 0.5 + .. versionchanged:: 0.11 + ``Environment.auto_reload`` set in accordance with + ``TEMPLATES_AUTO_RELOAD`` configuration option. + """ + options = dict(self.jinja_options) + if 'autoescape' not in options: + options['autoescape'] = self.select_jinja_autoescape + if 'auto_reload' not in options: + if self.config['TEMPLATES_AUTO_RELOAD'] is not None: + options['auto_reload'] = self.config['TEMPLATES_AUTO_RELOAD'] + else: + options['auto_reload'] = self.debug + rv = self.jinja_environment(self, **options) + rv.globals.update( + url_for=url_for, + get_flashed_messages=get_flashed_messages, + config=self.config, + # request, session and g are normally added with the + # context processor for efficiency reasons but for imported + # templates we also want the proxies in there. + request=request, + session=session, + g=g + ) + rv.filters['tojson'] = json.tojson_filter + return rv + + def create_global_jinja_loader(self): + """Creates the loader for the Jinja2 environment. Can be used to + override just the loader and keeping the rest unchanged. It's + discouraged to override this function. Instead one should override + the :meth:`jinja_loader` function instead. + + The global loader dispatches between the loaders of the application + and the individual blueprints. + + .. versionadded:: 0.7 + """ + return DispatchingJinjaLoader(self) + + def init_jinja_globals(self): + """Deprecated. Used to initialize the Jinja2 globals. + + .. versionadded:: 0.5 + .. versionchanged:: 0.7 + This method is deprecated with 0.7. Override + :meth:`create_jinja_environment` instead. + """ + + def select_jinja_autoescape(self, filename): + """Returns ``True`` if autoescaping should be active for the given + template name. If no template name is given, returns `True`. + + .. versionadded:: 0.5 + """ + if filename is None: + return True + return filename.endswith(('.html', '.htm', '.xml', '.xhtml')) + + def update_template_context(self, context): + """Update the template context with some commonly used variables. + This injects request, session, config and g into the template + context as well as everything template context processors want + to inject. Note that the as of Flask 0.6, the original values + in the context will not be overridden if a context processor + decides to return a value with the same key. + + :param context: the context as a dictionary that is updated in place + to add extra variables. + """ + funcs = self.template_context_processors[None] + reqctx = _request_ctx_stack.top + if reqctx is not None: + bp = reqctx.request.blueprint + if bp is not None and bp in self.template_context_processors: + funcs = chain(funcs, self.template_context_processors[bp]) + orig_ctx = context.copy() + for func in funcs: + context.update(func()) + # make sure the original values win. This makes it possible to + # easier add new variables in context processors without breaking + # existing views. + context.update(orig_ctx) + + def make_shell_context(self): + """Returns the shell context for an interactive shell for this + application. This runs all the registered shell context + processors. + + .. versionadded:: 0.11 + """ + rv = {'app': self, 'g': g} + for processor in self.shell_context_processors: + rv.update(processor()) + return rv + + def run(self, host=None, port=None, debug=None, **options): + """Runs the application on a local development server. + + Do not use ``run()`` in a production setting. It is not intended to + meet security and performance requirements for a production server. + Instead, see :ref:`deployment` for WSGI server recommendations. + + If the :attr:`debug` flag is set the server will automatically reload + for code changes and show a debugger in case an exception happened. + + If you want to run the application in debug mode, but disable the + code execution on the interactive debugger, you can pass + ``use_evalex=False`` as parameter. This will keep the debugger's + traceback screen active, but disable code execution. + + It is not recommended to use this function for development with + automatic reloading as this is badly supported. Instead you should + be using the :command:`flask` command line script's ``run`` support. + + .. admonition:: Keep in Mind + + Flask will suppress any server error with a generic error page + unless it is in debug mode. As such to enable just the + interactive debugger without the code reloading, you have to + invoke :meth:`run` with ``debug=True`` and ``use_reloader=False``. + Setting ``use_debugger`` to ``True`` without being in debug mode + won't catch any exceptions because there won't be any to + catch. + + .. versionchanged:: 0.10 + The default port is now picked from the ``SERVER_NAME`` variable. + + :param host: the hostname to listen on. Set this to ``'0.0.0.0'`` to + have the server available externally as well. Defaults to + ``'127.0.0.1'``. + :param port: the port of the webserver. Defaults to ``5000`` or the + port defined in the ``SERVER_NAME`` config variable if + present. + :param debug: if given, enable or disable debug mode. + See :attr:`debug`. + :param options: the options to be forwarded to the underlying + Werkzeug server. See + :func:`werkzeug.serving.run_simple` for more + information. + """ + from werkzeug.serving import run_simple + if host is None: + host = '127.0.0.1' + if port is None: + server_name = self.config['SERVER_NAME'] + if server_name and ':' in server_name: + port = int(server_name.rsplit(':', 1)[1]) + else: + port = 5000 + if debug is not None: + self.debug = bool(debug) + options.setdefault('use_reloader', self.debug) + options.setdefault('use_debugger', self.debug) + try: + run_simple(host, port, self, **options) + finally: + # reset the first request information if the development server + # reset normally. This makes it possible to restart the server + # without reloader and that stuff from an interactive shell. + self._got_first_request = False + + def test_client(self, use_cookies=True, **kwargs): + """Creates a test client for this application. For information + about unit testing head over to :ref:`testing`. + + Note that if you are testing for assertions or exceptions in your + application code, you must set ``app.testing = True`` in order for the + exceptions to propagate to the test client. Otherwise, the exception + will be handled by the application (not visible to the test client) and + the only indication of an AssertionError or other exception will be a + 500 status code response to the test client. See the :attr:`testing` + attribute. For example:: + + app.testing = True + client = app.test_client() + + The test client can be used in a ``with`` block to defer the closing down + of the context until the end of the ``with`` block. This is useful if + you want to access the context locals for testing:: + + with app.test_client() as c: + rv = c.get('/?vodka=42') + assert request.args['vodka'] == '42' + + Additionally, you may pass optional keyword arguments that will then + be passed to the application's :attr:`test_client_class` constructor. + For example:: + + from flask.testing import FlaskClient + + class CustomClient(FlaskClient): + def __init__(self, *args, **kwargs): + self._authentication = kwargs.pop("authentication") + super(CustomClient,self).__init__( *args, **kwargs) + + app.test_client_class = CustomClient + client = app.test_client(authentication='Basic ....') + + See :class:`~flask.testing.FlaskClient` for more information. + + .. versionchanged:: 0.4 + added support for ``with`` block usage for the client. + + .. versionadded:: 0.7 + The `use_cookies` parameter was added as well as the ability + to override the client to be used by setting the + :attr:`test_client_class` attribute. + + .. versionchanged:: 0.11 + Added `**kwargs` to support passing additional keyword arguments to + the constructor of :attr:`test_client_class`. + """ + cls = self.test_client_class + if cls is None: + from flask.testing import FlaskClient as cls + return cls(self, self.response_class, use_cookies=use_cookies, **kwargs) + + def open_session(self, request): + """Creates or opens a new session. Default implementation stores all + session data in a signed cookie. This requires that the + :attr:`secret_key` is set. Instead of overriding this method + we recommend replacing the :class:`session_interface`. + + :param request: an instance of :attr:`request_class`. + """ + return self.session_interface.open_session(self, request) + + def save_session(self, session, response): + """Saves the session if it needs updates. For the default + implementation, check :meth:`open_session`. Instead of overriding this + method we recommend replacing the :class:`session_interface`. + + :param session: the session to be saved (a + :class:`~werkzeug.contrib.securecookie.SecureCookie` + object) + :param response: an instance of :attr:`response_class` + """ + return self.session_interface.save_session(self, session, response) + + def make_null_session(self): + """Creates a new instance of a missing session. Instead of overriding + this method we recommend replacing the :class:`session_interface`. + + .. versionadded:: 0.7 + """ + return self.session_interface.make_null_session(self) + + @setupmethod + def register_blueprint(self, blueprint, **options): + """Registers a blueprint on the application. + + .. versionadded:: 0.7 + """ + first_registration = False + if blueprint.name in self.blueprints: + assert self.blueprints[blueprint.name] is blueprint, \ + 'A blueprint\'s name collision occurred between %r and ' \ + '%r. Both share the same name "%s". Blueprints that ' \ + 'are created on the fly need unique names.' % \ + (blueprint, self.blueprints[blueprint.name], blueprint.name) + else: + self.blueprints[blueprint.name] = blueprint + self._blueprint_order.append(blueprint) + first_registration = True + blueprint.register(self, options, first_registration) + + def iter_blueprints(self): + """Iterates over all blueprints by the order they were registered. + + .. versionadded:: 0.11 + """ + return iter(self._blueprint_order) + + @setupmethod + def add_url_rule(self, rule, endpoint=None, view_func=None, **options): + """Connects a URL rule. Works exactly like the :meth:`route` + decorator. If a view_func is provided it will be registered with the + endpoint. + + Basically this example:: + + @app.route('/') + def index(): + pass + + Is equivalent to the following:: + + def index(): + pass + app.add_url_rule('/', 'index', index) + + If the view_func is not provided you will need to connect the endpoint + to a view function like so:: + + app.view_functions['index'] = index + + Internally :meth:`route` invokes :meth:`add_url_rule` so if you want + to customize the behavior via subclassing you only need to change + this method. + + For more information refer to :ref:`url-route-registrations`. + + .. versionchanged:: 0.2 + `view_func` parameter added. + + .. versionchanged:: 0.6 + ``OPTIONS`` is added automatically as method. + + :param rule: the URL rule as string + :param endpoint: the endpoint for the registered URL rule. Flask + itself assumes the name of the view function as + endpoint + :param view_func: the function to call when serving a request to the + provided endpoint + :param options: the options to be forwarded to the underlying + :class:`~werkzeug.routing.Rule` object. A change + to Werkzeug is handling of method options. methods + is a list of methods this rule should be limited + to (``GET``, ``POST`` etc.). By default a rule + just listens for ``GET`` (and implicitly ``HEAD``). + Starting with Flask 0.6, ``OPTIONS`` is implicitly + added and handled by the standard request handling. + """ + if endpoint is None: + endpoint = _endpoint_from_view_func(view_func) + options['endpoint'] = endpoint + methods = options.pop('methods', None) + + # if the methods are not given and the view_func object knows its + # methods we can use that instead. If neither exists, we go with + # a tuple of only ``GET`` as default. + if methods is None: + methods = getattr(view_func, 'methods', None) or ('GET',) + if isinstance(methods, string_types): + raise TypeError('Allowed methods have to be iterables of strings, ' + 'for example: @app.route(..., methods=["POST"])') + methods = set(item.upper() for item in methods) + + # Methods that should always be added + required_methods = set(getattr(view_func, 'required_methods', ())) + + # starting with Flask 0.8 the view_func object can disable and + # force-enable the automatic options handling. + provide_automatic_options = getattr(view_func, + 'provide_automatic_options', None) + + if provide_automatic_options is None: + if 'OPTIONS' not in methods: + provide_automatic_options = True + required_methods.add('OPTIONS') + else: + provide_automatic_options = False + + # Add the required methods now. + methods |= required_methods + + rule = self.url_rule_class(rule, methods=methods, **options) + rule.provide_automatic_options = provide_automatic_options + + self.url_map.add(rule) + if view_func is not None: + old_func = self.view_functions.get(endpoint) + if old_func is not None and old_func != view_func: + raise AssertionError('View function mapping is overwriting an ' + 'existing endpoint function: %s' % endpoint) + self.view_functions[endpoint] = view_func + + def route(self, rule, **options): + """A decorator that is used to register a view function for a + given URL rule. This does the same thing as :meth:`add_url_rule` + but is intended for decorator usage:: + + @app.route('/') + def index(): + return 'Hello World' + + For more information refer to :ref:`url-route-registrations`. + + :param rule: the URL rule as string + :param endpoint: the endpoint for the registered URL rule. Flask + itself assumes the name of the view function as + endpoint + :param options: the options to be forwarded to the underlying + :class:`~werkzeug.routing.Rule` object. A change + to Werkzeug is handling of method options. methods + is a list of methods this rule should be limited + to (``GET``, ``POST`` etc.). By default a rule + just listens for ``GET`` (and implicitly ``HEAD``). + Starting with Flask 0.6, ``OPTIONS`` is implicitly + added and handled by the standard request handling. + """ + def decorator(f): + endpoint = options.pop('endpoint', None) + self.add_url_rule(rule, endpoint, f, **options) + return f + return decorator + + @setupmethod + def endpoint(self, endpoint): + """A decorator to register a function as an endpoint. + Example:: + + @app.endpoint('example.endpoint') + def example(): + return "example" + + :param endpoint: the name of the endpoint + """ + def decorator(f): + self.view_functions[endpoint] = f + return f + return decorator + + @staticmethod + def _get_exc_class_and_code(exc_class_or_code): + """Ensure that we register only exceptions as handler keys""" + if isinstance(exc_class_or_code, integer_types): + exc_class = default_exceptions[exc_class_or_code] + else: + exc_class = exc_class_or_code + + assert issubclass(exc_class, Exception) + + if issubclass(exc_class, HTTPException): + return exc_class, exc_class.code + else: + return exc_class, None + + @setupmethod + def errorhandler(self, code_or_exception): + """A decorator that is used to register a function given an + error code. Example:: + + @app.errorhandler(404) + def page_not_found(error): + return 'This page does not exist', 404 + + You can also register handlers for arbitrary exceptions:: + + @app.errorhandler(DatabaseError) + def special_exception_handler(error): + return 'Database connection failed', 500 + + You can also register a function as error handler without using + the :meth:`errorhandler` decorator. The following example is + equivalent to the one above:: + + def page_not_found(error): + return 'This page does not exist', 404 + app.error_handler_spec[None][404] = page_not_found + + Setting error handlers via assignments to :attr:`error_handler_spec` + however is discouraged as it requires fiddling with nested dictionaries + and the special case for arbitrary exception types. + + The first ``None`` refers to the active blueprint. If the error + handler should be application wide ``None`` shall be used. + + .. versionadded:: 0.7 + Use :meth:`register_error_handler` instead of modifying + :attr:`error_handler_spec` directly, for application wide error + handlers. + + .. versionadded:: 0.7 + One can now additionally also register custom exception types + that do not necessarily have to be a subclass of the + :class:`~werkzeug.exceptions.HTTPException` class. + + :param code_or_exception: the code as integer for the handler, or + an arbitrary exception + """ + def decorator(f): + self._register_error_handler(None, code_or_exception, f) + return f + return decorator + + def register_error_handler(self, code_or_exception, f): + """Alternative error attach function to the :meth:`errorhandler` + decorator that is more straightforward to use for non decorator + usage. + + .. versionadded:: 0.7 + """ + self._register_error_handler(None, code_or_exception, f) + + @setupmethod + def _register_error_handler(self, key, code_or_exception, f): + """ + :type key: None|str + :type code_or_exception: int|T<=Exception + :type f: callable + """ + if isinstance(code_or_exception, HTTPException): # old broken behavior + raise ValueError( + 'Tried to register a handler for an exception instance {0!r}. ' + 'Handlers can only be registered for exception classes or HTTP error codes.' + .format(code_or_exception)) + + exc_class, code = self._get_exc_class_and_code(code_or_exception) + + handlers = self.error_handler_spec.setdefault(key, {}).setdefault(code, {}) + handlers[exc_class] = f + + @setupmethod + def template_filter(self, name=None): + """A decorator that is used to register custom template filter. + You can specify a name for the filter, otherwise the function + name will be used. Example:: + + @app.template_filter() + def reverse(s): + return s[::-1] + + :param name: the optional name of the filter, otherwise the + function name will be used. + """ + def decorator(f): + self.add_template_filter(f, name=name) + return f + return decorator + + @setupmethod + def add_template_filter(self, f, name=None): + """Register a custom template filter. Works exactly like the + :meth:`template_filter` decorator. + + :param name: the optional name of the filter, otherwise the + function name will be used. + """ + self.jinja_env.filters[name or f.__name__] = f + + @setupmethod + def template_test(self, name=None): + """A decorator that is used to register custom template test. + You can specify a name for the test, otherwise the function + name will be used. Example:: + + @app.template_test() + def is_prime(n): + if n == 2: + return True + for i in range(2, int(math.ceil(math.sqrt(n))) + 1): + if n % i == 0: + return False + return True + + .. versionadded:: 0.10 + + :param name: the optional name of the test, otherwise the + function name will be used. + """ + def decorator(f): + self.add_template_test(f, name=name) + return f + return decorator + + @setupmethod + def add_template_test(self, f, name=None): + """Register a custom template test. Works exactly like the + :meth:`template_test` decorator. + + .. versionadded:: 0.10 + + :param name: the optional name of the test, otherwise the + function name will be used. + """ + self.jinja_env.tests[name or f.__name__] = f + + @setupmethod + def template_global(self, name=None): + """A decorator that is used to register a custom template global function. + You can specify a name for the global function, otherwise the function + name will be used. Example:: + + @app.template_global() + def double(n): + return 2 * n + + .. versionadded:: 0.10 + + :param name: the optional name of the global function, otherwise the + function name will be used. + """ + def decorator(f): + self.add_template_global(f, name=name) + return f + return decorator + + @setupmethod + def add_template_global(self, f, name=None): + """Register a custom template global function. Works exactly like the + :meth:`template_global` decorator. + + .. versionadded:: 0.10 + + :param name: the optional name of the global function, otherwise the + function name will be used. + """ + self.jinja_env.globals[name or f.__name__] = f + + @setupmethod + def before_request(self, f): + """Registers a function to run before each request. + + The function will be called without any arguments. + If the function returns a non-None value, it's handled as + if it was the return value from the view and further + request handling is stopped. + """ + self.before_request_funcs.setdefault(None, []).append(f) + return f + + @setupmethod + def before_first_request(self, f): + """Registers a function to be run before the first request to this + instance of the application. + + The function will be called without any arguments and its return + value is ignored. + + .. versionadded:: 0.8 + """ + self.before_first_request_funcs.append(f) + return f + + @setupmethod + def after_request(self, f): + """Register a function to be run after each request. + + Your function must take one parameter, an instance of + :attr:`response_class` and return a new response object or the + same (see :meth:`process_response`). + + As of Flask 0.7 this function might not be executed at the end of the + request in case an unhandled exception occurred. + """ + self.after_request_funcs.setdefault(None, []).append(f) + return f + + @setupmethod + def teardown_request(self, f): + """Register a function to be run at the end of each request, + regardless of whether there was an exception or not. These functions + are executed when the request context is popped, even if not an + actual request was performed. + + Example:: + + ctx = app.test_request_context() + ctx.push() + ... + ctx.pop() + + When ``ctx.pop()`` is executed in the above example, the teardown + functions are called just before the request context moves from the + stack of active contexts. This becomes relevant if you are using + such constructs in tests. + + Generally teardown functions must take every necessary step to avoid + that they will fail. If they do execute code that might fail they + will have to surround the execution of these code by try/except + statements and log occurring errors. + + When a teardown function was called because of a exception it will + be passed an error object. + + The return values of teardown functions are ignored. + + .. admonition:: Debug Note + + In debug mode Flask will not tear down a request on an exception + immediately. Instead it will keep it alive so that the interactive + debugger can still access it. This behavior can be controlled + by the ``PRESERVE_CONTEXT_ON_EXCEPTION`` configuration variable. + """ + self.teardown_request_funcs.setdefault(None, []).append(f) + return f + + @setupmethod + def teardown_appcontext(self, f): + """Registers a function to be called when the application context + ends. These functions are typically also called when the request + context is popped. + + Example:: + + ctx = app.app_context() + ctx.push() + ... + ctx.pop() + + When ``ctx.pop()`` is executed in the above example, the teardown + functions are called just before the app context moves from the + stack of active contexts. This becomes relevant if you are using + such constructs in tests. + + Since a request context typically also manages an application + context it would also be called when you pop a request context. + + When a teardown function was called because of an exception it will + be passed an error object. + + The return values of teardown functions are ignored. + + .. versionadded:: 0.9 + """ + self.teardown_appcontext_funcs.append(f) + return f + + @setupmethod + def context_processor(self, f): + """Registers a template context processor function.""" + self.template_context_processors[None].append(f) + return f + + @setupmethod + def shell_context_processor(self, f): + """Registers a shell context processor function. + + .. versionadded:: 0.11 + """ + self.shell_context_processors.append(f) + return f + + @setupmethod + def url_value_preprocessor(self, f): + """Registers a function as URL value preprocessor for all view + functions of the application. It's called before the view functions + are called and can modify the url values provided. + """ + self.url_value_preprocessors.setdefault(None, []).append(f) + return f + + @setupmethod + def url_defaults(self, f): + """Callback function for URL defaults for all view functions of the + application. It's called with the endpoint and values and should + update the values passed in place. + """ + self.url_default_functions.setdefault(None, []).append(f) + return f + + def _find_error_handler(self, e): + """Finds a registered error handler for the request’s blueprint. + Otherwise falls back to the app, returns None if not a suitable + handler is found. + """ + exc_class, code = self._get_exc_class_and_code(type(e)) + + def find_handler(handler_map): + if not handler_map: + return + for cls in exc_class.__mro__: + handler = handler_map.get(cls) + if handler is not None: + # cache for next time exc_class is raised + handler_map[exc_class] = handler + return handler + + # try blueprint handlers + handler = find_handler(self.error_handler_spec + .get(request.blueprint, {}) + .get(code)) + if handler is not None: + return handler + + # fall back to app handlers + return find_handler(self.error_handler_spec[None].get(code)) + + def handle_http_exception(self, e): + """Handles an HTTP exception. By default this will invoke the + registered error handlers and fall back to returning the + exception as response. + + .. versionadded:: 0.3 + """ + # Proxy exceptions don't have error codes. We want to always return + # those unchanged as errors + if e.code is None: + return e + + handler = self._find_error_handler(e) + if handler is None: + return e + return handler(e) + + def trap_http_exception(self, e): + """Checks if an HTTP exception should be trapped or not. By default + this will return ``False`` for all exceptions except for a bad request + key error if ``TRAP_BAD_REQUEST_ERRORS`` is set to ``True``. It + also returns ``True`` if ``TRAP_HTTP_EXCEPTIONS`` is set to ``True``. + + This is called for all HTTP exceptions raised by a view function. + If it returns ``True`` for any exception the error handler for this + exception is not called and it shows up as regular exception in the + traceback. This is helpful for debugging implicitly raised HTTP + exceptions. + + .. versionadded:: 0.8 + """ + if self.config['TRAP_HTTP_EXCEPTIONS']: + return True + if self.config['TRAP_BAD_REQUEST_ERRORS']: + return isinstance(e, BadRequest) + return False + + def handle_user_exception(self, e): + """This method is called whenever an exception occurs that should be + handled. A special case are + :class:`~werkzeug.exception.HTTPException`\s which are forwarded by + this function to the :meth:`handle_http_exception` method. This + function will either return a response value or reraise the + exception with the same traceback. + + .. versionadded:: 0.7 + """ + exc_type, exc_value, tb = sys.exc_info() + assert exc_value is e + + # ensure not to trash sys.exc_info() at that point in case someone + # wants the traceback preserved in handle_http_exception. Of course + # we cannot prevent users from trashing it themselves in a custom + # trap_http_exception method so that's their fault then. + + if isinstance(e, HTTPException) and not self.trap_http_exception(e): + return self.handle_http_exception(e) + + handler = self._find_error_handler(e) + + if handler is None: + reraise(exc_type, exc_value, tb) + return handler(e) + + def handle_exception(self, e): + """Default exception handling that kicks in when an exception + occurs that is not caught. In debug mode the exception will + be re-raised immediately, otherwise it is logged and the handler + for a 500 internal server error is used. If no such handler + exists, a default 500 internal server error message is displayed. + + .. versionadded:: 0.3 + """ + exc_type, exc_value, tb = sys.exc_info() + + got_request_exception.send(self, exception=e) + handler = self._find_error_handler(InternalServerError()) + + if self.propagate_exceptions: + # if we want to repropagate the exception, we can attempt to + # raise it with the whole traceback in case we can do that + # (the function was actually called from the except part) + # otherwise, we just raise the error again + if exc_value is e: + reraise(exc_type, exc_value, tb) + else: + raise e + + self.log_exception((exc_type, exc_value, tb)) + if handler is None: + return InternalServerError() + return self.finalize_request(handler(e), from_error_handler=True) + + def log_exception(self, exc_info): + """Logs an exception. This is called by :meth:`handle_exception` + if debugging is disabled and right before the handler is called. + The default implementation logs the exception as error on the + :attr:`logger`. + + .. versionadded:: 0.8 + """ + self.logger.error('Exception on %s [%s]' % ( + request.path, + request.method + ), exc_info=exc_info) + + def raise_routing_exception(self, request): + """Exceptions that are recording during routing are reraised with + this method. During debug we are not reraising redirect requests + for non ``GET``, ``HEAD``, or ``OPTIONS`` requests and we're raising + a different error instead to help debug situations. + + :internal: + """ + if not self.debug \ + or not isinstance(request.routing_exception, RequestRedirect) \ + or request.method in ('GET', 'HEAD', 'OPTIONS'): + raise request.routing_exception + + from .debughelpers import FormDataRoutingRedirect + raise FormDataRoutingRedirect(request) + + def dispatch_request(self): + """Does the request dispatching. Matches the URL and returns the + return value of the view or error handler. This does not have to + be a response object. In order to convert the return value to a + proper response object, call :func:`make_response`. + + .. versionchanged:: 0.7 + This no longer does the exception handling, this code was + moved to the new :meth:`full_dispatch_request`. + """ + req = _request_ctx_stack.top.request + if req.routing_exception is not None: + self.raise_routing_exception(req) + rule = req.url_rule + # if we provide automatic options for this URL and the + # request came with the OPTIONS method, reply automatically + if getattr(rule, 'provide_automatic_options', False) \ + and req.method == 'OPTIONS': + return self.make_default_options_response() + # otherwise dispatch to the handler for that endpoint + return self.view_functions[rule.endpoint](**req.view_args) + + def full_dispatch_request(self): + """Dispatches the request and on top of that performs request + pre and postprocessing as well as HTTP exception catching and + error handling. + + .. versionadded:: 0.7 + """ + self.try_trigger_before_first_request_functions() + try: + request_started.send(self) + rv = self.preprocess_request() + if rv is None: + rv = self.dispatch_request() + except Exception as e: + rv = self.handle_user_exception(e) + return self.finalize_request(rv) + + def finalize_request(self, rv, from_error_handler=False): + """Given the return value from a view function this finalizes + the request by converting it into a response and invoking the + postprocessing functions. This is invoked for both normal + request dispatching as well as error handlers. + + Because this means that it might be called as a result of a + failure a special safe mode is available which can be enabled + with the `from_error_handler` flag. If enabled, failures in + response processing will be logged and otherwise ignored. + + :internal: + """ + response = self.make_response(rv) + try: + response = self.process_response(response) + request_finished.send(self, response=response) + except Exception: + if not from_error_handler: + raise + self.logger.exception('Request finalizing failed with an ' + 'error while handling an error') + return response + + def try_trigger_before_first_request_functions(self): + """Called before each request and will ensure that it triggers + the :attr:`before_first_request_funcs` and only exactly once per + application instance (which means process usually). + + :internal: + """ + if self._got_first_request: + return + with self._before_request_lock: + if self._got_first_request: + return + for func in self.before_first_request_funcs: + func() + self._got_first_request = True + + def make_default_options_response(self): + """This method is called to create the default ``OPTIONS`` response. + This can be changed through subclassing to change the default + behavior of ``OPTIONS`` responses. + + .. versionadded:: 0.7 + """ + adapter = _request_ctx_stack.top.url_adapter + if hasattr(adapter, 'allowed_methods'): + methods = adapter.allowed_methods() + else: + # fallback for Werkzeug < 0.7 + methods = [] + try: + adapter.match(method='--') + except MethodNotAllowed as e: + methods = e.valid_methods + except HTTPException as e: + pass + rv = self.response_class() + rv.allow.update(methods) + return rv + + def should_ignore_error(self, error): + """This is called to figure out if an error should be ignored + or not as far as the teardown system is concerned. If this + function returns ``True`` then the teardown handlers will not be + passed the error. + + .. versionadded:: 0.10 + """ + return False + + def make_response(self, rv): + """Converts the return value from a view function to a real + response object that is an instance of :attr:`response_class`. + + The following types are allowed for `rv`: + + .. tabularcolumns:: |p{3.5cm}|p{9.5cm}| + + ======================= =========================================== + :attr:`response_class` the object is returned unchanged + :class:`str` a response object is created with the + string as body + :class:`unicode` a response object is created with the + string encoded to utf-8 as body + a WSGI function the function is called as WSGI application + and buffered as response object + :class:`tuple` A tuple in the form ``(response, status, + headers)`` or ``(response, headers)`` + where `response` is any of the + types defined here, `status` is a string + or an integer and `headers` is a list or + a dictionary with header values. + ======================= =========================================== + + :param rv: the return value from the view function + + .. versionchanged:: 0.9 + Previously a tuple was interpreted as the arguments for the + response object. + """ + status_or_headers = headers = None + if isinstance(rv, tuple): + rv, status_or_headers, headers = rv + (None,) * (3 - len(rv)) + + if rv is None: + raise ValueError('View function did not return a response') + + if isinstance(status_or_headers, (dict, list)): + headers, status_or_headers = status_or_headers, None + + if not isinstance(rv, self.response_class): + # When we create a response object directly, we let the constructor + # set the headers and status. We do this because there can be + # some extra logic involved when creating these objects with + # specific values (like default content type selection). + if isinstance(rv, (text_type, bytes, bytearray)): + rv = self.response_class(rv, headers=headers, + status=status_or_headers) + headers = status_or_headers = None + else: + rv = self.response_class.force_type(rv, request.environ) + + if status_or_headers is not None: + if isinstance(status_or_headers, string_types): + rv.status = status_or_headers + else: + rv.status_code = status_or_headers + if headers: + rv.headers.extend(headers) + + return rv + + def create_url_adapter(self, request): + """Creates a URL adapter for the given request. The URL adapter + is created at a point where the request context is not yet set up + so the request is passed explicitly. + + .. versionadded:: 0.6 + + .. versionchanged:: 0.9 + This can now also be called without a request object when the + URL adapter is created for the application context. + """ + if request is not None: + return self.url_map.bind_to_environ(request.environ, + server_name=self.config['SERVER_NAME']) + # We need at the very least the server name to be set for this + # to work. + if self.config['SERVER_NAME'] is not None: + return self.url_map.bind( + self.config['SERVER_NAME'], + script_name=self.config['APPLICATION_ROOT'] or '/', + url_scheme=self.config['PREFERRED_URL_SCHEME']) + + def inject_url_defaults(self, endpoint, values): + """Injects the URL defaults for the given endpoint directly into + the values dictionary passed. This is used internally and + automatically called on URL building. + + .. versionadded:: 0.7 + """ + funcs = self.url_default_functions.get(None, ()) + if '.' in endpoint: + bp = endpoint.rsplit('.', 1)[0] + funcs = chain(funcs, self.url_default_functions.get(bp, ())) + for func in funcs: + func(endpoint, values) + + def handle_url_build_error(self, error, endpoint, values): + """Handle :class:`~werkzeug.routing.BuildError` on :meth:`url_for`. + """ + exc_type, exc_value, tb = sys.exc_info() + for handler in self.url_build_error_handlers: + try: + rv = handler(error, endpoint, values) + if rv is not None: + return rv + except BuildError as e: + # make error available outside except block (py3) + error = e + + # At this point we want to reraise the exception. If the error is + # still the same one we can reraise it with the original traceback, + # otherwise we raise it from here. + if error is exc_value: + reraise(exc_type, exc_value, tb) + raise error + + def preprocess_request(self): + """Called before the actual request dispatching and will + call each :meth:`before_request` decorated function, passing no + arguments. + If any of these functions returns a value, it's handled as + if it was the return value from the view and further + request handling is stopped. + + This also triggers the :meth:`url_value_preprocessor` functions before + the actual :meth:`before_request` functions are called. + """ + bp = _request_ctx_stack.top.request.blueprint + + funcs = self.url_value_preprocessors.get(None, ()) + if bp is not None and bp in self.url_value_preprocessors: + funcs = chain(funcs, self.url_value_preprocessors[bp]) + for func in funcs: + func(request.endpoint, request.view_args) + + funcs = self.before_request_funcs.get(None, ()) + if bp is not None and bp in self.before_request_funcs: + funcs = chain(funcs, self.before_request_funcs[bp]) + for func in funcs: + rv = func() + if rv is not None: + return rv + + def process_response(self, response): + """Can be overridden in order to modify the response object + before it's sent to the WSGI server. By default this will + call all the :meth:`after_request` decorated functions. + + .. versionchanged:: 0.5 + As of Flask 0.5 the functions registered for after request + execution are called in reverse order of registration. + + :param response: a :attr:`response_class` object. + :return: a new response object or the same, has to be an + instance of :attr:`response_class`. + """ + ctx = _request_ctx_stack.top + bp = ctx.request.blueprint + funcs = ctx._after_request_functions + if bp is not None and bp in self.after_request_funcs: + funcs = chain(funcs, reversed(self.after_request_funcs[bp])) + if None in self.after_request_funcs: + funcs = chain(funcs, reversed(self.after_request_funcs[None])) + for handler in funcs: + response = handler(response) + if not self.session_interface.is_null_session(ctx.session): + self.save_session(ctx.session, response) + return response + + def do_teardown_request(self, exc=_sentinel): + """Called after the actual request dispatching and will + call every as :meth:`teardown_request` decorated function. This is + not actually called by the :class:`Flask` object itself but is always + triggered when the request context is popped. That way we have a + tighter control over certain resources under testing environments. + + .. versionchanged:: 0.9 + Added the `exc` argument. Previously this was always using the + current exception information. + """ + if exc is _sentinel: + exc = sys.exc_info()[1] + funcs = reversed(self.teardown_request_funcs.get(None, ())) + bp = _request_ctx_stack.top.request.blueprint + if bp is not None and bp in self.teardown_request_funcs: + funcs = chain(funcs, reversed(self.teardown_request_funcs[bp])) + for func in funcs: + func(exc) + request_tearing_down.send(self, exc=exc) + + def do_teardown_appcontext(self, exc=_sentinel): + """Called when an application context is popped. This works pretty + much the same as :meth:`do_teardown_request` but for the application + context. + + .. versionadded:: 0.9 + """ + if exc is _sentinel: + exc = sys.exc_info()[1] + for func in reversed(self.teardown_appcontext_funcs): + func(exc) + appcontext_tearing_down.send(self, exc=exc) + + def app_context(self): + """Binds the application only. For as long as the application is bound + to the current context the :data:`flask.current_app` points to that + application. An application context is automatically created when a + request context is pushed if necessary. + + Example usage:: + + with app.app_context(): + ... + + .. versionadded:: 0.9 + """ + return AppContext(self) + + def request_context(self, environ): + """Creates a :class:`~flask.ctx.RequestContext` from the given + environment and binds it to the current context. This must be used in + combination with the ``with`` statement because the request is only bound + to the current context for the duration of the ``with`` block. + + Example usage:: + + with app.request_context(environ): + do_something_with(request) + + The object returned can also be used without the ``with`` statement + which is useful for working in the shell. The example above is + doing exactly the same as this code:: + + ctx = app.request_context(environ) + ctx.push() + try: + do_something_with(request) + finally: + ctx.pop() + + .. versionchanged:: 0.3 + Added support for non-with statement usage and ``with`` statement + is now passed the ctx object. + + :param environ: a WSGI environment + """ + return RequestContext(self, environ) + + def test_request_context(self, *args, **kwargs): + """Creates a WSGI environment from the given values (see + :class:`werkzeug.test.EnvironBuilder` for more information, this + function accepts the same arguments). + """ + from flask.testing import make_test_environ_builder + builder = make_test_environ_builder(self, *args, **kwargs) + try: + return self.request_context(builder.get_environ()) + finally: + builder.close() + + def wsgi_app(self, environ, start_response): + """The actual WSGI application. This is not implemented in + `__call__` so that middlewares can be applied without losing a + reference to the class. So instead of doing this:: + + app = MyMiddleware(app) + + It's a better idea to do this instead:: + + app.wsgi_app = MyMiddleware(app.wsgi_app) + + Then you still have the original application object around and + can continue to call methods on it. + + .. versionchanged:: 0.7 + The behavior of the before and after request callbacks was changed + under error conditions and a new callback was added that will + always execute at the end of the request, independent on if an + error occurred or not. See :ref:`callbacks-and-errors`. + + :param environ: a WSGI environment + :param start_response: a callable accepting a status code, + a list of headers and an optional + exception context to start the response + """ + ctx = self.request_context(environ) + ctx.push() + error = None + try: + try: + response = self.full_dispatch_request() + except Exception as e: + error = e + response = self.handle_exception(e) + except: + error = sys.exc_info()[1] + raise + return response(environ, start_response) + finally: + if self.should_ignore_error(error): + error = None + ctx.auto_pop(error) + + def __call__(self, environ, start_response): + """Shortcut for :attr:`wsgi_app`.""" + return self.wsgi_app(environ, start_response) + + def __repr__(self): + return '<%s %r>' % ( + self.__class__.__name__, + self.name, + ) diff --git a/website/web/Lib/site-packages/flask/blueprints.py b/website/web/Lib/site-packages/flask/blueprints.py new file mode 100644 index 000000000..586a1b0b1 --- /dev/null +++ b/website/web/Lib/site-packages/flask/blueprints.py @@ -0,0 +1,413 @@ +# -*- coding: utf-8 -*- +""" + flask.blueprints + ~~~~~~~~~~~~~~~~ + + Blueprints are the recommended way to implement larger or more + pluggable applications in Flask 0.7 and later. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +from functools import update_wrapper + +from .helpers import _PackageBoundObject, _endpoint_from_view_func + + +class BlueprintSetupState(object): + """Temporary holder object for registering a blueprint with the + application. An instance of this class is created by the + :meth:`~flask.Blueprint.make_setup_state` method and later passed + to all register callback functions. + """ + + def __init__(self, blueprint, app, options, first_registration): + #: a reference to the current application + self.app = app + + #: a reference to the blueprint that created this setup state. + self.blueprint = blueprint + + #: a dictionary with all options that were passed to the + #: :meth:`~flask.Flask.register_blueprint` method. + self.options = options + + #: as blueprints can be registered multiple times with the + #: application and not everything wants to be registered + #: multiple times on it, this attribute can be used to figure + #: out if the blueprint was registered in the past already. + self.first_registration = first_registration + + subdomain = self.options.get('subdomain') + if subdomain is None: + subdomain = self.blueprint.subdomain + + #: The subdomain that the blueprint should be active for, ``None`` + #: otherwise. + self.subdomain = subdomain + + url_prefix = self.options.get('url_prefix') + if url_prefix is None: + url_prefix = self.blueprint.url_prefix + + #: The prefix that should be used for all URLs defined on the + #: blueprint. + self.url_prefix = url_prefix + + #: A dictionary with URL defaults that is added to each and every + #: URL that was defined with the blueprint. + self.url_defaults = dict(self.blueprint.url_values_defaults) + self.url_defaults.update(self.options.get('url_defaults', ())) + + def add_url_rule(self, rule, endpoint=None, view_func=None, **options): + """A helper method to register a rule (and optionally a view function) + to the application. The endpoint is automatically prefixed with the + blueprint's name. + """ + if self.url_prefix: + rule = self.url_prefix + rule + options.setdefault('subdomain', self.subdomain) + if endpoint is None: + endpoint = _endpoint_from_view_func(view_func) + defaults = self.url_defaults + if 'defaults' in options: + defaults = dict(defaults, **options.pop('defaults')) + self.app.add_url_rule(rule, '%s.%s' % (self.blueprint.name, endpoint), + view_func, defaults=defaults, **options) + + +class Blueprint(_PackageBoundObject): + """Represents a blueprint. A blueprint is an object that records + functions that will be called with the + :class:`~flask.blueprints.BlueprintSetupState` later to register functions + or other things on the main application. See :ref:`blueprints` for more + information. + + .. versionadded:: 0.7 + """ + + warn_on_modifications = False + _got_registered_once = False + + def __init__(self, name, import_name, static_folder=None, + static_url_path=None, template_folder=None, + url_prefix=None, subdomain=None, url_defaults=None, + root_path=None): + _PackageBoundObject.__init__(self, import_name, template_folder, + root_path=root_path) + self.name = name + self.url_prefix = url_prefix + self.subdomain = subdomain + self.static_folder = static_folder + self.static_url_path = static_url_path + self.deferred_functions = [] + if url_defaults is None: + url_defaults = {} + self.url_values_defaults = url_defaults + + def record(self, func): + """Registers a function that is called when the blueprint is + registered on the application. This function is called with the + state as argument as returned by the :meth:`make_setup_state` + method. + """ + if self._got_registered_once and self.warn_on_modifications: + from warnings import warn + warn(Warning('The blueprint was already registered once ' + 'but is getting modified now. These changes ' + 'will not show up.')) + self.deferred_functions.append(func) + + def record_once(self, func): + """Works like :meth:`record` but wraps the function in another + function that will ensure the function is only called once. If the + blueprint is registered a second time on the application, the + function passed is not called. + """ + def wrapper(state): + if state.first_registration: + func(state) + return self.record(update_wrapper(wrapper, func)) + + def make_setup_state(self, app, options, first_registration=False): + """Creates an instance of :meth:`~flask.blueprints.BlueprintSetupState` + object that is later passed to the register callback functions. + Subclasses can override this to return a subclass of the setup state. + """ + return BlueprintSetupState(self, app, options, first_registration) + + def register(self, app, options, first_registration=False): + """Called by :meth:`Flask.register_blueprint` to register a blueprint + on the application. This can be overridden to customize the register + behavior. Keyword arguments from + :func:`~flask.Flask.register_blueprint` are directly forwarded to this + method in the `options` dictionary. + """ + self._got_registered_once = True + state = self.make_setup_state(app, options, first_registration) + if self.has_static_folder: + state.add_url_rule(self.static_url_path + '/', + view_func=self.send_static_file, + endpoint='static') + + for deferred in self.deferred_functions: + deferred(state) + + def route(self, rule, **options): + """Like :meth:`Flask.route` but for a blueprint. The endpoint for the + :func:`url_for` function is prefixed with the name of the blueprint. + """ + def decorator(f): + endpoint = options.pop("endpoint", f.__name__) + self.add_url_rule(rule, endpoint, f, **options) + return f + return decorator + + def add_url_rule(self, rule, endpoint=None, view_func=None, **options): + """Like :meth:`Flask.add_url_rule` but for a blueprint. The endpoint for + the :func:`url_for` function is prefixed with the name of the blueprint. + """ + if endpoint: + assert '.' not in endpoint, "Blueprint endpoints should not contain dots" + self.record(lambda s: + s.add_url_rule(rule, endpoint, view_func, **options)) + + def endpoint(self, endpoint): + """Like :meth:`Flask.endpoint` but for a blueprint. This does not + prefix the endpoint with the blueprint name, this has to be done + explicitly by the user of this method. If the endpoint is prefixed + with a `.` it will be registered to the current blueprint, otherwise + it's an application independent endpoint. + """ + def decorator(f): + def register_endpoint(state): + state.app.view_functions[endpoint] = f + self.record_once(register_endpoint) + return f + return decorator + + def app_template_filter(self, name=None): + """Register a custom template filter, available application wide. Like + :meth:`Flask.template_filter` but for a blueprint. + + :param name: the optional name of the filter, otherwise the + function name will be used. + """ + def decorator(f): + self.add_app_template_filter(f, name=name) + return f + return decorator + + def add_app_template_filter(self, f, name=None): + """Register a custom template filter, available application wide. Like + :meth:`Flask.add_template_filter` but for a blueprint. Works exactly + like the :meth:`app_template_filter` decorator. + + :param name: the optional name of the filter, otherwise the + function name will be used. + """ + def register_template(state): + state.app.jinja_env.filters[name or f.__name__] = f + self.record_once(register_template) + + def app_template_test(self, name=None): + """Register a custom template test, available application wide. Like + :meth:`Flask.template_test` but for a blueprint. + + .. versionadded:: 0.10 + + :param name: the optional name of the test, otherwise the + function name will be used. + """ + def decorator(f): + self.add_app_template_test(f, name=name) + return f + return decorator + + def add_app_template_test(self, f, name=None): + """Register a custom template test, available application wide. Like + :meth:`Flask.add_template_test` but for a blueprint. Works exactly + like the :meth:`app_template_test` decorator. + + .. versionadded:: 0.10 + + :param name: the optional name of the test, otherwise the + function name will be used. + """ + def register_template(state): + state.app.jinja_env.tests[name or f.__name__] = f + self.record_once(register_template) + + def app_template_global(self, name=None): + """Register a custom template global, available application wide. Like + :meth:`Flask.template_global` but for a blueprint. + + .. versionadded:: 0.10 + + :param name: the optional name of the global, otherwise the + function name will be used. + """ + def decorator(f): + self.add_app_template_global(f, name=name) + return f + return decorator + + def add_app_template_global(self, f, name=None): + """Register a custom template global, available application wide. Like + :meth:`Flask.add_template_global` but for a blueprint. Works exactly + like the :meth:`app_template_global` decorator. + + .. versionadded:: 0.10 + + :param name: the optional name of the global, otherwise the + function name will be used. + """ + def register_template(state): + state.app.jinja_env.globals[name or f.__name__] = f + self.record_once(register_template) + + def before_request(self, f): + """Like :meth:`Flask.before_request` but for a blueprint. This function + is only executed before each request that is handled by a function of + that blueprint. + """ + self.record_once(lambda s: s.app.before_request_funcs + .setdefault(self.name, []).append(f)) + return f + + def before_app_request(self, f): + """Like :meth:`Flask.before_request`. Such a function is executed + before each request, even if outside of a blueprint. + """ + self.record_once(lambda s: s.app.before_request_funcs + .setdefault(None, []).append(f)) + return f + + def before_app_first_request(self, f): + """Like :meth:`Flask.before_first_request`. Such a function is + executed before the first request to the application. + """ + self.record_once(lambda s: s.app.before_first_request_funcs.append(f)) + return f + + def after_request(self, f): + """Like :meth:`Flask.after_request` but for a blueprint. This function + is only executed after each request that is handled by a function of + that blueprint. + """ + self.record_once(lambda s: s.app.after_request_funcs + .setdefault(self.name, []).append(f)) + return f + + def after_app_request(self, f): + """Like :meth:`Flask.after_request` but for a blueprint. Such a function + is executed after each request, even if outside of the blueprint. + """ + self.record_once(lambda s: s.app.after_request_funcs + .setdefault(None, []).append(f)) + return f + + def teardown_request(self, f): + """Like :meth:`Flask.teardown_request` but for a blueprint. This + function is only executed when tearing down requests handled by a + function of that blueprint. Teardown request functions are executed + when the request context is popped, even when no actual request was + performed. + """ + self.record_once(lambda s: s.app.teardown_request_funcs + .setdefault(self.name, []).append(f)) + return f + + def teardown_app_request(self, f): + """Like :meth:`Flask.teardown_request` but for a blueprint. Such a + function is executed when tearing down each request, even if outside of + the blueprint. + """ + self.record_once(lambda s: s.app.teardown_request_funcs + .setdefault(None, []).append(f)) + return f + + def context_processor(self, f): + """Like :meth:`Flask.context_processor` but for a blueprint. This + function is only executed for requests handled by a blueprint. + """ + self.record_once(lambda s: s.app.template_context_processors + .setdefault(self.name, []).append(f)) + return f + + def app_context_processor(self, f): + """Like :meth:`Flask.context_processor` but for a blueprint. Such a + function is executed each request, even if outside of the blueprint. + """ + self.record_once(lambda s: s.app.template_context_processors + .setdefault(None, []).append(f)) + return f + + def app_errorhandler(self, code): + """Like :meth:`Flask.errorhandler` but for a blueprint. This + handler is used for all requests, even if outside of the blueprint. + """ + def decorator(f): + self.record_once(lambda s: s.app.errorhandler(code)(f)) + return f + return decorator + + def url_value_preprocessor(self, f): + """Registers a function as URL value preprocessor for this + blueprint. It's called before the view functions are called and + can modify the url values provided. + """ + self.record_once(lambda s: s.app.url_value_preprocessors + .setdefault(self.name, []).append(f)) + return f + + def url_defaults(self, f): + """Callback function for URL defaults for this blueprint. It's called + with the endpoint and values and should update the values passed + in place. + """ + self.record_once(lambda s: s.app.url_default_functions + .setdefault(self.name, []).append(f)) + return f + + def app_url_value_preprocessor(self, f): + """Same as :meth:`url_value_preprocessor` but application wide. + """ + self.record_once(lambda s: s.app.url_value_preprocessors + .setdefault(None, []).append(f)) + return f + + def app_url_defaults(self, f): + """Same as :meth:`url_defaults` but application wide. + """ + self.record_once(lambda s: s.app.url_default_functions + .setdefault(None, []).append(f)) + return f + + def errorhandler(self, code_or_exception): + """Registers an error handler that becomes active for this blueprint + only. Please be aware that routing does not happen local to a + blueprint so an error handler for 404 usually is not handled by + a blueprint unless it is caused inside a view function. Another + special case is the 500 internal server error which is always looked + up from the application. + + Otherwise works as the :meth:`~flask.Flask.errorhandler` decorator + of the :class:`~flask.Flask` object. + """ + def decorator(f): + self.record_once(lambda s: s.app._register_error_handler( + self.name, code_or_exception, f)) + return f + return decorator + + def register_error_handler(self, code_or_exception, f): + """Non-decorator version of the :meth:`errorhandler` error attach + function, akin to the :meth:`~flask.Flask.register_error_handler` + application-wide function of the :class:`~flask.Flask` object but + for error handlers limited to this blueprint. + + .. versionadded:: 0.11 + """ + self.record_once(lambda s: s.app._register_error_handler( + self.name, code_or_exception, f)) diff --git a/website/web/Lib/site-packages/flask/cli.py b/website/web/Lib/site-packages/flask/cli.py new file mode 100644 index 000000000..074ee7687 --- /dev/null +++ b/website/web/Lib/site-packages/flask/cli.py @@ -0,0 +1,517 @@ +# -*- coding: utf-8 -*- +""" + flask.cli + ~~~~~~~~~ + + A simple command line application to run flask apps. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +import os +import sys +from threading import Lock, Thread +from functools import update_wrapper + +import click + +from ._compat import iteritems, reraise +from .helpers import get_debug_flag +from . import __version__ + +class NoAppException(click.UsageError): + """Raised if an application cannot be found or loaded.""" + + +def find_best_app(module): + """Given a module instance this tries to find the best possible + application in the module or raises an exception. + """ + from . import Flask + + # Search for the most common names first. + for attr_name in 'app', 'application': + app = getattr(module, attr_name, None) + if app is not None and isinstance(app, Flask): + return app + + # Otherwise find the only object that is a Flask instance. + matches = [v for k, v in iteritems(module.__dict__) + if isinstance(v, Flask)] + + if len(matches) == 1: + return matches[0] + raise NoAppException('Failed to find application in module "%s". Are ' + 'you sure it contains a Flask application? Maybe ' + 'you wrapped it in a WSGI middleware or you are ' + 'using a factory function.' % module.__name__) + + +def prepare_exec_for_file(filename): + """Given a filename this will try to calculate the python path, add it + to the search path and return the actual module name that is expected. + """ + module = [] + + # Chop off file extensions or package markers + if os.path.split(filename)[1] == '__init__.py': + filename = os.path.dirname(filename) + elif filename.endswith('.py'): + filename = filename[:-3] + else: + raise NoAppException('The file provided (%s) does exist but is not a ' + 'valid Python file. This means that it cannot ' + 'be used as application. Please change the ' + 'extension to .py' % filename) + filename = os.path.realpath(filename) + + dirpath = filename + while 1: + dirpath, extra = os.path.split(dirpath) + module.append(extra) + if not os.path.isfile(os.path.join(dirpath, '__init__.py')): + break + + sys.path.insert(0, dirpath) + return '.'.join(module[::-1]) + + +def locate_app(app_id): + """Attempts to locate the application.""" + __traceback_hide__ = True + if ':' in app_id: + module, app_obj = app_id.split(':', 1) + else: + module = app_id + app_obj = None + + try: + __import__(module) + except ImportError: + # Reraise the ImportError if it occurred within the imported module. + # Determine this by checking whether the trace has a depth > 1. + if sys.exc_info()[-1].tb_next: + raise + else: + raise NoAppException('The file/path provided (%s) does not appear' + ' to exist. Please verify the path is ' + 'correct. If app is not on PYTHONPATH, ' + 'ensure the extension is .py' % module) + + mod = sys.modules[module] + if app_obj is None: + app = find_best_app(mod) + else: + app = getattr(mod, app_obj, None) + if app is None: + raise RuntimeError('Failed to find application in module "%s"' + % module) + + return app + + +def find_default_import_path(): + app = os.environ.get('FLASK_APP') + if app is None: + return + if os.path.isfile(app): + return prepare_exec_for_file(app) + return app + + +def get_version(ctx, param, value): + if not value or ctx.resilient_parsing: + return + message = 'Flask %(version)s\nPython %(python_version)s' + click.echo(message % { + 'version': __version__, + 'python_version': sys.version, + }, color=ctx.color) + ctx.exit() + +version_option = click.Option(['--version'], + help='Show the flask version', + expose_value=False, + callback=get_version, + is_flag=True, is_eager=True) + +class DispatchingApp(object): + """Special application that dispatches to a Flask application which + is imported by name in a background thread. If an error happens + it is recorded and shown as part of the WSGI handling which in case + of the Werkzeug debugger means that it shows up in the browser. + """ + + def __init__(self, loader, use_eager_loading=False): + self.loader = loader + self._app = None + self._lock = Lock() + self._bg_loading_exc_info = None + if use_eager_loading: + self._load_unlocked() + else: + self._load_in_background() + + def _load_in_background(self): + def _load_app(): + __traceback_hide__ = True + with self._lock: + try: + self._load_unlocked() + except Exception: + self._bg_loading_exc_info = sys.exc_info() + t = Thread(target=_load_app, args=()) + t.start() + + def _flush_bg_loading_exception(self): + __traceback_hide__ = True + exc_info = self._bg_loading_exc_info + if exc_info is not None: + self._bg_loading_exc_info = None + reraise(*exc_info) + + def _load_unlocked(self): + __traceback_hide__ = True + self._app = rv = self.loader() + self._bg_loading_exc_info = None + return rv + + def __call__(self, environ, start_response): + __traceback_hide__ = True + if self._app is not None: + return self._app(environ, start_response) + self._flush_bg_loading_exception() + with self._lock: + if self._app is not None: + rv = self._app + else: + rv = self._load_unlocked() + return rv(environ, start_response) + + +class ScriptInfo(object): + """Help object to deal with Flask applications. This is usually not + necessary to interface with as it's used internally in the dispatching + to click. In future versions of Flask this object will most likely play + a bigger role. Typically it's created automatically by the + :class:`FlaskGroup` but you can also manually create it and pass it + onwards as click object. + """ + + def __init__(self, app_import_path=None, create_app=None): + if create_app is None: + if app_import_path is None: + app_import_path = find_default_import_path() + self.app_import_path = app_import_path + else: + app_import_path = None + + #: Optionally the import path for the Flask application. + self.app_import_path = app_import_path + #: Optionally a function that is passed the script info to create + #: the instance of the application. + self.create_app = create_app + #: A dictionary with arbitrary data that can be associated with + #: this script info. + self.data = {} + self._loaded_app = None + + def load_app(self): + """Loads the Flask app (if not yet loaded) and returns it. Calling + this multiple times will just result in the already loaded app to + be returned. + """ + __traceback_hide__ = True + if self._loaded_app is not None: + return self._loaded_app + if self.create_app is not None: + rv = self.create_app(self) + else: + if not self.app_import_path: + raise NoAppException( + 'Could not locate Flask application. You did not provide ' + 'the FLASK_APP environment variable.\n\nFor more ' + 'information see ' + 'http://flask.pocoo.org/docs/latest/quickstart/') + rv = locate_app(self.app_import_path) + debug = get_debug_flag() + if debug is not None: + rv.debug = debug + self._loaded_app = rv + return rv + + +pass_script_info = click.make_pass_decorator(ScriptInfo, ensure=True) + + +def with_appcontext(f): + """Wraps a callback so that it's guaranteed to be executed with the + script's application context. If callbacks are registered directly + to the ``app.cli`` object then they are wrapped with this function + by default unless it's disabled. + """ + @click.pass_context + def decorator(__ctx, *args, **kwargs): + with __ctx.ensure_object(ScriptInfo).load_app().app_context(): + return __ctx.invoke(f, *args, **kwargs) + return update_wrapper(decorator, f) + + +class AppGroup(click.Group): + """This works similar to a regular click :class:`~click.Group` but it + changes the behavior of the :meth:`command` decorator so that it + automatically wraps the functions in :func:`with_appcontext`. + + Not to be confused with :class:`FlaskGroup`. + """ + + def command(self, *args, **kwargs): + """This works exactly like the method of the same name on a regular + :class:`click.Group` but it wraps callbacks in :func:`with_appcontext` + unless it's disabled by passing ``with_appcontext=False``. + """ + wrap_for_ctx = kwargs.pop('with_appcontext', True) + def decorator(f): + if wrap_for_ctx: + f = with_appcontext(f) + return click.Group.command(self, *args, **kwargs)(f) + return decorator + + def group(self, *args, **kwargs): + """This works exactly like the method of the same name on a regular + :class:`click.Group` but it defaults the group class to + :class:`AppGroup`. + """ + kwargs.setdefault('cls', AppGroup) + return click.Group.group(self, *args, **kwargs) + + +class FlaskGroup(AppGroup): + """Special subclass of the :class:`AppGroup` group that supports + loading more commands from the configured Flask app. Normally a + developer does not have to interface with this class but there are + some very advanced use cases for which it makes sense to create an + instance of this. + + For information as of why this is useful see :ref:`custom-scripts`. + + :param add_default_commands: if this is True then the default run and + shell commands wil be added. + :param add_version_option: adds the ``--version`` option. + :param create_app: an optional callback that is passed the script info + and returns the loaded app. + """ + + def __init__(self, add_default_commands=True, create_app=None, + add_version_option=True, **extra): + params = list(extra.pop('params', None) or ()) + + if add_version_option: + params.append(version_option) + + AppGroup.__init__(self, params=params, **extra) + self.create_app = create_app + + if add_default_commands: + self.add_command(run_command) + self.add_command(shell_command) + + self._loaded_plugin_commands = False + + def _load_plugin_commands(self): + if self._loaded_plugin_commands: + return + try: + import pkg_resources + except ImportError: + self._loaded_plugin_commands = True + return + + for ep in pkg_resources.iter_entry_points('flask.commands'): + self.add_command(ep.load(), ep.name) + self._loaded_plugin_commands = True + + def get_command(self, ctx, name): + self._load_plugin_commands() + + # We load built-in commands first as these should always be the + # same no matter what the app does. If the app does want to + # override this it needs to make a custom instance of this group + # and not attach the default commands. + # + # This also means that the script stays functional in case the + # application completely fails. + rv = AppGroup.get_command(self, ctx, name) + if rv is not None: + return rv + + info = ctx.ensure_object(ScriptInfo) + try: + rv = info.load_app().cli.get_command(ctx, name) + if rv is not None: + return rv + except NoAppException: + pass + + def list_commands(self, ctx): + self._load_plugin_commands() + + # The commands available is the list of both the application (if + # available) plus the builtin commands. + rv = set(click.Group.list_commands(self, ctx)) + info = ctx.ensure_object(ScriptInfo) + try: + rv.update(info.load_app().cli.list_commands(ctx)) + except Exception: + # Here we intentionally swallow all exceptions as we don't + # want the help page to break if the app does not exist. + # If someone attempts to use the command we try to create + # the app again and this will give us the error. + pass + return sorted(rv) + + def main(self, *args, **kwargs): + obj = kwargs.get('obj') + if obj is None: + obj = ScriptInfo(create_app=self.create_app) + kwargs['obj'] = obj + kwargs.setdefault('auto_envvar_prefix', 'FLASK') + return AppGroup.main(self, *args, **kwargs) + + +@click.command('run', short_help='Runs a development server.') +@click.option('--host', '-h', default='127.0.0.1', + help='The interface to bind to.') +@click.option('--port', '-p', default=5000, + help='The port to bind to.') +@click.option('--reload/--no-reload', default=None, + help='Enable or disable the reloader. By default the reloader ' + 'is active if debug is enabled.') +@click.option('--debugger/--no-debugger', default=None, + help='Enable or disable the debugger. By default the debugger ' + 'is active if debug is enabled.') +@click.option('--eager-loading/--lazy-loader', default=None, + help='Enable or disable eager loading. By default eager ' + 'loading is enabled if the reloader is disabled.') +@click.option('--with-threads/--without-threads', default=False, + help='Enable or disable multithreading.') +@pass_script_info +def run_command(info, host, port, reload, debugger, eager_loading, + with_threads): + """Runs a local development server for the Flask application. + + This local server is recommended for development purposes only but it + can also be used for simple intranet deployments. By default it will + not support any sort of concurrency at all to simplify debugging. This + can be changed with the --with-threads option which will enable basic + multithreading. + + The reloader and debugger are by default enabled if the debug flag of + Flask is enabled and disabled otherwise. + """ + from werkzeug.serving import run_simple + + debug = get_debug_flag() + if reload is None: + reload = bool(debug) + if debugger is None: + debugger = bool(debug) + if eager_loading is None: + eager_loading = not reload + + app = DispatchingApp(info.load_app, use_eager_loading=eager_loading) + + # Extra startup messages. This depends a bit on Werkzeug internals to + # not double execute when the reloader kicks in. + if os.environ.get('WERKZEUG_RUN_MAIN') != 'true': + # If we have an import path we can print it out now which can help + # people understand what's being served. If we do not have an + # import path because the app was loaded through a callback then + # we won't print anything. + if info.app_import_path is not None: + print(' * Serving Flask app "%s"' % info.app_import_path) + if debug is not None: + print(' * Forcing debug mode %s' % (debug and 'on' or 'off')) + + run_simple(host, port, app, use_reloader=reload, + use_debugger=debugger, threaded=with_threads) + + +@click.command('shell', short_help='Runs a shell in the app context.') +@with_appcontext +def shell_command(): + """Runs an interactive Python shell in the context of a given + Flask application. The application will populate the default + namespace of this shell according to it's configuration. + + This is useful for executing small snippets of management code + without having to manually configuring the application. + """ + import code + from flask.globals import _app_ctx_stack + app = _app_ctx_stack.top.app + banner = 'Python %s on %s\nApp: %s%s\nInstance: %s' % ( + sys.version, + sys.platform, + app.import_name, + app.debug and ' [debug]' or '', + app.instance_path, + ) + ctx = {} + + # Support the regular Python interpreter startup script if someone + # is using it. + startup = os.environ.get('PYTHONSTARTUP') + if startup and os.path.isfile(startup): + with open(startup, 'r') as f: + eval(compile(f.read(), startup, 'exec'), ctx) + + ctx.update(app.make_shell_context()) + + code.interact(banner=banner, local=ctx) + + +cli = FlaskGroup(help="""\ +This shell command acts as general utility script for Flask applications. + +It loads the application configured (through the FLASK_APP environment +variable) and then provides commands either provided by the application or +Flask itself. + +The most useful commands are the "run" and "shell" command. + +Example usage: + +\b + %(prefix)s%(cmd)s FLASK_APP=hello.py + %(prefix)s%(cmd)s FLASK_DEBUG=1 + %(prefix)sflask run +""" % { + 'cmd': os.name == 'posix' and 'export' or 'set', + 'prefix': os.name == 'posix' and '$ ' or '', +}) + + +def main(as_module=False): + this_module = __package__ + '.cli' + args = sys.argv[1:] + + if as_module: + if sys.version_info >= (2, 7): + name = 'python -m ' + this_module.rsplit('.', 1)[0] + else: + name = 'python -m ' + this_module + + # This module is always executed as "python -m flask.run" and as such + # we need to ensure that we restore the actual command line so that + # the reloader can properly operate. + sys.argv = ['-m', this_module] + sys.argv[1:] + else: + name = None + + cli.main(args=args, prog_name=name) + + +if __name__ == '__main__': + main(as_module=True) diff --git a/website/web/Lib/site-packages/flask/config.py b/website/web/Lib/site-packages/flask/config.py new file mode 100644 index 000000000..697add719 --- /dev/null +++ b/website/web/Lib/site-packages/flask/config.py @@ -0,0 +1,263 @@ +# -*- coding: utf-8 -*- +""" + flask.config + ~~~~~~~~~~~~ + + Implements the configuration related objects. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +import os +import types +import errno + +from werkzeug.utils import import_string +from ._compat import string_types, iteritems +from . import json + + +class ConfigAttribute(object): + """Makes an attribute forward to the config""" + + def __init__(self, name, get_converter=None): + self.__name__ = name + self.get_converter = get_converter + + def __get__(self, obj, type=None): + if obj is None: + return self + rv = obj.config[self.__name__] + if self.get_converter is not None: + rv = self.get_converter(rv) + return rv + + def __set__(self, obj, value): + obj.config[self.__name__] = value + + +class Config(dict): + """Works exactly like a dict but provides ways to fill it from files + or special dictionaries. There are two common patterns to populate the + config. + + Either you can fill the config from a config file:: + + app.config.from_pyfile('yourconfig.cfg') + + Or alternatively you can define the configuration options in the + module that calls :meth:`from_object` or provide an import path to + a module that should be loaded. It is also possible to tell it to + use the same module and with that provide the configuration values + just before the call:: + + DEBUG = True + SECRET_KEY = 'development key' + app.config.from_object(__name__) + + In both cases (loading from any Python file or loading from modules), + only uppercase keys are added to the config. This makes it possible to use + lowercase values in the config file for temporary values that are not added + to the config or to define the config keys in the same file that implements + the application. + + Probably the most interesting way to load configurations is from an + environment variable pointing to a file:: + + app.config.from_envvar('YOURAPPLICATION_SETTINGS') + + In this case before launching the application you have to set this + environment variable to the file you want to use. On Linux and OS X + use the export statement:: + + export YOURAPPLICATION_SETTINGS='/path/to/config/file' + + On windows use `set` instead. + + :param root_path: path to which files are read relative from. When the + config object is created by the application, this is + the application's :attr:`~flask.Flask.root_path`. + :param defaults: an optional dictionary of default values + """ + + def __init__(self, root_path, defaults=None): + dict.__init__(self, defaults or {}) + self.root_path = root_path + + def from_envvar(self, variable_name, silent=False): + """Loads a configuration from an environment variable pointing to + a configuration file. This is basically just a shortcut with nicer + error messages for this line of code:: + + app.config.from_pyfile(os.environ['YOURAPPLICATION_SETTINGS']) + + :param variable_name: name of the environment variable + :param silent: set to ``True`` if you want silent failure for missing + files. + :return: bool. ``True`` if able to load config, ``False`` otherwise. + """ + rv = os.environ.get(variable_name) + if not rv: + if silent: + return False + raise RuntimeError('The environment variable %r is not set ' + 'and as such configuration could not be ' + 'loaded. Set this variable and make it ' + 'point to a configuration file' % + variable_name) + return self.from_pyfile(rv, silent=silent) + + def from_pyfile(self, filename, silent=False): + """Updates the values in the config from a Python file. This function + behaves as if the file was imported as module with the + :meth:`from_object` function. + + :param filename: the filename of the config. This can either be an + absolute filename or a filename relative to the + root path. + :param silent: set to ``True`` if you want silent failure for missing + files. + + .. versionadded:: 0.7 + `silent` parameter. + """ + filename = os.path.join(self.root_path, filename) + d = types.ModuleType('config') + d.__file__ = filename + try: + with open(filename, mode='rb') as config_file: + exec(compile(config_file.read(), filename, 'exec'), d.__dict__) + except IOError as e: + if silent and e.errno in (errno.ENOENT, errno.EISDIR): + return False + e.strerror = 'Unable to load configuration file (%s)' % e.strerror + raise + self.from_object(d) + return True + + def from_object(self, obj): + """Updates the values from the given object. An object can be of one + of the following two types: + + - a string: in this case the object with that name will be imported + - an actual object reference: that object is used directly + + Objects are usually either modules or classes. :meth:`from_object` + loads only the uppercase attributes of the module/class. A ``dict`` + object will not work with :meth:`from_object` because the keys of a + ``dict`` are not attributes of the ``dict`` class. + + Example of module-based configuration:: + + app.config.from_object('yourapplication.default_config') + from yourapplication import default_config + app.config.from_object(default_config) + + You should not use this function to load the actual configuration but + rather configuration defaults. The actual config should be loaded + with :meth:`from_pyfile` and ideally from a location not within the + package because the package might be installed system wide. + + See :ref:`config-dev-prod` for an example of class-based configuration + using :meth:`from_object`. + + :param obj: an import name or object + """ + if isinstance(obj, string_types): + obj = import_string(obj) + for key in dir(obj): + if key.isupper(): + self[key] = getattr(obj, key) + + def from_json(self, filename, silent=False): + """Updates the values in the config from a JSON file. This function + behaves as if the JSON object was a dictionary and passed to the + :meth:`from_mapping` function. + + :param filename: the filename of the JSON file. This can either be an + absolute filename or a filename relative to the + root path. + :param silent: set to ``True`` if you want silent failure for missing + files. + + .. versionadded:: 0.11 + """ + filename = os.path.join(self.root_path, filename) + + try: + with open(filename) as json_file: + obj = json.loads(json_file.read()) + except IOError as e: + if silent and e.errno in (errno.ENOENT, errno.EISDIR): + return False + e.strerror = 'Unable to load configuration file (%s)' % e.strerror + raise + return self.from_mapping(obj) + + def from_mapping(self, *mapping, **kwargs): + """Updates the config like :meth:`update` ignoring items with non-upper + keys. + + .. versionadded:: 0.11 + """ + mappings = [] + if len(mapping) == 1: + if hasattr(mapping[0], 'items'): + mappings.append(mapping[0].items()) + else: + mappings.append(mapping[0]) + elif len(mapping) > 1: + raise TypeError( + 'expected at most 1 positional argument, got %d' % len(mapping) + ) + mappings.append(kwargs.items()) + for mapping in mappings: + for (key, value) in mapping: + if key.isupper(): + self[key] = value + return True + + def get_namespace(self, namespace, lowercase=True, trim_namespace=True): + """Returns a dictionary containing a subset of configuration options + that match the specified namespace/prefix. Example usage:: + + app.config['IMAGE_STORE_TYPE'] = 'fs' + app.config['IMAGE_STORE_PATH'] = '/var/app/images' + app.config['IMAGE_STORE_BASE_URL'] = 'http://img.website.com' + image_store_config = app.config.get_namespace('IMAGE_STORE_') + + The resulting dictionary `image_store_config` would look like:: + + { + 'type': 'fs', + 'path': '/var/app/images', + 'base_url': 'http://img.website.com' + } + + This is often useful when configuration options map directly to + keyword arguments in functions or class constructors. + + :param namespace: a configuration namespace + :param lowercase: a flag indicating if the keys of the resulting + dictionary should be lowercase + :param trim_namespace: a flag indicating if the keys of the resulting + dictionary should not include the namespace + + .. versionadded:: 0.11 + """ + rv = {} + for k, v in iteritems(self): + if not k.startswith(namespace): + continue + if trim_namespace: + key = k[len(namespace):] + else: + key = k + if lowercase: + key = key.lower() + rv[key] = v + return rv + + def __repr__(self): + return '<%s %s>' % (self.__class__.__name__, dict.__repr__(self)) diff --git a/website/web/Lib/site-packages/flask/ctx.py b/website/web/Lib/site-packages/flask/ctx.py new file mode 100644 index 000000000..480d9c5c4 --- /dev/null +++ b/website/web/Lib/site-packages/flask/ctx.py @@ -0,0 +1,410 @@ +# -*- coding: utf-8 -*- +""" + flask.ctx + ~~~~~~~~~ + + Implements the objects required to keep the context. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +import sys +from functools import update_wrapper + +from werkzeug.exceptions import HTTPException + +from .globals import _request_ctx_stack, _app_ctx_stack +from .signals import appcontext_pushed, appcontext_popped +from ._compat import BROKEN_PYPY_CTXMGR_EXIT, reraise + + +# a singleton sentinel value for parameter defaults +_sentinel = object() + + +class _AppCtxGlobals(object): + """A plain object.""" + + def get(self, name, default=None): + return self.__dict__.get(name, default) + + def pop(self, name, default=_sentinel): + if default is _sentinel: + return self.__dict__.pop(name) + else: + return self.__dict__.pop(name, default) + + def setdefault(self, name, default=None): + return self.__dict__.setdefault(name, default) + + def __contains__(self, item): + return item in self.__dict__ + + def __iter__(self): + return iter(self.__dict__) + + def __repr__(self): + top = _app_ctx_stack.top + if top is not None: + return '' % top.app.name + return object.__repr__(self) + + +def after_this_request(f): + """Executes a function after this request. This is useful to modify + response objects. The function is passed the response object and has + to return the same or a new one. + + Example:: + + @app.route('/') + def index(): + @after_this_request + def add_header(response): + response.headers['X-Foo'] = 'Parachute' + return response + return 'Hello World!' + + This is more useful if a function other than the view function wants to + modify a response. For instance think of a decorator that wants to add + some headers without converting the return value into a response object. + + .. versionadded:: 0.9 + """ + _request_ctx_stack.top._after_request_functions.append(f) + return f + + +def copy_current_request_context(f): + """A helper function that decorates a function to retain the current + request context. This is useful when working with greenlets. The moment + the function is decorated a copy of the request context is created and + then pushed when the function is called. + + Example:: + + import gevent + from flask import copy_current_request_context + + @app.route('/') + def index(): + @copy_current_request_context + def do_some_work(): + # do some work here, it can access flask.request like you + # would otherwise in the view function. + ... + gevent.spawn(do_some_work) + return 'Regular response' + + .. versionadded:: 0.10 + """ + top = _request_ctx_stack.top + if top is None: + raise RuntimeError('This decorator can only be used at local scopes ' + 'when a request context is on the stack. For instance within ' + 'view functions.') + reqctx = top.copy() + def wrapper(*args, **kwargs): + with reqctx: + return f(*args, **kwargs) + return update_wrapper(wrapper, f) + + +def has_request_context(): + """If you have code that wants to test if a request context is there or + not this function can be used. For instance, you may want to take advantage + of request information if the request object is available, but fail + silently if it is unavailable. + + :: + + class User(db.Model): + + def __init__(self, username, remote_addr=None): + self.username = username + if remote_addr is None and has_request_context(): + remote_addr = request.remote_addr + self.remote_addr = remote_addr + + Alternatively you can also just test any of the context bound objects + (such as :class:`request` or :class:`g` for truthness):: + + class User(db.Model): + + def __init__(self, username, remote_addr=None): + self.username = username + if remote_addr is None and request: + remote_addr = request.remote_addr + self.remote_addr = remote_addr + + .. versionadded:: 0.7 + """ + return _request_ctx_stack.top is not None + + +def has_app_context(): + """Works like :func:`has_request_context` but for the application + context. You can also just do a boolean check on the + :data:`current_app` object instead. + + .. versionadded:: 0.9 + """ + return _app_ctx_stack.top is not None + + +class AppContext(object): + """The application context binds an application object implicitly + to the current thread or greenlet, similar to how the + :class:`RequestContext` binds request information. The application + context is also implicitly created if a request context is created + but the application is not on top of the individual application + context. + """ + + def __init__(self, app): + self.app = app + self.url_adapter = app.create_url_adapter(None) + self.g = app.app_ctx_globals_class() + + # Like request context, app contexts can be pushed multiple times + # but there a basic "refcount" is enough to track them. + self._refcnt = 0 + + def push(self): + """Binds the app context to the current context.""" + self._refcnt += 1 + if hasattr(sys, 'exc_clear'): + sys.exc_clear() + _app_ctx_stack.push(self) + appcontext_pushed.send(self.app) + + def pop(self, exc=_sentinel): + """Pops the app context.""" + try: + self._refcnt -= 1 + if self._refcnt <= 0: + if exc is _sentinel: + exc = sys.exc_info()[1] + self.app.do_teardown_appcontext(exc) + finally: + rv = _app_ctx_stack.pop() + assert rv is self, 'Popped wrong app context. (%r instead of %r)' \ + % (rv, self) + appcontext_popped.send(self.app) + + def __enter__(self): + self.push() + return self + + def __exit__(self, exc_type, exc_value, tb): + self.pop(exc_value) + + if BROKEN_PYPY_CTXMGR_EXIT and exc_type is not None: + reraise(exc_type, exc_value, tb) + + +class RequestContext(object): + """The request context contains all request relevant information. It is + created at the beginning of the request and pushed to the + `_request_ctx_stack` and removed at the end of it. It will create the + URL adapter and request object for the WSGI environment provided. + + Do not attempt to use this class directly, instead use + :meth:`~flask.Flask.test_request_context` and + :meth:`~flask.Flask.request_context` to create this object. + + When the request context is popped, it will evaluate all the + functions registered on the application for teardown execution + (:meth:`~flask.Flask.teardown_request`). + + The request context is automatically popped at the end of the request + for you. In debug mode the request context is kept around if + exceptions happen so that interactive debuggers have a chance to + introspect the data. With 0.4 this can also be forced for requests + that did not fail and outside of ``DEBUG`` mode. By setting + ``'flask._preserve_context'`` to ``True`` on the WSGI environment the + context will not pop itself at the end of the request. This is used by + the :meth:`~flask.Flask.test_client` for example to implement the + deferred cleanup functionality. + + You might find this helpful for unittests where you need the + information from the context local around for a little longer. Make + sure to properly :meth:`~werkzeug.LocalStack.pop` the stack yourself in + that situation, otherwise your unittests will leak memory. + """ + + def __init__(self, app, environ, request=None): + self.app = app + if request is None: + request = app.request_class(environ) + self.request = request + self.url_adapter = app.create_url_adapter(self.request) + self.flashes = None + self.session = None + + # Request contexts can be pushed multiple times and interleaved with + # other request contexts. Now only if the last level is popped we + # get rid of them. Additionally if an application context is missing + # one is created implicitly so for each level we add this information + self._implicit_app_ctx_stack = [] + + # indicator if the context was preserved. Next time another context + # is pushed the preserved context is popped. + self.preserved = False + + # remembers the exception for pop if there is one in case the context + # preservation kicks in. + self._preserved_exc = None + + # Functions that should be executed after the request on the response + # object. These will be called before the regular "after_request" + # functions. + self._after_request_functions = [] + + self.match_request() + + def _get_g(self): + return _app_ctx_stack.top.g + def _set_g(self, value): + _app_ctx_stack.top.g = value + g = property(_get_g, _set_g) + del _get_g, _set_g + + def copy(self): + """Creates a copy of this request context with the same request object. + This can be used to move a request context to a different greenlet. + Because the actual request object is the same this cannot be used to + move a request context to a different thread unless access to the + request object is locked. + + .. versionadded:: 0.10 + """ + return self.__class__(self.app, + environ=self.request.environ, + request=self.request + ) + + def match_request(self): + """Can be overridden by a subclass to hook into the matching + of the request. + """ + try: + url_rule, self.request.view_args = \ + self.url_adapter.match(return_rule=True) + self.request.url_rule = url_rule + except HTTPException as e: + self.request.routing_exception = e + + def push(self): + """Binds the request context to the current context.""" + # If an exception occurs in debug mode or if context preservation is + # activated under exception situations exactly one context stays + # on the stack. The rationale is that you want to access that + # information under debug situations. However if someone forgets to + # pop that context again we want to make sure that on the next push + # it's invalidated, otherwise we run at risk that something leaks + # memory. This is usually only a problem in test suite since this + # functionality is not active in production environments. + top = _request_ctx_stack.top + if top is not None and top.preserved: + top.pop(top._preserved_exc) + + # Before we push the request context we have to ensure that there + # is an application context. + app_ctx = _app_ctx_stack.top + if app_ctx is None or app_ctx.app != self.app: + app_ctx = self.app.app_context() + app_ctx.push() + self._implicit_app_ctx_stack.append(app_ctx) + else: + self._implicit_app_ctx_stack.append(None) + + if hasattr(sys, 'exc_clear'): + sys.exc_clear() + + _request_ctx_stack.push(self) + + # Open the session at the moment that the request context is + # available. This allows a custom open_session method to use the + # request context (e.g. code that access database information + # stored on `g` instead of the appcontext). + self.session = self.app.open_session(self.request) + if self.session is None: + self.session = self.app.make_null_session() + + def pop(self, exc=_sentinel): + """Pops the request context and unbinds it by doing that. This will + also trigger the execution of functions registered by the + :meth:`~flask.Flask.teardown_request` decorator. + + .. versionchanged:: 0.9 + Added the `exc` argument. + """ + app_ctx = self._implicit_app_ctx_stack.pop() + + try: + clear_request = False + if not self._implicit_app_ctx_stack: + self.preserved = False + self._preserved_exc = None + if exc is _sentinel: + exc = sys.exc_info()[1] + self.app.do_teardown_request(exc) + + # If this interpreter supports clearing the exception information + # we do that now. This will only go into effect on Python 2.x, + # on 3.x it disappears automatically at the end of the exception + # stack. + if hasattr(sys, 'exc_clear'): + sys.exc_clear() + + request_close = getattr(self.request, 'close', None) + if request_close is not None: + request_close() + clear_request = True + finally: + rv = _request_ctx_stack.pop() + + # get rid of circular dependencies at the end of the request + # so that we don't require the GC to be active. + if clear_request: + rv.request.environ['werkzeug.request'] = None + + # Get rid of the app as well if necessary. + if app_ctx is not None: + app_ctx.pop(exc) + + assert rv is self, 'Popped wrong request context. ' \ + '(%r instead of %r)' % (rv, self) + + def auto_pop(self, exc): + if self.request.environ.get('flask._preserve_context') or \ + (exc is not None and self.app.preserve_context_on_exception): + self.preserved = True + self._preserved_exc = exc + else: + self.pop(exc) + + def __enter__(self): + self.push() + return self + + def __exit__(self, exc_type, exc_value, tb): + # do not pop the request stack if we are in debug mode and an + # exception happened. This will allow the debugger to still + # access the request object in the interactive shell. Furthermore + # the context can be force kept alive for the test client. + # See flask.testing for how this works. + self.auto_pop(exc_value) + + if BROKEN_PYPY_CTXMGR_EXIT and exc_type is not None: + reraise(exc_type, exc_value, tb) + + def __repr__(self): + return '<%s \'%s\' [%s] of %s>' % ( + self.__class__.__name__, + self.request.url, + self.request.method, + self.app.name, + ) diff --git a/website/web/Lib/site-packages/flask/debughelpers.py b/website/web/Lib/site-packages/flask/debughelpers.py new file mode 100644 index 000000000..90710dd35 --- /dev/null +++ b/website/web/Lib/site-packages/flask/debughelpers.py @@ -0,0 +1,155 @@ +# -*- coding: utf-8 -*- +""" + flask.debughelpers + ~~~~~~~~~~~~~~~~~~ + + Various helpers to make the development experience better. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +from ._compat import implements_to_string, text_type +from .app import Flask +from .blueprints import Blueprint +from .globals import _request_ctx_stack + + +class UnexpectedUnicodeError(AssertionError, UnicodeError): + """Raised in places where we want some better error reporting for + unexpected unicode or binary data. + """ + + +@implements_to_string +class DebugFilesKeyError(KeyError, AssertionError): + """Raised from request.files during debugging. The idea is that it can + provide a better error message than just a generic KeyError/BadRequest. + """ + + def __init__(self, request, key): + form_matches = request.form.getlist(key) + buf = ['You tried to access the file "%s" in the request.files ' + 'dictionary but it does not exist. The mimetype for the request ' + 'is "%s" instead of "multipart/form-data" which means that no ' + 'file contents were transmitted. To fix this error you should ' + 'provide enctype="multipart/form-data" in your form.' % + (key, request.mimetype)] + if form_matches: + buf.append('\n\nThe browser instead transmitted some file names. ' + 'This was submitted: %s' % ', '.join('"%s"' % x + for x in form_matches)) + self.msg = ''.join(buf) + + def __str__(self): + return self.msg + + +class FormDataRoutingRedirect(AssertionError): + """This exception is raised by Flask in debug mode if it detects a + redirect caused by the routing system when the request method is not + GET, HEAD or OPTIONS. Reasoning: form data will be dropped. + """ + + def __init__(self, request): + exc = request.routing_exception + buf = ['A request was sent to this URL (%s) but a redirect was ' + 'issued automatically by the routing system to "%s".' + % (request.url, exc.new_url)] + + # In case just a slash was appended we can be extra helpful + if request.base_url + '/' == exc.new_url.split('?')[0]: + buf.append(' The URL was defined with a trailing slash so ' + 'Flask will automatically redirect to the URL ' + 'with the trailing slash if it was accessed ' + 'without one.') + + buf.append(' Make sure to directly send your %s-request to this URL ' + 'since we can\'t make browsers or HTTP clients redirect ' + 'with form data reliably or without user interaction.' % + request.method) + buf.append('\n\nNote: this exception is only raised in debug mode') + AssertionError.__init__(self, ''.join(buf).encode('utf-8')) + + +def attach_enctype_error_multidict(request): + """Since Flask 0.8 we're monkeypatching the files object in case a + request is detected that does not use multipart form data but the files + object is accessed. + """ + oldcls = request.files.__class__ + class newcls(oldcls): + def __getitem__(self, key): + try: + return oldcls.__getitem__(self, key) + except KeyError: + if key not in request.form: + raise + raise DebugFilesKeyError(request, key) + newcls.__name__ = oldcls.__name__ + newcls.__module__ = oldcls.__module__ + request.files.__class__ = newcls + + +def _dump_loader_info(loader): + yield 'class: %s.%s' % (type(loader).__module__, type(loader).__name__) + for key, value in sorted(loader.__dict__.items()): + if key.startswith('_'): + continue + if isinstance(value, (tuple, list)): + if not all(isinstance(x, (str, text_type)) for x in value): + continue + yield '%s:' % key + for item in value: + yield ' - %s' % item + continue + elif not isinstance(value, (str, text_type, int, float, bool)): + continue + yield '%s: %r' % (key, value) + + +def explain_template_loading_attempts(app, template, attempts): + """This should help developers understand what failed""" + info = ['Locating template "%s":' % template] + total_found = 0 + blueprint = None + reqctx = _request_ctx_stack.top + if reqctx is not None and reqctx.request.blueprint is not None: + blueprint = reqctx.request.blueprint + + for idx, (loader, srcobj, triple) in enumerate(attempts): + if isinstance(srcobj, Flask): + src_info = 'application "%s"' % srcobj.import_name + elif isinstance(srcobj, Blueprint): + src_info = 'blueprint "%s" (%s)' % (srcobj.name, + srcobj.import_name) + else: + src_info = repr(srcobj) + + info.append('% 5d: trying loader of %s' % ( + idx + 1, src_info)) + + for line in _dump_loader_info(loader): + info.append(' %s' % line) + + if triple is None: + detail = 'no match' + else: + detail = 'found (%r)' % (triple[1] or '') + total_found += 1 + info.append(' -> %s' % detail) + + seems_fishy = False + if total_found == 0: + info.append('Error: the template could not be found.') + seems_fishy = True + elif total_found > 1: + info.append('Warning: multiple loaders returned a match for the template.') + seems_fishy = True + + if blueprint is not None and seems_fishy: + info.append(' The template was looked up from an endpoint that ' + 'belongs to the blueprint "%s".' % blueprint) + info.append(' Maybe you did not place a template in the right folder?') + info.append(' See http://flask.pocoo.org/docs/blueprints/#templates') + + app.logger.info('\n'.join(info)) diff --git a/website/web/Lib/site-packages/flask/ext/__init__.py b/website/web/Lib/site-packages/flask/ext/__init__.py new file mode 100644 index 000000000..051f44ac4 --- /dev/null +++ b/website/web/Lib/site-packages/flask/ext/__init__.py @@ -0,0 +1,29 @@ +# -*- coding: utf-8 -*- +""" + flask.ext + ~~~~~~~~~ + + Redirect imports for extensions. This module basically makes it possible + for us to transition from flaskext.foo to flask_foo without having to + force all extensions to upgrade at the same time. + + When a user does ``from flask.ext.foo import bar`` it will attempt to + import ``from flask_foo import bar`` first and when that fails it will + try to import ``from flaskext.foo import bar``. + + We're switching from namespace packages because it was just too painful for + everybody involved. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + + +def setup(): + from ..exthook import ExtensionImporter + importer = ExtensionImporter(['flask_%s', 'flaskext.%s'], __name__) + importer.install() + + +setup() +del setup diff --git a/website/web/Lib/site-packages/flask/exthook.py b/website/web/Lib/site-packages/flask/exthook.py new file mode 100644 index 000000000..d88428027 --- /dev/null +++ b/website/web/Lib/site-packages/flask/exthook.py @@ -0,0 +1,143 @@ +# -*- coding: utf-8 -*- +""" + flask.exthook + ~~~~~~~~~~~~~ + + Redirect imports for extensions. This module basically makes it possible + for us to transition from flaskext.foo to flask_foo without having to + force all extensions to upgrade at the same time. + + When a user does ``from flask.ext.foo import bar`` it will attempt to + import ``from flask_foo import bar`` first and when that fails it will + try to import ``from flaskext.foo import bar``. + + We're switching from namespace packages because it was just too painful for + everybody involved. + + This is used by `flask.ext`. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +import sys +import os +import warnings +from ._compat import reraise + + +class ExtDeprecationWarning(DeprecationWarning): + pass + +warnings.simplefilter('always', ExtDeprecationWarning) + + +class ExtensionImporter(object): + """This importer redirects imports from this submodule to other locations. + This makes it possible to transition from the old flaskext.name to the + newer flask_name without people having a hard time. + """ + + def __init__(self, module_choices, wrapper_module): + self.module_choices = module_choices + self.wrapper_module = wrapper_module + self.prefix = wrapper_module + '.' + self.prefix_cutoff = wrapper_module.count('.') + 1 + + def __eq__(self, other): + return self.__class__.__module__ == other.__class__.__module__ and \ + self.__class__.__name__ == other.__class__.__name__ and \ + self.wrapper_module == other.wrapper_module and \ + self.module_choices == other.module_choices + + def __ne__(self, other): + return not self.__eq__(other) + + def install(self): + sys.meta_path[:] = [x for x in sys.meta_path if self != x] + [self] + + def find_module(self, fullname, path=None): + if fullname.startswith(self.prefix) and \ + fullname != 'flask.ext.ExtDeprecationWarning': + return self + + def load_module(self, fullname): + if fullname in sys.modules: + return sys.modules[fullname] + + modname = fullname.split('.', self.prefix_cutoff)[self.prefix_cutoff] + + warnings.warn( + "Importing flask.ext.{x} is deprecated, use flask_{x} instead." + .format(x=modname), ExtDeprecationWarning, stacklevel=2 + ) + + for path in self.module_choices: + realname = path % modname + try: + __import__(realname) + except ImportError: + exc_type, exc_value, tb = sys.exc_info() + # since we only establish the entry in sys.modules at the + # very this seems to be redundant, but if recursive imports + # happen we will call into the move import a second time. + # On the second invocation we still don't have an entry for + # fullname in sys.modules, but we will end up with the same + # fake module name and that import will succeed since this + # one already has a temporary entry in the modules dict. + # Since this one "succeeded" temporarily that second + # invocation now will have created a fullname entry in + # sys.modules which we have to kill. + sys.modules.pop(fullname, None) + + # If it's an important traceback we reraise it, otherwise + # we swallow it and try the next choice. The skipped frame + # is the one from __import__ above which we don't care about + if self.is_important_traceback(realname, tb): + reraise(exc_type, exc_value, tb.tb_next) + continue + module = sys.modules[fullname] = sys.modules[realname] + if '.' not in modname: + setattr(sys.modules[self.wrapper_module], modname, module) + + if realname.startswith('flaskext.'): + warnings.warn( + "Detected extension named flaskext.{x}, please rename it " + "to flask_{x}. The old form is deprecated." + .format(x=modname), ExtDeprecationWarning + ) + + return module + raise ImportError('No module named %s' % fullname) + + def is_important_traceback(self, important_module, tb): + """Walks a traceback's frames and checks if any of the frames + originated in the given important module. If that is the case then we + were able to import the module itself but apparently something went + wrong when the module was imported. (Eg: import of an import failed). + """ + while tb is not None: + if self.is_important_frame(important_module, tb): + return True + tb = tb.tb_next + return False + + def is_important_frame(self, important_module, tb): + """Checks a single frame if it's important.""" + g = tb.tb_frame.f_globals + if '__name__' not in g: + return False + + module_name = g['__name__'] + + # Python 2.7 Behavior. Modules are cleaned up late so the + # name shows up properly here. Success! + if module_name == important_module: + return True + + # Some python versions will clean up modules so early that the + # module name at that point is no longer set. Try guessing from + # the filename then. + filename = os.path.abspath(tb.tb_frame.f_code.co_filename) + test_string = os.path.sep + important_module.replace('.', os.path.sep) + return test_string + '.py' in filename or \ + test_string + os.path.sep + '__init__.py' in filename diff --git a/website/web/Lib/site-packages/flask/globals.py b/website/web/Lib/site-packages/flask/globals.py new file mode 100644 index 000000000..0b70a3ef9 --- /dev/null +++ b/website/web/Lib/site-packages/flask/globals.py @@ -0,0 +1,61 @@ +# -*- coding: utf-8 -*- +""" + flask.globals + ~~~~~~~~~~~~~ + + Defines all the global objects that are proxies to the current + active context. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +from functools import partial +from werkzeug.local import LocalStack, LocalProxy + + +_request_ctx_err_msg = '''\ +Working outside of request context. + +This typically means that you attempted to use functionality that needed +an active HTTP request. Consult the documentation on testing for +information about how to avoid this problem.\ +''' +_app_ctx_err_msg = '''\ +Working outside of application context. + +This typically means that you attempted to use functionality that needed +to interface with the current application object in a way. To solve +this set up an application context with app.app_context(). See the +documentation for more information.\ +''' + + +def _lookup_req_object(name): + top = _request_ctx_stack.top + if top is None: + raise RuntimeError(_request_ctx_err_msg) + return getattr(top, name) + + +def _lookup_app_object(name): + top = _app_ctx_stack.top + if top is None: + raise RuntimeError(_app_ctx_err_msg) + return getattr(top, name) + + +def _find_app(): + top = _app_ctx_stack.top + if top is None: + raise RuntimeError(_app_ctx_err_msg) + return top.app + + +# context locals +_request_ctx_stack = LocalStack() +_app_ctx_stack = LocalStack() +current_app = LocalProxy(_find_app) +request = LocalProxy(partial(_lookup_req_object, 'request')) +session = LocalProxy(partial(_lookup_req_object, 'session')) +g = LocalProxy(partial(_lookup_app_object, 'g')) diff --git a/website/web/Lib/site-packages/flask/helpers.py b/website/web/Lib/site-packages/flask/helpers.py new file mode 100644 index 000000000..4bb1d1c91 --- /dev/null +++ b/website/web/Lib/site-packages/flask/helpers.py @@ -0,0 +1,966 @@ +# -*- coding: utf-8 -*- +""" + flask.helpers + ~~~~~~~~~~~~~ + + Implements various helpers. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" + +import os +import sys +import pkgutil +import posixpath +import mimetypes +from time import time +from zlib import adler32 +from threading import RLock +from werkzeug.routing import BuildError +from functools import update_wrapper + +try: + from werkzeug.urls import url_quote +except ImportError: + from urlparse import quote as url_quote + +from werkzeug.datastructures import Headers, Range +from werkzeug.exceptions import BadRequest, NotFound, \ + RequestedRangeNotSatisfiable + +# this was moved in 0.7 +try: + from werkzeug.wsgi import wrap_file +except ImportError: + from werkzeug.utils import wrap_file + +from jinja2 import FileSystemLoader + +from .signals import message_flashed +from .globals import session, _request_ctx_stack, _app_ctx_stack, \ + current_app, request +from ._compat import string_types, text_type + + +# sentinel +_missing = object() + + +# what separators does this operating system provide that are not a slash? +# this is used by the send_from_directory function to ensure that nobody is +# able to access files from outside the filesystem. +_os_alt_seps = list(sep for sep in [os.path.sep, os.path.altsep] + if sep not in (None, '/')) + + +def get_debug_flag(default=None): + val = os.environ.get('FLASK_DEBUG') + if not val: + return default + return val not in ('0', 'false', 'no') + + +def _endpoint_from_view_func(view_func): + """Internal helper that returns the default endpoint for a given + function. This always is the function name. + """ + assert view_func is not None, 'expected view func if endpoint ' \ + 'is not provided.' + return view_func.__name__ + + +def stream_with_context(generator_or_function): + """Request contexts disappear when the response is started on the server. + This is done for efficiency reasons and to make it less likely to encounter + memory leaks with badly written WSGI middlewares. The downside is that if + you are using streamed responses, the generator cannot access request bound + information any more. + + This function however can help you keep the context around for longer:: + + from flask import stream_with_context, request, Response + + @app.route('/stream') + def streamed_response(): + @stream_with_context + def generate(): + yield 'Hello ' + yield request.args['name'] + yield '!' + return Response(generate()) + + Alternatively it can also be used around a specific generator:: + + from flask import stream_with_context, request, Response + + @app.route('/stream') + def streamed_response(): + def generate(): + yield 'Hello ' + yield request.args['name'] + yield '!' + return Response(stream_with_context(generate())) + + .. versionadded:: 0.9 + """ + try: + gen = iter(generator_or_function) + except TypeError: + def decorator(*args, **kwargs): + gen = generator_or_function(*args, **kwargs) + return stream_with_context(gen) + return update_wrapper(decorator, generator_or_function) + + def generator(): + ctx = _request_ctx_stack.top + if ctx is None: + raise RuntimeError('Attempted to stream with context but ' + 'there was no context in the first place to keep around.') + with ctx: + # Dummy sentinel. Has to be inside the context block or we're + # not actually keeping the context around. + yield None + + # The try/finally is here so that if someone passes a WSGI level + # iterator in we're still running the cleanup logic. Generators + # don't need that because they are closed on their destruction + # automatically. + try: + for item in gen: + yield item + finally: + if hasattr(gen, 'close'): + gen.close() + + # The trick is to start the generator. Then the code execution runs until + # the first dummy None is yielded at which point the context was already + # pushed. This item is discarded. Then when the iteration continues the + # real generator is executed. + wrapped_g = generator() + next(wrapped_g) + return wrapped_g + + +def make_response(*args): + """Sometimes it is necessary to set additional headers in a view. Because + views do not have to return response objects but can return a value that + is converted into a response object by Flask itself, it becomes tricky to + add headers to it. This function can be called instead of using a return + and you will get a response object which you can use to attach headers. + + If view looked like this and you want to add a new header:: + + def index(): + return render_template('index.html', foo=42) + + You can now do something like this:: + + def index(): + response = make_response(render_template('index.html', foo=42)) + response.headers['X-Parachutes'] = 'parachutes are cool' + return response + + This function accepts the very same arguments you can return from a + view function. This for example creates a response with a 404 error + code:: + + response = make_response(render_template('not_found.html'), 404) + + The other use case of this function is to force the return value of a + view function into a response which is helpful with view + decorators:: + + response = make_response(view_function()) + response.headers['X-Parachutes'] = 'parachutes are cool' + + Internally this function does the following things: + + - if no arguments are passed, it creates a new response argument + - if one argument is passed, :meth:`flask.Flask.make_response` + is invoked with it. + - if more than one argument is passed, the arguments are passed + to the :meth:`flask.Flask.make_response` function as tuple. + + .. versionadded:: 0.6 + """ + if not args: + return current_app.response_class() + if len(args) == 1: + args = args[0] + return current_app.make_response(args) + + +def url_for(endpoint, **values): + """Generates a URL to the given endpoint with the method provided. + + Variable arguments that are unknown to the target endpoint are appended + to the generated URL as query arguments. If the value of a query argument + is ``None``, the whole pair is skipped. In case blueprints are active + you can shortcut references to the same blueprint by prefixing the + local endpoint with a dot (``.``). + + This will reference the index function local to the current blueprint:: + + url_for('.index') + + For more information, head over to the :ref:`Quickstart `. + + To integrate applications, :class:`Flask` has a hook to intercept URL build + errors through :attr:`Flask.url_build_error_handlers`. The `url_for` + function results in a :exc:`~werkzeug.routing.BuildError` when the current + app does not have a URL for the given endpoint and values. When it does, the + :data:`~flask.current_app` calls its :attr:`~Flask.url_build_error_handlers` if + it is not ``None``, which can return a string to use as the result of + `url_for` (instead of `url_for`'s default to raise the + :exc:`~werkzeug.routing.BuildError` exception) or re-raise the exception. + An example:: + + def external_url_handler(error, endpoint, values): + "Looks up an external URL when `url_for` cannot build a URL." + # This is an example of hooking the build_error_handler. + # Here, lookup_url is some utility function you've built + # which looks up the endpoint in some external URL registry. + url = lookup_url(endpoint, **values) + if url is None: + # External lookup did not have a URL. + # Re-raise the BuildError, in context of original traceback. + exc_type, exc_value, tb = sys.exc_info() + if exc_value is error: + raise exc_type, exc_value, tb + else: + raise error + # url_for will use this result, instead of raising BuildError. + return url + + app.url_build_error_handlers.append(external_url_handler) + + Here, `error` is the instance of :exc:`~werkzeug.routing.BuildError`, and + `endpoint` and `values` are the arguments passed into `url_for`. Note + that this is for building URLs outside the current application, and not for + handling 404 NotFound errors. + + .. versionadded:: 0.10 + The `_scheme` parameter was added. + + .. versionadded:: 0.9 + The `_anchor` and `_method` parameters were added. + + .. versionadded:: 0.9 + Calls :meth:`Flask.handle_build_error` on + :exc:`~werkzeug.routing.BuildError`. + + :param endpoint: the endpoint of the URL (name of the function) + :param values: the variable arguments of the URL rule + :param _external: if set to ``True``, an absolute URL is generated. Server + address can be changed via ``SERVER_NAME`` configuration variable which + defaults to `localhost`. + :param _scheme: a string specifying the desired URL scheme. The `_external` + parameter must be set to ``True`` or a :exc:`ValueError` is raised. The default + behavior uses the same scheme as the current request, or + ``PREFERRED_URL_SCHEME`` from the :ref:`app configuration ` if no + request context is available. As of Werkzeug 0.10, this also can be set + to an empty string to build protocol-relative URLs. + :param _anchor: if provided this is added as anchor to the URL. + :param _method: if provided this explicitly specifies an HTTP method. + """ + appctx = _app_ctx_stack.top + reqctx = _request_ctx_stack.top + if appctx is None: + raise RuntimeError('Attempted to generate a URL without the ' + 'application context being pushed. This has to be ' + 'executed when application context is available.') + + # If request specific information is available we have some extra + # features that support "relative" URLs. + if reqctx is not None: + url_adapter = reqctx.url_adapter + blueprint_name = request.blueprint + if not reqctx.request._is_old_module: + if endpoint[:1] == '.': + if blueprint_name is not None: + endpoint = blueprint_name + endpoint + else: + endpoint = endpoint[1:] + else: + # TODO: get rid of this deprecated functionality in 1.0 + if '.' not in endpoint: + if blueprint_name is not None: + endpoint = blueprint_name + '.' + endpoint + elif endpoint.startswith('.'): + endpoint = endpoint[1:] + external = values.pop('_external', False) + + # Otherwise go with the url adapter from the appctx and make + # the URLs external by default. + else: + url_adapter = appctx.url_adapter + if url_adapter is None: + raise RuntimeError('Application was not able to create a URL ' + 'adapter for request independent URL generation. ' + 'You might be able to fix this by setting ' + 'the SERVER_NAME config variable.') + external = values.pop('_external', True) + + anchor = values.pop('_anchor', None) + method = values.pop('_method', None) + scheme = values.pop('_scheme', None) + appctx.app.inject_url_defaults(endpoint, values) + + # This is not the best way to deal with this but currently the + # underlying Werkzeug router does not support overriding the scheme on + # a per build call basis. + old_scheme = None + if scheme is not None: + if not external: + raise ValueError('When specifying _scheme, _external must be True') + old_scheme = url_adapter.url_scheme + url_adapter.url_scheme = scheme + + try: + try: + rv = url_adapter.build(endpoint, values, method=method, + force_external=external) + finally: + if old_scheme is not None: + url_adapter.url_scheme = old_scheme + except BuildError as error: + # We need to inject the values again so that the app callback can + # deal with that sort of stuff. + values['_external'] = external + values['_anchor'] = anchor + values['_method'] = method + return appctx.app.handle_url_build_error(error, endpoint, values) + + if anchor is not None: + rv += '#' + url_quote(anchor) + return rv + + +def get_template_attribute(template_name, attribute): + """Loads a macro (or variable) a template exports. This can be used to + invoke a macro from within Python code. If you for example have a + template named :file:`_cider.html` with the following contents: + + .. sourcecode:: html+jinja + + {% macro hello(name) %}Hello {{ name }}!{% endmacro %} + + You can access this from Python code like this:: + + hello = get_template_attribute('_cider.html', 'hello') + return hello('World') + + .. versionadded:: 0.2 + + :param template_name: the name of the template + :param attribute: the name of the variable of macro to access + """ + return getattr(current_app.jinja_env.get_template(template_name).module, + attribute) + + +def flash(message, category='message'): + """Flashes a message to the next request. In order to remove the + flashed message from the session and to display it to the user, + the template has to call :func:`get_flashed_messages`. + + .. versionchanged:: 0.3 + `category` parameter added. + + :param message: the message to be flashed. + :param category: the category for the message. The following values + are recommended: ``'message'`` for any kind of message, + ``'error'`` for errors, ``'info'`` for information + messages and ``'warning'`` for warnings. However any + kind of string can be used as category. + """ + # Original implementation: + # + # session.setdefault('_flashes', []).append((category, message)) + # + # This assumed that changes made to mutable structures in the session are + # are always in sync with the session object, which is not true for session + # implementations that use external storage for keeping their keys/values. + flashes = session.get('_flashes', []) + flashes.append((category, message)) + session['_flashes'] = flashes + message_flashed.send(current_app._get_current_object(), + message=message, category=category) + + +def get_flashed_messages(with_categories=False, category_filter=[]): + """Pulls all flashed messages from the session and returns them. + Further calls in the same request to the function will return + the same messages. By default just the messages are returned, + but when `with_categories` is set to ``True``, the return value will + be a list of tuples in the form ``(category, message)`` instead. + + Filter the flashed messages to one or more categories by providing those + categories in `category_filter`. This allows rendering categories in + separate html blocks. The `with_categories` and `category_filter` + arguments are distinct: + + * `with_categories` controls whether categories are returned with message + text (``True`` gives a tuple, where ``False`` gives just the message text). + * `category_filter` filters the messages down to only those matching the + provided categories. + + See :ref:`message-flashing-pattern` for examples. + + .. versionchanged:: 0.3 + `with_categories` parameter added. + + .. versionchanged:: 0.9 + `category_filter` parameter added. + + :param with_categories: set to ``True`` to also receive categories. + :param category_filter: whitelist of categories to limit return values + """ + flashes = _request_ctx_stack.top.flashes + if flashes is None: + _request_ctx_stack.top.flashes = flashes = session.pop('_flashes') \ + if '_flashes' in session else [] + if category_filter: + flashes = list(filter(lambda f: f[0] in category_filter, flashes)) + if not with_categories: + return [x[1] for x in flashes] + return flashes + + +def send_file(filename_or_fp, mimetype=None, as_attachment=False, + attachment_filename=None, add_etags=True, + cache_timeout=None, conditional=False, last_modified=None): + """Sends the contents of a file to the client. This will use the + most efficient method available and configured. By default it will + try to use the WSGI server's file_wrapper support. Alternatively + you can set the application's :attr:`~Flask.use_x_sendfile` attribute + to ``True`` to directly emit an ``X-Sendfile`` header. This however + requires support of the underlying webserver for ``X-Sendfile``. + + By default it will try to guess the mimetype for you, but you can + also explicitly provide one. For extra security you probably want + to send certain files as attachment (HTML for instance). The mimetype + guessing requires a `filename` or an `attachment_filename` to be + provided. + + ETags will also be attached automatically if a `filename` is provided. You + can turn this off by setting `add_etags=False`. + + If `conditional=True` and `filename` is provided, this method will try to + upgrade the response stream to support range requests. This will allow + the request to be answered with partial content response. + + Please never pass filenames to this function from user sources; + you should use :func:`send_from_directory` instead. + + .. versionadded:: 0.2 + + .. versionadded:: 0.5 + The `add_etags`, `cache_timeout` and `conditional` parameters were + added. The default behavior is now to attach etags. + + .. versionchanged:: 0.7 + mimetype guessing and etag support for file objects was + deprecated because it was unreliable. Pass a filename if you are + able to, otherwise attach an etag yourself. This functionality + will be removed in Flask 1.0 + + .. versionchanged:: 0.9 + cache_timeout pulls its default from application config, when None. + + .. versionchanged:: 0.12 + The filename is no longer automatically inferred from file objects. If + you want to use automatic mimetype and etag support, pass a filepath via + `filename_or_fp` or `attachment_filename`. + + .. versionchanged:: 0.12 + The `attachment_filename` is preferred over `filename` for MIME-type + detection. + + :param filename_or_fp: the filename of the file to send in `latin-1`. + This is relative to the :attr:`~Flask.root_path` + if a relative path is specified. + Alternatively a file object might be provided in + which case ``X-Sendfile`` might not work and fall + back to the traditional method. Make sure that the + file pointer is positioned at the start of data to + send before calling :func:`send_file`. + :param mimetype: the mimetype of the file if provided. If a file path is + given, auto detection happens as fallback, otherwise an + error will be raised. + :param as_attachment: set to ``True`` if you want to send this file with + a ``Content-Disposition: attachment`` header. + :param attachment_filename: the filename for the attachment if it + differs from the file's filename. + :param add_etags: set to ``False`` to disable attaching of etags. + :param conditional: set to ``True`` to enable conditional responses. + + :param cache_timeout: the timeout in seconds for the headers. When ``None`` + (default), this value is set by + :meth:`~Flask.get_send_file_max_age` of + :data:`~flask.current_app`. + :param last_modified: set the ``Last-Modified`` header to this value, + a :class:`~datetime.datetime` or timestamp. + If a file was passed, this overrides its mtime. + """ + mtime = None + fsize = None + if isinstance(filename_or_fp, string_types): + filename = filename_or_fp + if not os.path.isabs(filename): + filename = os.path.join(current_app.root_path, filename) + file = None + if attachment_filename is None: + attachment_filename = os.path.basename(filename) + else: + file = filename_or_fp + filename = None + + if mimetype is None: + if attachment_filename is not None: + mimetype = mimetypes.guess_type(attachment_filename)[0] \ + or 'application/octet-stream' + + if mimetype is None: + raise ValueError( + 'Unable to infer MIME-type because no filename is available. ' + 'Please set either `attachment_filename`, pass a filepath to ' + '`filename_or_fp` or set your own MIME-type via `mimetype`.' + ) + + headers = Headers() + if as_attachment: + if attachment_filename is None: + raise TypeError('filename unavailable, required for ' + 'sending as attachment') + headers.add('Content-Disposition', 'attachment', + filename=attachment_filename) + + if current_app.use_x_sendfile and filename: + if file is not None: + file.close() + headers['X-Sendfile'] = filename + fsize = os.path.getsize(filename) + headers['Content-Length'] = fsize + data = None + else: + if file is None: + file = open(filename, 'rb') + mtime = os.path.getmtime(filename) + fsize = os.path.getsize(filename) + headers['Content-Length'] = fsize + data = wrap_file(request.environ, file) + + rv = current_app.response_class(data, mimetype=mimetype, headers=headers, + direct_passthrough=True) + + if last_modified is not None: + rv.last_modified = last_modified + elif mtime is not None: + rv.last_modified = mtime + + rv.cache_control.public = True + if cache_timeout is None: + cache_timeout = current_app.get_send_file_max_age(filename) + if cache_timeout is not None: + rv.cache_control.max_age = cache_timeout + rv.expires = int(time() + cache_timeout) + + if add_etags and filename is not None: + from warnings import warn + + try: + rv.set_etag('%s-%s-%s' % ( + os.path.getmtime(filename), + os.path.getsize(filename), + adler32( + filename.encode('utf-8') if isinstance(filename, text_type) + else filename + ) & 0xffffffff + )) + except OSError: + warn('Access %s failed, maybe it does not exist, so ignore etags in ' + 'headers' % filename, stacklevel=2) + + if conditional: + if callable(getattr(Range, 'to_content_range_header', None)): + # Werkzeug supports Range Requests + # Remove this test when support for Werkzeug <0.12 is dropped + try: + rv = rv.make_conditional(request, accept_ranges=True, + complete_length=fsize) + except RequestedRangeNotSatisfiable: + file.close() + raise + else: + rv = rv.make_conditional(request) + # make sure we don't send x-sendfile for servers that + # ignore the 304 status code for x-sendfile. + if rv.status_code == 304: + rv.headers.pop('x-sendfile', None) + return rv + + +def safe_join(directory, *pathnames): + """Safely join `directory` and zero or more untrusted `pathnames` + components. + + Example usage:: + + @app.route('/wiki/') + def wiki_page(filename): + filename = safe_join(app.config['WIKI_FOLDER'], filename) + with open(filename, 'rb') as fd: + content = fd.read() # Read and process the file content... + + :param directory: the trusted base directory. + :param pathnames: the untrusted pathnames relative to that directory. + :raises: :class:`~werkzeug.exceptions.NotFound` if one or more passed + paths fall out of its boundaries. + """ + + parts = [directory] + + for filename in pathnames: + if filename != '': + filename = posixpath.normpath(filename) + + if ( + any(sep in filename for sep in _os_alt_seps) + or os.path.isabs(filename) + or filename == '..' + or filename.startswith('../') + ): + raise NotFound() + + parts.append(filename) + + return posixpath.join(*parts) + + +def send_from_directory(directory, filename, **options): + """Send a file from a given directory with :func:`send_file`. This + is a secure way to quickly expose static files from an upload folder + or something similar. + + Example usage:: + + @app.route('/uploads/') + def download_file(filename): + return send_from_directory(app.config['UPLOAD_FOLDER'], + filename, as_attachment=True) + + .. admonition:: Sending files and Performance + + It is strongly recommended to activate either ``X-Sendfile`` support in + your webserver or (if no authentication happens) to tell the webserver + to serve files for the given path on its own without calling into the + web application for improved performance. + + .. versionadded:: 0.5 + + :param directory: the directory where all the files are stored. + :param filename: the filename relative to that directory to + download. + :param options: optional keyword arguments that are directly + forwarded to :func:`send_file`. + """ + filename = safe_join(directory, filename) + if not os.path.isabs(filename): + filename = os.path.join(current_app.root_path, filename) + try: + if not os.path.isfile(filename): + raise NotFound() + except (TypeError, ValueError): + raise BadRequest() + options.setdefault('conditional', True) + return send_file(filename, **options) + + +def get_root_path(import_name): + """Returns the path to a package or cwd if that cannot be found. This + returns the path of a package or the folder that contains a module. + + Not to be confused with the package path returned by :func:`find_package`. + """ + # Module already imported and has a file attribute. Use that first. + mod = sys.modules.get(import_name) + if mod is not None and hasattr(mod, '__file__'): + return os.path.dirname(os.path.abspath(mod.__file__)) + + # Next attempt: check the loader. + loader = pkgutil.get_loader(import_name) + + # Loader does not exist or we're referring to an unloaded main module + # or a main module without path (interactive sessions), go with the + # current working directory. + if loader is None or import_name == '__main__': + return os.getcwd() + + # For .egg, zipimporter does not have get_filename until Python 2.7. + # Some other loaders might exhibit the same behavior. + if hasattr(loader, 'get_filename'): + filepath = loader.get_filename(import_name) + else: + # Fall back to imports. + __import__(import_name) + mod = sys.modules[import_name] + filepath = getattr(mod, '__file__', None) + + # If we don't have a filepath it might be because we are a + # namespace package. In this case we pick the root path from the + # first module that is contained in our package. + if filepath is None: + raise RuntimeError('No root path can be found for the provided ' + 'module "%s". This can happen because the ' + 'module came from an import hook that does ' + 'not provide file name information or because ' + 'it\'s a namespace package. In this case ' + 'the root path needs to be explicitly ' + 'provided.' % import_name) + + # filepath is import_name.py for a module, or __init__.py for a package. + return os.path.dirname(os.path.abspath(filepath)) + + +def _matching_loader_thinks_module_is_package(loader, mod_name): + """Given the loader that loaded a module and the module this function + attempts to figure out if the given module is actually a package. + """ + # If the loader can tell us if something is a package, we can + # directly ask the loader. + if hasattr(loader, 'is_package'): + return loader.is_package(mod_name) + # importlib's namespace loaders do not have this functionality but + # all the modules it loads are packages, so we can take advantage of + # this information. + elif (loader.__class__.__module__ == '_frozen_importlib' and + loader.__class__.__name__ == 'NamespaceLoader'): + return True + # Otherwise we need to fail with an error that explains what went + # wrong. + raise AttributeError( + ('%s.is_package() method is missing but is required by Flask of ' + 'PEP 302 import hooks. If you do not use import hooks and ' + 'you encounter this error please file a bug against Flask.') % + loader.__class__.__name__) + + +def find_package(import_name): + """Finds a package and returns the prefix (or None if the package is + not installed) as well as the folder that contains the package or + module as a tuple. The package path returned is the module that would + have to be added to the pythonpath in order to make it possible to + import the module. The prefix is the path below which a UNIX like + folder structure exists (lib, share etc.). + """ + root_mod_name = import_name.split('.')[0] + loader = pkgutil.get_loader(root_mod_name) + if loader is None or import_name == '__main__': + # import name is not found, or interactive/main module + package_path = os.getcwd() + else: + # For .egg, zipimporter does not have get_filename until Python 2.7. + if hasattr(loader, 'get_filename'): + filename = loader.get_filename(root_mod_name) + elif hasattr(loader, 'archive'): + # zipimporter's loader.archive points to the .egg or .zip + # archive filename is dropped in call to dirname below. + filename = loader.archive + else: + # At least one loader is missing both get_filename and archive: + # Google App Engine's HardenedModulesHook + # + # Fall back to imports. + __import__(import_name) + filename = sys.modules[import_name].__file__ + package_path = os.path.abspath(os.path.dirname(filename)) + + # In case the root module is a package we need to chop of the + # rightmost part. This needs to go through a helper function + # because of python 3.3 namespace packages. + if _matching_loader_thinks_module_is_package( + loader, root_mod_name): + package_path = os.path.dirname(package_path) + + site_parent, site_folder = os.path.split(package_path) + py_prefix = os.path.abspath(sys.prefix) + if package_path.startswith(py_prefix): + return py_prefix, package_path + elif site_folder.lower() == 'site-packages': + parent, folder = os.path.split(site_parent) + # Windows like installations + if folder.lower() == 'lib': + base_dir = parent + # UNIX like installations + elif os.path.basename(parent).lower() == 'lib': + base_dir = os.path.dirname(parent) + else: + base_dir = site_parent + return base_dir, package_path + return None, package_path + + +class locked_cached_property(object): + """A decorator that converts a function into a lazy property. The + function wrapped is called the first time to retrieve the result + and then that calculated result is used the next time you access + the value. Works like the one in Werkzeug but has a lock for + thread safety. + """ + + def __init__(self, func, name=None, doc=None): + self.__name__ = name or func.__name__ + self.__module__ = func.__module__ + self.__doc__ = doc or func.__doc__ + self.func = func + self.lock = RLock() + + def __get__(self, obj, type=None): + if obj is None: + return self + with self.lock: + value = obj.__dict__.get(self.__name__, _missing) + if value is _missing: + value = self.func(obj) + obj.__dict__[self.__name__] = value + return value + + +class _PackageBoundObject(object): + + def __init__(self, import_name, template_folder=None, root_path=None): + #: The name of the package or module. Do not change this once + #: it was set by the constructor. + self.import_name = import_name + + #: location of the templates. ``None`` if templates should not be + #: exposed. + self.template_folder = template_folder + + if root_path is None: + root_path = get_root_path(self.import_name) + + #: Where is the app root located? + self.root_path = root_path + + self._static_folder = None + self._static_url_path = None + + def _get_static_folder(self): + if self._static_folder is not None: + return os.path.join(self.root_path, self._static_folder) + def _set_static_folder(self, value): + self._static_folder = value + static_folder = property(_get_static_folder, _set_static_folder, doc=''' + The absolute path to the configured static folder. + ''') + del _get_static_folder, _set_static_folder + + def _get_static_url_path(self): + if self._static_url_path is not None: + return self._static_url_path + if self.static_folder is not None: + return '/' + os.path.basename(self.static_folder) + def _set_static_url_path(self, value): + self._static_url_path = value + static_url_path = property(_get_static_url_path, _set_static_url_path) + del _get_static_url_path, _set_static_url_path + + @property + def has_static_folder(self): + """This is ``True`` if the package bound object's container has a + folder for static files. + + .. versionadded:: 0.5 + """ + return self.static_folder is not None + + @locked_cached_property + def jinja_loader(self): + """The Jinja loader for this package bound object. + + .. versionadded:: 0.5 + """ + if self.template_folder is not None: + return FileSystemLoader(os.path.join(self.root_path, + self.template_folder)) + + def get_send_file_max_age(self, filename): + """Provides default cache_timeout for the :func:`send_file` functions. + + By default, this function returns ``SEND_FILE_MAX_AGE_DEFAULT`` from + the configuration of :data:`~flask.current_app`. + + Static file functions such as :func:`send_from_directory` use this + function, and :func:`send_file` calls this function on + :data:`~flask.current_app` when the given cache_timeout is ``None``. If a + cache_timeout is given in :func:`send_file`, that timeout is used; + otherwise, this method is called. + + This allows subclasses to change the behavior when sending files based + on the filename. For example, to set the cache timeout for .js files + to 60 seconds:: + + class MyFlask(flask.Flask): + def get_send_file_max_age(self, name): + if name.lower().endswith('.js'): + return 60 + return flask.Flask.get_send_file_max_age(self, name) + + .. versionadded:: 0.9 + """ + return total_seconds(current_app.send_file_max_age_default) + + def send_static_file(self, filename): + """Function used internally to send static files from the static + folder to the browser. + + .. versionadded:: 0.5 + """ + if not self.has_static_folder: + raise RuntimeError('No static folder for this object') + # Ensure get_send_file_max_age is called in all cases. + # Here, we ensure get_send_file_max_age is called for Blueprints. + cache_timeout = self.get_send_file_max_age(filename) + return send_from_directory(self.static_folder, filename, + cache_timeout=cache_timeout) + + def open_resource(self, resource, mode='rb'): + """Opens a resource from the application's resource folder. To see + how this works, consider the following folder structure:: + + /myapplication.py + /schema.sql + /static + /style.css + /templates + /layout.html + /index.html + + If you want to open the :file:`schema.sql` file you would do the + following:: + + with app.open_resource('schema.sql') as f: + contents = f.read() + do_something_with(contents) + + :param resource: the name of the resource. To access resources within + subfolders use forward slashes as separator. + :param mode: resource file opening mode, default is 'rb'. + """ + if mode not in ('r', 'rb'): + raise ValueError('Resources can only be opened for reading') + return open(os.path.join(self.root_path, resource), mode) + + +def total_seconds(td): + """Returns the total seconds from a timedelta object. + + :param timedelta td: the timedelta to be converted in seconds + + :returns: number of seconds + :rtype: int + """ + return td.days * 60 * 60 * 24 + td.seconds diff --git a/website/web/Lib/site-packages/flask/json.py b/website/web/Lib/site-packages/flask/json.py new file mode 100644 index 000000000..16e0c2956 --- /dev/null +++ b/website/web/Lib/site-packages/flask/json.py @@ -0,0 +1,269 @@ +# -*- coding: utf-8 -*- +""" + flask.jsonimpl + ~~~~~~~~~~~~~~ + + Implementation helpers for the JSON support in Flask. + + :copyright: (c) 2015 by Armin Ronacher. + :license: BSD, see LICENSE for more details. +""" +import io +import uuid +from datetime import date +from .globals import current_app, request +from ._compat import text_type, PY2 + +from werkzeug.http import http_date +from jinja2 import Markup + +# Use the same json implementation as itsdangerous on which we +# depend anyways. +from itsdangerous import json as _json + + +# Figure out if simplejson escapes slashes. This behavior was changed +# from one version to another without reason. +_slash_escape = '\\/' not in _json.dumps('/') + + +__all__ = ['dump', 'dumps', 'load', 'loads', 'htmlsafe_dump', + 'htmlsafe_dumps', 'JSONDecoder', 'JSONEncoder', + 'jsonify'] + + +def _wrap_reader_for_text(fp, encoding): + if isinstance(fp.read(0), bytes): + fp = io.TextIOWrapper(io.BufferedReader(fp), encoding) + return fp + + +def _wrap_writer_for_text(fp, encoding): + try: + fp.write('') + except TypeError: + fp = io.TextIOWrapper(fp, encoding) + return fp + + +class JSONEncoder(_json.JSONEncoder): + """The default Flask JSON encoder. This one extends the default simplejson + encoder by also supporting ``datetime`` objects, ``UUID`` as well as + ``Markup`` objects which are serialized as RFC 822 datetime strings (same + as the HTTP date format). In order to support more data types override the + :meth:`default` method. + """ + + def default(self, o): + """Implement this method in a subclass such that it returns a + serializable object for ``o``, or calls the base implementation (to + raise a :exc:`TypeError`). + + For example, to support arbitrary iterators, you could implement + default like this:: + + def default(self, o): + try: + iterable = iter(o) + except TypeError: + pass + else: + return list(iterable) + return JSONEncoder.default(self, o) + """ + if isinstance(o, date): + return http_date(o.timetuple()) + if isinstance(o, uuid.UUID): + return str(o) + if hasattr(o, '__html__'): + return text_type(o.__html__()) + return _json.JSONEncoder.default(self, o) + + +class JSONDecoder(_json.JSONDecoder): + """The default JSON decoder. This one does not change the behavior from + the default simplejson decoder. Consult the :mod:`json` documentation + for more information. This decoder is not only used for the load + functions of this module but also :attr:`~flask.Request`. + """ + + +def _dump_arg_defaults(kwargs): + """Inject default arguments for dump functions.""" + if current_app: + kwargs.setdefault('cls', current_app.json_encoder) + if not current_app.config['JSON_AS_ASCII']: + kwargs.setdefault('ensure_ascii', False) + kwargs.setdefault('sort_keys', current_app.config['JSON_SORT_KEYS']) + else: + kwargs.setdefault('sort_keys', True) + kwargs.setdefault('cls', JSONEncoder) + + +def _load_arg_defaults(kwargs): + """Inject default arguments for load functions.""" + if current_app: + kwargs.setdefault('cls', current_app.json_decoder) + else: + kwargs.setdefault('cls', JSONDecoder) + + +def dumps(obj, **kwargs): + """Serialize ``obj`` to a JSON formatted ``str`` by using the application's + configured encoder (:attr:`~flask.Flask.json_encoder`) if there is an + application on the stack. + + This function can return ``unicode`` strings or ascii-only bytestrings by + default which coerce into unicode strings automatically. That behavior by + default is controlled by the ``JSON_AS_ASCII`` configuration variable + and can be overridden by the simplejson ``ensure_ascii`` parameter. + """ + _dump_arg_defaults(kwargs) + encoding = kwargs.pop('encoding', None) + rv = _json.dumps(obj, **kwargs) + if encoding is not None and isinstance(rv, text_type): + rv = rv.encode(encoding) + return rv + + +def dump(obj, fp, **kwargs): + """Like :func:`dumps` but writes into a file object.""" + _dump_arg_defaults(kwargs) + encoding = kwargs.pop('encoding', None) + if encoding is not None: + fp = _wrap_writer_for_text(fp, encoding) + _json.dump(obj, fp, **kwargs) + + +def loads(s, **kwargs): + """Unserialize a JSON object from a string ``s`` by using the application's + configured decoder (:attr:`~flask.Flask.json_decoder`) if there is an + application on the stack. + """ + _load_arg_defaults(kwargs) + if isinstance(s, bytes): + s = s.decode(kwargs.pop('encoding', None) or 'utf-8') + return _json.loads(s, **kwargs) + + +def load(fp, **kwargs): + """Like :func:`loads` but reads from a file object. + """ + _load_arg_defaults(kwargs) + if not PY2: + fp = _wrap_reader_for_text(fp, kwargs.pop('encoding', None) or 'utf-8') + return _json.load(fp, **kwargs) + + +def htmlsafe_dumps(obj, **kwargs): + """Works exactly like :func:`dumps` but is safe for use in ``') + # => <script> do_nasty_stuff() </script> + # sanitize_html('Click here for $100') + # => Click here for $100 + def sanitize_token(self, token): + + # accommodate filters which use token_type differently + token_type = token["type"] + if token_type in ("StartTag", "EndTag", "EmptyTag"): + name = token["name"] + namespace = token["namespace"] + if ((namespace, name) in self.allowed_elements or + (namespace is None and + (namespaces["html"], name) in self.allowed_elements)): + return self.allowed_token(token) + else: + return self.disallowed_token(token) + elif token_type == "Comment": + pass + else: + return token + + def allowed_token(self, token): + if "data" in token: + attrs = token["data"] + attr_names = set(attrs.keys()) + + # Remove forbidden attributes + for to_remove in (attr_names - self.allowed_attributes): + del token["data"][to_remove] + attr_names.remove(to_remove) + + # Remove attributes with disallowed URL values + for attr in (attr_names & self.attr_val_is_uri): + assert attr in attrs + # I don't have a clue where this regexp comes from or why it matches those + # characters, nor why we call unescape. I just know it's always been here. + # Should you be worried by this comment in a sanitizer? Yes. On the other hand, all + # this will do is remove *more* than it otherwise would. + val_unescaped = re.sub("[`\x00-\x20\x7f-\xa0\s]+", '', + unescape(attrs[attr])).lower() + # remove replacement characters from unescaped characters + val_unescaped = val_unescaped.replace("\ufffd", "") + try: + uri = urlparse.urlparse(val_unescaped) + except ValueError: + uri = None + del attrs[attr] + if uri and uri.scheme: + if uri.scheme not in self.allowed_protocols: + del attrs[attr] + if uri.scheme == 'data': + m = data_content_type.match(uri.path) + if not m: + del attrs[attr] + elif m.group('content_type') not in self.allowed_content_types: + del attrs[attr] + + for attr in self.svg_attr_val_allows_ref: + if attr in attrs: + attrs[attr] = re.sub(r'url\s*\(\s*[^#\s][^)]+?\)', + ' ', + unescape(attrs[attr])) + if (token["name"] in self.svg_allow_local_href and + (namespaces['xlink'], 'href') in attrs and re.search('^\s*[^#\s].*', + attrs[(namespaces['xlink'], 'href')])): + del attrs[(namespaces['xlink'], 'href')] + if (None, 'style') in attrs: + attrs[(None, 'style')] = self.sanitize_css(attrs[(None, 'style')]) + token["data"] = attrs + return token + + def disallowed_token(self, token): + token_type = token["type"] + if token_type == "EndTag": + token["data"] = "" % token["name"] + elif token["data"]: + assert token_type in ("StartTag", "EmptyTag") + attrs = [] + for (ns, name), v in token["data"].items(): + attrs.append(' %s="%s"' % (name if ns is None else "%s:%s" % (prefixes[ns], name), escape(v))) + token["data"] = "<%s%s>" % (token["name"], ''.join(attrs)) + else: + token["data"] = "<%s>" % token["name"] + if token.get("selfClosing"): + token["data"] = token["data"][:-1] + "/>" + + token["type"] = "Characters" + + del token["name"] + return token + + def sanitize_css(self, style): + # disallow urls + style = re.compile('url\s*\(\s*[^\s)]+?\s*\)\s*').sub(' ', style) + + # gauntlet + if not re.match("""^([:,;#%.\sa-zA-Z0-9!]|\w-\w|'[\s\w]+'|"[\s\w]+"|\([\d,\s]+\))*$""", style): + return '' + if not re.match("^\s*([-\w]+\s*:[^:;]*(;\s*|$))*$", style): + return '' + + clean = [] + for prop, value in re.findall("([-\w]+)\s*:\s*([^:;]*)", style): + if not value: + continue + if prop.lower() in self.allowed_css_properties: + clean.append(prop + ': ' + value + ';') + elif prop.split('-')[0].lower() in ['background', 'border', 'margin', + 'padding']: + for keyword in value.split(): + if keyword not in self.allowed_css_keywords and \ + not re.match("^(#[0-9a-f]+|rgb\(\d+%?,\d*%?,?\d*%?\)?|\d{0,2}\.?\d{0,2}(cm|em|ex|in|mm|pc|pt|px|%|,|\))?)$", keyword): # noqa + break + else: + clean.append(prop + ': ' + value + ';') + elif prop.lower() in self.allowed_svg_properties: + clean.append(prop + ': ' + value + ';') + + return ' '.join(clean) diff --git a/website/web/Lib/site-packages/pip/_vendor/html5lib/filters/whitespace.py b/website/web/Lib/site-packages/pip/_vendor/html5lib/filters/whitespace.py new file mode 100644 index 000000000..892105287 --- /dev/null +++ b/website/web/Lib/site-packages/pip/_vendor/html5lib/filters/whitespace.py @@ -0,0 +1,38 @@ +from __future__ import absolute_import, division, unicode_literals + +import re + +from . import base +from ..constants import rcdataElements, spaceCharacters +spaceCharacters = "".join(spaceCharacters) + +SPACES_REGEX = re.compile("[%s]+" % spaceCharacters) + + +class Filter(base.Filter): + + spacePreserveElements = frozenset(["pre", "textarea"] + list(rcdataElements)) + + def __iter__(self): + preserve = 0 + for token in base.Filter.__iter__(self): + type = token["type"] + if type == "StartTag" \ + and (preserve or token["name"] in self.spacePreserveElements): + preserve += 1 + + elif type == "EndTag" and preserve: + preserve -= 1 + + elif not preserve and type == "SpaceCharacters" and token["data"]: + # Test on token["data"] above to not introduce spaces where there were not + token["data"] = " " + + elif not preserve and type == "Characters": + token["data"] = collapse_spaces(token["data"]) + + yield token + + +def collapse_spaces(text): + return SPACES_REGEX.sub(' ', text) diff --git a/website/web/Lib/site-packages/pip/_vendor/html5lib/html5parser.py b/website/web/Lib/site-packages/pip/_vendor/html5lib/html5parser.py new file mode 100644 index 000000000..f7043cb19 --- /dev/null +++ b/website/web/Lib/site-packages/pip/_vendor/html5lib/html5parser.py @@ -0,0 +1,2733 @@ +from __future__ import absolute_import, division, unicode_literals +from pip._vendor.six import with_metaclass, viewkeys, PY3 + +import types + +try: + from collections import OrderedDict +except ImportError: + from pip._vendor.ordereddict import OrderedDict + +from . import _inputstream +from . import _tokenizer + +from . import treebuilders +from .treebuilders.base import Marker + +from . import _utils +from .constants import ( + spaceCharacters, asciiUpper2Lower, + specialElements, headingElements, cdataElements, rcdataElements, + tokenTypes, tagTokenTypes, + namespaces, + htmlIntegrationPointElements, mathmlTextIntegrationPointElements, + adjustForeignAttributes as adjustForeignAttributesMap, + adjustMathMLAttributes, adjustSVGAttributes, + E, + ReparseException +) + + +def parse(doc, treebuilder="etree", namespaceHTMLElements=True, **kwargs): + """Parse a string or file-like object into a tree""" + tb = treebuilders.getTreeBuilder(treebuilder) + p = HTMLParser(tb, namespaceHTMLElements=namespaceHTMLElements) + return p.parse(doc, **kwargs) + + +def parseFragment(doc, container="div", treebuilder="etree", namespaceHTMLElements=True, **kwargs): + tb = treebuilders.getTreeBuilder(treebuilder) + p = HTMLParser(tb, namespaceHTMLElements=namespaceHTMLElements) + return p.parseFragment(doc, container=container, **kwargs) + + +def method_decorator_metaclass(function): + class Decorated(type): + def __new__(meta, classname, bases, classDict): + for attributeName, attribute in classDict.items(): + if isinstance(attribute, types.FunctionType): + attribute = function(attribute) + + classDict[attributeName] = attribute + return type.__new__(meta, classname, bases, classDict) + return Decorated + + +class HTMLParser(object): + """HTML parser. Generates a tree structure from a stream of (possibly + malformed) HTML""" + + def __init__(self, tree=None, strict=False, namespaceHTMLElements=True, debug=False): + """ + strict - raise an exception when a parse error is encountered + + tree - a treebuilder class controlling the type of tree that will be + returned. Built in treebuilders can be accessed through + html5lib.treebuilders.getTreeBuilder(treeType) + """ + + # Raise an exception on the first error encountered + self.strict = strict + + if tree is None: + tree = treebuilders.getTreeBuilder("etree") + self.tree = tree(namespaceHTMLElements) + self.errors = [] + + self.phases = dict([(name, cls(self, self.tree)) for name, cls in + getPhases(debug).items()]) + + def _parse(self, stream, innerHTML=False, container="div", scripting=False, **kwargs): + + self.innerHTMLMode = innerHTML + self.container = container + self.scripting = scripting + self.tokenizer = _tokenizer.HTMLTokenizer(stream, parser=self, **kwargs) + self.reset() + + try: + self.mainLoop() + except ReparseException: + self.reset() + self.mainLoop() + + def reset(self): + self.tree.reset() + self.firstStartTag = False + self.errors = [] + self.log = [] # only used with debug mode + # "quirks" / "limited quirks" / "no quirks" + self.compatMode = "no quirks" + + if self.innerHTMLMode: + self.innerHTML = self.container.lower() + + if self.innerHTML in cdataElements: + self.tokenizer.state = self.tokenizer.rcdataState + elif self.innerHTML in rcdataElements: + self.tokenizer.state = self.tokenizer.rawtextState + elif self.innerHTML == 'plaintext': + self.tokenizer.state = self.tokenizer.plaintextState + else: + # state already is data state + # self.tokenizer.state = self.tokenizer.dataState + pass + self.phase = self.phases["beforeHtml"] + self.phase.insertHtmlElement() + self.resetInsertionMode() + else: + self.innerHTML = False # pylint:disable=redefined-variable-type + self.phase = self.phases["initial"] + + self.lastPhase = None + + self.beforeRCDataPhase = None + + self.framesetOK = True + + @property + def documentEncoding(self): + """The name of the character encoding + that was used to decode the input stream, + or :obj:`None` if that is not determined yet. + + """ + if not hasattr(self, 'tokenizer'): + return None + return self.tokenizer.stream.charEncoding[0].name + + def isHTMLIntegrationPoint(self, element): + if (element.name == "annotation-xml" and + element.namespace == namespaces["mathml"]): + return ("encoding" in element.attributes and + element.attributes["encoding"].translate( + asciiUpper2Lower) in + ("text/html", "application/xhtml+xml")) + else: + return (element.namespace, element.name) in htmlIntegrationPointElements + + def isMathMLTextIntegrationPoint(self, element): + return (element.namespace, element.name) in mathmlTextIntegrationPointElements + + def mainLoop(self): + CharactersToken = tokenTypes["Characters"] + SpaceCharactersToken = tokenTypes["SpaceCharacters"] + StartTagToken = tokenTypes["StartTag"] + EndTagToken = tokenTypes["EndTag"] + CommentToken = tokenTypes["Comment"] + DoctypeToken = tokenTypes["Doctype"] + ParseErrorToken = tokenTypes["ParseError"] + + for token in self.normalizedTokens(): + prev_token = None + new_token = token + while new_token is not None: + prev_token = new_token + currentNode = self.tree.openElements[-1] if self.tree.openElements else None + currentNodeNamespace = currentNode.namespace if currentNode else None + currentNodeName = currentNode.name if currentNode else None + + type = new_token["type"] + + if type == ParseErrorToken: + self.parseError(new_token["data"], new_token.get("datavars", {})) + new_token = None + else: + if (len(self.tree.openElements) == 0 or + currentNodeNamespace == self.tree.defaultNamespace or + (self.isMathMLTextIntegrationPoint(currentNode) and + ((type == StartTagToken and + token["name"] not in frozenset(["mglyph", "malignmark"])) or + type in (CharactersToken, SpaceCharactersToken))) or + (currentNodeNamespace == namespaces["mathml"] and + currentNodeName == "annotation-xml" and + type == StartTagToken and + token["name"] == "svg") or + (self.isHTMLIntegrationPoint(currentNode) and + type in (StartTagToken, CharactersToken, SpaceCharactersToken))): + phase = self.phase + else: + phase = self.phases["inForeignContent"] + + if type == CharactersToken: + new_token = phase.processCharacters(new_token) + elif type == SpaceCharactersToken: + new_token = phase.processSpaceCharacters(new_token) + elif type == StartTagToken: + new_token = phase.processStartTag(new_token) + elif type == EndTagToken: + new_token = phase.processEndTag(new_token) + elif type == CommentToken: + new_token = phase.processComment(new_token) + elif type == DoctypeToken: + new_token = phase.processDoctype(new_token) + + if (type == StartTagToken and prev_token["selfClosing"] and + not prev_token["selfClosingAcknowledged"]): + self.parseError("non-void-element-with-trailing-solidus", + {"name": prev_token["name"]}) + + # When the loop finishes it's EOF + reprocess = True + phases = [] + while reprocess: + phases.append(self.phase) + reprocess = self.phase.processEOF() + if reprocess: + assert self.phase not in phases + + def normalizedTokens(self): + for token in self.tokenizer: + yield self.normalizeToken(token) + + def parse(self, stream, *args, **kwargs): + """Parse a HTML document into a well-formed tree + + stream - a filelike object or string containing the HTML to be parsed + + The optional encoding parameter must be a string that indicates + the encoding. If specified, that encoding will be used, + regardless of any BOM or later declaration (such as in a meta + element) + + scripting - treat noscript elements as if javascript was turned on + """ + self._parse(stream, False, None, *args, **kwargs) + return self.tree.getDocument() + + def parseFragment(self, stream, *args, **kwargs): + """Parse a HTML fragment into a well-formed tree fragment + + container - name of the element we're setting the innerHTML property + if set to None, default to 'div' + + stream - a filelike object or string containing the HTML to be parsed + + The optional encoding parameter must be a string that indicates + the encoding. If specified, that encoding will be used, + regardless of any BOM or later declaration (such as in a meta + element) + + scripting - treat noscript elements as if javascript was turned on + """ + self._parse(stream, True, *args, **kwargs) + return self.tree.getFragment() + + def parseError(self, errorcode="XXX-undefined-error", datavars=None): + # XXX The idea is to make errorcode mandatory. + if datavars is None: + datavars = {} + self.errors.append((self.tokenizer.stream.position(), errorcode, datavars)) + if self.strict: + raise ParseError(E[errorcode] % datavars) + + def normalizeToken(self, token): + """ HTML5 specific normalizations to the token stream """ + + if token["type"] == tokenTypes["StartTag"]: + raw = token["data"] + token["data"] = OrderedDict(raw) + if len(raw) > len(token["data"]): + # we had some duplicated attribute, fix so first wins + token["data"].update(raw[::-1]) + + return token + + def adjustMathMLAttributes(self, token): + adjust_attributes(token, adjustMathMLAttributes) + + def adjustSVGAttributes(self, token): + adjust_attributes(token, adjustSVGAttributes) + + def adjustForeignAttributes(self, token): + adjust_attributes(token, adjustForeignAttributesMap) + + def reparseTokenNormal(self, token): + # pylint:disable=unused-argument + self.parser.phase() + + def resetInsertionMode(self): + # The name of this method is mostly historical. (It's also used in the + # specification.) + last = False + newModes = { + "select": "inSelect", + "td": "inCell", + "th": "inCell", + "tr": "inRow", + "tbody": "inTableBody", + "thead": "inTableBody", + "tfoot": "inTableBody", + "caption": "inCaption", + "colgroup": "inColumnGroup", + "table": "inTable", + "head": "inBody", + "body": "inBody", + "frameset": "inFrameset", + "html": "beforeHead" + } + for node in self.tree.openElements[::-1]: + nodeName = node.name + new_phase = None + if node == self.tree.openElements[0]: + assert self.innerHTML + last = True + nodeName = self.innerHTML + # Check for conditions that should only happen in the innerHTML + # case + if nodeName in ("select", "colgroup", "head", "html"): + assert self.innerHTML + + if not last and node.namespace != self.tree.defaultNamespace: + continue + + if nodeName in newModes: + new_phase = self.phases[newModes[nodeName]] + break + elif last: + new_phase = self.phases["inBody"] + break + + self.phase = new_phase + + def parseRCDataRawtext(self, token, contentType): + """Generic RCDATA/RAWTEXT Parsing algorithm + contentType - RCDATA or RAWTEXT + """ + assert contentType in ("RAWTEXT", "RCDATA") + + self.tree.insertElement(token) + + if contentType == "RAWTEXT": + self.tokenizer.state = self.tokenizer.rawtextState + else: + self.tokenizer.state = self.tokenizer.rcdataState + + self.originalPhase = self.phase + + self.phase = self.phases["text"] + + +@_utils.memoize +def getPhases(debug): + def log(function): + """Logger that records which phase processes each token""" + type_names = dict((value, key) for key, value in + tokenTypes.items()) + + def wrapped(self, *args, **kwargs): + if function.__name__.startswith("process") and len(args) > 0: + token = args[0] + try: + info = {"type": type_names[token['type']]} + except: + raise + if token['type'] in tagTokenTypes: + info["name"] = token['name'] + + self.parser.log.append((self.parser.tokenizer.state.__name__, + self.parser.phase.__class__.__name__, + self.__class__.__name__, + function.__name__, + info)) + return function(self, *args, **kwargs) + else: + return function(self, *args, **kwargs) + return wrapped + + def getMetaclass(use_metaclass, metaclass_func): + if use_metaclass: + return method_decorator_metaclass(metaclass_func) + else: + return type + + # pylint:disable=unused-argument + class Phase(with_metaclass(getMetaclass(debug, log))): + """Base class for helper object that implements each phase of processing + """ + + def __init__(self, parser, tree): + self.parser = parser + self.tree = tree + + def processEOF(self): + raise NotImplementedError + + def processComment(self, token): + # For most phases the following is correct. Where it's not it will be + # overridden. + self.tree.insertComment(token, self.tree.openElements[-1]) + + def processDoctype(self, token): + self.parser.parseError("unexpected-doctype") + + def processCharacters(self, token): + self.tree.insertText(token["data"]) + + def processSpaceCharacters(self, token): + self.tree.insertText(token["data"]) + + def processStartTag(self, token): + return self.startTagHandler[token["name"]](token) + + def startTagHtml(self, token): + if not self.parser.firstStartTag and token["name"] == "html": + self.parser.parseError("non-html-root") + # XXX Need a check here to see if the first start tag token emitted is + # this token... If it's not, invoke self.parser.parseError(). + for attr, value in token["data"].items(): + if attr not in self.tree.openElements[0].attributes: + self.tree.openElements[0].attributes[attr] = value + self.parser.firstStartTag = False + + def processEndTag(self, token): + return self.endTagHandler[token["name"]](token) + + class InitialPhase(Phase): + def processSpaceCharacters(self, token): + pass + + def processComment(self, token): + self.tree.insertComment(token, self.tree.document) + + def processDoctype(self, token): + name = token["name"] + publicId = token["publicId"] + systemId = token["systemId"] + correct = token["correct"] + + if (name != "html" or publicId is not None or + systemId is not None and systemId != "about:legacy-compat"): + self.parser.parseError("unknown-doctype") + + if publicId is None: + publicId = "" + + self.tree.insertDoctype(token) + + if publicId != "": + publicId = publicId.translate(asciiUpper2Lower) + + if (not correct or token["name"] != "html" or + publicId.startswith( + ("+//silmaril//dtd html pro v0r11 19970101//", + "-//advasoft ltd//dtd html 3.0 aswedit + extensions//", + "-//as//dtd html 3.0 aswedit + extensions//", + "-//ietf//dtd html 2.0 level 1//", + "-//ietf//dtd html 2.0 level 2//", + "-//ietf//dtd html 2.0 strict level 1//", + "-//ietf//dtd html 2.0 strict level 2//", + "-//ietf//dtd html 2.0 strict//", + "-//ietf//dtd html 2.0//", + "-//ietf//dtd html 2.1e//", + "-//ietf//dtd html 3.0//", + "-//ietf//dtd html 3.2 final//", + "-//ietf//dtd html 3.2//", + "-//ietf//dtd html 3//", + "-//ietf//dtd html level 0//", + "-//ietf//dtd html level 1//", + "-//ietf//dtd html level 2//", + "-//ietf//dtd html level 3//", + "-//ietf//dtd html strict level 0//", + "-//ietf//dtd html strict level 1//", + "-//ietf//dtd html strict level 2//", + "-//ietf//dtd html strict level 3//", + "-//ietf//dtd html strict//", + "-//ietf//dtd html//", + "-//metrius//dtd metrius presentational//", + "-//microsoft//dtd internet explorer 2.0 html strict//", + "-//microsoft//dtd internet explorer 2.0 html//", + "-//microsoft//dtd internet explorer 2.0 tables//", + "-//microsoft//dtd internet explorer 3.0 html strict//", + "-//microsoft//dtd internet explorer 3.0 html//", + "-//microsoft//dtd internet explorer 3.0 tables//", + "-//netscape comm. corp.//dtd html//", + "-//netscape comm. corp.//dtd strict html//", + "-//o'reilly and associates//dtd html 2.0//", + "-//o'reilly and associates//dtd html extended 1.0//", + "-//o'reilly and associates//dtd html extended relaxed 1.0//", + "-//softquad software//dtd hotmetal pro 6.0::19990601::extensions to html 4.0//", + "-//softquad//dtd hotmetal pro 4.0::19971010::extensions to html 4.0//", + "-//spyglass//dtd html 2.0 extended//", + "-//sq//dtd html 2.0 hotmetal + extensions//", + "-//sun microsystems corp.//dtd hotjava html//", + "-//sun microsystems corp.//dtd hotjava strict html//", + "-//w3c//dtd html 3 1995-03-24//", + "-//w3c//dtd html 3.2 draft//", + "-//w3c//dtd html 3.2 final//", + "-//w3c//dtd html 3.2//", + "-//w3c//dtd html 3.2s draft//", + "-//w3c//dtd html 4.0 frameset//", + "-//w3c//dtd html 4.0 transitional//", + "-//w3c//dtd html experimental 19960712//", + "-//w3c//dtd html experimental 970421//", + "-//w3c//dtd w3 html//", + "-//w3o//dtd w3 html 3.0//", + "-//webtechs//dtd mozilla html 2.0//", + "-//webtechs//dtd mozilla html//")) or + publicId in ("-//w3o//dtd w3 html strict 3.0//en//", + "-/w3c/dtd html 4.0 transitional/en", + "html") or + publicId.startswith( + ("-//w3c//dtd html 4.01 frameset//", + "-//w3c//dtd html 4.01 transitional//")) and + systemId is None or + systemId and systemId.lower() == "http://www.ibm.com/data/dtd/v11/ibmxhtml1-transitional.dtd"): + self.parser.compatMode = "quirks" + elif (publicId.startswith( + ("-//w3c//dtd xhtml 1.0 frameset//", + "-//w3c//dtd xhtml 1.0 transitional//")) or + publicId.startswith( + ("-//w3c//dtd html 4.01 frameset//", + "-//w3c//dtd html 4.01 transitional//")) and + systemId is not None): + self.parser.compatMode = "limited quirks" + + self.parser.phase = self.parser.phases["beforeHtml"] + + def anythingElse(self): + self.parser.compatMode = "quirks" + self.parser.phase = self.parser.phases["beforeHtml"] + + def processCharacters(self, token): + self.parser.parseError("expected-doctype-but-got-chars") + self.anythingElse() + return token + + def processStartTag(self, token): + self.parser.parseError("expected-doctype-but-got-start-tag", + {"name": token["name"]}) + self.anythingElse() + return token + + def processEndTag(self, token): + self.parser.parseError("expected-doctype-but-got-end-tag", + {"name": token["name"]}) + self.anythingElse() + return token + + def processEOF(self): + self.parser.parseError("expected-doctype-but-got-eof") + self.anythingElse() + return True + + class BeforeHtmlPhase(Phase): + # helper methods + def insertHtmlElement(self): + self.tree.insertRoot(impliedTagToken("html", "StartTag")) + self.parser.phase = self.parser.phases["beforeHead"] + + # other + def processEOF(self): + self.insertHtmlElement() + return True + + def processComment(self, token): + self.tree.insertComment(token, self.tree.document) + + def processSpaceCharacters(self, token): + pass + + def processCharacters(self, token): + self.insertHtmlElement() + return token + + def processStartTag(self, token): + if token["name"] == "html": + self.parser.firstStartTag = True + self.insertHtmlElement() + return token + + def processEndTag(self, token): + if token["name"] not in ("head", "body", "html", "br"): + self.parser.parseError("unexpected-end-tag-before-html", + {"name": token["name"]}) + else: + self.insertHtmlElement() + return token + + class BeforeHeadPhase(Phase): + def __init__(self, parser, tree): + Phase.__init__(self, parser, tree) + + self.startTagHandler = _utils.MethodDispatcher([ + ("html", self.startTagHtml), + ("head", self.startTagHead) + ]) + self.startTagHandler.default = self.startTagOther + + self.endTagHandler = _utils.MethodDispatcher([ + (("head", "body", "html", "br"), self.endTagImplyHead) + ]) + self.endTagHandler.default = self.endTagOther + + def processEOF(self): + self.startTagHead(impliedTagToken("head", "StartTag")) + return True + + def processSpaceCharacters(self, token): + pass + + def processCharacters(self, token): + self.startTagHead(impliedTagToken("head", "StartTag")) + return token + + def startTagHtml(self, token): + return self.parser.phases["inBody"].processStartTag(token) + + def startTagHead(self, token): + self.tree.insertElement(token) + self.tree.headPointer = self.tree.openElements[-1] + self.parser.phase = self.parser.phases["inHead"] + + def startTagOther(self, token): + self.startTagHead(impliedTagToken("head", "StartTag")) + return token + + def endTagImplyHead(self, token): + self.startTagHead(impliedTagToken("head", "StartTag")) + return token + + def endTagOther(self, token): + self.parser.parseError("end-tag-after-implied-root", + {"name": token["name"]}) + + class InHeadPhase(Phase): + def __init__(self, parser, tree): + Phase.__init__(self, parser, tree) + + self.startTagHandler = _utils.MethodDispatcher([ + ("html", self.startTagHtml), + ("title", self.startTagTitle), + (("noframes", "style"), self.startTagNoFramesStyle), + ("noscript", self.startTagNoscript), + ("script", self.startTagScript), + (("base", "basefont", "bgsound", "command", "link"), + self.startTagBaseLinkCommand), + ("meta", self.startTagMeta), + ("head", self.startTagHead) + ]) + self.startTagHandler.default = self.startTagOther + + self.endTagHandler = _utils.MethodDispatcher([ + ("head", self.endTagHead), + (("br", "html", "body"), self.endTagHtmlBodyBr) + ]) + self.endTagHandler.default = self.endTagOther + + # the real thing + def processEOF(self): + self.anythingElse() + return True + + def processCharacters(self, token): + self.anythingElse() + return token + + def startTagHtml(self, token): + return self.parser.phases["inBody"].processStartTag(token) + + def startTagHead(self, token): + self.parser.parseError("two-heads-are-not-better-than-one") + + def startTagBaseLinkCommand(self, token): + self.tree.insertElement(token) + self.tree.openElements.pop() + token["selfClosingAcknowledged"] = True + + def startTagMeta(self, token): + self.tree.insertElement(token) + self.tree.openElements.pop() + token["selfClosingAcknowledged"] = True + + attributes = token["data"] + if self.parser.tokenizer.stream.charEncoding[1] == "tentative": + if "charset" in attributes: + self.parser.tokenizer.stream.changeEncoding(attributes["charset"]) + elif ("content" in attributes and + "http-equiv" in attributes and + attributes["http-equiv"].lower() == "content-type"): + # Encoding it as UTF-8 here is a hack, as really we should pass + # the abstract Unicode string, and just use the + # ContentAttrParser on that, but using UTF-8 allows all chars + # to be encoded and as a ASCII-superset works. + data = _inputstream.EncodingBytes(attributes["content"].encode("utf-8")) + parser = _inputstream.ContentAttrParser(data) + codec = parser.parse() + self.parser.tokenizer.stream.changeEncoding(codec) + + def startTagTitle(self, token): + self.parser.parseRCDataRawtext(token, "RCDATA") + + def startTagNoFramesStyle(self, token): + # Need to decide whether to implement the scripting-disabled case + self.parser.parseRCDataRawtext(token, "RAWTEXT") + + def startTagNoscript(self, token): + if self.parser.scripting: + self.parser.parseRCDataRawtext(token, "RAWTEXT") + else: + self.tree.insertElement(token) + self.parser.phase = self.parser.phases["inHeadNoscript"] + + def startTagScript(self, token): + self.tree.insertElement(token) + self.parser.tokenizer.state = self.parser.tokenizer.scriptDataState + self.parser.originalPhase = self.parser.phase + self.parser.phase = self.parser.phases["text"] + + def startTagOther(self, token): + self.anythingElse() + return token + + def endTagHead(self, token): + node = self.parser.tree.openElements.pop() + assert node.name == "head", "Expected head got %s" % node.name + self.parser.phase = self.parser.phases["afterHead"] + + def endTagHtmlBodyBr(self, token): + self.anythingElse() + return token + + def endTagOther(self, token): + self.parser.parseError("unexpected-end-tag", {"name": token["name"]}) + + def anythingElse(self): + self.endTagHead(impliedTagToken("head")) + + class InHeadNoscriptPhase(Phase): + def __init__(self, parser, tree): + Phase.__init__(self, parser, tree) + + self.startTagHandler = _utils.MethodDispatcher([ + ("html", self.startTagHtml), + (("basefont", "bgsound", "link", "meta", "noframes", "style"), self.startTagBaseLinkCommand), + (("head", "noscript"), self.startTagHeadNoscript), + ]) + self.startTagHandler.default = self.startTagOther + + self.endTagHandler = _utils.MethodDispatcher([ + ("noscript", self.endTagNoscript), + ("br", self.endTagBr), + ]) + self.endTagHandler.default = self.endTagOther + + def processEOF(self): + self.parser.parseError("eof-in-head-noscript") + self.anythingElse() + return True + + def processComment(self, token): + return self.parser.phases["inHead"].processComment(token) + + def processCharacters(self, token): + self.parser.parseError("char-in-head-noscript") + self.anythingElse() + return token + + def processSpaceCharacters(self, token): + return self.parser.phases["inHead"].processSpaceCharacters(token) + + def startTagHtml(self, token): + return self.parser.phases["inBody"].processStartTag(token) + + def startTagBaseLinkCommand(self, token): + return self.parser.phases["inHead"].processStartTag(token) + + def startTagHeadNoscript(self, token): + self.parser.parseError("unexpected-start-tag", {"name": token["name"]}) + + def startTagOther(self, token): + self.parser.parseError("unexpected-inhead-noscript-tag", {"name": token["name"]}) + self.anythingElse() + return token + + def endTagNoscript(self, token): + node = self.parser.tree.openElements.pop() + assert node.name == "noscript", "Expected noscript got %s" % node.name + self.parser.phase = self.parser.phases["inHead"] + + def endTagBr(self, token): + self.parser.parseError("unexpected-inhead-noscript-tag", {"name": token["name"]}) + self.anythingElse() + return token + + def endTagOther(self, token): + self.parser.parseError("unexpected-end-tag", {"name": token["name"]}) + + def anythingElse(self): + # Caller must raise parse error first! + self.endTagNoscript(impliedTagToken("noscript")) + + class AfterHeadPhase(Phase): + def __init__(self, parser, tree): + Phase.__init__(self, parser, tree) + + self.startTagHandler = _utils.MethodDispatcher([ + ("html", self.startTagHtml), + ("body", self.startTagBody), + ("frameset", self.startTagFrameset), + (("base", "basefont", "bgsound", "link", "meta", "noframes", "script", + "style", "title"), + self.startTagFromHead), + ("head", self.startTagHead) + ]) + self.startTagHandler.default = self.startTagOther + self.endTagHandler = _utils.MethodDispatcher([(("body", "html", "br"), + self.endTagHtmlBodyBr)]) + self.endTagHandler.default = self.endTagOther + + def processEOF(self): + self.anythingElse() + return True + + def processCharacters(self, token): + self.anythingElse() + return token + + def startTagHtml(self, token): + return self.parser.phases["inBody"].processStartTag(token) + + def startTagBody(self, token): + self.parser.framesetOK = False + self.tree.insertElement(token) + self.parser.phase = self.parser.phases["inBody"] + + def startTagFrameset(self, token): + self.tree.insertElement(token) + self.parser.phase = self.parser.phases["inFrameset"] + + def startTagFromHead(self, token): + self.parser.parseError("unexpected-start-tag-out-of-my-head", + {"name": token["name"]}) + self.tree.openElements.append(self.tree.headPointer) + self.parser.phases["inHead"].processStartTag(token) + for node in self.tree.openElements[::-1]: + if node.name == "head": + self.tree.openElements.remove(node) + break + + def startTagHead(self, token): + self.parser.parseError("unexpected-start-tag", {"name": token["name"]}) + + def startTagOther(self, token): + self.anythingElse() + return token + + def endTagHtmlBodyBr(self, token): + self.anythingElse() + return token + + def endTagOther(self, token): + self.parser.parseError("unexpected-end-tag", {"name": token["name"]}) + + def anythingElse(self): + self.tree.insertElement(impliedTagToken("body", "StartTag")) + self.parser.phase = self.parser.phases["inBody"] + self.parser.framesetOK = True + + class InBodyPhase(Phase): + # http://www.whatwg.org/specs/web-apps/current-work/#parsing-main-inbody + # the really-really-really-very crazy mode + def __init__(self, parser, tree): + Phase.__init__(self, parser, tree) + + # Set this to the default handler + self.processSpaceCharacters = self.processSpaceCharactersNonPre + + self.startTagHandler = _utils.MethodDispatcher([ + ("html", self.startTagHtml), + (("base", "basefont", "bgsound", "command", "link", "meta", + "script", "style", "title"), + self.startTagProcessInHead), + ("body", self.startTagBody), + ("frameset", self.startTagFrameset), + (("address", "article", "aside", "blockquote", "center", "details", + "dir", "div", "dl", "fieldset", "figcaption", "figure", + "footer", "header", "hgroup", "main", "menu", "nav", "ol", "p", + "section", "summary", "ul"), + self.startTagCloseP), + (headingElements, self.startTagHeading), + (("pre", "listing"), self.startTagPreListing), + ("form", self.startTagForm), + (("li", "dd", "dt"), self.startTagListItem), + ("plaintext", self.startTagPlaintext), + ("a", self.startTagA), + (("b", "big", "code", "em", "font", "i", "s", "small", "strike", + "strong", "tt", "u"), self.startTagFormatting), + ("nobr", self.startTagNobr), + ("button", self.startTagButton), + (("applet", "marquee", "object"), self.startTagAppletMarqueeObject), + ("xmp", self.startTagXmp), + ("table", self.startTagTable), + (("area", "br", "embed", "img", "keygen", "wbr"), + self.startTagVoidFormatting), + (("param", "source", "track"), self.startTagParamSource), + ("input", self.startTagInput), + ("hr", self.startTagHr), + ("image", self.startTagImage), + ("isindex", self.startTagIsIndex), + ("textarea", self.startTagTextarea), + ("iframe", self.startTagIFrame), + ("noscript", self.startTagNoscript), + (("noembed", "noframes"), self.startTagRawtext), + ("select", self.startTagSelect), + (("rp", "rt"), self.startTagRpRt), + (("option", "optgroup"), self.startTagOpt), + (("math"), self.startTagMath), + (("svg"), self.startTagSvg), + (("caption", "col", "colgroup", "frame", "head", + "tbody", "td", "tfoot", "th", "thead", + "tr"), self.startTagMisplaced) + ]) + self.startTagHandler.default = self.startTagOther + + self.endTagHandler = _utils.MethodDispatcher([ + ("body", self.endTagBody), + ("html", self.endTagHtml), + (("address", "article", "aside", "blockquote", "button", "center", + "details", "dialog", "dir", "div", "dl", "fieldset", "figcaption", "figure", + "footer", "header", "hgroup", "listing", "main", "menu", "nav", "ol", "pre", + "section", "summary", "ul"), self.endTagBlock), + ("form", self.endTagForm), + ("p", self.endTagP), + (("dd", "dt", "li"), self.endTagListItem), + (headingElements, self.endTagHeading), + (("a", "b", "big", "code", "em", "font", "i", "nobr", "s", "small", + "strike", "strong", "tt", "u"), self.endTagFormatting), + (("applet", "marquee", "object"), self.endTagAppletMarqueeObject), + ("br", self.endTagBr), + ]) + self.endTagHandler.default = self.endTagOther + + def isMatchingFormattingElement(self, node1, node2): + return (node1.name == node2.name and + node1.namespace == node2.namespace and + node1.attributes == node2.attributes) + + # helper + def addFormattingElement(self, token): + self.tree.insertElement(token) + element = self.tree.openElements[-1] + + matchingElements = [] + for node in self.tree.activeFormattingElements[::-1]: + if node is Marker: + break + elif self.isMatchingFormattingElement(node, element): + matchingElements.append(node) + + assert len(matchingElements) <= 3 + if len(matchingElements) == 3: + self.tree.activeFormattingElements.remove(matchingElements[-1]) + self.tree.activeFormattingElements.append(element) + + # the real deal + def processEOF(self): + allowed_elements = frozenset(("dd", "dt", "li", "p", "tbody", "td", + "tfoot", "th", "thead", "tr", "body", + "html")) + for node in self.tree.openElements[::-1]: + if node.name not in allowed_elements: + self.parser.parseError("expected-closing-tag-but-got-eof") + break + # Stop parsing + + def processSpaceCharactersDropNewline(self, token): + # Sometimes (start of

, , and ",k.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue,c.appendChild(b),b.innerHTML="",k.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,k.noCloneEvent=!0,b.attachEvent&&(b.attachEvent("onclick",function(){k.noCloneEvent=!1}),b.cloneNode(!0).click()),null==k.deleteExpando){k.deleteExpando=!0;try{delete b.test}catch(d){k.deleteExpando=!1}}}(),function(){var b,c,d=y.createElement("div");for(b in{submit:!0,change:!0,focusin:!0})c="on"+b,(k[b+"Bubbles"]=c in a)||(d.setAttribute(c,"t"),k[b+"Bubbles"]=d.attributes[c].expando===!1);d=null}();var X=/^(?:input|select|textarea)$/i,Y=/^key/,Z=/^(?:mouse|pointer|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=/^([^.]*)(?:\.(.+)|)$/;function aa(){return!0}function ba(){return!1}function ca(){try{return y.activeElement}catch(a){}}m.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m._data(a);if(r){c.handler&&(i=c,c=i.handler,e=i.selector),c.guid||(c.guid=m.guid++),(g=r.events)||(g=r.events={}),(k=r.handle)||(k=r.handle=function(a){return typeof m===K||a&&m.event.triggered===a.type?void 0:m.event.dispatch.apply(k.elem,arguments)},k.elem=a),b=(b||"").match(E)||[""],h=b.length;while(h--)f=_.exec(b[h])||[],o=q=f[1],p=(f[2]||"").split(".").sort(),o&&(j=m.event.special[o]||{},o=(e?j.delegateType:j.bindType)||o,j=m.event.special[o]||{},l=m.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&m.expr.match.needsContext.test(e),namespace:p.join(".")},i),(n=g[o])||(n=g[o]=[],n.delegateCount=0,j.setup&&j.setup.call(a,d,p,k)!==!1||(a.addEventListener?a.addEventListener(o,k,!1):a.attachEvent&&a.attachEvent("on"+o,k))),j.add&&(j.add.call(a,l),l.handler.guid||(l.handler.guid=c.guid)),e?n.splice(n.delegateCount++,0,l):n.push(l),m.event.global[o]=!0);a=null}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m.hasData(a)&&m._data(a);if(r&&(k=r.events)){b=(b||"").match(E)||[""],j=b.length;while(j--)if(h=_.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=m.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,n=k[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),i=f=n.length;while(f--)g=n[f],!e&&q!==g.origType||c&&c.guid!==g.guid||h&&!h.test(g.namespace)||d&&d!==g.selector&&("**"!==d||!g.selector)||(n.splice(f,1),g.selector&&n.delegateCount--,l.remove&&l.remove.call(a,g));i&&!n.length&&(l.teardown&&l.teardown.call(a,p,r.handle)!==!1||m.removeEvent(a,o,r.handle),delete k[o])}else for(o in k)m.event.remove(a,o+b[j],c,d,!0);m.isEmptyObject(k)&&(delete r.handle,m._removeData(a,"events"))}},trigger:function(b,c,d,e){var f,g,h,i,k,l,n,o=[d||y],p=j.call(b,"type")?b.type:b,q=j.call(b,"namespace")?b.namespace.split("."):[];if(h=l=d=d||y,3!==d.nodeType&&8!==d.nodeType&&!$.test(p+m.event.triggered)&&(p.indexOf(".")>=0&&(q=p.split("."),p=q.shift(),q.sort()),g=p.indexOf(":")<0&&"on"+p,b=b[m.expando]?b:new m.Event(p,"object"==typeof b&&b),b.isTrigger=e?2:3,b.namespace=q.join("."),b.namespace_re=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=d),c=null==c?[b]:m.makeArray(c,[b]),k=m.event.special[p]||{},e||!k.trigger||k.trigger.apply(d,c)!==!1)){if(!e&&!k.noBubble&&!m.isWindow(d)){for(i=k.delegateType||p,$.test(i+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),l=h;l===(d.ownerDocument||y)&&o.push(l.defaultView||l.parentWindow||a)}n=0;while((h=o[n++])&&!b.isPropagationStopped())b.type=n>1?i:k.bindType||p,f=(m._data(h,"events")||{})[b.type]&&m._data(h,"handle"),f&&f.apply(h,c),f=g&&h[g],f&&f.apply&&m.acceptData(h)&&(b.result=f.apply(h,c),b.result===!1&&b.preventDefault());if(b.type=p,!e&&!b.isDefaultPrevented()&&(!k._default||k._default.apply(o.pop(),c)===!1)&&m.acceptData(d)&&g&&d[p]&&!m.isWindow(d)){l=d[g],l&&(d[g]=null),m.event.triggered=p;try{d[p]()}catch(r){}m.event.triggered=void 0,l&&(d[g]=l)}return b.result}},dispatch:function(a){a=m.event.fix(a);var b,c,e,f,g,h=[],i=d.call(arguments),j=(m._data(this,"events")||{})[a.type]||[],k=m.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,a)!==!1){h=m.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,g=0;while((e=f.handlers[g++])&&!a.isImmediatePropagationStopped())(!a.namespace_re||a.namespace_re.test(e.namespace))&&(a.handleObj=e,a.data=e.data,c=((m.event.special[e.origType]||{}).handle||e.handler).apply(f.elem,i),void 0!==c&&(a.result=c)===!1&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&(!a.button||"click"!==a.type))for(;i!=this;i=i.parentNode||this)if(1===i.nodeType&&(i.disabled!==!0||"click"!==a.type)){for(e=[],f=0;h>f;f++)d=b[f],c=d.selector+" ",void 0===e[c]&&(e[c]=d.needsContext?m(c,this).index(i)>=0:m.find(c,this,null,[i]).length),e[c]&&e.push(d);e.length&&g.push({elem:i,handlers:e})}return h]","i"),ha=/^\s+/,ia=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,ja=/<([\w:]+)/,ka=/\s*$/g,ra={option:[1,""],legend:[1,"
","
"],area:[1,"",""],param:[1,"",""],thead:[1,"","
"],tr:[2,"","
"],col:[2,"","
"],td:[3,"","
"],_default:k.htmlSerialize?[0,"",""]:[1,"X
","
"]},sa=da(y),ta=sa.appendChild(y.createElement("div"));ra.optgroup=ra.option,ra.tbody=ra.tfoot=ra.colgroup=ra.caption=ra.thead,ra.th=ra.td;function ua(a,b){var c,d,e=0,f=typeof a.getElementsByTagName!==K?a.getElementsByTagName(b||"*"):typeof a.querySelectorAll!==K?a.querySelectorAll(b||"*"):void 0;if(!f)for(f=[],c=a.childNodes||a;null!=(d=c[e]);e++)!b||m.nodeName(d,b)?f.push(d):m.merge(f,ua(d,b));return void 0===b||b&&m.nodeName(a,b)?m.merge([a],f):f}function va(a){W.test(a.type)&&(a.defaultChecked=a.checked)}function wa(a,b){return m.nodeName(a,"table")&&m.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function xa(a){return a.type=(null!==m.find.attr(a,"type"))+"/"+a.type,a}function ya(a){var b=pa.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function za(a,b){for(var c,d=0;null!=(c=a[d]);d++)m._data(c,"globalEval",!b||m._data(b[d],"globalEval"))}function Aa(a,b){if(1===b.nodeType&&m.hasData(a)){var c,d,e,f=m._data(a),g=m._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;e>d;d++)m.event.add(b,c,h[c][d])}g.data&&(g.data=m.extend({},g.data))}}function Ba(a,b){var c,d,e;if(1===b.nodeType){if(c=b.nodeName.toLowerCase(),!k.noCloneEvent&&b[m.expando]){e=m._data(b);for(d in e.events)m.removeEvent(b,d,e.handle);b.removeAttribute(m.expando)}"script"===c&&b.text!==a.text?(xa(b).text=a.text,ya(b)):"object"===c?(b.parentNode&&(b.outerHTML=a.outerHTML),k.html5Clone&&a.innerHTML&&!m.trim(b.innerHTML)&&(b.innerHTML=a.innerHTML)):"input"===c&&W.test(a.type)?(b.defaultChecked=b.checked=a.checked,b.value!==a.value&&(b.value=a.value)):"option"===c?b.defaultSelected=b.selected=a.defaultSelected:("input"===c||"textarea"===c)&&(b.defaultValue=a.defaultValue)}}m.extend({clone:function(a,b,c){var d,e,f,g,h,i=m.contains(a.ownerDocument,a);if(k.html5Clone||m.isXMLDoc(a)||!ga.test("<"+a.nodeName+">")?f=a.cloneNode(!0):(ta.innerHTML=a.outerHTML,ta.removeChild(f=ta.firstChild)),!(k.noCloneEvent&&k.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||m.isXMLDoc(a)))for(d=ua(f),h=ua(a),g=0;null!=(e=h[g]);++g)d[g]&&Ba(e,d[g]);if(b)if(c)for(h=h||ua(a),d=d||ua(f),g=0;null!=(e=h[g]);g++)Aa(e,d[g]);else Aa(a,f);return d=ua(f,"script"),d.length>0&&za(d,!i&&ua(a,"script")),d=h=e=null,f},buildFragment:function(a,b,c,d){for(var e,f,g,h,i,j,l,n=a.length,o=da(b),p=[],q=0;n>q;q++)if(f=a[q],f||0===f)if("object"===m.type(f))m.merge(p,f.nodeType?[f]:f);else if(la.test(f)){h=h||o.appendChild(b.createElement("div")),i=(ja.exec(f)||["",""])[1].toLowerCase(),l=ra[i]||ra._default,h.innerHTML=l[1]+f.replace(ia,"<$1>")+l[2],e=l[0];while(e--)h=h.lastChild;if(!k.leadingWhitespace&&ha.test(f)&&p.push(b.createTextNode(ha.exec(f)[0])),!k.tbody){f="table"!==i||ka.test(f)?""!==l[1]||ka.test(f)?0:h:h.firstChild,e=f&&f.childNodes.length;while(e--)m.nodeName(j=f.childNodes[e],"tbody")&&!j.childNodes.length&&f.removeChild(j)}m.merge(p,h.childNodes),h.textContent="";while(h.firstChild)h.removeChild(h.firstChild);h=o.lastChild}else p.push(b.createTextNode(f));h&&o.removeChild(h),k.appendChecked||m.grep(ua(p,"input"),va),q=0;while(f=p[q++])if((!d||-1===m.inArray(f,d))&&(g=m.contains(f.ownerDocument,f),h=ua(o.appendChild(f),"script"),g&&za(h),c)){e=0;while(f=h[e++])oa.test(f.type||"")&&c.push(f)}return h=null,o},cleanData:function(a,b){for(var d,e,f,g,h=0,i=m.expando,j=m.cache,l=k.deleteExpando,n=m.event.special;null!=(d=a[h]);h++)if((b||m.acceptData(d))&&(f=d[i],g=f&&j[f])){if(g.events)for(e in g.events)n[e]?m.event.remove(d,e):m.removeEvent(d,e,g.handle);j[f]&&(delete j[f],l?delete d[i]:typeof d.removeAttribute!==K?d.removeAttribute(i):d[i]=null,c.push(f))}}}),m.fn.extend({text:function(a){return V(this,function(a){return void 0===a?m.text(this):this.empty().append((this[0]&&this[0].ownerDocument||y).createTextNode(a))},null,a,arguments.length)},append:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wa(this,a);b.appendChild(a)}})},prepend:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wa(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},remove:function(a,b){for(var c,d=a?m.filter(a,this):this,e=0;null!=(c=d[e]);e++)b||1!==c.nodeType||m.cleanData(ua(c)),c.parentNode&&(b&&m.contains(c.ownerDocument,c)&&za(ua(c,"script")),c.parentNode.removeChild(c));return this},empty:function(){for(var a,b=0;null!=(a=this[b]);b++){1===a.nodeType&&m.cleanData(ua(a,!1));while(a.firstChild)a.removeChild(a.firstChild);a.options&&m.nodeName(a,"select")&&(a.options.length=0)}return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return m.clone(this,a,b)})},html:function(a){return V(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a)return 1===b.nodeType?b.innerHTML.replace(fa,""):void 0;if(!("string"!=typeof a||ma.test(a)||!k.htmlSerialize&&ga.test(a)||!k.leadingWhitespace&&ha.test(a)||ra[(ja.exec(a)||["",""])[1].toLowerCase()])){a=a.replace(ia,"<$1>");try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(m.cleanData(ua(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=arguments[0];return this.domManip(arguments,function(b){a=this.parentNode,m.cleanData(ua(this)),a&&a.replaceChild(b,this)}),a&&(a.length||a.nodeType)?this:this.remove()},detach:function(a){return this.remove(a,!0)},domManip:function(a,b){a=e.apply([],a);var c,d,f,g,h,i,j=0,l=this.length,n=this,o=l-1,p=a[0],q=m.isFunction(p);if(q||l>1&&"string"==typeof p&&!k.checkClone&&na.test(p))return this.each(function(c){var d=n.eq(c);q&&(a[0]=p.call(this,c,d.html())),d.domManip(a,b)});if(l&&(i=m.buildFragment(a,this[0].ownerDocument,!1,this),c=i.firstChild,1===i.childNodes.length&&(i=c),c)){for(g=m.map(ua(i,"script"),xa),f=g.length;l>j;j++)d=i,j!==o&&(d=m.clone(d,!0,!0),f&&m.merge(g,ua(d,"script"))),b.call(this[j],d,j);if(f)for(h=g[g.length-1].ownerDocument,m.map(g,ya),j=0;f>j;j++)d=g[j],oa.test(d.type||"")&&!m._data(d,"globalEval")&&m.contains(h,d)&&(d.src?m._evalUrl&&m._evalUrl(d.src):m.globalEval((d.text||d.textContent||d.innerHTML||"").replace(qa,"")));i=c=null}return this}}),m.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){m.fn[a]=function(a){for(var c,d=0,e=[],g=m(a),h=g.length-1;h>=d;d++)c=d===h?this:this.clone(!0),m(g[d])[b](c),f.apply(e,c.get());return this.pushStack(e)}});var Ca,Da={};function Ea(b,c){var d,e=m(c.createElement(b)).appendTo(c.body),f=a.getDefaultComputedStyle&&(d=a.getDefaultComputedStyle(e[0]))?d.display:m.css(e[0],"display");return e.detach(),f}function Fa(a){var b=y,c=Da[a];return c||(c=Ea(a,b),"none"!==c&&c||(Ca=(Ca||m("